- InChI
- InChI=1S/C5H8O2/c1-3-5(6)7-4-2/h3H,1,4H2,2H3
- InChI Key
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N
- Formula
- C5H8O2
- SMILES
- C=CC(=O)OCC
- Molecular Weight1
- 100.12
- CAS
- 140-88-5
- Other Names
-
- Acrylate d'ethyle
- Acrylic acid ethyl ester
- Acrylic acid, ethyl ester (inhibited)
- Acrylsaeureaethylester
- Aethylacrylat
- Akrylanem etylu
- CH2=CHCOOC2H5
- Carboset 511
- ETHYL PROPENOATE
- Ethoxycarbonylethylene
- Ethyl 2-propenoate
- Ethyl acrylate
- Ethyl acrylate, inhibited
- Ethyl ester of 2-propenoic acid
- Ethylacrylaat
- Ethylakrylat
- Ethylester kyseliny akrylove
- Etil acrilato
- Etilacrilatului
- NCI-C50384
- NSC 8263
- Rcra waste number U113
- acrylic acid, ethyl ester
- propenoic acid, ethyl ester
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- NFPA Safety : NFPA Safety Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4000 | KDB | |
| ΔcH°liquid | -2715.00 | kJ/mol | NIST |
| ΔfG° | -154.86 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | [-354.20; -327.80] | kJ/mol |
|
| ΔfH°gas | -331.40 | kJ/mol | NIST |
| ΔfH°gas | -354.20 | kJ/mol | NIST |
| ΔfH°gas | -327.80 | kJ/mol | NIST |
| ΔfH°liquid | [-393.40; -367.00] | kJ/mol |
|
| ΔfH°liquid | -370.60 | kJ/mol | NIST |
| ΔfH°liquid | -393.40 | kJ/mol | NIST |
| ΔfH°liquid | -367.00 | kJ/mol | NIST |
| ΔfusH° | 10.21 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [39.20; 39.20] | kJ/mol |
|
| ΔvapH° | 39.20 | kJ/mol | NIST |
| ΔvapH° | 39.20 | kJ/mol | NIST |
| IE | 10.30 | eV | NIST |
| log10WS | -0.74 | Aq. Sol... | |
| logPoct/wat | 0.735 | Crippen Calculated Property | |
| McVol | 84.450 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 3 | KDB | |
| NFPA Health | 2 | KDB | |
| NFPA Safety | 2 | KDB | |
| Pc | 3740.00 | kPa | KDB |
| Inp | [644.00; 702.00] |
|
|
| Inp | 676.00 | NIST | |
| Inp | 678.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 644.00 | NIST | |
| Inp | 648.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 664.00 | NIST | |
| Inp | 664.00 | NIST | |
| Inp | 678.00 | NIST | |
| Inp | 683.00 | NIST | |
| Inp | 648.00 | NIST | |
| Inp | Outlier 702.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 664.00 | NIST | |
| Inp | 677.00 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 644.00 | NIST | |
| Inp | 678.00 | NIST | |
| I | [980.00; 993.00] |
|
|
| I | 992.00 | NIST | |
| I | 993.00 | NIST | |
| I | 989.00 | NIST | |
| I | 980.00 | NIST | |
| I | 992.00 | NIST | |
| Tboil | [372.50; 373.00] | K |
|
| Tboil | 373.00 | K | KDB |
| Tboil | 373.00 | K | NIST |
| Tboil | 373.00 | K | NIST |
| Tboil | 372.75 | K | NIST |
| Tboil | 372.50 ± 3.00 | K | NIST |
| Tc | 552.00 | K | KDB |
| Tfus | [201.00; 202.10] | K |
|
| Tfus | 201.00 | K | KDB |
| Tfus | 202.10 | K | Aq. Sol... |
| Tfus | 201.15 | K | NIST |
| Vc | 0.320 | m3/kmol | KDB |
| Zc | 0.2607630 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [149.35; 191.98] | J/mol×K | [386.77; 569.17] |
|
| Cp,gas | 149.35 | J/mol×K | 386.77 | Joback Calculated Property |
| Cp,gas | 157.10 | J/mol×K | 417.17 | Joback Calculated Property |
| Cp,gas | 164.59 | J/mol×K | 447.57 | Joback Calculated Property |
| Cp,gas | 171.82 | J/mol×K | 477.97 | Joback Calculated Property |
| Cp,gas | 178.80 | J/mol×K | 508.37 | Joback Calculated Property |
| Cp,gas | 185.52 | J/mol×K | 538.77 | Joback Calculated Property |
| Cp,gas | 191.98 | J/mol×K | 569.17 | Joback Calculated Property |
| η | [0.0002673; 0.0024241] | Pa×s | [216.51; 386.77] |
|
| η | 0.0024241 | Pa×s | 216.51 | Joback Calculated Property |
| η | 0.0013568 | Pa×s | 244.89 | Joback Calculated Property |
| η | 0.0008567 | Pa×s | 273.26 | Joback Calculated Property |
| η | 0.0005898 | Pa×s | 301.64 | Joback Calculated Property |
| η | 0.0004330 | Pa×s | 330.02 | Joback Calculated Property |
| η | 0.0003338 | Pa×s | 358.39 | Joback Calculated Property |
| η | 0.0002673 | Pa×s | 386.77 | Joback Calculated Property |
| ΔvapH | 41.40 | kJ/mol | 307.50 | NIST |
| n0 | [1.39990; 1.40490] | [298.15; 313.15] |
|
|
| n0 | 1.40490 | 298.15 | Volumet... | |
| n0 | 1.40320 | 303.15 | Volumet... | |
| n0 | 1.40140 | 308.15 | Volumet... | |
| n0 | 1.39990 | 313.15 | Volumet... | |
| ρl | [868.78; 939.09] | kg/m3 | [278.15; 338.15] |
|
| ρl | 939.09 | kg/m3 | 278.15 | Thermop... |
| ρl | 936.25 | kg/m3 | 280.65 | Thermop... |
| ρl | 933.39 | kg/m3 | 283.15 | Thermop... |
| ρl | 930.52 | kg/m3 | 285.65 | Thermop... |
| ρl | 927.65 | kg/m3 | 288.15 | Thermop... |
| ρl | 924.78 | kg/m3 | 290.65 | Thermop... |
| ρl | 921.00 | kg/m3 | 293.00 | KDB |
| ρl | 921.90 | kg/m3 | 293.15 | Thermop... |
| ρl | 919.01 | kg/m3 | 295.65 | Thermop... |
| ρl | 915.95 | kg/m3 | 298.15 | Densiti... |
| ρl | 916.12 | kg/m3 | 298.15 | Volumet... |
| ρl | 916.12 | kg/m3 | 298.15 | Thermop... |
| ρl | 913.22 | kg/m3 | 300.65 | Thermop... |
| ρl | 910.32 | kg/m3 | 303.15 | Thermop... |
| ρl | 907.41 | kg/m3 | 305.65 | Thermop... |
| ρl | 904.49 | kg/m3 | 308.15 | Thermop... |
| ρl | 901.56 | kg/m3 | 310.65 | Thermop... |
| ρl | 898.63 | kg/m3 | 313.15 | Thermop... |
| ρl | 895.68 | kg/m3 | 315.65 | Thermop... |
| ρl | 892.73 | kg/m3 | 318.15 | Thermop... |
| ρl | 889.77 | kg/m3 | 320.65 | Thermop... |
| ρl | 886.80 | kg/m3 | 323.15 | Thermop... |
| ρl | 883.82 | kg/m3 | 325.65 | Thermop... |
| ρl | 880.83 | kg/m3 | 328.15 | Thermop... |
| ρl | 877.83 | kg/m3 | 330.65 | Thermop... |
| ρl | 874.83 | kg/m3 | 333.15 | Thermop... |
| ρl | 871.81 | kg/m3 | 335.65 | Thermop... |
| ρl | 868.78 | kg/m3 | 338.15 | Thermop... |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [274.70; 397.18] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.46709e+01 | |||
| Coefficient B | -3.28201e+03 | |||
| Coefficient C | -4.65160e+01 | |||
| Temperature range, min. | 274.70 | |||
| Temperature range, max. | 397.18 | |||
| Pvap | 1.33 | kPa | 274.70 | Calculated Property |
| Pvap | 3.00 | kPa | 288.31 | Calculated Property |
| Pvap | 6.18 | kPa | 301.92 | Calculated Property |
| Pvap | 11.83 | kPa | 315.53 | Calculated Property |
| Pvap | 21.29 | kPa | 329.14 | Calculated Property |
| Pvap | 36.29 | kPa | 342.74 | Calculated Property |
| Pvap | 59.04 | kPa | 356.35 | Calculated Property |
| Pvap | 92.19 | kPa | 369.96 | Calculated Property |
| Pvap | 138.88 | kPa | 383.57 | Calculated Property |
| Pvap | 202.65 | kPa | 397.18 | Calculated Property |
| Pvap | [1.55e-03; 3733.07] | kPa | [201.95; 553.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 9.87203e+01 | |||
| Coefficient B | -7.84512e+03 | |||
| Coefficient C | -1.25776e+01 | |||
| Coefficient D | 1.02128e-05 | |||
| Temperature range, min. | 201.95 | |||
| Temperature range, max. | 553.00 | |||
| Pvap | 1.55e-03 | kPa | 201.95 | Calculated Property |
| Pvap | 0.11 | kPa | 240.96 | Calculated Property |
| Pvap | 1.87 | kPa | 279.96 | Calculated Property |
| Pvap | 14.20 | kPa | 318.97 | Calculated Property |
| Pvap | 63.53 | kPa | 357.97 | Calculated Property |
| Pvap | 201.30 | kPa | 396.98 | Calculated Property |
| Pvap | 505.65 | kPa | 435.98 | Calculated Property |
| Pvap | 1084.25 | kPa | 474.99 | Calculated Property |
| Pvap | 2086.75 | kPa | 513.99 | Calculated Property |
| Pvap | 3733.07 | kPa | 553.00 | Calculated Property |
Similar Compounds
Find more compounds similar to 2-Propenoic acid, ethyl ester.
Mixtures
- 2-Propenoic acid, ethyl ester + 1-Butanol, 3-methyl-, acetate
- 2-Propenoic acid, ethyl ester + Benzene
- 2-Propenoic acid, ethyl ester + Formamide, N,N-dimethyl-
- 2-Propenoic acid, ethyl ester + N,N-Dimethylacetamide
- 2-Propenoic acid, ethyl ester + Acetonitrile
- 2-Propenoic acid, ethyl ester + Tetrahydrofuran
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Volumetric Properties of 3-Methylbutyl Ethanoate with Ethyl Acrylate, Butyl Acrylate, Methyl Methacrylate, and Styrene at 25 C
- Volumetric, Viscometric, Ultrasonic, and Refractive Index Properties of Liquid Mixtures of Benzene with Industrially Important Monomers at Different Temperatures
- Ultrasonic velocities, densities, and excess molar volumes of binary mixtures of N,N-dimethyl formamide with methyl acrylate, or ethyl acrylate, or butyl acrylate, or 2-ethyl hexyl acrylate at T = 308.15 K
- Densities and volumetric properties of binary mixtures of N,N-dimethylformamide/N,N-dimethylacetamide with some alkyl acrylates at temperatures from 288.15 K to 318.15 K
- Densities and volumetric properties of (acetonitrile + alkyl acrylate monomer) binary mixtures at temperatures from 293.15 K to 318.15 K
- Temperature and concentration dependence of volumetric properties of (tetrahydrofuran + methyl acrylate, or + ethyl acrylate, or + n-butyl acrylate, or + tert-butyl acrylate) binary mixtures
- Thermophysical Properties of Three Compounds from the Acrylate Family
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.