- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 313.15 | 0.0140 | 197.00 |
| 313.15 | 0.0330 | 467.00 |
| 313.15 | 0.0480 | 666.00 |
| 313.15 | 0.0750 | 1039.00 |
| 313.15 | 0.1070 | 1469.00 |
| 313.15 | 0.1690 | 2271.00 |
| 333.15 | 0.0120 | 216.00 |
| 333.15 | 0.0280 | 510.00 |
| 333.15 | 0.0400 | 730.00 |
| 333.15 | 0.0630 | 1140.00 |
| 333.15 | 0.0890 | 1611.00 |
| 333.15 | 0.1400 | 2506.00 |
| 353.15 | 0.0100 | 232.00 |
| 353.15 | 0.0240 | 550.00 |
| 353.15 | 0.0340 | 787.00 |
| 353.15 | 0.0540 | 1235.00 |
| 353.15 | 0.0760 | 1741.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 313.15 | 0.0140 | 197.00 |
| 313.15 | 0.0330 | 467.00 |
| 313.15 | 0.0480 | 666.00 |
| 313.15 | 0.0750 | 1039.00 |
| 313.15 | 0.1070 | 1469.00 |
| 313.15 | 0.1690 | 2271.00 |
| 333.15 | 0.0120 | 216.00 |
| 333.15 | 0.0280 | 510.00 |
| 333.15 | 0.0400 | 730.00 |
| 333.15 | 0.0630 | 1140.00 |
| 333.15 | 0.0890 | 1611.00 |
| 333.15 | 0.1400 | 2506.00 |
| 353.15 | 0.0100 | 232.00 |
| 353.15 | 0.0240 | 550.00 |
| 353.15 | 0.0340 | 787.00 |
| 353.15 | 0.0540 | 1235.00 |
| 353.15 | 0.0760 | 1741.00 |