- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- Propanal, 2-methyl-
- InChI
- InChI=1S/C4H8O/c1-4(2)3-5/h3-4H,1-2H3
- InChI Key
- AMIMRNSIRUDHCM-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CC(C)C=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-84-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Henry's Law constant (amount concentration scale), kPa*dm3/mol of Propanal, 2-methyl- (2) [ref]
Operational condition: Amount concentration (molarity), mol/dm3 = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (amount concentration scale), kPa*dm3/mol of Propanal, 2-methyl- (2) - Liquid |
|---|---|
| 275.00 | 213.8 |
| 275.00 | 208.73 |
| 275.00 | 212.78 |
| 276.00 | 202.65 |
| 279.00 | 162.12 |
| 281.00 | 133.75 |
| 281.00 | 135.78 |
| 283.00 | 133.75 |
| 283.00 | 134.76 |
| 283.00 | 135.78 |
| 285.00 | 104.36 |
| 285.00 | 107.4 |
| 288.00 | 109.43 |
| 288.00 | 106.39 |
| 290.00 | 82.07 |
| 290.00 | 94.23 |
| 293.00 | 78.02 |
| 293.00 | 74.98 |
Henry's Law constant (amount concentration scale), kPa*dm3/mol of Propanal, 2-methyl- (2) [ref]
Operational condition: Amount concentration (molarity), mol/dm3 = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (amount concentration scale), kPa*dm3/mol of Propanal, 2-methyl- (2) - Liquid |
|---|---|
| 275.00 | 213.8 |
| 275.00 | 208.73 |
| 275.00 | 212.78 |
| 276.00 | 202.65 |
| 279.00 | 162.12 |
| 281.00 | 133.75 |
| 281.00 | 135.78 |
| 283.00 | 133.75 |
| 283.00 | 134.76 |
| 283.00 | 135.78 |
| 285.00 | 104.36 |
| 285.00 | 107.4 |
| 288.00 | 109.43 |
| 288.00 | 106.39 |
| 290.00 | 82.07 |
| 290.00 | 94.23 |
| 293.00 | 78.02 |
| 293.00 | 74.98 |