- Name
- Benzene, 1-chloro-4-ethenyl-
- InChI
- InChI=1S/C8H7Cl/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2
- InChI Key
- KTZVZZJJVJQZHV-UHFFFAOYSA-N
- Formula
- C8H7Cl
- SMILES
- C=Cc1ccc(Cl)cc1
- Mol. Weight (g/mol)
- 138.59
- CAS
- 1073-67-2
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1-chloro-4-ethenyl- (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 313.20 | 0.0600 | 9860.00 |
| 313.20 | 0.0840 | 9720.00 |
| 313.20 | 0.1090 | 9690.00 |
| 313.20 | 0.1370 | 9670.00 |
| 313.20 | 0.1680 | 9640.00 |
| 313.20 | 0.2110 | 9330.00 |
| 313.20 | 0.2660 | 9180.00 |
| 313.20 | 0.3930 | 8560.00 |
| 313.20 | 0.4900 | 7970.00 |
| 313.20 | 0.5590 | 7460.00 |
| 333.20 | 0.0600 | 14000.00 |
| 333.20 | 0.0840 | 13940.00 |
| 333.20 | 0.1090 | 13940.00 |
| 333.20 | 0.1370 | 13830.00 |
| 333.20 | 0.1680 | 13660.00 |
| 333.20 | 0.2110 | 13290.00 |
| 333.20 | 0.2660 | 12820.00 |
| 333.20 | 0.3930 | 11420.00 |
| 333.20 | 0.4900 | 10100.00 |
| 333.20 | 0.5590 | 9130.00 |
| 353.20 | 0.0600 | 17000.00 |
| 353.20 | 0.0840 | 17760.00 |
| 353.20 | 0.1090 | 17650.00 |
| 353.20 | 0.1370 | 17480.00 |
| 353.20 | 0.1680 | 17480.00 |
| 353.20 | 0.2110 | 17070.00 |
| 353.20 | 0.2660 | 16230.00 |
| 353.20 | 0.3930 | 14040.00 |
| 353.20 | 0.4900 | 12000.00 |
| 353.20 | 0.5590 | 10720.00 |
| 373.20 | 0.0600 | 19900.00 |
| 373.20 | 0.0840 | 20970.00 |
| 373.20 | 0.1090 | 20820.00 |
| 373.20 | 0.1370 | 20720.00 |
| 373.20 | 0.1680 | 20310.00 |
| 373.20 | 0.2110 | 19900.00 |
| 373.20 | 0.2660 | 18930.00 |
| 373.20 | 0.3930 | 16300.00 |
| 373.20 | 0.4900 | 13830.00 |
| 373.20 | 0.5590 | 12320.00 |
| 393.20 | 0.0600 | 21830.00 |
| 393.20 | 0.0840 | 23620.00 |
| 393.20 | 0.1090 | 23740.00 |
| 393.20 | 0.1370 | 23730.00 |
| 393.20 | 0.1680 | 22990.00 |
| 393.20 | 0.2110 | 22100.00 |
| 393.20 | 0.2660 | 21070.00 |
| 393.20 | 0.3930 | 18290.00 |
| 393.20 | 0.4900 | 15690.00 |
| 393.20 | 0.5590 | 13830.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1-chloro-4-ethenyl- (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 313.20 | 0.0600 | 9860.00 |
| 313.20 | 0.0840 | 9720.00 |
| 313.20 | 0.1090 | 9690.00 |
| 313.20 | 0.1370 | 9670.00 |
| 313.20 | 0.1680 | 9640.00 |
| 313.20 | 0.2110 | 9330.00 |
| 313.20 | 0.2660 | 9180.00 |
| 313.20 | 0.3930 | 8560.00 |
| 313.20 | 0.4900 | 7970.00 |
| 313.20 | 0.5590 | 7460.00 |
| 333.20 | 0.0600 | 14000.00 |
| 333.20 | 0.0840 | 13940.00 |
| 333.20 | 0.1090 | 13940.00 |
| 333.20 | 0.1370 | 13830.00 |
| 333.20 | 0.1680 | 13660.00 |
| 333.20 | 0.2110 | 13290.00 |
| 333.20 | 0.2660 | 12820.00 |
| 333.20 | 0.3930 | 11420.00 |
| 333.20 | 0.4900 | 10100.00 |
| 333.20 | 0.5590 | 9130.00 |
| 353.20 | 0.0600 | 17000.00 |
| 353.20 | 0.0840 | 17760.00 |
| 353.20 | 0.1090 | 17650.00 |
| 353.20 | 0.1370 | 17480.00 |
| 353.20 | 0.1680 | 17480.00 |
| 353.20 | 0.2110 | 17070.00 |
| 353.20 | 0.2660 | 16230.00 |
| 353.20 | 0.3930 | 14040.00 |
| 353.20 | 0.4900 | 12000.00 |
| 353.20 | 0.5590 | 10720.00 |
| 373.20 | 0.0600 | 19900.00 |
| 373.20 | 0.0840 | 20970.00 |
| 373.20 | 0.1090 | 20820.00 |
| 373.20 | 0.1370 | 20720.00 |
| 373.20 | 0.1680 | 20310.00 |
| 373.20 | 0.2110 | 19900.00 |
| 373.20 | 0.2660 | 18930.00 |
| 373.20 | 0.3930 | 16300.00 |
| 373.20 | 0.4900 | 13830.00 |
| 373.20 | 0.5590 | 12320.00 |
| 393.20 | 0.0600 | 21830.00 |
| 393.20 | 0.0840 | 23620.00 |
| 393.20 | 0.1090 | 23740.00 |
| 393.20 | 0.1370 | 23730.00 |
| 393.20 | 0.1680 | 22990.00 |
| 393.20 | 0.2110 | 22100.00 |
| 393.20 | 0.2660 | 21070.00 |
| 393.20 | 0.3930 | 18290.00 |
| 393.20 | 0.4900 | 15690.00 |
| 393.20 | 0.5590 | 13830.00 |