- Name
- Sodium oxalate
- InChI
- InChI=1S/C2H2O4.2Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2
- InChI Key
- ZNCPFRVNHGOPAG-UHFFFAOYSA-L
- Formula
- C2Na2O4
- SMILES
- O=C([O-])C(=O)[O-].[Na+].[Na+]
- Mol. Weight (g/mol)
- 134.00
- CAS
- 62-76-0
- Name
- hydrogen peroxide
- InChI
- InChI=1S/H2O2/c1-2/h1-2H
- InChI Key
- MHAJPDPJQMAIIY-UHFFFAOYSA-N
- Formula
- H2O2
- SMILES
- OO
- Mol. Weight (g/mol)
- 34.01
- CAS
- 7722-84-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Sodium oxalate (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass fraction of Sodium oxalate (1) - Liquid |
| 283.15 | 0.4249 | 0.0273 |
| 283.15 | 0.4444 | 0.0234 |
| 283.15 | 0.4486 | 0.0211 |
| 283.15 | 0.5047 | 0.0193 |
| 283.15 | 0.5922 | 0.0128 |
| 293.15 | 0.4497 | 0.0201 |
| 293.15 | 0.5073 | 0.0178 |
| 293.15 | 0.5764 | 0.0152 |
| 293.15 | 0.6586 | 0.0148 |
Mass fraction of Sodium oxalate (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass fraction of Sodium oxalate (1) - Liquid |
| 283.15 | 0.0000 | 0.0295 |
| 283.15 | 0.0623 | 0.0322 |
| 283.15 | 0.1083 | 0.0337 |
| 283.15 | 0.1298 | 0.0362 |
| 283.15 | 0.2332 | 0.0354 |
| 283.15 | 0.2943 | 0.0389 |
| 283.15 | 0.3378 | 0.0396 |
| 283.15 | 0.3684 | 0.0396 |
| 293.15 | 0.0000 | 0.0340 |
| 293.15 | 0.0441 | 0.0348 |
| 293.15 | 0.0988 | 0.0360 |
| 293.15 | 0.1322 | 0.0340 |
| 293.15 | 0.1782 | 0.0375 |
| 293.15 | 0.2208 | 0.0349 |
| 293.15 | 0.2539 | 0.0383 |
| 293.15 | 0.3127 | 0.0351 |
| 293.15 | 0.3843 | 0.0289 |
| 293.15 | 0.4119 | 0.0283 |
| 293.15 | 0.4224 | 0.0276 |
Mass fraction of Sodium oxalate (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass fraction of Sodium oxalate (1) - Liquid |
| 283.15 | 0.4249 | 0.0273 |
| 283.15 | 0.4444 | 0.0234 |
| 283.15 | 0.4486 | 0.0211 |
| 283.15 | 0.5047 | 0.0193 |
| 283.15 | 0.5922 | 0.0128 |
| 293.15 | 0.4497 | 0.0201 |
| 293.15 | 0.5073 | 0.0178 |
| 293.15 | 0.5764 | 0.0152 |
| 293.15 | 0.6586 | 0.0148 |
Mass fraction of Sodium oxalate (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass fraction of Sodium oxalate (1) - Liquid |
| 283.15 | 0.0000 | 0.0295 |
| 283.15 | 0.0623 | 0.0322 |
| 283.15 | 0.1083 | 0.0337 |
| 283.15 | 0.1298 | 0.0362 |
| 283.15 | 0.2332 | 0.0354 |
| 283.15 | 0.2943 | 0.0389 |
| 283.15 | 0.3378 | 0.0396 |
| 283.15 | 0.3684 | 0.0396 |
| 293.15 | 0.0000 | 0.0340 |
| 293.15 | 0.0441 | 0.0348 |
| 293.15 | 0.0988 | 0.0360 |
| 293.15 | 0.1322 | 0.0340 |
| 293.15 | 0.1782 | 0.0375 |
| 293.15 | 0.2208 | 0.0349 |
| 293.15 | 0.2539 | 0.0383 |
| 293.15 | 0.3127 | 0.0351 |
| 293.15 | 0.3843 | 0.0289 |
| 293.15 | 0.4119 | 0.0283 |
| 293.15 | 0.4224 | 0.0276 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.4249 | 1213.9 |
| 283.15 | 0.4444 | 1222.1 |
| 283.15 | 0.4486 | 1226.9 |
| 283.15 | 0.5047 | 1237.3 |
| 283.15 | 0.5922 | 1247.8 |
| 293.15 | 0.4497 | 1241.8 |
| 293.15 | 0.5073 | 1253.4 |
| 293.15 | 0.5764 | 1261.4 |
| 293.15 | 0.6586 | 1265.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0000 | 1043.4 |
| 283.15 | 0.0623 | 1055.9 |
| 283.15 | 0.1083 | 1069.7 |
| 283.15 | 0.1298 | 1082.4 |
| 283.15 | 0.2332 | 1093.0 |
| 283.15 | 0.2943 | 1118.5 |
| 283.15 | 0.3378 | 1139.8 |
| 283.15 | 0.3684 | 1184.9 |
| 293.15 | 0.0000 | 1023.9 |
| 293.15 | 0.0441 | 1037.1 |
| 293.15 | 0.0988 | 1065.6 |
| 293.15 | 0.1322 | 1082.7 |
| 293.15 | 0.1782 | 1097.8 |
| 293.15 | 0.2208 | 1119.8 |
| 293.15 | 0.2539 | 1138.3 |
| 293.15 | 0.3127 | 1169.9 |
| 293.15 | 0.3843 | 1201.7 |
| 293.15 | 0.4119 | 1217.9 |
| 293.15 | 0.4224 | 1225.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.4249 | 1213.9 |
| 283.15 | 0.4444 | 1222.1 |
| 283.15 | 0.4486 | 1226.9 |
| 283.15 | 0.5047 | 1237.3 |
| 283.15 | 0.5922 | 1247.8 |
| 293.15 | 0.4497 | 1241.8 |
| 293.15 | 0.5073 | 1253.4 |
| 293.15 | 0.5764 | 1261.4 |
| 293.15 | 0.6586 | 1265.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of hydrogen peroxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0000 | 1043.4 |
| 283.15 | 0.0623 | 1055.9 |
| 283.15 | 0.1083 | 1069.7 |
| 283.15 | 0.1298 | 1082.4 |
| 283.15 | 0.2332 | 1093.0 |
| 283.15 | 0.2943 | 1118.5 |
| 283.15 | 0.3378 | 1139.8 |
| 283.15 | 0.3684 | 1184.9 |
| 293.15 | 0.0000 | 1023.9 |
| 293.15 | 0.0441 | 1037.1 |
| 293.15 | 0.0988 | 1065.6 |
| 293.15 | 0.1322 | 1082.7 |
| 293.15 | 0.1782 | 1097.8 |
| 293.15 | 0.2208 | 1119.8 |
| 293.15 | 0.2539 | 1138.3 |
| 293.15 | 0.3127 | 1169.9 |
| 293.15 | 0.3843 | 1201.7 |
| 293.15 | 0.4119 | 1217.9 |
| 293.15 | 0.4224 | 1225.1 |