- Name
- p-Methylbenzeneboronic acid
- InChI
- InChI=1S/C7H9BO2/c1-6-2-4-7(5-3-6)8(9)10/h2-5,9-10H,1H3
- InChI Key
- BIWQNIMLAISTBV-UHFFFAOYSA-N
- Formula
- C7H9BO2
- SMILES
- Cc1ccc(B(O)O)cc1
- Mol. Weight (g/mol)
- 135.96
- CAS
- 5720-05-8
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass concentration, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Temperature, K - Fluid (supercritical or subcritical phases) | Mass concentration, kg/m3 - Fluid (supercritical or subcritical phases) |
| 8000.00 | 379.25 | 0.0278 |
| 8000.00 | 400.35 | 0.0373 |
| 8000.00 | 412.95 | 0.0442 |
| 8000.00 | 423.45 | 0.0524 |
| 8000.00 | 440.65 | 0.0592 |
| 8000.00 | 475.35 | 0.0757 |
| 8000.00 | 511.15 | 0.0882 |
| 8000.00 | 518.25 | 0.0911 |
| 8000.00 | 526.05 | 0.0931 |
| 8000.00 | 569.85 | 0.1063 |
| 8000.00 | 585.15 | 0.1113 |
| 11000.00 | 368.75 | 0.0552 |
| 11000.00 | 384.55 | 0.0684 |
| 11000.00 | 398.65 | 0.0787 |
| 11000.00 | 432.15 | 0.1112 |
| 11000.00 | 439.95 | 0.1184 |
| 11000.00 | 445.55 | 0.1217 |
| 11000.00 | 467.25 | 0.1435 |
| 11000.00 | 500.45 | 0.1688 |
| 11000.00 | 514.55 | 0.1814 |
| 11000.00 | 528.95 | 0.1928 |
| 11000.00 | 551.55 | 0.2075 |
| 11000.00 | 578.35 | 0.2217 |
| 11000.00 | 590.35 | 0.2360 |
Mass concentration, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Temperature, K - Fluid (supercritical or subcritical phases) | Mass concentration, kg/m3 - Fluid (supercritical or subcritical phases) |
| 8000.00 | 379.25 | 0.0278 |
| 8000.00 | 400.35 | 0.0373 |
| 8000.00 | 412.95 | 0.0442 |
| 8000.00 | 423.45 | 0.0524 |
| 8000.00 | 440.65 | 0.0592 |
| 8000.00 | 475.35 | 0.0757 |
| 8000.00 | 511.15 | 0.0882 |
| 8000.00 | 518.25 | 0.0911 |
| 8000.00 | 526.05 | 0.0931 |
| 8000.00 | 569.85 | 0.1063 |
| 8000.00 | 585.15 | 0.1113 |
| 11000.00 | 368.75 | 0.0552 |
| 11000.00 | 384.55 | 0.0684 |
| 11000.00 | 398.65 | 0.0787 |
| 11000.00 | 432.15 | 0.1112 |
| 11000.00 | 439.95 | 0.1184 |
| 11000.00 | 445.55 | 0.1217 |
| 11000.00 | 467.25 | 0.1435 |
| 11000.00 | 500.45 | 0.1688 |
| 11000.00 | 514.55 | 0.1814 |
| 11000.00 | 528.95 | 0.1928 |
| 11000.00 | 551.55 | 0.2075 |
| 11000.00 | 578.35 | 0.2217 |
| 11000.00 | 590.35 | 0.2360 |