- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- Cetrimonium Bromide
- InChI
- InChI=1S/C19H42N.BrH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2,3)4;/h5-19H2,1-4H3;1H/q+1;/p-1
- InChI Key
- LZZYPRNAOMGNLH-UHFFFAOYSA-M
- Formula
- C19H42BrN
- SMILES
- Br.CCCCCCCCCCCCCCCC[N+](C)(C)C
- Mol. Weight (g/mol)
- 364.45
- CAS
- 57-09-0
- Name
- Phenol, 4,4'-(1-methylethylidene)bis-
- InChI
- InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3
- InChI Key
- IISBACLAFKSPIT-UHFFFAOYSA-N
- Formula
- C15H16O2
- SMILES
- CC(C)(c1ccc(O)cc1)c1ccc(O)cc1
- Mol. Weight (g/mol)
- 228.29
- CAS
- 80-05-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass concentration, kg/m3 of Phenol, 4,4'-(1-methylethylidene)bis- (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Ratio of component mass to volume of solvent, kg/m3 of Cetrimonium Bromide (2) - Liquid | Mass concentration, kg/m3 of Phenol, 4,4'-(1-methylethylidene)bis- (3) - Liquid |
| 298.15 | 0.0000 | 0.3810 |
| 298.15 | 0.1000 | 0.4450 |
| 298.15 | 0.2000 | 0.4310 |
| 298.15 | 0.3000 | 0.5310 |
| 298.15 | 0.4000 | 0.5910 |
| 298.15 | 0.8000 | 0.8780 |
| 298.15 | 1.2 | 1.182 |
| 298.15 | 2.0 | 1.526 |
| 303.15 | 0.0000 | 0.4660 |
| 303.15 | 0.1000 | 0.4770 |
| 303.15 | 0.2000 | 0.5640 |
| 303.15 | 0.3000 | 0.6510 |
| 303.15 | 0.4000 | 0.7120 |
| 303.15 | 0.8000 | 1.06 |
| 303.15 | 1.2 | 1.321 |
| 303.15 | 2.0 | 1.818 |
| 308.15 | 0.0000 | 0.5410 |
| 308.15 | 0.1000 | 0.5720 |
| 308.15 | 0.2000 | 0.6450 |
| 308.15 | 0.3000 | 0.7420 |
| 308.15 | 0.4000 | 0.8040 |
| 308.15 | 0.8000 | 1.128 |
| 308.15 | 1.2 | 1.425 |
| 308.15 | 2.0 | 1.958 |
| 313.15 | 0.0000 | 0.5940 |
| 313.15 | 0.1000 | 0.6380 |
| 313.15 | 0.2000 | 0.7060 |
| 313.15 | 0.3000 | 0.8210 |
| 313.15 | 0.4000 | 0.9870 |
| 313.15 | 0.8000 | 1.295 |
| 313.15 | 1.2 | 1.591 |
| 313.15 | 2.0 | 2.261 |
Mass concentration, kg/m3 of Phenol, 4,4'-(1-methylethylidene)bis- (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Ratio of component mass to volume of solvent, kg/m3 of Cetrimonium Bromide (2) - Liquid | Mass concentration, kg/m3 of Phenol, 4,4'-(1-methylethylidene)bis- (3) - Liquid |
| 298.15 | 0.0000 | 0.3810 |
| 298.15 | 0.1000 | 0.4450 |
| 298.15 | 0.2000 | 0.4310 |
| 298.15 | 0.3000 | 0.5310 |
| 298.15 | 0.4000 | 0.5910 |
| 298.15 | 0.8000 | 0.8780 |
| 298.15 | 1.2 | 1.182 |
| 298.15 | 2.0 | 1.526 |
| 303.15 | 0.0000 | 0.4660 |
| 303.15 | 0.1000 | 0.4770 |
| 303.15 | 0.2000 | 0.5640 |
| 303.15 | 0.3000 | 0.6510 |
| 303.15 | 0.4000 | 0.7120 |
| 303.15 | 0.8000 | 1.06 |
| 303.15 | 1.2 | 1.321 |
| 303.15 | 2.0 | 1.818 |
| 308.15 | 0.0000 | 0.5410 |
| 308.15 | 0.1000 | 0.5720 |
| 308.15 | 0.2000 | 0.6450 |
| 308.15 | 0.3000 | 0.7420 |
| 308.15 | 0.4000 | 0.8040 |
| 308.15 | 0.8000 | 1.128 |
| 308.15 | 1.2 | 1.425 |
| 308.15 | 2.0 | 1.958 |
| 313.15 | 0.0000 | 0.5940 |
| 313.15 | 0.1000 | 0.6380 |
| 313.15 | 0.2000 | 0.7060 |
| 313.15 | 0.3000 | 0.8210 |
| 313.15 | 0.4000 | 0.9870 |
| 313.15 | 0.8000 | 1.295 |
| 313.15 | 1.2 | 1.591 |
| 313.15 | 2.0 | 2.261 |