- Name
- Dodecanoic acid
- InChI
- InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)
- InChI Key
- POULHZVOKOAJMA-UHFFFAOYSA-N
- Formula
- C12H24O2
- SMILES
- CCCCCCCCCCCC(=O)O
- Mol. Weight (g/mol)
- 200.32
- CAS
- 143-07-7
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Activity coefficient of Acetone (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Acetone (2) - Liquid |
|---|---|
| 314.10 | 1.592 |
| 314.24 | 1.59 |
| 333.26 | 1.45 |
| 333.38 | 1.466 |
| 353.25 | 1.335 |
| 353.30 | 1.365 |
Activity coefficient of Acetone (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Acetone (2) - Liquid |
|---|---|
| 314.10 | 1.592 |
| 314.24 | 1.59 |
| 333.26 | 1.45 |
| 333.38 | 1.466 |
| 353.25 | 1.335 |
| 353.30 | 1.365 |
Mole fraction of Dodecanoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Dodecanoic acid (1) - Liquid |
|---|---|
| 286.60 | 0.0794 |
| 290.10 | 0.1075 |
| 293.10 | 0.1457 |
| 293.30 | 0.1465 |
| 298.00 | 0.2242 |
| 299.90 | 0.2835 |
| 301.90 | 0.3395 |
| 303.40 | 0.3890 |
| 305.10 | 0.4489 |
| 306.70 | 0.5123 |
| 308.10 | 0.5679 |
| 309.10 | 0.6138 |
| 310.90 | 0.6780 |
| 312.00 | 0.7349 |
| 313.00 | 0.7950 |
| 314.40 | 0.8571 |
| 315.20 | 0.8955 |
Mole fraction of Dodecanoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Dodecanoic acid (1) - Liquid |
|---|---|
| 286.60 | 0.0794 |
| 290.10 | 0.1075 |
| 293.10 | 0.1457 |
| 293.30 | 0.1465 |
| 298.00 | 0.2242 |
| 299.90 | 0.2835 |
| 301.90 | 0.3395 |
| 303.40 | 0.3890 |
| 305.10 | 0.4489 |
| 306.70 | 0.5123 |
| 308.10 | 0.5679 |
| 309.10 | 0.6138 |
| 310.90 | 0.6780 |
| 312.00 | 0.7349 |
| 313.00 | 0.7950 |
| 314.40 | 0.8571 |
| 315.20 | 0.8955 |