- InChI
- InChI=1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3
- InChI Key
- NIQCNGHVCWTJSM-UHFFFAOYSA-N
- Formula
- C10H10O4
- SMILES
- COC(=O)c1ccccc1C(=O)OC
- Molecular Weight1
- 194.18
- CAS
- 131-11-3
- Other Names
-
- 1,2-BENZENEDICARBOXYLIC ACID
- 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester
- 1,2-Benzenedicarboxylic acid, dimethyl ester
- 1,2-dimethyl phthalate
- 64441-70-9
- AVOLIN
- DIMETHYL 1,2-BENZENEDICARBOXYLATE
- DIMETHYL ESTER
- DMF, Insect repellent
- DMP
- Dimethyl 1,2-benzendicarboxylate
- Dimethyl benzene-o-dicarboxylate
- Dimethyl benzeneorthodicarboxylate
- Dimethyl o-phthalate
- Dimethyl orthophthalate
- ENT 262
- Fermine
- Kemester DMP
- Kodaflex DMP
- Mipax
- NSC 15398
- NTM
- Palatinol M
- Phthalic acid, dimethyl ester
- Phthalsaeuredimethylester
- Repeftal
- Solvanom
- Solvarone
- Unimoll DM
- Uniplex 110
- dimethyl benzene-1,2-dicarboxylate
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- ΔcH°solid : Standard solid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- EA : Electron affinity (eV).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°solid : Solid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH° : Enthalpy of sublimation at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | -4702.00 | kJ/mol | NIST |
| ΔcH°solid | -4680.40 ± 2.40 | kJ/mol | NIST |
| EA | 0.55 | eV | NIST |
| ΔfG° | -331.74 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -606.10 ± 2.70 | kJ/mol | NIST |
| ΔfH°solid | -683.80 ± 2.70 | kJ/mol | NIST |
| ΔfusH° | 20.88 | kJ/mol | Joback Calculated Property |
| ΔsubH° | 77.70 | kJ/mol | NIST |
| ΔvapH° | 59.10 | kJ/mol | Joback Calculated Property |
| IE | 9.64 ± 0.07 | eV | NIST |
| log10WS | [-1.74; -1.66] |
|
|
| log10WS | -1.74 | Aq. Sol... | |
| log10WS | -1.66 | Estimat... | |
| logPoct/wat | 1.260 | Crippen Calculated Property | |
| McVol | 142.880 | ml/mol | McGowan Calculated Property |
| Pc | 2770.00 | kPa | Critica... |
| Inp | [248.00; 1481.00] |
|
|
| Inp | 1409.00 | NIST | |
| Inp | 1418.00 | NIST | |
| Inp | 1427.00 | NIST | |
| Inp | 1437.00 | NIST | |
| Inp | 1453.00 | NIST | |
| Inp | 1416.00 | NIST | |
| Inp | 1420.00 | NIST | |
| Inp | 1457.00 | NIST | |
| Inp | 1435.00 | NIST | |
| Inp | 1434.00 | NIST | |
| Inp | 1476.00 | NIST | |
| Inp | 1400.00 | NIST | |
| Inp | 1457.00 | NIST | |
| Inp | 1454.00 | NIST | |
| Inp | 1400.00 | NIST | |
| Inp | 1425.00 | NIST | |
| Inp | 1429.29 | NIST | |
| Inp | 1431.47 | NIST | |
| Inp | 1429.44 | NIST | |
| Inp | 1440.94 | NIST | |
| Inp | 1441.55 | NIST | |
| Inp | 1433.14 | NIST | |
| Inp | 1431.25 | NIST | |
| Inp | 1449.00 | NIST | |
| Inp | 1457.00 | NIST | |
| Inp | 1425.00 | NIST | |
| Inp | 1466.20 | NIST | |
| Inp | 1406.00 | NIST | |
| Inp | 1458.00 | NIST | |
| Inp | 1454.00 | NIST | |
| Inp | 1460.70 | NIST | |
| Inp | 1417.00 | NIST | |
| Inp | 1417.00 | NIST | |
| Inp | 1417.00 | NIST | |
| Inp | 1417.00 | NIST | |
| Inp | 1417.00 | NIST | |
| Inp | 1418.00 | NIST | |
| Inp | 1426.00 | NIST | |
| Inp | 1400.00 | NIST | |
| Inp | 1405.00 | NIST | |
| Inp | 1456.00 | NIST | |
| Inp | 1406.00 | NIST | |
| Inp | 1414.00 | NIST | |
| Inp | 1414.00 | NIST | |
| Inp | 1481.00 | NIST | |
| Inp | 1445.00 | NIST | |
| Inp | 1451.00 | NIST | |
| Inp | 1469.00 | NIST | |
| Inp | 1469.00 | NIST | |
| Inp | 1460.00 | NIST | |
| Inp | 1456.00 | NIST | |
| Inp | 1440.00 | NIST | |
| Inp | 1413.00 | NIST | |
| Inp | 1453.00 | NIST | |
| Inp | 1406.00 | NIST | |
| Inp | Outlier 257.40 | NIST | |
| Inp | Outlier 248.00 | NIST | |
| I | [2276.00; 2325.00] |
|
|
| I | 2303.00 | NIST | |
| I | 2303.00 | NIST | |
| I | 2276.00 | NIST | |
| I | 2325.00 | NIST | |
| S°liquid | 365.50 | J/mol×K | NIST |
| Tboil | [555.20; 557.08] | K |
|
| Tboil | 557.08 | K | (Liquid... |
| Tboil | 556.80 | K | (Liquid... |
| Tboil | 555.20 | K | NIST |
| Tboil | 555.50 | K | NIST |
| Tc | 831.50 | K | Joback Calculated Property |
| Tfus | [273.00; 276.77] | K |
|
| Tfus | 276.77 | K | Aq. Sol... |
| Tfus | 273.00 | K | NIST |
| Tfus | 273.20 ± 0.20 | K | NIST |
| Ttriple | 274.18 ± 0.02 | K | NIST |
| Vc | 0.535 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [338.80; 399.66] | J/mol×K | [612.44; 831.50] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 340 350 360 370 380 390 400 650 700 750 800 | ||||
| Cp,gas | 338.80 | J/mol×K | 612.44 | Joback Calculated Property |
| Cp,gas | 350.71 | J/mol×K | 648.95 | Joback Calculated Property |
| Cp,gas | 361.93 | J/mol×K | 685.46 | Joback Calculated Property |
| Cp,gas | 372.43 | J/mol×K | 721.97 | Joback Calculated Property |
| Cp,gas | 382.23 | J/mol×K | 758.48 | Joback Calculated Property |
| Cp,gas | 391.31 | J/mol×K | 794.99 | Joback Calculated Property |
| Cp,gas | 399.66 | J/mol×K | 831.50 | Joback Calculated Property |
| Cp,liquid | 303.80 | J/mol×K | 300.00 | NIST |
| η | [0.0001824; 0.0012091] | Pa×s | [385.72; 612.44] |
|
|
T(K) Dynamic viscosity (Pa×s) 2.00e-4 4.00e-4 6.00e-4 8.00e-4 1.00e-3 1.20e-3 400 500 600 | ||||
| η | 0.0012091 | Pa×s | 385.72 | Joback Calculated Property |
| η | 0.0007664 | Pa×s | 423.51 | Joback Calculated Property |
| η | 0.0005235 | Pa×s | 461.29 | Joback Calculated Property |
| η | 0.0003788 | Pa×s | 499.08 | Joback Calculated Property |
| η | 0.0002869 | Pa×s | 536.87 | Joback Calculated Property |
| η | 0.0002254 | Pa×s | 574.65 | Joback Calculated Property |
| η | 0.0001824 | Pa×s | 612.44 | Joback Calculated Property |
| ΔfusH | [16.95; 16.95] | kJ/mol | [274.18; 274.20] |
|
| ΔfusH | 16.95 | kJ/mol | 274.18 | NIST |
| ΔfusH | 16.95 | kJ/mol | 274.20 | NIST |
| ΔfusH | 16.95 | kJ/mol | 274.20 | NIST |
| ΔvapH | [61.50; 84.20] | kJ/mol | [298.00; 492.00] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 60 65 70 75 80 85 300 350 400 450 | ||||
| ΔvapH | 84.20 | kJ/mol | 298.00 | A Compa... |
| ΔvapH | 74.50 ± 0.30 | kJ/mol | 326.00 | NIST |
| ΔvapH | 78.70 | kJ/mol | 337.50 | NIST |
| ΔvapH | 72.50 ± 0.60 | kJ/mol | 344.00 | NIST |
| ΔvapH | 69.40 ± 0.10 | kJ/mol | 365.00 | NIST |
| ΔvapH | 68.60 | kJ/mol | 408.50 | NIST |
| ΔvapH | 63.70 | kJ/mol | 459.00 | NIST |
| ΔvapH | 61.50 | kJ/mol | 492.00 | NIST |
| n0 | [1.50320; 1.51779] | [288.15; 323.15] |
|
|
|
T(K) Refractive Index 1.51 1.51 1.52 290 300 310 320 | ||||
| n0 | 1.51779 | 288.15 | Experim... | |
| n0 | 1.51565 | 293.15 | Experim... | |
| n0 | 1.51600 | 293.20 | Isobari... | |
| n0 | 1.51354 | 298.15 | Experim... | |
| n0 | 1.51146 | 303.15 | Experim... | |
| n0 | 1.50943 | 308.15 | Experim... | |
| n0 | 1.50736 | 313.15 | Experim... | |
| n0 | 1.50524 | 318.15 | Experim... | |
| n0 | 1.50320 | 323.15 | Experim... | |
| ρl | [1163.65; 1196.23] | kg/m3 | [288.15; 323.15] |
|
|
T(K) Liquid Density (kg/m3) 1165 1170 1175 1180 1185 1190 1195 290 300 310 320 | ||||
| ρl | 1196.23 | kg/m3 | 288.15 | Experim... |
| ρl | 1191.54 | kg/m3 | 293.15 | Experim... |
| ρl | 1186.90 | kg/m3 | 298.15 | Revisio... |
| ρl | 1186.87 | kg/m3 | 298.15 | Experim... |
| ρl | 1182.20 | kg/m3 | 303.15 | Experim... |
| ρl | 1177.55 | kg/m3 | 308.15 | Experim... |
| ρl | 1172.91 | kg/m3 | 313.15 | Experim... |
| ρl | 1168.28 | kg/m3 | 318.15 | Experim... |
| ρl | 1163.65 | kg/m3 | 323.15 | Experim... |
| ΔfusS | 61.80 | J/mol×K | 274.18 | NIST |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 389.30 ± 0.30 | K | 0.30 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.68] | kPa | [418.67; 533.94] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 2.07702e+01 | |||
| Coefficient B | -7.26443e+03 | |||
| Coefficient C | -6.40100e+01 | |||
| Temperature range, min. | 418.67 | |||
| Temperature range, max. | 533.94 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 450 500 | ||||
| Pvap | 1.33 | kPa | 418.67 | Calculated Property |
| Pvap | 2.72 | kPa | 431.48 | Calculated Property |
| Pvap | 5.30 | kPa | 444.29 | Calculated Property |
| Pvap | 9.87 | kPa | 457.09 | Calculated Property |
| Pvap | 17.68 | kPa | 469.90 | Calculated Property |
| Pvap | 30.57 | kPa | 482.71 | Calculated Property |
| Pvap | 51.17 | kPa | 495.52 | Calculated Property |
| Pvap | 83.13 | kPa | 508.32 | Calculated Property |
| Pvap | 131.43 | kPa | 521.13 | Calculated Property |
| Pvap | 202.68 | kPa | 533.94 | Calculated Property |
| Pvap | [2.46e-05; 2664.64] | kPa | [272.15; 766.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 5.81743e+01 | |||
| Coefficient B | -1.02413e+04 | |||
| Coefficient C | -5.55726e+00 | |||
| Coefficient D | -1.68650e-08 | |||
| Temperature range, min. | 272.15 | |||
| Temperature range, max. | 766.00 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 400 600 | ||||
| Pvap | 2.46e-05 | kPa | 272.15 | Calculated Property |
| Pvap | 4.89e-03 | kPa | 327.02 | Calculated Property |
| Pvap | 0.19 | kPa | 381.89 | Calculated Property |
| Pvap | 2.56 | kPa | 436.77 | Calculated Property |
| Pvap | 18.12 | kPa | 491.64 | Calculated Property |
| Pvap | 81.40 | kPa | 546.51 | Calculated Property |
| Pvap | 264.14 | kPa | 601.38 | Calculated Property |
| Pvap | 674.50 | kPa | 656.26 | Calculated Property |
| Pvap | 1437.44 | kPa | 711.13 | Calculated Property |
| Pvap | 2664.64 | kPa | 766.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Dimethyl phthalate.
Mixtures
- Dimethyl phthalate + Water
- Dimethyl phthalate + Maleic anhydride
- Dimethyl phthalate + Propanoic acid + Water
- Dimethyl phthalate + Butanoic acid + Water
- Dimethyl phthalate + 1-Butanol
- Dimethyl phthalate + 2-Butanone
- Dimethyl phthalate + Pentanoic acid + Water
- Pentanoic acid, 4-oxo- + Dimethyl phthalate + Water
- Dimethyl phthalate + Morpholine + Water
- Toluene + Dimethyl phthalate + Heptane
- n-Hexane + Toluene + Dimethyl phthalate
- Toluene + Dimethyl phthalate + Cyclohexane
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Revision of the volumetric method for measurements of liquid liquid equilibria in binary systems
- Isobaric vapor-liquid equilibria of the binary system maleic anhydride and dimethyl phthalate at 2.67, 5.33 and 8.00 kPa
- (Liquid + liquid) equilibria of (water + propionic acid + dimethyl phthalate) at several temperatures
- (Liquid + liquid) equilibria of (water + butyric acid + esters) ternary systems
- Liquid-liquid equilibria for the aqueous mixture of C5 carboxylic acids and heavier than water solvents at T = 298.2 K
- Experimental Determination and Modeling of Densities, Refractive Indices of the Binary Mixtures of Dimethylphthalate (or Dimethyladipate) + 1-Butanol, or + 2-Butanol, or + 2-Butanone at T = (288.15 to 323.15) K
- Experimental Investigation of Interactions and Thermodynamic Properties of Poly(ethylene glycol) 200/400 + Dimethyl Adipate/Dimethyl Phthalate Binary Mixtures
- A Comparison of Results by Correlation Gas Chromatography with Another Gas Chromatographic Retention Time Technique. The Effects of Retention Time Coincidence on Vaporization Enthalpy and Vapor Pressure
- Parametric Analysis of Mandelic Acid Separation from Aqueous Solutions by Using Secondary Amine Mixture (Amberlite LA-2) in Various Diluents
- Critical Temperatures and Pressures of 12 Phthalates Using the Pulse-Heating Method
- Liquid Phase Equilibria for Mixtures of (Water + Morpholine + Ethyl Nonanoate, Dimethyl Phthalate, or Isoamyl Alcohol) at 298.15 K
- Phase Equilibria for Liquid Mixtures of (an Alkane + Toluene + Dimethyl Phthalate)
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.