- Name
- 1-Octanol
- InChI
- InChI=1S/C8H18O/c1-2-3-4-5-6-7-8-9/h9H,2-8H2,1H3
- InChI Key
- KBPLFHHGFOOTCA-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCCCO
- Mol. Weight (g/mol)
- 130.23
- CAS
- 111-87-5
- Name
- Pentane, 2,2,4-trimethyl-
- InChI
- InChI=1S/C8H18/c1-7(2)6-8(3,4)5/h7H,6H2,1-5H3
- InChI Key
- NHTMVDHEPJAVLT-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CC(C)CC(C)(C)C
- Mol. Weight (g/mol)
- 114.23
- CAS
- 540-84-1
- Name
- Pyrene
- InChI
- InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H
- InChI Key
- BBEAQIROQSPTKN-UHFFFAOYSA-N
- Formula
- C16H10
- SMILES
- c1cc2ccc3cccc4ccc(c1)c2c34
- Mol. Weight (g/mol)
- 202.25
- CAS
- 129-00-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of Pentane, 2,2,4-trimethyl- (2) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0219 |
| 293.00 | 0.1000 | 0.0190 |
| 293.00 | 0.2000 | 0.0174 |
| 293.00 | 0.3000 | 0.0164 |
| 293.00 | 0.4000 | 0.0148 |
| 293.00 | 0.5000 | 0.0145 |
| 293.00 | 0.6000 | 0.0141 |
| 293.00 | 0.7000 | 0.0133 |
| 293.00 | 0.8000 | 0.0122 |
| 293.00 | 0.9000 | 0.0103 |
| 293.00 | 1.0000 | 0.0073 |
| 298.00 | 0.0000 | 0.0241 |
| 298.00 | 0.1000 | 0.0221 |
| 298.00 | 0.2000 | 0.0192 |
| 298.00 | 0.3000 | 0.0186 |
| 298.00 | 0.4000 | 0.0170 |
| 298.00 | 0.5000 | 0.0167 |
| 298.00 | 0.6000 | 0.0166 |
| 298.00 | 0.7000 | 0.0150 |
| 298.00 | 0.8000 | 0.0139 |
| 298.00 | 0.9000 | 0.0117 |
| 298.00 | 1.0000 | 0.0086 |
| 303.00 | 0.0000 | 0.0285 |
| 303.00 | 0.1000 | 0.0243 |
| 303.00 | 0.2000 | 0.0225 |
| 303.00 | 0.3000 | 0.0217 |
| 303.00 | 0.4000 | 0.0213 |
| 303.00 | 0.5000 | 0.0209 |
| 303.00 | 0.6000 | 0.0178 |
| 303.00 | 0.7000 | 0.0172 |
| 303.00 | 0.8000 | 0.0155 |
| 303.00 | 0.9000 | 0.0137 |
| 303.00 | 1.0000 | 0.0104 |
| 308.00 | 0.0000 | 0.0333 |
| 308.00 | 0.1000 | 0.0285 |
| 308.00 | 0.2000 | 0.0260 |
| 308.00 | 0.3000 | 0.0252 |
| 308.00 | 0.4000 | 0.0239 |
| 308.00 | 0.5000 | 0.0215 |
| 308.00 | 0.6000 | 0.0212 |
| 308.00 | 0.7000 | 0.0189 |
| 308.00 | 0.8000 | 0.0171 |
| 308.00 | 0.9000 | 0.0149 |
| 308.00 | 1.0000 | 0.0120 |
| 313.00 | 0.0000 | 0.0366 |
| 313.00 | 0.1000 | 0.0310 |
| 313.00 | 0.2000 | 0.0277 |
| 313.00 | 0.3000 | 0.0275 |
| 313.00 | 0.4000 | 0.0272 |
| 313.00 | 0.5000 | 0.0243 |
| 313.00 | 0.6000 | 0.0234 |
| 313.00 | 0.7000 | 0.0213 |
| 313.00 | 0.8000 | 0.0202 |
| 313.00 | 0.9000 | 0.0165 |
| 313.00 | 1.0000 | 0.0135 |
| 318.00 | 0.0000 | 0.0411 |
| 318.00 | 0.1000 | 0.0353 |
| 318.00 | 0.2000 | 0.0330 |
| 318.00 | 0.3000 | 0.0322 |
| 318.00 | 0.4000 | 0.0295 |
| 318.00 | 0.5000 | 0.0276 |
| 318.00 | 0.6000 | 0.0267 |
| 318.00 | 0.7000 | 0.0242 |
| 318.00 | 0.8000 | 0.0212 |
| 318.00 | 0.9000 | 0.0192 |
| 318.00 | 1.0000 | 0.0146 |
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of Pentane, 2,2,4-trimethyl- (2) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0219 |
| 293.00 | 0.1000 | 0.0190 |
| 293.00 | 0.2000 | 0.0174 |
| 293.00 | 0.3000 | 0.0164 |
| 293.00 | 0.4000 | 0.0148 |
| 293.00 | 0.5000 | 0.0145 |
| 293.00 | 0.6000 | 0.0141 |
| 293.00 | 0.7000 | 0.0133 |
| 293.00 | 0.8000 | 0.0122 |
| 293.00 | 0.9000 | 0.0103 |
| 293.00 | 1.0000 | 0.0073 |
| 298.00 | 0.0000 | 0.0241 |
| 298.00 | 0.1000 | 0.0221 |
| 298.00 | 0.2000 | 0.0192 |
| 298.00 | 0.3000 | 0.0186 |
| 298.00 | 0.4000 | 0.0170 |
| 298.00 | 0.5000 | 0.0167 |
| 298.00 | 0.6000 | 0.0166 |
| 298.00 | 0.7000 | 0.0150 |
| 298.00 | 0.8000 | 0.0139 |
| 298.00 | 0.9000 | 0.0117 |
| 298.00 | 1.0000 | 0.0086 |
| 303.00 | 0.0000 | 0.0285 |
| 303.00 | 0.1000 | 0.0243 |
| 303.00 | 0.2000 | 0.0225 |
| 303.00 | 0.3000 | 0.0217 |
| 303.00 | 0.4000 | 0.0213 |
| 303.00 | 0.5000 | 0.0209 |
| 303.00 | 0.6000 | 0.0178 |
| 303.00 | 0.7000 | 0.0172 |
| 303.00 | 0.8000 | 0.0155 |
| 303.00 | 0.9000 | 0.0137 |
| 303.00 | 1.0000 | 0.0104 |
| 308.00 | 0.0000 | 0.0333 |
| 308.00 | 0.1000 | 0.0285 |
| 308.00 | 0.2000 | 0.0260 |
| 308.00 | 0.3000 | 0.0252 |
| 308.00 | 0.4000 | 0.0239 |
| 308.00 | 0.5000 | 0.0215 |
| 308.00 | 0.6000 | 0.0212 |
| 308.00 | 0.7000 | 0.0189 |
| 308.00 | 0.8000 | 0.0171 |
| 308.00 | 0.9000 | 0.0149 |
| 308.00 | 1.0000 | 0.0120 |
| 313.00 | 0.0000 | 0.0366 |
| 313.00 | 0.1000 | 0.0310 |
| 313.00 | 0.2000 | 0.0277 |
| 313.00 | 0.3000 | 0.0275 |
| 313.00 | 0.4000 | 0.0272 |
| 313.00 | 0.5000 | 0.0243 |
| 313.00 | 0.6000 | 0.0234 |
| 313.00 | 0.7000 | 0.0213 |
| 313.00 | 0.8000 | 0.0202 |
| 313.00 | 0.9000 | 0.0165 |
| 313.00 | 1.0000 | 0.0135 |
| 318.00 | 0.0000 | 0.0411 |
| 318.00 | 0.1000 | 0.0353 |
| 318.00 | 0.2000 | 0.0330 |
| 318.00 | 0.3000 | 0.0322 |
| 318.00 | 0.4000 | 0.0295 |
| 318.00 | 0.5000 | 0.0276 |
| 318.00 | 0.6000 | 0.0267 |
| 318.00 | 0.7000 | 0.0242 |
| 318.00 | 0.8000 | 0.0212 |
| 318.00 | 0.9000 | 0.0192 |
| 318.00 | 1.0000 | 0.0146 |