- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Carbon dioxide (1) [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid |
|---|---|
| 308.20 | 0.9100 |
| 318.20 | 0.9020 |
| 328.20 | 0.8840 |
| 338.20 | 0.8760 |
| 348.20 | 0.8680 |
Mole fraction of Carbon dioxide (1) [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid |
|---|---|
| 308.20 | 0.9100 |
| 318.20 | 0.9020 |
| 328.20 | 0.8840 |
| 338.20 | 0.8760 |
| 348.20 | 0.8680 |
Critical pressure, kPa [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Temperature, K - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 308.20 | 17990.00 |
| 318.20 | 18220.00 |
| 328.20 | 19400.00 |
| 338.20 | 21150.00 |
| 348.20 | 22890.00 |
Critical pressure, kPa [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Temperature, K - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 308.20 | 17990.00 |
| 318.20 | 18220.00 |
| 328.20 | 19400.00 |
| 338.20 | 21150.00 |
| 348.20 | 22890.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Gas | Vapor or sublimation pressure, kPa - Gas |
| 308.20 | 0.9170 | 17900.00 |
| 308.20 | 0.9500 | 15150.00 |
| 308.20 | 0.9800 | 8560.00 |
| 318.20 | 0.9170 | 17980.00 |
| 318.20 | 0.9500 | 15320.00 |
| 318.20 | 0.9800 | 10350.00 |
| 328.20 | 0.8890 | 19380.00 |
| 328.20 | 0.9170 | 18730.00 |
| 328.20 | 0.9500 | 16150.00 |
| 328.20 | 0.9800 | 12270.00 |
| 338.20 | 0.8890 | 21050.00 |
| 338.20 | 0.9170 | 20050.00 |
| 338.20 | 0.9500 | 17410.00 |
| 338.20 | 0.9800 | 13730.00 |
| 348.20 | 0.8890 | 22670.00 |
| 348.20 | 0.9170 | 21630.00 |
| 348.20 | 0.9500 | 18650.00 |
| 348.20 | 0.9800 | 14850.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 308.20 | 0.1990 | 2860.00 |
| 308.20 | 0.2990 | 4310.00 |
| 308.20 | 0.4040 | 5490.00 |
| 308.20 | 0.4980 | 6440.00 |
| 308.20 | 0.5970 | 7170.00 |
| 308.20 | 0.6970 | 8060.00 |
| 308.20 | 0.7480 | 9970.00 |
| 308.20 | 0.7980 | 11540.00 |
| 308.20 | 0.8290 | 13380.00 |
| 308.20 | 0.8600 | 15420.00 |
| 308.20 | 0.8890 | 17460.00 |
| 318.20 | 0.1990 | 3440.00 |
| 318.20 | 0.2990 | 4930.00 |
| 318.20 | 0.4040 | 6410.00 |
| 318.20 | 0.4980 | 7930.00 |
| 318.20 | 0.5970 | 9200.00 |
| 318.20 | 0.6970 | 11350.00 |
| 318.20 | 0.7480 | 13110.00 |
| 318.20 | 0.7980 | 14640.00 |
| 318.20 | 0.8290 | 15850.00 |
| 318.20 | 0.8600 | 17100.00 |
| 318.20 | 0.8890 | 18100.00 |
| 328.20 | 0.1990 | 3900.00 |
| 328.20 | 0.2990 | 5880.00 |
| 328.20 | 0.4040 | 7650.00 |
| 328.20 | 0.4980 | 9880.00 |
| 328.20 | 0.5970 | 11740.00 |
| 328.20 | 0.6970 | 14650.00 |
| 328.20 | 0.7480 | 16250.00 |
| 328.20 | 0.7980 | 17360.00 |
| 328.20 | 0.8290 | 18180.00 |
| 328.20 | 0.8600 | 19120.00 |
| 338.20 | 0.1990 | 4580.00 |
| 338.20 | 0.2990 | 6800.00 |
| 338.20 | 0.4040 | 8880.00 |
| 338.20 | 0.4980 | 11150.00 |
| 338.20 | 0.5970 | 14340.00 |
| 338.20 | 0.6970 | 17560.00 |
| 338.20 | 0.7480 | 18830.00 |
| 338.20 | 0.7980 | 19920.00 |
| 338.20 | 0.8290 | 20410.00 |
| 338.20 | 0.8600 | 21030.00 |
| 348.20 | 0.1990 | 5180.00 |
| 348.20 | 0.2990 | 7750.00 |
| 348.20 | 0.4040 | 10360.00 |
| 348.20 | 0.4980 | 13160.00 |
| 348.20 | 0.5970 | 16740.00 |
| 348.20 | 0.6970 | 20060.00 |
| 348.20 | 0.7480 | 21070.00 |
| 348.20 | 0.7980 | 21970.00 |
| 348.20 | 0.8290 | 22460.00 |
| 348.20 | 0.8600 | 22870.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Gas | Vapor or sublimation pressure, kPa - Gas |
| 308.20 | 0.9170 | 17900.00 |
| 308.20 | 0.9500 | 15150.00 |
| 308.20 | 0.9800 | 8560.00 |
| 318.20 | 0.9170 | 17980.00 |
| 318.20 | 0.9500 | 15320.00 |
| 318.20 | 0.9800 | 10350.00 |
| 328.20 | 0.8890 | 19380.00 |
| 328.20 | 0.9170 | 18730.00 |
| 328.20 | 0.9500 | 16150.00 |
| 328.20 | 0.9800 | 12270.00 |
| 338.20 | 0.8890 | 21050.00 |
| 338.20 | 0.9170 | 20050.00 |
| 338.20 | 0.9500 | 17410.00 |
| 338.20 | 0.9800 | 13730.00 |
| 348.20 | 0.8890 | 22670.00 |
| 348.20 | 0.9170 | 21630.00 |
| 348.20 | 0.9500 | 18650.00 |
| 348.20 | 0.9800 | 14850.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Solvent: Mole fraction = 0.9 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 308.20 | 0.1990 | 2860.00 |
| 308.20 | 0.2990 | 4310.00 |
| 308.20 | 0.4040 | 5490.00 |
| 308.20 | 0.4980 | 6440.00 |
| 308.20 | 0.5970 | 7170.00 |
| 308.20 | 0.6970 | 8060.00 |
| 308.20 | 0.7480 | 9970.00 |
| 308.20 | 0.7980 | 11540.00 |
| 308.20 | 0.8290 | 13380.00 |
| 308.20 | 0.8600 | 15420.00 |
| 308.20 | 0.8890 | 17460.00 |
| 318.20 | 0.1990 | 3440.00 |
| 318.20 | 0.2990 | 4930.00 |
| 318.20 | 0.4040 | 6410.00 |
| 318.20 | 0.4980 | 7930.00 |
| 318.20 | 0.5970 | 9200.00 |
| 318.20 | 0.6970 | 11350.00 |
| 318.20 | 0.7480 | 13110.00 |
| 318.20 | 0.7980 | 14640.00 |
| 318.20 | 0.8290 | 15850.00 |
| 318.20 | 0.8600 | 17100.00 |
| 318.20 | 0.8890 | 18100.00 |
| 328.20 | 0.1990 | 3900.00 |
| 328.20 | 0.2990 | 5880.00 |
| 328.20 | 0.4040 | 7650.00 |
| 328.20 | 0.4980 | 9880.00 |
| 328.20 | 0.5970 | 11740.00 |
| 328.20 | 0.6970 | 14650.00 |
| 328.20 | 0.7480 | 16250.00 |
| 328.20 | 0.7980 | 17360.00 |
| 328.20 | 0.8290 | 18180.00 |
| 328.20 | 0.8600 | 19120.00 |
| 338.20 | 0.1990 | 4580.00 |
| 338.20 | 0.2990 | 6800.00 |
| 338.20 | 0.4040 | 8880.00 |
| 338.20 | 0.4980 | 11150.00 |
| 338.20 | 0.5970 | 14340.00 |
| 338.20 | 0.6970 | 17560.00 |
| 338.20 | 0.7480 | 18830.00 |
| 338.20 | 0.7980 | 19920.00 |
| 338.20 | 0.8290 | 20410.00 |
| 338.20 | 0.8600 | 21030.00 |
| 348.20 | 0.1990 | 5180.00 |
| 348.20 | 0.2990 | 7750.00 |
| 348.20 | 0.4040 | 10360.00 |
| 348.20 | 0.4980 | 13160.00 |
| 348.20 | 0.5970 | 16740.00 |
| 348.20 | 0.6970 | 20060.00 |
| 348.20 | 0.7480 | 21070.00 |
| 348.20 | 0.7980 | 21970.00 |
| 348.20 | 0.8290 | 22460.00 |
| 348.20 | 0.8600 | 22870.00 |