- Name
- 2-Propenoic acid, 2-methyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester
- InChI
- InChI=1S/C14H22O6/c1-11(2)13(15)19-9-7-17-5-6-18-8-10-20-14(16)12(3)4/h1,3,5-10H2,2,4H3
- InChI Key
- HWSSEYVMGDIFMH-UHFFFAOYSA-N
- Formula
- C14H22O6
- SMILES
-
C=C(C)C(=O)OCCOCCOCCOC(=O)C(=C
)C - Mol. Weight (g/mol)
- 286.32
- CAS
- 109-16-0
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Mole fraction of Carbon dioxide (2) - Fluid (supercritical or subcritical phases) | Vapor or sublimation pressure, kPa - Fluid (supercritical or subcritical phases) |
| 313.20 | 0.5630 | 4150.00 |
| 313.20 | 0.6010 | 4740.00 |
| 313.20 | 0.6670 | 5500.00 |
| 313.20 | 0.6960 | 5920.00 |
| 313.20 | 0.7760 | 7080.00 |
| 313.20 | 0.7970 | 7510.00 |
| 313.20 | 0.8390 | 7950.00 |
| 313.20 | 0.8960 | 9050.00 |
| 313.20 | 0.9370 | 10150.00 |
| 313.20 | 0.9530 | 10410.00 |
| 323.20 | 0.5630 | 4900.00 |
| 323.20 | 0.6010 | 5500.00 |
| 323.20 | 0.6670 | 6510.00 |
| 323.20 | 0.6960 | 7010.00 |
| 323.20 | 0.7370 | 7960.00 |
| 323.20 | 0.7760 | 8570.00 |
| 323.20 | 0.7970 | 9160.00 |
| 323.20 | 0.8390 | 9910.00 |
| 323.20 | 0.8960 | 11950.00 |
| 323.20 | 0.9370 | 13680.00 |
| 323.20 | 0.9530 | 13570.00 |
| 333.20 | 0.5630 | 5610.00 |
| 333.20 | 0.6010 | 6350.00 |
| 333.20 | 0.6670 | 7570.00 |
| 333.20 | 0.6960 | 8230.00 |
| 333.20 | 0.7370 | 9700.00 |
| 333.20 | 0.7760 | 10210.00 |
| 333.20 | 0.7970 | 11040.00 |
| 333.20 | 0.8390 | 12180.00 |
| 333.20 | 0.8960 | 14880.00 |
| 333.20 | 0.9370 | 16290.00 |
| 333.20 | 0.9530 | 16460.00 |
| 343.20 | 0.5630 | 6510.00 |
| 343.20 | 0.6010 | 7140.00 |
| 343.20 | 0.6670 | 8670.00 |
| 343.20 | 0.6960 | 9500.00 |
| 343.20 | 0.7370 | 11170.00 |
| 343.20 | 0.7760 | 11950.00 |
| 343.20 | 0.7970 | 12950.00 |
| 343.20 | 0.8390 | 14520.00 |
| 343.20 | 0.8960 | 17560.00 |
| 343.20 | 0.9370 | 18910.00 |
| 343.20 | 0.9530 | 19140.00 |
| 353.20 | 0.5630 | 7290.00 |
| 353.20 | 0.6010 | 7890.00 |
| 353.20 | 0.6670 | 9800.00 |
| 353.20 | 0.6960 | 10870.00 |
| 353.20 | 0.7370 | 12680.00 |
| 353.20 | 0.7760 | 13730.00 |
| 353.20 | 0.7970 | 14920.00 |
| 353.20 | 0.8390 | 17030.00 |
| 353.20 | 0.8960 | 20240.00 |
| 353.20 | 0.9370 | 21060.00 |
| 353.20 | 0.9530 | 21220.00 |
| 363.20 | 0.5630 | 8080.00 |
| 363.20 | 0.6010 | 8750.00 |
| 363.20 | 0.6670 | 10970.00 |
| 363.20 | 0.6960 | 12280.00 |
| 363.20 | 0.7370 | 14390.00 |
| 363.20 | 0.7760 | 15560.00 |
| 363.20 | 0.7970 | 16870.00 |
| 363.20 | 0.8390 | 19260.00 |
| 363.20 | 0.8960 | 22040.00 |
| 363.20 | 0.9370 | 23170.00 |
| 363.20 | 0.9530 | 23300.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Mole fraction of Carbon dioxide (2) - Fluid (supercritical or subcritical phases) | Vapor or sublimation pressure, kPa - Fluid (supercritical or subcritical phases) |
| 313.20 | 0.5630 | 4150.00 |
| 313.20 | 0.6010 | 4740.00 |
| 313.20 | 0.6670 | 5500.00 |
| 313.20 | 0.6960 | 5920.00 |
| 313.20 | 0.7760 | 7080.00 |
| 313.20 | 0.7970 | 7510.00 |
| 313.20 | 0.8390 | 7950.00 |
| 313.20 | 0.8960 | 9050.00 |
| 313.20 | 0.9370 | 10150.00 |
| 313.20 | 0.9530 | 10410.00 |
| 323.20 | 0.5630 | 4900.00 |
| 323.20 | 0.6010 | 5500.00 |
| 323.20 | 0.6670 | 6510.00 |
| 323.20 | 0.6960 | 7010.00 |
| 323.20 | 0.7370 | 7960.00 |
| 323.20 | 0.7760 | 8570.00 |
| 323.20 | 0.7970 | 9160.00 |
| 323.20 | 0.8390 | 9910.00 |
| 323.20 | 0.8960 | 11950.00 |
| 323.20 | 0.9370 | 13680.00 |
| 323.20 | 0.9530 | 13570.00 |
| 333.20 | 0.5630 | 5610.00 |
| 333.20 | 0.6010 | 6350.00 |
| 333.20 | 0.6670 | 7570.00 |
| 333.20 | 0.6960 | 8230.00 |
| 333.20 | 0.7370 | 9700.00 |
| 333.20 | 0.7760 | 10210.00 |
| 333.20 | 0.7970 | 11040.00 |
| 333.20 | 0.8390 | 12180.00 |
| 333.20 | 0.8960 | 14880.00 |
| 333.20 | 0.9370 | 16290.00 |
| 333.20 | 0.9530 | 16460.00 |
| 343.20 | 0.5630 | 6510.00 |
| 343.20 | 0.6010 | 7140.00 |
| 343.20 | 0.6670 | 8670.00 |
| 343.20 | 0.6960 | 9500.00 |
| 343.20 | 0.7370 | 11170.00 |
| 343.20 | 0.7760 | 11950.00 |
| 343.20 | 0.7970 | 12950.00 |
| 343.20 | 0.8390 | 14520.00 |
| 343.20 | 0.8960 | 17560.00 |
| 343.20 | 0.9370 | 18910.00 |
| 343.20 | 0.9530 | 19140.00 |
| 353.20 | 0.5630 | 7290.00 |
| 353.20 | 0.6010 | 7890.00 |
| 353.20 | 0.6670 | 9800.00 |
| 353.20 | 0.6960 | 10870.00 |
| 353.20 | 0.7370 | 12680.00 |
| 353.20 | 0.7760 | 13730.00 |
| 353.20 | 0.7970 | 14920.00 |
| 353.20 | 0.8390 | 17030.00 |
| 353.20 | 0.8960 | 20240.00 |
| 353.20 | 0.9370 | 21060.00 |
| 353.20 | 0.9530 | 21220.00 |
| 363.20 | 0.5630 | 8080.00 |
| 363.20 | 0.6010 | 8750.00 |
| 363.20 | 0.6670 | 10970.00 |
| 363.20 | 0.6960 | 12280.00 |
| 363.20 | 0.7370 | 14390.00 |
| 363.20 | 0.7760 | 15560.00 |
| 363.20 | 0.7970 | 16870.00 |
| 363.20 | 0.8390 | 19260.00 |
| 363.20 | 0.8960 | 22040.00 |
| 363.20 | 0.9370 | 23170.00 |
| 363.20 | 0.9530 | 23300.00 |