- Name
- Pentanoic acid, 4-oxo-
- InChI
- InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)
- InChI Key
- JOOXCMJARBKPKM-UHFFFAOYSA-N
- Formula
- C5H8O3
- SMILES
- CC(=O)CCC(=O)O
- Mol. Weight (g/mol)
- 116.12
- CAS
- 123-76-2
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Tetra-N-butylammonium bromide
- InChI
- InChI=1S/C16H36N.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- JRMUNVKIHCOMHV-UHFFFAOYSA-M
- Formula
- C16H36BrN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
- Mol. Weight (g/mol)
- 322.37
- CAS
- 1643-19-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Carbon dioxide (2) [ref]
Operational condition: Solvent: Mole fraction = 0.75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (2) - Gas | Molality, mol/kg of Carbon dioxide (2) - Liquid |
| 303.15 | 70.20 | 0.0334 |
| 303.15 | 122.90 | 0.0603 |
| 303.15 | 206.20 | 0.0986 |
| 303.15 | 301.70 | 0.1437 |
| 303.15 | 401.50 | 0.1914 |
| 303.15 | 500.40 | 0.2373 |
| 303.15 | 568.20 | 0.2694 |
| 313.15 | 82.60 | 0.0333 |
| 313.15 | 198.00 | 0.0797 |
| 313.15 | 290.60 | 0.1174 |
| 313.15 | 400.40 | 0.1621 |
| 313.15 | 499.90 | 0.2034 |
| 313.15 | 568.40 | 0.2307 |
| 323.15 | 101.10 | 0.0334 |
| 323.15 | 201.40 | 0.0628 |
| 323.15 | 306.90 | 0.0995 |
| 323.15 | 402.30 | 0.1326 |
| 323.15 | 502.90 | 0.1672 |
| 323.15 | 566.60 | 0.1890 |
| 333.15 | 85.30 | 0.0230 |
| 333.15 | 142.30 | 0.0392 |
| 333.15 | 230.70 | 0.0655 |
| 333.15 | 326.00 | 0.0929 |
| 333.15 | 423.20 | 0.1216 |
| 333.15 | 523.50 | 0.1518 |
| 333.15 | 586.40 | 0.1699 |
Molality, mol/kg of Carbon dioxide (2) [ref]
Operational condition: Solvent: Mole fraction = 0.75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (2) - Gas | Molality, mol/kg of Carbon dioxide (2) - Liquid |
| 303.15 | 70.20 | 0.0334 |
| 303.15 | 122.90 | 0.0603 |
| 303.15 | 206.20 | 0.0986 |
| 303.15 | 301.70 | 0.1437 |
| 303.15 | 401.50 | 0.1914 |
| 303.15 | 500.40 | 0.2373 |
| 303.15 | 568.20 | 0.2694 |
| 313.15 | 82.60 | 0.0333 |
| 313.15 | 198.00 | 0.0797 |
| 313.15 | 290.60 | 0.1174 |
| 313.15 | 400.40 | 0.1621 |
| 313.15 | 499.90 | 0.2034 |
| 313.15 | 568.40 | 0.2307 |
| 323.15 | 101.10 | 0.0334 |
| 323.15 | 201.40 | 0.0628 |
| 323.15 | 306.90 | 0.0995 |
| 323.15 | 402.30 | 0.1326 |
| 323.15 | 502.90 | 0.1672 |
| 323.15 | 566.60 | 0.1890 |
| 333.15 | 85.30 | 0.0230 |
| 333.15 | 142.30 | 0.0392 |
| 333.15 | 230.70 | 0.0655 |
| 333.15 | 326.00 | 0.0929 |
| 333.15 | 423.20 | 0.1216 |
| 333.15 | 523.50 | 0.1518 |
| 333.15 | 586.40 | 0.1699 |