- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
- Name
- Methyl Alcohol
- InChI
- InChI=1S/CH4O/c1-2/h2H,1H3
- InChI Key
- OKKJLVBELUTLKV-UHFFFAOYSA-N
- Formula
- CH4O
- SMILES
- CO
- Mol. Weight (g/mol)
- 32.04
- CAS
- 67-56-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Carbon dioxide (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Solvent: Amount ratio of component to other component of binary solvent of Acetone (2) - Liquid | Mole fraction of Carbon dioxide (1) - Liquid |
| 258.30 | 525.00 | 0.0613 | 0.0897 |
| 258.30 | 795.00 | 0.0613 | 0.1470 |
| 258.30 | 925.00 | 0.0613 | 0.1801 |
| 258.30 | 1327.00 | 0.0613 | 0.3070 |
| 258.30 | 1811.00 | 0.0613 | 0.5223 |
| 273.00 | 509.00 | 0.0613 | 0.0568 |
| 273.00 | 882.00 | 0.0613 | 0.1118 |
| 273.00 | 1224.00 | 0.0613 | 0.1803 |
| 273.00 | 1782.00 | 0.0613 | 0.2698 |
| 273.00 | 2215.00 | 0.0613 | 0.3832 |
| 273.00 | 2627.00 | 0.0613 | 0.5034 |
| 288.10 | 555.00 | 0.0613 | 0.0442 |
| 288.10 | 1016.00 | 0.0613 | 0.0905 |
| 288.10 | 1637.00 | 0.0613 | 0.1649 |
| 288.10 | 2065.00 | 0.0613 | 0.2085 |
| 288.10 | 2583.00 | 0.0613 | 0.2781 |
| 288.10 | 3205.00 | 0.0613 | 0.3822 |
| 288.10 | 3749.00 | 0.0613 | 0.5068 |
| 298.20 | 534.00 | 0.0613 | 0.0343 |
| 298.20 | 1046.00 | 0.0613 | 0.0718 |
| 298.20 | 1535.00 | 0.0613 | 0.1160 |
| 298.20 | 2034.00 | 0.0613 | 0.1593 |
| 298.20 | 2600.00 | 0.0613 | 0.2135 |
| 298.20 | 3416.00 | 0.0613 | 0.3101 |
| 298.20 | 4101.00 | 0.0613 | 0.4154 |
| 298.20 | 4578.00 | 0.0613 | 0.4979 |
| 258.30 | 555.00 | 0.2364 | 0.1264 |
| 258.30 | 886.00 | 0.2364 | 0.2111 |
| 258.30 | 1290.00 | 0.2364 | 0.3642 |
| 258.30 | 1548.00 | 0.2364 | 0.5048 |
| 258.30 | 1807.00 | 0.2364 | 0.6301 |
| 272.90 | 551.00 | 0.2364 | 0.0782 |
| 272.90 | 938.00 | 0.2364 | 0.1533 |
| 272.90 | 1370.00 | 0.2364 | 0.2405 |
| 272.90 | 1830.00 | 0.2364 | 0.3639 |
| 272.90 | 2418.00 | 0.2364 | 0.5290 |
| 288.10 | 533.00 | 0.2364 | 0.0523 |
| 288.10 | 1005.00 | 0.2364 | 0.1110 |
| 288.10 | 1659.00 | 0.2364 | 0.2036 |
| 288.10 | 2304.00 | 0.2364 | 0.3112 |
| 288.10 | 2872.00 | 0.2364 | 0.4138 |
| 288.10 | 3498.00 | 0.2364 | 0.5607 |
| 288.10 | 3913.00 | 0.2364 | 0.6637 |
| 298.20 | 517.00 | 0.2364 | 0.0409 |
| 298.20 | 1135.00 | 0.2364 | 0.1067 |
| 298.20 | 1734.00 | 0.2364 | 0.1671 |
| 298.20 | 2333.00 | 0.2364 | 0.2381 |
| 298.20 | 2925.00 | 0.2364 | 0.3197 |
| 298.20 | 3574.00 | 0.2364 | 0.4046 |
| 298.20 | 4118.00 | 0.2364 | 0.5221 |
Mole fraction of Carbon dioxide (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Solvent: Amount ratio of component to other component of binary solvent of Acetone (2) - Liquid | Mole fraction of Carbon dioxide (1) - Liquid |
| 258.30 | 525.00 | 0.0613 | 0.0897 |
| 258.30 | 795.00 | 0.0613 | 0.1470 |
| 258.30 | 925.00 | 0.0613 | 0.1801 |
| 258.30 | 1327.00 | 0.0613 | 0.3070 |
| 258.30 | 1811.00 | 0.0613 | 0.5223 |
| 273.00 | 509.00 | 0.0613 | 0.0568 |
| 273.00 | 882.00 | 0.0613 | 0.1118 |
| 273.00 | 1224.00 | 0.0613 | 0.1803 |
| 273.00 | 1782.00 | 0.0613 | 0.2698 |
| 273.00 | 2215.00 | 0.0613 | 0.3832 |
| 273.00 | 2627.00 | 0.0613 | 0.5034 |
| 288.10 | 555.00 | 0.0613 | 0.0442 |
| 288.10 | 1016.00 | 0.0613 | 0.0905 |
| 288.10 | 1637.00 | 0.0613 | 0.1649 |
| 288.10 | 2065.00 | 0.0613 | 0.2085 |
| 288.10 | 2583.00 | 0.0613 | 0.2781 |
| 288.10 | 3205.00 | 0.0613 | 0.3822 |
| 288.10 | 3749.00 | 0.0613 | 0.5068 |
| 298.20 | 534.00 | 0.0613 | 0.0343 |
| 298.20 | 1046.00 | 0.0613 | 0.0718 |
| 298.20 | 1535.00 | 0.0613 | 0.1160 |
| 298.20 | 2034.00 | 0.0613 | 0.1593 |
| 298.20 | 2600.00 | 0.0613 | 0.2135 |
| 298.20 | 3416.00 | 0.0613 | 0.3101 |
| 298.20 | 4101.00 | 0.0613 | 0.4154 |
| 298.20 | 4578.00 | 0.0613 | 0.4979 |
| 258.30 | 555.00 | 0.2364 | 0.1264 |
| 258.30 | 886.00 | 0.2364 | 0.2111 |
| 258.30 | 1290.00 | 0.2364 | 0.3642 |
| 258.30 | 1548.00 | 0.2364 | 0.5048 |
| 258.30 | 1807.00 | 0.2364 | 0.6301 |
| 272.90 | 551.00 | 0.2364 | 0.0782 |
| 272.90 | 938.00 | 0.2364 | 0.1533 |
| 272.90 | 1370.00 | 0.2364 | 0.2405 |
| 272.90 | 1830.00 | 0.2364 | 0.3639 |
| 272.90 | 2418.00 | 0.2364 | 0.5290 |
| 288.10 | 533.00 | 0.2364 | 0.0523 |
| 288.10 | 1005.00 | 0.2364 | 0.1110 |
| 288.10 | 1659.00 | 0.2364 | 0.2036 |
| 288.10 | 2304.00 | 0.2364 | 0.3112 |
| 288.10 | 2872.00 | 0.2364 | 0.4138 |
| 288.10 | 3498.00 | 0.2364 | 0.5607 |
| 288.10 | 3913.00 | 0.2364 | 0.6637 |
| 298.20 | 517.00 | 0.2364 | 0.0409 |
| 298.20 | 1135.00 | 0.2364 | 0.1067 |
| 298.20 | 1734.00 | 0.2364 | 0.1671 |
| 298.20 | 2333.00 | 0.2364 | 0.2381 |
| 298.20 | 2925.00 | 0.2364 | 0.3197 |
| 298.20 | 3574.00 | 0.2364 | 0.4046 |
| 298.20 | 4118.00 | 0.2364 | 0.5221 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Gas | Mole fraction of Carbon dioxide (1) - Liquid | Solvent: Amount ratio of component to other component of binary solvent of Acetone (2) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 258.30 | 0.0399 | 0.0613 | 209.00 |
| 258.30 | 0.0795 | 0.0613 | 418.00 |
| 258.30 | 0.1147 | 0.0613 | 595.00 |
| 258.30 | 0.1559 | 0.0613 | 796.00 |
| 258.30 | 0.1836 | 0.0613 | 953.00 |
| 273.00 | 0.0306 | 0.0613 | 218.00 |
| 273.00 | 0.0559 | 0.0613 | 421.00 |
| 273.00 | 0.0833 | 0.0613 | 631.00 |
| 273.00 | 0.1133 | 0.0613 | 856.00 |
| 273.00 | 0.1398 | 0.0613 | 1049.00 |
| 288.20 | 0.0242 | 0.0613 | 212.00 |
| 288.20 | 0.0419 | 0.0613 | 422.00 |
| 288.20 | 0.0621 | 0.0613 | 651.00 |
| 288.20 | 0.0796 | 0.0613 | 837.00 |
| 288.20 | 0.0997 | 0.0613 | 1047.00 |
| 298.30 | 0.0202 | 0.0613 | 219.00 |
| 298.30 | 0.0377 | 0.0613 | 477.00 |
| 298.30 | 0.0551 | 0.0613 | 714.00 |
| 298.30 | 0.0693 | 0.0613 | 897.00 |
| 298.30 | 0.0946 | 0.0613 | 1221.00 |
| 258.30 | 0.0455 | 0.2364 | 206.00 |
| 258.30 | 0.0906 | 0.2364 | 407.00 |
| 258.30 | 0.1356 | 0.2364 | 602.00 |
| 258.30 | 0.1803 | 0.2364 | 783.00 |
| 258.30 | 0.2175 | 0.2364 | 927.00 |
| 273.00 | 0.0365 | 0.2364 | 223.00 |
| 273.00 | 0.0663 | 0.2364 | 421.00 |
| 273.00 | 0.0974 | 0.2364 | 620.00 |
| 273.00 | 0.1313 | 0.2364 | 834.00 |
| 273.00 | 0.1597 | 0.2364 | 1004.00 |
| 288.20 | 0.0353 | 0.2364 | 270.00 |
| 288.20 | 0.0557 | 0.2364 | 469.00 |
| 288.20 | 0.0711 | 0.2364 | 611.00 |
| 288.20 | 0.1026 | 0.2364 | 886.00 |
| 288.20 | 0.1259 | 0.2364 | 1086.00 |
| 298.30 | 0.0235 | 0.2364 | 213.00 |
| 298.30 | 0.0434 | 0.2364 | 461.00 |
| 298.30 | 0.0581 | 0.2364 | 628.00 |
| 298.30 | 0.0751 | 0.2364 | 815.00 |
| 298.30 | 0.0966 | 0.2364 | 1046.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Gas | Mole fraction of Carbon dioxide (1) - Liquid | Solvent: Amount ratio of component to other component of binary solvent of Acetone (2) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 258.30 | 0.0399 | 0.0613 | 209.00 |
| 258.30 | 0.0795 | 0.0613 | 418.00 |
| 258.30 | 0.1147 | 0.0613 | 595.00 |
| 258.30 | 0.1559 | 0.0613 | 796.00 |
| 258.30 | 0.1836 | 0.0613 | 953.00 |
| 273.00 | 0.0306 | 0.0613 | 218.00 |
| 273.00 | 0.0559 | 0.0613 | 421.00 |
| 273.00 | 0.0833 | 0.0613 | 631.00 |
| 273.00 | 0.1133 | 0.0613 | 856.00 |
| 273.00 | 0.1398 | 0.0613 | 1049.00 |
| 288.20 | 0.0242 | 0.0613 | 212.00 |
| 288.20 | 0.0419 | 0.0613 | 422.00 |
| 288.20 | 0.0621 | 0.0613 | 651.00 |
| 288.20 | 0.0796 | 0.0613 | 837.00 |
| 288.20 | 0.0997 | 0.0613 | 1047.00 |
| 298.30 | 0.0202 | 0.0613 | 219.00 |
| 298.30 | 0.0377 | 0.0613 | 477.00 |
| 298.30 | 0.0551 | 0.0613 | 714.00 |
| 298.30 | 0.0693 | 0.0613 | 897.00 |
| 298.30 | 0.0946 | 0.0613 | 1221.00 |
| 258.30 | 0.0455 | 0.2364 | 206.00 |
| 258.30 | 0.0906 | 0.2364 | 407.00 |
| 258.30 | 0.1356 | 0.2364 | 602.00 |
| 258.30 | 0.1803 | 0.2364 | 783.00 |
| 258.30 | 0.2175 | 0.2364 | 927.00 |
| 273.00 | 0.0365 | 0.2364 | 223.00 |
| 273.00 | 0.0663 | 0.2364 | 421.00 |
| 273.00 | 0.0974 | 0.2364 | 620.00 |
| 273.00 | 0.1313 | 0.2364 | 834.00 |
| 273.00 | 0.1597 | 0.2364 | 1004.00 |
| 288.20 | 0.0353 | 0.2364 | 270.00 |
| 288.20 | 0.0557 | 0.2364 | 469.00 |
| 288.20 | 0.0711 | 0.2364 | 611.00 |
| 288.20 | 0.1026 | 0.2364 | 886.00 |
| 288.20 | 0.1259 | 0.2364 | 1086.00 |
| 298.30 | 0.0235 | 0.2364 | 213.00 |
| 298.30 | 0.0434 | 0.2364 | 461.00 |
| 298.30 | 0.0581 | 0.2364 | 628.00 |
| 298.30 | 0.0751 | 0.2364 | 815.00 |
| 298.30 | 0.0966 | 0.2364 | 1046.00 |