- Name
- Ethane
- InChI
- InChI=1S/C2H6/c1-2/h1-2H3
- InChI Key
- OTMSDBZUPAUEDD-UHFFFAOYSA-N
- Formula
- C2H6
- SMILES
- CC
- Mol. Weight (g/mol)
- 30.07
- CAS
- 74-84-0
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (8)
- Lower consolute pressure, kPa (2)
- Pc - Critical pressure, kPa (2)
- ρl - Mass density, kg/m3 (4)
Mole fraction of Ethane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Ethane (1) - Liquid mixture 1 |
| 293.15 | 2.33 | 0.0280 |
| 293.15 | 2.43 | 0.0170 |
| 293.15 | 2.50 | 0.0120 |
| 293.15 | 2.57 | 0.0090 |
| 293.15 | 2.69 | 0.0040 |
| 293.15 | 2.75 | 0.0020 |
| 313.15 | 3.53 | 0.0180 |
| 313.15 | 3.71 | 0.0140 |
| 313.15 | 3.87 | 0.0090 |
| 313.15 | 4.05 | 0.0120 |
| 313.15 | 4.18 | 0.0070 |
| 313.15 | 4.31 | 0.0140 |
| 313.15 | 4.48 | 0.0070 |
| 313.15 | 4.73 | 0.0060 |
| 333.15 | 4.51 | 0.0290 |
| 333.15 | 4.71 | 0.0150 |
| 333.15 | 4.92 | 0.0080 |
| 333.15 | 5.08 | 0.0050 |
| 333.15 | 5.35 | 0.0030 |
| 333.15 | 5.48 | 0.0010 |
| 333.15 | 5.71 | 0.0010 |
| 333.15 | 5.82 | 0.0010 |
Mole fraction of Ethane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Ethane (1) - Liquid mixture 2 |
| 293.15 | 2.33 | 0.1670 |
| 293.15 | 2.43 | 0.2240 |
| 293.15 | 2.50 | 0.2640 |
| 293.15 | 2.57 | 0.3470 |
| 293.15 | 2.69 | 0.4180 |
| 293.15 | 2.75 | 0.4750 |
| 313.15 | 3.53 | 0.2600 |
| 313.15 | 3.71 | 0.3400 |
| 313.15 | 3.87 | 0.4170 |
| 313.15 | 4.05 | 0.5190 |
| 313.15 | 4.18 | 0.5950 |
| 313.15 | 4.31 | 0.6470 |
| 313.15 | 4.48 | 0.6840 |
| 313.15 | 4.73 | 0.7040 |
| 333.15 | 4.51 | 0.1650 |
| 333.15 | 4.71 | 0.2350 |
| 333.15 | 4.92 | 0.2960 |
| 333.15 | 5.08 | 0.3360 |
| 333.15 | 5.35 | 0.4140 |
| 333.15 | 5.48 | 0.4580 |
| 333.15 | 5.71 | 0.5430 |
| 333.15 | 5.82 | 0.5990 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.15 | 2.33 | 0.6090 |
| 293.15 | 2.43 | 0.6590 |
| 293.15 | 2.50 | 0.6870 |
| 293.15 | 2.57 | 0.7110 |
| 293.15 | 2.69 | 0.7420 |
| 293.15 | 2.75 | 0.7540 |
| 313.15 | 3.53 | 0.7040 |
| 313.15 | 3.71 | 0.7350 |
| 313.15 | 3.87 | 0.7900 |
| 313.15 | 4.05 | 0.7810 |
| 313.15 | 4.18 | 0.8040 |
| 313.15 | 4.31 | 0.8120 |
| 313.15 | 4.48 | 0.8540 |
| 313.15 | 4.73 | 0.8900 |
| 333.15 | 4.51 | 0.6680 |
| 333.15 | 4.71 | 0.7230 |
| 333.15 | 4.92 | 0.7600 |
| 333.15 | 5.08 | 0.7760 |
| 333.15 | 5.35 | 0.8010 |
| 333.15 | 5.48 | 0.8120 |
| 333.15 | 5.71 | 0.8280 |
| 333.15 | 5.82 | 0.8330 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 |
| 293.15 | 2.33 | 0.2960 |
| 293.15 | 2.43 | 0.2120 |
| 293.15 | 2.50 | 0.1720 |
| 293.15 | 2.57 | 0.1470 |
| 293.15 | 2.69 | 0.1270 |
| 293.15 | 2.75 | 0.1190 |
| 313.15 | 3.53 | 0.2220 |
| 313.15 | 3.71 | 0.1590 |
| 313.15 | 3.87 | 0.1250 |
| 313.15 | 4.05 | 0.0940 |
| 313.15 | 4.18 | 0.0840 |
| 313.15 | 4.31 | 0.0780 |
| 313.15 | 4.48 | 0.0840 |
| 313.15 | 4.73 | 0.0890 |
| 333.15 | 4.51 | 0.3470 |
| 333.15 | 4.71 | 0.2590 |
| 333.15 | 4.92 | 0.2090 |
| 333.15 | 5.08 | 0.1860 |
| 333.15 | 5.35 | 0.1550 |
| 333.15 | 5.48 | 0.1420 |
| 333.15 | 5.71 | 0.1190 |
| 333.15 | 5.82 | 0.1090 |
Mole fraction of Ethane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Ethane (1) - Liquid mixture 1 |
| 293.15 | 2.33 | 0.0280 |
| 293.15 | 2.43 | 0.0170 |
| 293.15 | 2.50 | 0.0120 |
| 293.15 | 2.57 | 0.0090 |
| 293.15 | 2.69 | 0.0040 |
| 293.15 | 2.75 | 0.0020 |
| 313.15 | 3.53 | 0.0180 |
| 313.15 | 3.71 | 0.0140 |
| 313.15 | 3.87 | 0.0090 |
| 313.15 | 4.05 | 0.0120 |
| 313.15 | 4.18 | 0.0070 |
| 313.15 | 4.31 | 0.0140 |
| 313.15 | 4.48 | 0.0070 |
| 313.15 | 4.73 | 0.0060 |
| 333.15 | 4.51 | 0.0290 |
| 333.15 | 4.71 | 0.0150 |
| 333.15 | 4.92 | 0.0080 |
| 333.15 | 5.08 | 0.0050 |
| 333.15 | 5.35 | 0.0030 |
| 333.15 | 5.48 | 0.0010 |
| 333.15 | 5.71 | 0.0010 |
| 333.15 | 5.82 | 0.0010 |
Mole fraction of Ethane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Ethane (1) - Liquid mixture 2 |
| 293.15 | 2.33 | 0.1670 |
| 293.15 | 2.43 | 0.2240 |
| 293.15 | 2.50 | 0.2640 |
| 293.15 | 2.57 | 0.3470 |
| 293.15 | 2.69 | 0.4180 |
| 293.15 | 2.75 | 0.4750 |
| 313.15 | 3.53 | 0.2600 |
| 313.15 | 3.71 | 0.3400 |
| 313.15 | 3.87 | 0.4170 |
| 313.15 | 4.05 | 0.5190 |
| 313.15 | 4.18 | 0.5950 |
| 313.15 | 4.31 | 0.6470 |
| 313.15 | 4.48 | 0.6840 |
| 313.15 | 4.73 | 0.7040 |
| 333.15 | 4.51 | 0.1650 |
| 333.15 | 4.71 | 0.2350 |
| 333.15 | 4.92 | 0.2960 |
| 333.15 | 5.08 | 0.3360 |
| 333.15 | 5.35 | 0.4140 |
| 333.15 | 5.48 | 0.4580 |
| 333.15 | 5.71 | 0.5430 |
| 333.15 | 5.82 | 0.5990 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.15 | 2.33 | 0.6090 |
| 293.15 | 2.43 | 0.6590 |
| 293.15 | 2.50 | 0.6870 |
| 293.15 | 2.57 | 0.7110 |
| 293.15 | 2.69 | 0.7420 |
| 293.15 | 2.75 | 0.7540 |
| 313.15 | 3.53 | 0.7040 |
| 313.15 | 3.71 | 0.7350 |
| 313.15 | 3.87 | 0.7900 |
| 313.15 | 4.05 | 0.7810 |
| 313.15 | 4.18 | 0.8040 |
| 313.15 | 4.31 | 0.8120 |
| 313.15 | 4.48 | 0.8540 |
| 313.15 | 4.73 | 0.8900 |
| 333.15 | 4.51 | 0.6680 |
| 333.15 | 4.71 | 0.7230 |
| 333.15 | 4.92 | 0.7600 |
| 333.15 | 5.08 | 0.7760 |
| 333.15 | 5.35 | 0.8010 |
| 333.15 | 5.48 | 0.8120 |
| 333.15 | 5.71 | 0.8280 |
| 333.15 | 5.82 | 0.8330 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 |
| 293.15 | 2.33 | 0.2960 |
| 293.15 | 2.43 | 0.2120 |
| 293.15 | 2.50 | 0.1720 |
| 293.15 | 2.57 | 0.1470 |
| 293.15 | 2.69 | 0.1270 |
| 293.15 | 2.75 | 0.1190 |
| 313.15 | 3.53 | 0.2220 |
| 313.15 | 3.71 | 0.1590 |
| 313.15 | 3.87 | 0.1250 |
| 313.15 | 4.05 | 0.0940 |
| 313.15 | 4.18 | 0.0840 |
| 313.15 | 4.31 | 0.0780 |
| 313.15 | 4.48 | 0.0840 |
| 313.15 | 4.73 | 0.0890 |
| 333.15 | 4.51 | 0.3470 |
| 333.15 | 4.71 | 0.2590 |
| 333.15 | 4.92 | 0.2090 |
| 333.15 | 5.08 | 0.1860 |
| 333.15 | 5.35 | 0.1550 |
| 333.15 | 5.48 | 0.1420 |
| 333.15 | 5.71 | 0.1190 |
| 333.15 | 5.82 | 0.1090 |
Lower consolute pressure, kPa [ref]
| Temperature, K - Liquid mixture 1 | Lower consolute pressure, kPa - Liquid mixture 1 |
|---|---|
| 283.15 | 1875.00 |
| 293.15 | 2316.00 |
| 303.15 | 2784.00 |
| 313.15 | 3320.00 |
| 323.15 | 3868.00 |
| 333.15 | 4440.00 |
Temperature, K
Lower consolute pressure, kPa
2000
2500
3000
3500
4000
4500
300
320
Lower consolute pressure, kPa [ref]
| Temperature, K - Liquid mixture 1 | Lower consolute pressure, kPa - Liquid mixture 1 |
|---|---|
| 283.15 | 1875.00 |
| 293.15 | 2316.00 |
| 303.15 | 2784.00 |
| 313.15 | 3320.00 |
| 323.15 | 3868.00 |
| 333.15 | 4440.00 |
Temperature, K
Lower consolute pressure, kPa
2000
2500
3000
3500
4000
4500
300
320
Critical pressure, kPa [ref]
| Temperature, K - Liquid mixture 2 | Critical pressure, kPa - Liquid mixture 2 |
|---|---|
| 310.15 | 4687.00 |
| 313.15 | 4875.00 |
| 323.15 | 5464.00 |
| 333.15 | 6180.00 |
| 343.15 | 6930.00 |
Temperature, K
Critical pressure, kPa
4500
5000
5500
6000
6500
7000
310
320
330
340
Critical pressure, kPa [ref]
| Temperature, K - Liquid mixture 2 | Critical pressure, kPa - Liquid mixture 2 |
|---|---|
| 310.15 | 4687.00 |
| 313.15 | 4875.00 |
| 323.15 | 5464.00 |
| 333.15 | 6180.00 |
| 343.15 | 6930.00 |
Temperature, K
Critical pressure, kPa
4500
5000
5500
6000
6500
7000
310
320
330
340
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.15 | 2332.00 | 861.0 |
| 293.15 | 2429.00 | 880.0 |
| 293.15 | 2500.00 | 891.0 |
| 293.15 | 2571.00 | 898.0 |
| 293.15 | 2686.00 | 903.0 |
| 293.15 | 2750.00 | 907.0 |
| 313.15 | 3530.00 | 875.0 |
| 313.15 | 3710.00 | 889.0 |
| 313.15 | 3867.00 | 903.0 |
| 313.15 | 4047.00 | 908.0 |
| 313.15 | 4177.00 | 919.0 |
| 313.15 | 4306.00 | 922.0 |
| 313.15 | 4477.00 | 935.0 |
| 313.15 | 4727.00 | 953.0 |
| 333.15 | 4512.00 | 831.0 |
| 333.15 | 4712.00 | 861.0 |
| 333.15 | 4917.00 | 876.0 |
| 333.15 | 5079.00 | 883.0 |
| 333.15 | 5350.00 | 896.0 |
| 333.15 | 5482.00 | 898.0 |
| 333.15 | 5706.00 | 905.0 |
| 333.15 | 5822.00 | 910.0 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.15 | 2332.00 | 757.0 |
| 293.15 | 2429.00 | 727.0 |
| 293.15 | 2500.00 | 702.0 |
| 293.15 | 2571.00 | 675.0 |
| 293.15 | 2686.00 | 656.0 |
| 293.15 | 2750.00 | 634.0 |
| 313.15 | 3530.00 | 713.0 |
| 313.15 | 3710.00 | 681.0 |
| 313.15 | 3867.00 | 660.0 |
| 313.15 | 4047.00 | 639.0 |
| 313.15 | 4177.00 | 614.0 |
| 313.15 | 4306.00 | 557.0 |
| 313.15 | 4477.00 | 490.0 |
| 313.15 | 4727.00 | 334.0 |
| 333.15 | 4512.00 | 736.0 |
| 333.15 | 4712.00 | 713.0 |
| 333.15 | 4917.00 | 682.0 |
| 333.15 | 5079.00 | 670.0 |
| 333.15 | 5350.00 | 605.0 |
| 333.15 | 5482.00 | 596.0 |
| 333.15 | 5706.00 | 574.0 |
| 333.15 | 5822.00 | 574.0 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.15 | 2332.00 | 861.0 |
| 293.15 | 2429.00 | 880.0 |
| 293.15 | 2500.00 | 891.0 |
| 293.15 | 2571.00 | 898.0 |
| 293.15 | 2686.00 | 903.0 |
| 293.15 | 2750.00 | 907.0 |
| 313.15 | 3530.00 | 875.0 |
| 313.15 | 3710.00 | 889.0 |
| 313.15 | 3867.00 | 903.0 |
| 313.15 | 4047.00 | 908.0 |
| 313.15 | 4177.00 | 919.0 |
| 313.15 | 4306.00 | 922.0 |
| 313.15 | 4477.00 | 935.0 |
| 313.15 | 4727.00 | 953.0 |
| 333.15 | 4512.00 | 831.0 |
| 333.15 | 4712.00 | 861.0 |
| 333.15 | 4917.00 | 876.0 |
| 333.15 | 5079.00 | 883.0 |
| 333.15 | 5350.00 | 896.0 |
| 333.15 | 5482.00 | 898.0 |
| 333.15 | 5706.00 | 905.0 |
| 333.15 | 5822.00 | 910.0 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.15 | 2332.00 | 757.0 |
| 293.15 | 2429.00 | 727.0 |
| 293.15 | 2500.00 | 702.0 |
| 293.15 | 2571.00 | 675.0 |
| 293.15 | 2686.00 | 656.0 |
| 293.15 | 2750.00 | 634.0 |
| 313.15 | 3530.00 | 713.0 |
| 313.15 | 3710.00 | 681.0 |
| 313.15 | 3867.00 | 660.0 |
| 313.15 | 4047.00 | 639.0 |
| 313.15 | 4177.00 | 614.0 |
| 313.15 | 4306.00 | 557.0 |
| 313.15 | 4477.00 | 490.0 |
| 313.15 | 4727.00 | 334.0 |
| 333.15 | 4512.00 | 736.0 |
| 333.15 | 4712.00 | 713.0 |
| 333.15 | 4917.00 | 682.0 |
| 333.15 | 5079.00 | 670.0 |
| 333.15 | 5350.00 | 605.0 |
| 333.15 | 5482.00 | 596.0 |
| 333.15 | 5706.00 | 574.0 |
| 333.15 | 5822.00 | 574.0 |