- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Tetrahydropyran
- InChI
- InChI=1S/C5H10O/c1-2-4-6-5-3-1/h1-5H2
- InChI Key
- DHXVGJBLRPWPCS-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- C1CCOCC1
- Mol. Weight (g/mol)
- 86.13
- CAS
- 142-68-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- csound,fluid - Speed of Sound, m/s (2)
- Excess molar volume, m3/mol (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0804 | -0.0286 |
| 0.1402 | -0.0533 |
| 0.2416 | -0.0944 |
| 0.3002 | -0.1147 |
| 0.3842 | -0.1360 |
| 0.4706 | -0.1461 |
| 0.5776 | -0.1402 |
| 0.6454 | -0.1264 |
| 0.6914 | -0.1133 |
| 0.7432 | -0.0955 |
| 0.7919 | -0.0767 |
| 0.8476 | -0.0540 |
| 0.9021 | -0.0322 |
| 0.9415 | -0.0177 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0804 | -0.0286 |
| 0.1402 | -0.0533 |
| 0.2416 | -0.0944 |
| 0.3002 | -0.1147 |
| 0.3842 | -0.1360 |
| 0.4706 | -0.1461 |
| 0.5776 | -0.1402 |
| 0.6454 | -0.1264 |
| 0.6914 | -0.1133 |
| 0.7432 | -0.0955 |
| 0.7919 | -0.0767 |
| 0.8476 | -0.0540 |
| 0.9021 | -0.0322 |
| 0.9415 | -0.0177 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0784 | 1271.0 |
| 0.1521 | 1267.0 |
| 0.2123 | 1263.0 |
| 0.2876 | 1258.0 |
| 0.3342 | 1255.0 |
| 0.4091 | 1251.0 |
| 0.4953 | 1247.0 |
| 0.5186 | 1245.0 |
| 0.5684 | 1243.0 |
| 0.6175 | 1241.0 |
| 0.7077 | 1237.0 |
| 0.7909 | 1233.0 |
| 0.8666 | 1230.0 |
| 0.9354 | 1227.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0784 | 1271.0 |
| 0.1521 | 1267.0 |
| 0.2123 | 1263.0 |
| 0.2876 | 1258.0 |
| 0.3342 | 1255.0 |
| 0.4091 | 1251.0 |
| 0.4953 | 1247.0 |
| 0.5186 | 1245.0 |
| 0.5684 | 1243.0 |
| 0.6175 | 1241.0 |
| 0.7077 | 1237.0 |
| 0.7909 | 1233.0 |
| 0.8666 | 1230.0 |
| 0.9354 | 1227.0 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0639 | -2.2000e-08 |
| 0.1503 | -4.3000e-08 |
| 0.2321 | -5.5000e-08 |
| 0.2835 | -5.9000e-08 |
| 0.3331 | -6.1000e-08 |
| 0.3832 | -6.1000e-08 |
| 0.4421 | -6.0000e-08 |
| 0.5127 | -5.7000e-08 |
| 0.5515 | -5.4000e-08 |
| 0.6027 | -4.9000e-08 |
| 0.6529 | -4.4000e-08 |
| 0.7211 | -3.6000e-08 |
| 0.7905 | -2.7000e-08 |
| 0.8673 | -1.7000e-08 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0639 | -2.2000e-08 |
| 0.1503 | -4.3000e-08 |
| 0.2321 | -5.5000e-08 |
| 0.2835 | -5.9000e-08 |
| 0.3331 | -6.1000e-08 |
| 0.3832 | -6.1000e-08 |
| 0.4421 | -6.0000e-08 |
| 0.5127 | -5.7000e-08 |
| 0.5515 | -5.4000e-08 |
| 0.6027 | -4.9000e-08 |
| 0.6529 | -4.4000e-08 |
| 0.7211 | -3.6000e-08 |
| 0.7905 | -2.7000e-08 |
| 0.8673 | -1.7000e-08 |