- InChI
- InChI=1S/C2H3Cl3/c3-1-2(4)5/h2H,1H2
- InChI Key
- UBOXGVDOUJQMTN-UHFFFAOYSA-N
- Formula
- C2H3Cl3
- SMILES
- ClCC(Cl)Cl
- Molecular Weight1
- 133.40
- CAS
- 79-00-5
- Other Names
-
- 1,1,2-Trichlorethane
- 1,1,2-Trichloroethane
- 1,2,2-Trichloroethane
- CHCl2CH2Cl
- ETHANE TRICHLORIDE
- NCI-C04579
- NSC 405074
- R-140
- Rcra waste number U227
- Rcra waste number U359
- Trichloroethane
- Trojchloroetan(1,1,2)
- VINYL TRICHLORIDE
- freon 140
- vinyltrichloride
- «beta»-T
- «beta»-Trichloroethane
- «beta»-T
- «beta»-Trichloroethane
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,solid : Solid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | -1098.10 ± 4.40 | kJ/mol | NIST |
| μ | 1.25 | debye | KDB |
| ΔfG° | -77.54 | kJ/mol | KDB |
| ΔfH°gas | [-148.20; -138.60] | kJ/mol |
|
| ΔfH°gas | -138.60 | kJ/mol | KDB |
| ΔfH°gas | -148.00 ± 4.00 | kJ/mol | NIST |
| ΔfH°gas | -148.20 ± 4.40 | kJ/mol | NIST |
| ΔfH°liquid | [-188.50; -188.00] | kJ/mol |
|
| ΔfH°liquid | -188.00 ± 4.00 | kJ/mol | NIST |
| ΔfH°liquid | -188.50 ± 4.40 | kJ/mol | NIST |
| ΔfusH° | 10.00 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [40.10; 40.30] | kJ/mol |
|
| ΔvapH° | 40.28 | kJ/mol | NIST |
| ΔvapH° | 40.10 ± 0.60 | kJ/mol | NIST |
| ΔvapH° | 40.30 ± 0.07 | kJ/mol | NIST |
| ΔvapH° | 40.20 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 40.28 ± 0.06 | kJ/mol | NIST |
| ΔvapH° | 40.30 ± 0.10 | kJ/mol | NIST |
| IE | [11.00; 11.48] | eV |
|
| IE | 11.00 | eV | NIST |
| IE | 11.48 | eV | NIST |
| log10WS | [-1.48; -1.48] |
|
|
| log10WS | -1.48 | Aq. Sol... | |
| log10WS | -1.48 | Estimat... | |
| logPoct/wat | 2.029 | Crippen Calculated Property | |
| McVol | 75.760 | ml/mol | McGowan Calculated Property |
| Pc | 5140.00 | kPa | KDB |
| Inp | [713.00; 772.00] |
|
|
| Inp | 742.80 | NIST | |
| Inp | 743.10 | NIST | |
| Inp | 748.10 | NIST | |
| Inp | 745.10 | NIST | |
| Inp | 741.40 | NIST | |
| Inp | 738.70 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 744.00 | NIST | |
| Inp | 729.00 | NIST | |
| Inp | Outlier 713.00 | NIST | |
| Inp | 769.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | Outlier 772.00 | NIST | |
| Inp | 747.50 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 747.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 752.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 752.00 | NIST | |
| Inp | 752.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | Outlier 772.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 739.00 | NIST | |
| I | [1226.00; 1282.00] |
|
|
| I | 1226.00 | NIST | |
| I | 1282.00 | NIST | |
| I | 1267.00 | NIST | |
| I | 1269.00 | NIST | |
| I | 1236.00 | NIST | |
| I | 1236.00 | NIST | |
| I | 1267.00 | NIST | |
| I | 1240.00 | NIST | |
| I | 1226.00 | NIST | |
| Tboil | 386.60 | K | KDB |
| Tc | [602.00; 606.00] | K |
|
| Tc | 606.00 | K | KDB |
| Tc | 602.00 | K | NIST |
| Tfus | [235.80; 237.90] | K |
|
| Tfus | 235.80 | K | KDB |
| Tfus | 236.95 | K | Aq. Sol... |
| Tfus | Outlier 237.90 ± 0.20 | K | NIST |
| Tfus | 236.55 | K | NIST |
| Tfus | 236.60 ± 0.02 | K | NIST |
| Tfus | 236.50 ± 0.20 | K | NIST |
| Tfus | 236.58 ± 0.05 | K | NIST |
| Ttriple | 237.10 ± 0.20 | K | NIST |
| Vc | 0.288 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [99.38; 120.82] | J/mol×K | [357.01; 554.36] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 100 105 110 115 120 400 450 500 550 | ||||
| Cp,gas | 99.38 | J/mol×K | 357.01 | Joback Calculated Property |
| Cp,gas | 103.48 | J/mol×K | 389.90 | Joback Calculated Property |
| Cp,gas | 107.37 | J/mol×K | 422.79 | Joback Calculated Property |
| Cp,gas | 111.03 | J/mol×K | 455.69 | Joback Calculated Property |
| Cp,gas | 114.49 | J/mol×K | 488.58 | Joback Calculated Property |
| Cp,gas | 117.75 | J/mol×K | 521.47 | Joback Calculated Property |
| Cp,gas | 120.82 | J/mol×K | 554.36 | Joback Calculated Property |
| Cp,solid | 143.10 | J/mol×K | 251.70 | NIST |
| η | [0.0004016; 0.0058194] | Pa×s | [187.06; 357.01] |
|
|
T(K) Dynamic viscosity (Pa×s) 0 1.00e-3 2.00e-3 3.00e-3 4.00e-3 5.00e-3 6.00e-3 200 250 300 350 | ||||
| η | 0.0058194 | Pa×s | 187.06 | Joback Calculated Property |
| η | 0.0027805 | Pa×s | 215.38 | Joback Calculated Property |
| η | 0.0015774 | Pa×s | 243.71 | Joback Calculated Property |
| η | 0.0010070 | Pa×s | 272.03 | Joback Calculated Property |
| η | 0.0006996 | Pa×s | 300.36 | Joback Calculated Property |
| η | 0.0005175 | Pa×s | 328.69 | Joback Calculated Property |
| η | 0.0004016 | Pa×s | 357.01 | Joback Calculated Property |
| ΔfusH | [10.88; 11.38] | kJ/mol | [237.10; 237.90] |
|
|
T(K) Enthalpy of fusion at a given temperature (kJ/mol) 10.9 11 11.1 11.2 11.3 11.4 237.2 237.4 237.6 237.8 | ||||
| ΔfusH | 11.38 | kJ/mol | 237.10 | NIST |
| ΔfusH | 11.38 | kJ/mol | 237.10 | NIST |
| ΔfusH | 11.38 | kJ/mol | 237.10 | NIST |
| ΔfusH | 10.88 | kJ/mol | 237.90 | NIST |
| ΔfusH | 10.90 | kJ/mol | 237.90 | NIST |
| ΔvapH | [33.30; 38.60] | kJ/mol | [330.33; 386.90] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 33 34 35 36 37 38 39 340 360 380 | ||||
| ΔvapH | 38.29 ± 0.63 | kJ/mol | 330.33 | NIST |
| ΔvapH | 38.60 | kJ/mol | 350.00 | NIST |
| ΔvapH | 38.30 | kJ/mol | 354.50 | NIST |
| ΔvapH | 38.20 | kJ/mol | 365.00 | NIST |
| ΔvapH | 33.30 | kJ/mol | 386.60 | KDB |
| ΔvapH | 34.82 | kJ/mol | 386.90 | NIST |
| ρl | [1409.60; 1441.00] | kg/m3 | [293.00; 313.15] |
|
| ρl | 1441.00 | kg/m3 | 293.00 | KDB |
| ρl | 1425.00 | kg/m3 | 303.15 | Excess ... |
| ρl | 1416.10 | kg/m3 | 308.15 | Excess ... |
| ρl | 1409.60 | kg/m3 | 313.15 | Excess ... |
| ΔfusS | [45.70; 48.00] | J/mol×K | [237.10; 237.90] |
|
| ΔfusS | 48.00 | J/mol×K | 237.10 | NIST |
| ΔfusS | 45.70 | J/mol×K | 237.90 | NIST |
| γ | 0.03 | N/m | 293.20 | KDB |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 308.15 | 101.00 | 0.0009 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 203.99] | kPa | [282.31; 412.98] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.44525e+01 | |||
| Coefficient B | -3.36081e+03 | |||
| Coefficient C | -4.50510e+01 | |||
| Temperature range, min. | 282.31 | |||
| Temperature range, max. | 412.98 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 300 350 400 | ||||
| Pvap | 1.33 | kPa | 282.31 | Calculated Property |
| Pvap | 3.02 | kPa | 296.83 | Calculated Property |
| Pvap | 6.25 | kPa | 311.35 | Calculated Property |
| Pvap | 11.99 | kPa | 325.87 | Calculated Property |
| Pvap | 21.60 | kPa | 340.39 | Calculated Property |
| Pvap | 36.82 | kPa | 354.90 | Calculated Property |
| Pvap | 59.83 | kPa | 369.42 | Calculated Property |
| Pvap | 93.26 | kPa | 383.94 | Calculated Property |
| Pvap | 140.16 | kPa | 398.46 | Calculated Property |
| Pvap | 203.99 | kPa | 412.98 | Calculated Property |
| Pvap | [0.05; 4668.14] | kPa | [236.50; 602.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 6.69520e+01 | |||
| Coefficient B | -6.70908e+03 | |||
| Coefficient C | -7.67345e+00 | |||
| Coefficient D | 4.83782e-06 | |||
| Temperature range, min. | 236.50 | |||
| Temperature range, max. | 602.00 | |||
|
T(K) Vapor pressure (kPa) 0 1000 2000 3000 4000 5000 300 400 500 600 | ||||
| Pvap | 0.05 | kPa | 236.50 | Calculated Property |
| Pvap | 0.96 | kPa | 277.11 | Calculated Property |
| Pvap | 8.30 | kPa | 317.72 | Calculated Property |
| Pvap | 41.22 | kPa | 358.33 | Calculated Property |
| Pvap | 141.17 | kPa | 398.94 | Calculated Property |
| Pvap | 374.11 | kPa | 439.56 | Calculated Property |
| Pvap | 827.23 | kPa | 480.17 | Calculated Property |
| Pvap | 1605.71 | kPa | 520.78 | Calculated Property |
| Pvap | 2834.66 | kPa | 561.39 | Calculated Property |
| Pvap | 4668.14 | kPa | 602.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Ethane, 1,1,2-trichloro-.
Mixtures
- Ethane, 1,1,2-trichloro- + Acetamide, N-methyl-
- Ethane, 1,1,2-trichloro- + Benzyl nitrile
- Ethane, 1,1,2-trichloro- + Water
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Densities and viscosities of binary liquid mixtures of N-methylacetamide with some chloroethanes and chloroethenes at T = 308.15 K
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Excess Molar Volumes and Sound Speed in (Phenylacetonitrile + 1,2-Dichloroethane), (Phenylacetonitrile + 1,1,2-Trichloroethane), (Phenylacetonitrile + 1,1,2,2-Tetrachloroethane), (Phenylacetonitrile + Trichloroethene), and (Phenylacetonitrile + Tetrachloroethene) at Temperatures of (303.15, 308.15, and 313.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.