- Name
- Glycerin
- InChI
- InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
- InChI Key
- PEDCQBHIVMGVHV-UHFFFAOYSA-N
- Formula
- C3H8O3
- SMILES
- OCC(O)CO
- Mol. Weight (g/mol)
- 92.09
- CAS
- 56-81-5
- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
- Name
- Methyl Alcohol
- InChI
- InChI=1S/CH4O/c1-2/h2H,1H3
- InChI Key
- OKKJLVBELUTLKV-UHFFFAOYSA-N
- Formula
- CH4O
- SMILES
- CO
- Mol. Weight (g/mol)
- 32.04
- CAS
- 67-56-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Methyl Alcohol (3) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 1 | Mole fraction of Methyl Alcohol (3) - Liquid mixture 1 |
| 303.20 | 0.9430 | 0.0450 |
| 303.20 | 0.8980 | 0.0880 |
| 303.20 | 0.8000 | 0.1790 |
| 303.20 | 0.7170 | 0.2510 |
| 303.20 | 0.6370 | 0.3090 |
| 303.20 | 0.5210 | 0.3780 |
| 303.20 | 0.4150 | 0.4230 |
| 303.20 | 0.3360 | 0.4470 |
| 303.20 | 0.2700 | 0.4580 |
| 303.20 | 0.2030 | 0.4600 |
| 303.20 | 0.1440 | 0.4490 |
| 303.20 | 0.1080 | 0.4240 |
| 303.20 | 0.0910 | 0.3860 |
| 303.20 | 0.0700 | 0.3540 |
| 303.20 | 0.0540 | 0.3120 |
| 303.20 | 0.0470 | 0.2280 |
| 313.20 | 0.8880 | 0.0920 |
| 313.20 | 0.8110 | 0.1630 |
| 313.20 | 0.7010 | 0.2560 |
| 313.20 | 0.5980 | 0.3250 |
| 313.20 | 0.4820 | 0.3890 |
| 313.20 | 0.3830 | 0.4260 |
| 313.20 | 0.3000 | 0.4410 |
| 313.20 | 0.2360 | 0.4480 |
| 313.20 | 0.1960 | 0.4480 |
| 313.20 | 0.1530 | 0.4400 |
| 313.20 | 0.1140 | 0.4130 |
| 313.20 | 0.0950 | 0.3840 |
| 313.20 | 0.0730 | 0.3480 |
| 313.20 | 0.0650 | 0.3130 |
| 313.20 | 0.0580 | 0.2670 |
| 313.20 | 0.0540 | 0.2200 |
| 323.20 | 0.8260 | 0.1370 |
| 323.20 | 0.7140 | 0.2330 |
| 323.20 | 0.6080 | 0.3130 |
| 323.20 | 0.4790 | 0.3830 |
| 323.20 | 0.3920 | 0.4180 |
| 323.20 | 0.3410 | 0.4300 |
| 323.20 | 0.2950 | 0.4340 |
| 323.20 | 0.2170 | 0.4390 |
| 323.20 | 0.2100 | 0.4380 |
| 323.20 | 0.1840 | 0.4340 |
| 323.20 | 0.1530 | 0.4220 |
| 323.20 | 0.1240 | 0.4040 |
| 323.20 | 0.1040 | 0.3730 |
| 323.20 | 0.0750 | 0.3220 |
| 323.20 | 0.0690 | 0.2820 |
| 323.20 | 0.0580 | 0.2400 |
Mole fraction of Methyl Alcohol (3) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 1 | Mole fraction of Methyl Alcohol (3) - Liquid mixture 1 |
| 303.20 | 0.9430 | 0.0450 |
| 303.20 | 0.8980 | 0.0880 |
| 303.20 | 0.8000 | 0.1790 |
| 303.20 | 0.7170 | 0.2510 |
| 303.20 | 0.6370 | 0.3090 |
| 303.20 | 0.5210 | 0.3780 |
| 303.20 | 0.4150 | 0.4230 |
| 303.20 | 0.3360 | 0.4470 |
| 303.20 | 0.2700 | 0.4580 |
| 303.20 | 0.2030 | 0.4600 |
| 303.20 | 0.1440 | 0.4490 |
| 303.20 | 0.1080 | 0.4240 |
| 303.20 | 0.0910 | 0.3860 |
| 303.20 | 0.0700 | 0.3540 |
| 303.20 | 0.0540 | 0.3120 |
| 303.20 | 0.0470 | 0.2280 |
| 313.20 | 0.8880 | 0.0920 |
| 313.20 | 0.8110 | 0.1630 |
| 313.20 | 0.7010 | 0.2560 |
| 313.20 | 0.5980 | 0.3250 |
| 313.20 | 0.4820 | 0.3890 |
| 313.20 | 0.3830 | 0.4260 |
| 313.20 | 0.3000 | 0.4410 |
| 313.20 | 0.2360 | 0.4480 |
| 313.20 | 0.1960 | 0.4480 |
| 313.20 | 0.1530 | 0.4400 |
| 313.20 | 0.1140 | 0.4130 |
| 313.20 | 0.0950 | 0.3840 |
| 313.20 | 0.0730 | 0.3480 |
| 313.20 | 0.0650 | 0.3130 |
| 313.20 | 0.0580 | 0.2670 |
| 313.20 | 0.0540 | 0.2200 |
| 323.20 | 0.8260 | 0.1370 |
| 323.20 | 0.7140 | 0.2330 |
| 323.20 | 0.6080 | 0.3130 |
| 323.20 | 0.4790 | 0.3830 |
| 323.20 | 0.3920 | 0.4180 |
| 323.20 | 0.3410 | 0.4300 |
| 323.20 | 0.2950 | 0.4340 |
| 323.20 | 0.2170 | 0.4390 |
| 323.20 | 0.2100 | 0.4380 |
| 323.20 | 0.1840 | 0.4340 |
| 323.20 | 0.1530 | 0.4220 |
| 323.20 | 0.1240 | 0.4040 |
| 323.20 | 0.1040 | 0.3730 |
| 323.20 | 0.0750 | 0.3220 |
| 323.20 | 0.0690 | 0.2820 |
| 323.20 | 0.0580 | 0.2400 |