- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
- Name
- Ethylene
- InChI
- InChI=1S/C2H4/c1-2/h1-2H2
- InChI Key
- VGGSQFUCUMXWEO-UHFFFAOYSA-N
- Formula
- C2H4
- SMILES
- C=C
- Mol. Weight (g/mol)
- 28.05
- CAS
- 74-85-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (8)
- Lower consolute pressure, kPa (2)
- Pc - Critical pressure, kPa (2)
- ρl - Mass density, kg/m3 (4)
Mole fraction of Ethylene (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Ethylene (2) - Liquid mixture 2 |
| 293.15 | 2.86 | 0.2060 |
| 293.15 | 3.35 | 0.3090 |
| 293.15 | 3.61 | 0.3470 |
| 293.15 | 3.90 | 0.4220 |
| 293.15 | 4.36 | 0.5430 |
| 293.15 | 4.61 | 0.6380 |
| 293.15 | 4.97 | 0.6880 |
| 313.15 | 3.87 | 0.1840 |
| 313.15 | 4.01 | 0.2140 |
| 313.15 | 4.41 | 0.2790 |
| 313.15 | 4.50 | 0.2950 |
| 313.15 | 4.67 | 0.3250 |
| 313.15 | 4.78 | 0.3390 |
| 313.15 | 4.94 | 0.3630 |
| 313.15 | 5.28 | 0.4240 |
| 313.15 | 5.47 | 0.4520 |
| 313.15 | 5.58 | 0.4660 |
| 313.15 | 5.76 | 0.5010 |
| 313.15 | 6.08 | 0.5670 |
| 313.15 | 6.30 | 0.6020 |
| 313.15 | 6.50 | 0.6560 |
| 313.15 | 6.65 | 0.6910 |
| 333.15 | 5.29 | 0.2080 |
| 333.15 | 5.59 | 0.2390 |
| 333.15 | 5.88 | 0.2800 |
| 333.15 | 6.17 | 0.3210 |
| 333.15 | 7.08 | 0.4310 |
| 333.15 | 7.73 | 0.5220 |
| 333.15 | 8.04 | 0.5710 |
Mole fraction of Ethylene (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Ethylene (2) - Liquid mixture 1 |
| 293.15 | 2.86 | 0.0300 |
| 293.15 | 3.35 | 0.0200 |
| 293.15 | 3.61 | 0.0190 |
| 293.15 | 3.90 | 0.0170 |
| 293.15 | 4.36 | 0.0150 |
| 293.15 | 4.61 | 0.0140 |
| 293.15 | 4.97 | 0.0160 |
| 313.15 | 3.87 | 0.0340 |
| 313.15 | 4.01 | 0.0260 |
| 313.15 | 4.41 | 0.0240 |
| 313.15 | 4.50 | 0.0200 |
| 313.15 | 4.67 | 0.0190 |
| 313.15 | 4.78 | 0.0190 |
| 313.15 | 4.94 | 0.0190 |
| 313.15 | 5.28 | 0.0170 |
| 313.15 | 5.47 | 0.0160 |
| 313.15 | 5.58 | 0.0150 |
| 313.15 | 5.76 | 0.0140 |
| 313.15 | 6.08 | 0.0180 |
| 313.15 | 6.30 | 0.0220 |
| 313.15 | 6.50 | 0.0200 |
| 313.15 | 6.65 | 0.0210 |
| 333.15 | 5.29 | 0.0280 |
| 333.15 | 5.59 | 0.0230 |
| 333.15 | 5.88 | 0.0200 |
| 333.15 | 6.17 | 0.0200 |
| 333.15 | 7.08 | 0.0180 |
| 333.15 | 7.73 | 0.0170 |
| 333.15 | 8.04 | 0.0220 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.15 | 2.86 | 0.7030 |
| 293.15 | 3.35 | 0.7750 |
| 293.15 | 3.61 | 0.7920 |
| 293.15 | 3.90 | 0.8150 |
| 293.15 | 4.36 | 0.8420 |
| 293.15 | 4.61 | 0.8570 |
| 293.15 | 4.97 | 0.8790 |
| 313.15 | 3.87 | 0.7070 |
| 313.15 | 4.01 | 0.7460 |
| 313.15 | 4.41 | 0.7750 |
| 313.15 | 4.50 | 0.7900 |
| 313.15 | 4.67 | 0.8000 |
| 313.15 | 4.78 | 0.8060 |
| 313.15 | 4.94 | 0.8130 |
| 313.15 | 5.28 | 0.8320 |
| 313.15 | 5.47 | 0.8400 |
| 313.15 | 5.58 | 0.8450 |
| 313.15 | 5.76 | 0.8510 |
| 313.15 | 6.08 | 0.8540 |
| 313.15 | 6.30 | 0.8600 |
| 313.15 | 6.50 | 0.8700 |
| 313.15 | 6.65 | 0.8750 |
| 333.15 | 5.29 | 0.7610 |
| 333.15 | 5.59 | 0.7890 |
| 333.15 | 5.88 | 0.8070 |
| 333.15 | 6.17 | 0.8180 |
| 333.15 | 7.08 | 0.8470 |
| 333.15 | 7.73 | 0.8610 |
| 333.15 | 8.04 | 0.8640 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 |
| 293.15 | 2.86 | 0.2330 |
| 293.15 | 3.35 | 0.1420 |
| 293.15 | 3.61 | 0.1300 |
| 293.15 | 3.90 | 0.0830 |
| 293.15 | 4.36 | 0.0570 |
| 293.15 | 4.61 | 0.0570 |
| 293.15 | 4.97 | 0.0420 |
| 313.15 | 3.87 | 0.2950 |
| 313.15 | 4.01 | 0.2550 |
| 313.15 | 4.41 | 0.1930 |
| 313.15 | 4.50 | 0.1750 |
| 313.15 | 4.67 | 0.1520 |
| 313.15 | 4.78 | 0.1480 |
| 313.15 | 4.94 | 0.1340 |
| 313.15 | 5.28 | 0.1100 |
| 313.15 | 5.47 | 0.1030 |
| 313.15 | 5.58 | 0.1020 |
| 313.15 | 5.76 | 0.0840 |
| 313.15 | 6.08 | 0.0860 |
| 313.15 | 6.30 | 0.0940 |
| 313.15 | 6.50 | 0.0930 |
| 313.15 | 6.65 | 0.0900 |
| 333.15 | 5.29 | 0.2910 |
| 333.15 | 5.59 | 0.2620 |
| 333.15 | 5.88 | 0.2140 |
| 333.15 | 6.17 | 0.1840 |
| 333.15 | 7.08 | 0.1330 |
| 333.15 | 7.73 | 0.1120 |
| 333.15 | 8.04 | 0.0990 |
Mole fraction of Ethylene (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Ethylene (2) - Liquid mixture 2 |
| 293.15 | 2.86 | 0.2060 |
| 293.15 | 3.35 | 0.3090 |
| 293.15 | 3.61 | 0.3470 |
| 293.15 | 3.90 | 0.4220 |
| 293.15 | 4.36 | 0.5430 |
| 293.15 | 4.61 | 0.6380 |
| 293.15 | 4.97 | 0.6880 |
| 313.15 | 3.87 | 0.1840 |
| 313.15 | 4.01 | 0.2140 |
| 313.15 | 4.41 | 0.2790 |
| 313.15 | 4.50 | 0.2950 |
| 313.15 | 4.67 | 0.3250 |
| 313.15 | 4.78 | 0.3390 |
| 313.15 | 4.94 | 0.3630 |
| 313.15 | 5.28 | 0.4240 |
| 313.15 | 5.47 | 0.4520 |
| 313.15 | 5.58 | 0.4660 |
| 313.15 | 5.76 | 0.5010 |
| 313.15 | 6.08 | 0.5670 |
| 313.15 | 6.30 | 0.6020 |
| 313.15 | 6.50 | 0.6560 |
| 313.15 | 6.65 | 0.6910 |
| 333.15 | 5.29 | 0.2080 |
| 333.15 | 5.59 | 0.2390 |
| 333.15 | 5.88 | 0.2800 |
| 333.15 | 6.17 | 0.3210 |
| 333.15 | 7.08 | 0.4310 |
| 333.15 | 7.73 | 0.5220 |
| 333.15 | 8.04 | 0.5710 |
Mole fraction of Ethylene (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Ethylene (2) - Liquid mixture 1 |
| 293.15 | 2.86 | 0.0300 |
| 293.15 | 3.35 | 0.0200 |
| 293.15 | 3.61 | 0.0190 |
| 293.15 | 3.90 | 0.0170 |
| 293.15 | 4.36 | 0.0150 |
| 293.15 | 4.61 | 0.0140 |
| 293.15 | 4.97 | 0.0160 |
| 313.15 | 3.87 | 0.0340 |
| 313.15 | 4.01 | 0.0260 |
| 313.15 | 4.41 | 0.0240 |
| 313.15 | 4.50 | 0.0200 |
| 313.15 | 4.67 | 0.0190 |
| 313.15 | 4.78 | 0.0190 |
| 313.15 | 4.94 | 0.0190 |
| 313.15 | 5.28 | 0.0170 |
| 313.15 | 5.47 | 0.0160 |
| 313.15 | 5.58 | 0.0150 |
| 313.15 | 5.76 | 0.0140 |
| 313.15 | 6.08 | 0.0180 |
| 313.15 | 6.30 | 0.0220 |
| 313.15 | 6.50 | 0.0200 |
| 313.15 | 6.65 | 0.0210 |
| 333.15 | 5.29 | 0.0280 |
| 333.15 | 5.59 | 0.0230 |
| 333.15 | 5.88 | 0.0200 |
| 333.15 | 6.17 | 0.0200 |
| 333.15 | 7.08 | 0.0180 |
| 333.15 | 7.73 | 0.0170 |
| 333.15 | 8.04 | 0.0220 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.15 | 2.86 | 0.7030 |
| 293.15 | 3.35 | 0.7750 |
| 293.15 | 3.61 | 0.7920 |
| 293.15 | 3.90 | 0.8150 |
| 293.15 | 4.36 | 0.8420 |
| 293.15 | 4.61 | 0.8570 |
| 293.15 | 4.97 | 0.8790 |
| 313.15 | 3.87 | 0.7070 |
| 313.15 | 4.01 | 0.7460 |
| 313.15 | 4.41 | 0.7750 |
| 313.15 | 4.50 | 0.7900 |
| 313.15 | 4.67 | 0.8000 |
| 313.15 | 4.78 | 0.8060 |
| 313.15 | 4.94 | 0.8130 |
| 313.15 | 5.28 | 0.8320 |
| 313.15 | 5.47 | 0.8400 |
| 313.15 | 5.58 | 0.8450 |
| 313.15 | 5.76 | 0.8510 |
| 313.15 | 6.08 | 0.8540 |
| 313.15 | 6.30 | 0.8600 |
| 313.15 | 6.50 | 0.8700 |
| 313.15 | 6.65 | 0.8750 |
| 333.15 | 5.29 | 0.7610 |
| 333.15 | 5.59 | 0.7890 |
| 333.15 | 5.88 | 0.8070 |
| 333.15 | 6.17 | 0.8180 |
| 333.15 | 7.08 | 0.8470 |
| 333.15 | 7.73 | 0.8610 |
| 333.15 | 8.04 | 0.8640 |
Mole fraction of Water (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 |
| 293.15 | 2.86 | 0.2330 |
| 293.15 | 3.35 | 0.1420 |
| 293.15 | 3.61 | 0.1300 |
| 293.15 | 3.90 | 0.0830 |
| 293.15 | 4.36 | 0.0570 |
| 293.15 | 4.61 | 0.0570 |
| 293.15 | 4.97 | 0.0420 |
| 313.15 | 3.87 | 0.2950 |
| 313.15 | 4.01 | 0.2550 |
| 313.15 | 4.41 | 0.1930 |
| 313.15 | 4.50 | 0.1750 |
| 313.15 | 4.67 | 0.1520 |
| 313.15 | 4.78 | 0.1480 |
| 313.15 | 4.94 | 0.1340 |
| 313.15 | 5.28 | 0.1100 |
| 313.15 | 5.47 | 0.1030 |
| 313.15 | 5.58 | 0.1020 |
| 313.15 | 5.76 | 0.0840 |
| 313.15 | 6.08 | 0.0860 |
| 313.15 | 6.30 | 0.0940 |
| 313.15 | 6.50 | 0.0930 |
| 313.15 | 6.65 | 0.0900 |
| 333.15 | 5.29 | 0.2910 |
| 333.15 | 5.59 | 0.2620 |
| 333.15 | 5.88 | 0.2140 |
| 333.15 | 6.17 | 0.1840 |
| 333.15 | 7.08 | 0.1330 |
| 333.15 | 7.73 | 0.1120 |
| 333.15 | 8.04 | 0.0990 |
Lower consolute pressure, kPa [ref]
| Temperature, K - Liquid mixture 1 | Lower consolute pressure, kPa - Liquid mixture 1 |
|---|---|
| 278.15 | 1967.00 |
| 283.15 | 2183.00 |
| 293.15 | 2635.00 |
| 303.15 | 3135.00 |
| 313.15 | 3642.00 |
| 323.15 | 4205.00 |
| 333.15 | 4640.00 |
| 343.15 | 5490.00 |
| 353.15 | 6134.00 |
Temperature, K
Lower consolute pressure, kPa
2000
3000
4000
5000
6000
280
300
320
340
Lower consolute pressure, kPa [ref]
| Temperature, K - Liquid mixture 1 | Lower consolute pressure, kPa - Liquid mixture 1 |
|---|---|
| 278.15 | 1967.00 |
| 283.15 | 2183.00 |
| 293.15 | 2635.00 |
| 303.15 | 3135.00 |
| 313.15 | 3642.00 |
| 323.15 | 4205.00 |
| 333.15 | 4640.00 |
| 343.15 | 5490.00 |
| 353.15 | 6134.00 |
Temperature, K
Lower consolute pressure, kPa
2000
3000
4000
5000
6000
280
300
320
340
Critical pressure, kPa [ref]
| Temperature, K - Liquid mixture 2 | Critical pressure, kPa - Liquid mixture 2 |
|---|---|
| 293.15 | 5065.00 |
| 303.15 | 5900.00 |
| 313.15 | 6965.00 |
| 323.15 | 7729.00 |
| 333.15 | 8396.00 |
| 343.15 | 9226.00 |
| 353.15 | 10060.00 |
Temperature, K
Critical pressure, kPa
5000
6000
7000
8000
9000
10000
300
320
340
Critical pressure, kPa [ref]
| Temperature, K - Liquid mixture 2 | Critical pressure, kPa - Liquid mixture 2 |
|---|---|
| 293.15 | 5065.00 |
| 303.15 | 5900.00 |
| 313.15 | 6965.00 |
| 323.15 | 7729.00 |
| 333.15 | 8396.00 |
| 343.15 | 9226.00 |
| 353.15 | 10060.00 |
Temperature, K
Critical pressure, kPa
5000
6000
7000
8000
9000
10000
300
320
340
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.15 | 2863.00 | 897.0 |
| 293.15 | 3353.00 | 924.0 |
| 293.15 | 3610.00 | 932.0 |
| 293.15 | 3900.00 | 942.0 |
| 293.15 | 4360.00 | 949.0 |
| 293.15 | 4610.00 | 955.0 |
| 293.15 | 4970.00 | 969.0 |
| 313.15 | 3872.00 | 876.0 |
| 313.15 | 4015.00 | 893.0 |
| 313.15 | 4410.00 | 901.0 |
| 313.15 | 4505.00 | 904.0 |
| 313.15 | 4670.00 | 908.0 |
| 313.15 | 4780.00 | 916.0 |
| 313.15 | 4937.00 | 920.0 |
| 313.15 | 5280.00 | 927.0 |
| 313.15 | 5475.00 | 932.0 |
| 313.15 | 5585.00 | 935.0 |
| 313.15 | 5760.00 | 936.0 |
| 313.15 | 6080.00 | 943.0 |
| 313.15 | 6300.00 | 945.0 |
| 313.15 | 6500.00 | 948.0 |
| 313.15 | 6650.00 | 950.0 |
| 333.15 | 5293.00 | 882.0 |
| 333.15 | 5595.00 | 891.0 |
| 333.15 | 5880.00 | 899.0 |
| 333.15 | 6165.00 | 911.0 |
| 333.15 | 7080.00 | 921.0 |
| 333.15 | 7730.00 | 929.0 |
| 333.15 | 8040.00 | 932.0 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.15 | 2863.00 | 704.0 |
| 293.15 | 3353.00 | 642.0 |
| 293.15 | 3610.00 | 596.0 |
| 293.15 | 3900.00 | 557.0 |
| 293.15 | 4360.00 | 533.0 |
| 293.15 | 4610.00 | 522.0 |
| 293.15 | 4970.00 | 424.0 |
| 313.15 | 3872.00 | 775.0 |
| 313.15 | 4015.00 | 763.0 |
| 313.15 | 4410.00 | 706.0 |
| 313.15 | 4505.00 | 697.0 |
| 313.15 | 4670.00 | 688.0 |
| 313.15 | 4780.00 | 693.0 |
| 313.15 | 4937.00 | 677.0 |
| 313.15 | 5280.00 | 646.0 |
| 313.15 | 5475.00 | 635.0 |
| 313.15 | 5585.00 | 604.0 |
| 313.15 | 5760.00 | 552.0 |
| 313.15 | 6080.00 | 501.0 |
| 313.15 | 6300.00 | 463.0 |
| 313.15 | 6500.00 | 449.0 |
| 313.15 | 6650.00 | 436.0 |
| 333.15 | 5293.00 | 751.0 |
| 333.15 | 5595.00 | 719.0 |
| 333.15 | 5880.00 | 704.0 |
| 333.15 | 6165.00 | 693.0 |
| 333.15 | 7080.00 | 626.0 |
| 333.15 | 7730.00 | 554.0 |
| 333.15 | 8040.00 | 505.0 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.15 | 2863.00 | 897.0 |
| 293.15 | 3353.00 | 924.0 |
| 293.15 | 3610.00 | 932.0 |
| 293.15 | 3900.00 | 942.0 |
| 293.15 | 4360.00 | 949.0 |
| 293.15 | 4610.00 | 955.0 |
| 293.15 | 4970.00 | 969.0 |
| 313.15 | 3872.00 | 876.0 |
| 313.15 | 4015.00 | 893.0 |
| 313.15 | 4410.00 | 901.0 |
| 313.15 | 4505.00 | 904.0 |
| 313.15 | 4670.00 | 908.0 |
| 313.15 | 4780.00 | 916.0 |
| 313.15 | 4937.00 | 920.0 |
| 313.15 | 5280.00 | 927.0 |
| 313.15 | 5475.00 | 932.0 |
| 313.15 | 5585.00 | 935.0 |
| 313.15 | 5760.00 | 936.0 |
| 313.15 | 6080.00 | 943.0 |
| 313.15 | 6300.00 | 945.0 |
| 313.15 | 6500.00 | 948.0 |
| 313.15 | 6650.00 | 950.0 |
| 333.15 | 5293.00 | 882.0 |
| 333.15 | 5595.00 | 891.0 |
| 333.15 | 5880.00 | 899.0 |
| 333.15 | 6165.00 | 911.0 |
| 333.15 | 7080.00 | 921.0 |
| 333.15 | 7730.00 | 929.0 |
| 333.15 | 8040.00 | 932.0 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Pressure, kPa - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.15 | 2863.00 | 704.0 |
| 293.15 | 3353.00 | 642.0 |
| 293.15 | 3610.00 | 596.0 |
| 293.15 | 3900.00 | 557.0 |
| 293.15 | 4360.00 | 533.0 |
| 293.15 | 4610.00 | 522.0 |
| 293.15 | 4970.00 | 424.0 |
| 313.15 | 3872.00 | 775.0 |
| 313.15 | 4015.00 | 763.0 |
| 313.15 | 4410.00 | 706.0 |
| 313.15 | 4505.00 | 697.0 |
| 313.15 | 4670.00 | 688.0 |
| 313.15 | 4780.00 | 693.0 |
| 313.15 | 4937.00 | 677.0 |
| 313.15 | 5280.00 | 646.0 |
| 313.15 | 5475.00 | 635.0 |
| 313.15 | 5585.00 | 604.0 |
| 313.15 | 5760.00 | 552.0 |
| 313.15 | 6080.00 | 501.0 |
| 313.15 | 6300.00 | 463.0 |
| 313.15 | 6500.00 | 449.0 |
| 313.15 | 6650.00 | 436.0 |
| 333.15 | 5293.00 | 751.0 |
| 333.15 | 5595.00 | 719.0 |
| 333.15 | 5880.00 | 704.0 |
| 333.15 | 6165.00 | 693.0 |
| 333.15 | 7080.00 | 626.0 |
| 333.15 | 7730.00 | 554.0 |
| 333.15 | 8040.00 | 505.0 |