- Name
- Tetra-N-butylammonium chloride
- InChI
- InChI=1S/C16H36N.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- NHGXDBSUJJNIRV-UHFFFAOYSA-M
- Formula
- C16H36ClN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Cl-]
- Mol. Weight (g/mol)
- 277.92
- CAS
- 1112-67-0
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- n-Decanoic acid
- InChI
- InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)
- InChI Key
- GHVNFZFCNZKVNT-UHFFFAOYSA-N
- Formula
- C10H20O2
- SMILES
- CCCCCCCCCC(=O)O
- Mol. Weight (g/mol)
- 172.26
- CAS
- 334-48-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Carbon dioxide (2) [ref]
Operational condition: Solvent: Amount ratio of component to other component of binary solvent = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (2) - Liquid |
| 298.15 | 90.00 | 0.0124 |
| 298.15 | 190.00 | 0.0257 |
| 298.15 | 290.00 | 0.0389 |
| 298.15 | 390.00 | 0.0523 |
| 298.15 | 490.00 | 0.0653 |
| 298.15 | 690.00 | 0.0905 |
| 298.15 | 790.00 | 0.1027 |
| 298.15 | 990.00 | 0.1265 |
| 298.15 | 1190.00 | 0.1503 |
| 298.15 | 1490.00 | 0.1853 |
| 298.15 | 1790.00 | 0.2179 |
| 298.15 | 1990.00 | 0.2394 |
| 308.15 | 90.00 | 0.0101 |
| 308.15 | 190.00 | 0.0217 |
| 308.15 | 290.00 | 0.0335 |
| 308.15 | 390.00 | 0.0447 |
| 308.15 | 490.00 | 0.0558 |
| 308.15 | 690.00 | 0.0778 |
| 308.15 | 790.00 | 0.0886 |
| 308.15 | 990.00 | 0.1097 |
| 308.15 | 1190.00 | 0.1299 |
| 308.15 | 1490.00 | 0.1602 |
| 308.15 | 1790.00 | 0.1893 |
| 308.15 | 1990.00 | 0.2078 |
| 323.15 | 90.00 | 0.0086 |
| 323.15 | 190.00 | 0.0178 |
| 323.15 | 290.00 | 0.0271 |
| 323.15 | 390.00 | 0.0365 |
| 323.15 | 490.00 | 0.0458 |
| 323.15 | 690.00 | 0.0639 |
| 323.15 | 790.00 | 0.0724 |
| 323.15 | 990.00 | 0.0901 |
| 323.15 | 1190.00 | 0.1076 |
| 323.15 | 1490.00 | 0.1324 |
| 323.15 | 1790.00 | 0.1560 |
| 323.15 | 1990.00 | 0.1716 |
Mole fraction of Carbon dioxide (2) [ref]
Operational condition: Solvent: Amount ratio of component to other component of binary solvent = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (2) - Liquid |
| 298.15 | 90.00 | 0.0124 |
| 298.15 | 190.00 | 0.0257 |
| 298.15 | 290.00 | 0.0389 |
| 298.15 | 390.00 | 0.0523 |
| 298.15 | 490.00 | 0.0653 |
| 298.15 | 690.00 | 0.0905 |
| 298.15 | 790.00 | 0.1027 |
| 298.15 | 990.00 | 0.1265 |
| 298.15 | 1190.00 | 0.1503 |
| 298.15 | 1490.00 | 0.1853 |
| 298.15 | 1790.00 | 0.2179 |
| 298.15 | 1990.00 | 0.2394 |
| 308.15 | 90.00 | 0.0101 |
| 308.15 | 190.00 | 0.0217 |
| 308.15 | 290.00 | 0.0335 |
| 308.15 | 390.00 | 0.0447 |
| 308.15 | 490.00 | 0.0558 |
| 308.15 | 690.00 | 0.0778 |
| 308.15 | 790.00 | 0.0886 |
| 308.15 | 990.00 | 0.1097 |
| 308.15 | 1190.00 | 0.1299 |
| 308.15 | 1490.00 | 0.1602 |
| 308.15 | 1790.00 | 0.1893 |
| 308.15 | 1990.00 | 0.2078 |
| 323.15 | 90.00 | 0.0086 |
| 323.15 | 190.00 | 0.0178 |
| 323.15 | 290.00 | 0.0271 |
| 323.15 | 390.00 | 0.0365 |
| 323.15 | 490.00 | 0.0458 |
| 323.15 | 690.00 | 0.0639 |
| 323.15 | 790.00 | 0.0724 |
| 323.15 | 990.00 | 0.0901 |
| 323.15 | 1190.00 | 0.1076 |
| 323.15 | 1490.00 | 0.1324 |
| 323.15 | 1790.00 | 0.1560 |
| 323.15 | 1990.00 | 0.1716 |