- InChI
- InChI=1S/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H
- InChI Key
- USIUVYZYUHIAEV-UHFFFAOYSA-N
- Formula
- C12H10O
- SMILES
- c1ccc(Oc2ccccc2)cc1
- Molecular Weight1
- 170.21
- CAS
- 101-84-8
- Other Names
-
- 1,1'-OXYBIS-BENZENE
- 1,1'-Oxybisbenzene
- BIPHENYL OXIDE
- Benzene, 1,1'-oxybis-
- Benzene, phenoxy-
- Chemcryl JK-EB
- Diphenyl oxide
- Ether, diphenyl-
- Geranium crystals
- NSC 19311
- Oxybisbenzene
- Oxydiphenyl
- PHENOXY BENZENE
- Phenoxybenzene
- Phenyl ether
- Phenyl oxide
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- ΔcH°solid : Standard solid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,solid : Solid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°solid : Solid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°solid,1 bar : Solid phase molar entropy at standard conditions (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4400 | KDB | |
| ΔcH°liquid | -6113.70 ± 3.80 | kJ/mol | NIST |
| ΔcH°solid | -6119.24 ± 0.88 | kJ/mol | NIST |
| μ | 1.10 | debye | KDB |
| ΔfG° | 169.98 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | 49.99 | kJ/mol | KDB |
| ΔfH°solid | -32.11 ± 0.93 | kJ/mol | NIST |
| ΔfusH° | 17.12 | kJ/mol | Standar... |
| ΔvapH° | [64.90; 67.10] | kJ/mol |
|
| ΔvapH° | 67.10 | kJ/mol | NIST |
| ΔvapH° | 65.00 | kJ/mol | NIST |
| ΔvapH° | 66.90 ± 0.30 | kJ/mol | NIST |
| ΔvapH° | 66.10 ± 0.40 | kJ/mol | NIST |
| ΔvapH° | 64.90 ± 2.10 | kJ/mol | NIST |
| IE | [8.00; 8.82] | eV |
|
| IE | 8.09 | eV | NIST |
| IE | 8.00 | eV | NIST |
| IE | 8.09 ± 0.03 | eV | NIST |
| IE | 8.10 | eV | NIST |
| IE | 8.82 ± 0.05 | eV | NIST |
| log10WS | [-3.96; -3.93] |
|
|
| log10WS | -3.93 | Aq. Sol... | |
| log10WS | -3.96 | Estimat... | |
| logPoct/wat | 3.479 | Crippen Calculated Property | |
| McVol | 138.290 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 1 | KDB | |
| NFPA Health | 1 | KDB | |
| Pc | [3140.00; 3141.07] | kPa |
|
| Pc | 3140.00 | kPa | KDB |
| Pc | 3141.07 ± 202.65 | kPa | NIST |
| Inp | [241.16; 1405.00] |
|
|
| Inp | 1389.90 | NIST | |
| Inp | 1378.00 | NIST | |
| Inp | 1380.00 | NIST | |
| Inp | 1396.00 | NIST | |
| Inp | 1376.30 | NIST | |
| Inp | 1366.80 | NIST | |
| Inp | 1370.00 | NIST | |
| Inp | 1370.90 | NIST | |
| Inp | 1366.40 | NIST | |
| Inp | 1381.70 | NIST | |
| Inp | 1393.70 | NIST | |
| Inp | 1380.10 | NIST | |
| Inp | 1384.60 | NIST | |
| Inp | 1404.00 | NIST | |
| Inp | 1405.00 | NIST | |
| Inp | 1372.00 | NIST | |
| Inp | 1396.00 | NIST | |
| Inp | 1386.00 | NIST | |
| Inp | 1364.00 | NIST | |
| Inp | 1372.00 | NIST | |
| Inp | 1356.90 | NIST | |
| Inp | 1372.60 | NIST | |
| Inp | 1371.80 | NIST | |
| Inp | 1376.20 | NIST | |
| Inp | 1386.00 | NIST | |
| Inp | 1379.00 | NIST | |
| Inp | 1363.00 | NIST | |
| Inp | 1376.00 | NIST | |
| Inp | Outlier 241.70 | NIST | |
| Inp | Outlier 241.16 | NIST | |
| Inp | Outlier 241.70 | NIST | |
| Inp | 1396.00 | NIST | |
| Inp | 1366.40 | NIST | |
| Inp | 1378.00 | NIST | |
| I | [1991.00; 2055.00] |
|
|
| I | 2017.00 | NIST | |
| I | 2017.00 | NIST | |
| I | 2026.00 | NIST | |
| I | 1991.00 | NIST | |
| I | 2038.00 | NIST | |
| I | 2017.00 | NIST | |
| I | 1991.00 | NIST | |
| I | 2055.00 | NIST | |
| I | 2026.00 | NIST | |
| S°solid,1 bar | 233.91 | J/mol×K | NIST |
| Tboil | [523.65; 532.50] | K |
|
| Tboil | 531.20 | K | KDB |
| Tboil | 532.20 | K | NIST |
| Tboil | 531.10 | K | NIST |
| Tboil | Outlier 523.65 ± 1.50 | K | NIST |
| Tboil | 531.46 ± 0.07 | K | NIST |
| Tboil | 532.50 ± 0.50 | K | NIST |
| Tc | [766.80; 788.15] | K |
|
| Tc | 766.80 | K | KDB |
| Tc | 766.80 ± 1.00 | K | NIST |
| Tc | 788.15 ± 2.00 | K | NIST |
| Tc | 767.20 ± 1.00 | K | NIST |
| Tfus | [299.90; 300.60] | K |
|
| Tfus | 300.02 | K | KDB |
| Tfus | 300.60 | K | Aq. Sol... |
| Tfus | 300.58 ± 0.20 | K | NIST |
| Tfus | 300.04 ± 0.01 | K | NIST |
| Tfus | 300.00 ± 0.02 | K | NIST |
| Tfus | 299.90 ± 0.02 | K | NIST |
| Tfus | 300.15 ± 1.00 | K | NIST |
| Tfus | 300.05 ± 0.05 | K | NIST |
| Tfus | 299.90 ± 0.40 | K | NIST |
| Tfus | 299.90 ± 0.30 | K | NIST |
| Tfus | 300.20 ± 0.20 | K | NIST |
| Ttriple | [300.01; 300.03] | K |
|
| Ttriple | 300.01 ± 0.00 | K | NIST |
| Ttriple | 300.03 ± 0.01 | K | NIST |
| Vc | 0.509 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [302.80; 380.90] | J/mol×K | [549.74; 795.91] |
|
| Cp,gas | 302.80 | J/mol×K | 549.74 | Joback Calculated Property |
| Cp,gas | 318.62 | J/mol×K | 590.77 | Joback Calculated Property |
| Cp,gas | 333.25 | J/mol×K | 631.80 | Joback Calculated Property |
| Cp,gas | 346.73 | J/mol×K | 672.82 | Joback Calculated Property |
| Cp,gas | 359.14 | J/mol×K | 713.85 | Joback Calculated Property |
| Cp,gas | 370.51 | J/mol×K | 754.88 | Joback Calculated Property |
| Cp,gas | 380.90 | J/mol×K | 795.91 | Joback Calculated Property |
| Cp,solid | [215.90; 216.56] | J/mol×K | [298.15; 298.50] |
|
| Cp,solid | 216.56 | J/mol×K | 298.15 | NIST |
| Cp,solid | 216.56 | J/mol×K | 298.15 | NIST |
| Cp,solid | 215.90 | J/mol×K | 298.50 | NIST |
| η | [0.0001694; 0.0019947] | Pa×s | [300.07; 549.74] |
|
| η | 0.0019947 | Pa×s | 300.07 | Joback Calculated Property |
| η | 0.0010297 | Pa×s | 341.68 | Joback Calculated Property |
| η | 0.0006136 | Pa×s | 383.29 | Joback Calculated Property |
| η | 0.0004047 | Pa×s | 424.91 | Joback Calculated Property |
| η | 0.0002874 | Pa×s | 466.52 | Joback Calculated Property |
| η | 0.0002159 | Pa×s | 508.13 | Joback Calculated Property |
| η | 0.0001694 | Pa×s | 549.74 | Joback Calculated Property |
| ΔfusH | [16.51; 17.22] | kJ/mol | [300.00; 300.40] |
|
| ΔfusH | 17.21 | kJ/mol | 300.00 | NIST |
| ΔfusH | 17.21 | kJ/mol | 300.00 | NIST |
| ΔfusH | 17.22 | kJ/mol | 300.02 | NIST |
| ΔfusH | 17.21 | kJ/mol | 300.03 | NIST |
| ΔfusH | 16.51 | kJ/mol | 300.40 | NIST |
| ΔvapH | [48.20; 64.20] | kJ/mol | [323.00; 510.50] |
|
| ΔvapH | 64.20 | kJ/mol | 323.00 | NIST |
| ΔvapH | 53.00 | kJ/mol | 510.50 | NIST |
| ΔvapH | 48.20 | kJ/mol | 510.50 | NIST |
| Pvap | [2.93e-03; 0.09] | kPa | [299.30; 343.70] |
|
| Pvap | 2.93e-03 | kPa | 299.30 | Benchma... |
| Pvap | 4.26e-03 | kPa | 303.30 | Benchma... |
| Pvap | 5.31e-03 | kPa | 305.30 | Benchma... |
| Pvap | 6.46e-03 | kPa | 308.30 | Benchma... |
| Pvap | 7.44e-03 | kPa | 310.30 | Benchma... |
| Pvap | 9.68e-03 | kPa | 313.40 | Benchma... |
| Pvap | 0.01 | kPa | 315.30 | Benchma... |
| Pvap | 0.02 | kPa | 319.40 | Benchma... |
| Pvap | 0.02 | kPa | 323.40 | Benchma... |
| Pvap | 0.03 | kPa | 327.40 | Benchma... |
| Pvap | 0.03 | kPa | 328.90 | Benchma... |
| Pvap | 0.04 | kPa | 331.50 | Benchma... |
| Pvap | 0.05 | kPa | 335.50 | Benchma... |
| Pvap | 0.06 | kPa | 339.60 | Benchma... |
| Pvap | 0.09 | kPa | 343.70 | Benchma... |
| ρl | [1005.20; 1066.00] | kg/m3 | [303.00; 373.15] |
|
| ρl | 1066.00 | kg/m3 | 303.00 | KDB |
| ρl | 1065.50 | kg/m3 | 303.15 | Isobari... |
| ρl | 1061.20 | kg/m3 | 308.15 | Isobari... |
| ρl | 1056.90 | kg/m3 | 313.15 | Isobari... |
| ρl | 1048.20 | kg/m3 | 323.15 | Isobari... |
| ρl | 1039.60 | kg/m3 | 333.15 | Isobari... |
| ρl | 1030.90 | kg/m3 | 343.15 | Isobari... |
| ρl | 1022.30 | kg/m3 | 353.15 | Isobari... |
| ρl | 1013.70 | kg/m3 | 363.15 | Isobari... |
| ρl | 1005.20 | kg/m3 | 373.15 | Isobari... |
| ΔfusS | [57.38; 57.38] | J/mol×K | [300.02; 300.03] |
|
| ΔfusS | 57.38 | J/mol×K | 300.02 | NIST |
| ΔfusS | 57.38 | J/mol×K | 300.03 | NIST |
| λ | [0.13; 0.15] | W/m×K | [303.15; 343.15] |
|
| λ | 0.13 | W/m×K | 303.15 | Thermop... |
| λ | 0.13 | W/m×K | 313.15 | Thermop... |
| λ | 0.14 | W/m×K | 323.15 | Thermop... |
| λ | 0.14 | W/m×K | 333.15 | Thermop... |
| λ | 0.15 | W/m×K | 343.15 | Thermop... |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [396.23; 565.91] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.44628e+01 | |||
| Coefficient B | -4.38113e+03 | |||
| Coefficient C | -8.71630e+01 | |||
| Temperature range, min. | 396.23 | |||
| Temperature range, max. | 565.91 | |||
| Pvap | 1.33 | kPa | 396.23 | Calculated Property |
| Pvap | 3.01 | kPa | 415.08 | Calculated Property |
| Pvap | 6.23 | kPa | 433.94 | Calculated Property |
| Pvap | 11.94 | kPa | 452.79 | Calculated Property |
| Pvap | 21.49 | kPa | 471.64 | Calculated Property |
| Pvap | 36.61 | kPa | 490.50 | Calculated Property |
| Pvap | 59.47 | kPa | 509.35 | Calculated Property |
| Pvap | 92.68 | kPa | 528.20 | Calculated Property |
| Pvap | 139.26 | kPa | 547.06 | Calculated Property |
| Pvap | 202.65 | kPa | 565.91 | Calculated Property |
Similar Compounds
Find more compounds similar to Diphenyl ether.
Mixtures
Sources
- Crippen Method
- Thermophysical properties of diphenyl ether + biphenyl mixtures for their use as heat transfer fluids
- Isobaric heat capacity at high pressure, density, and viscosity of (diphenyl ether + biphenyl) mixtures
- Standard enthalpy of formation of diphenyl oxide
- Benchmark properties of diphenyl oxide as a potential liquid organic hydrogen carrier: Evaluation of thermochemical data with complementary experimental and computational methods
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.