- Name
- Octane
- InChI
- InChI=1S/C8H18/c1-3-5-7-8-6-4-2/h3-8H2,1-2H3
- InChI Key
- TVMXDCGIABBOFY-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CCCCCCCC
- Mol. Weight (g/mol)
- 114.23
- CAS
- 111-65-9
- Name
- 1-Octanol
- InChI
- InChI=1S/C8H18O/c1-2-3-4-5-6-7-8-9/h9H,2-8H2,1H3
- InChI Key
- KBPLFHHGFOOTCA-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCCCO
- Mol. Weight (g/mol)
- 130.23
- CAS
- 111-87-5
- Name
- Pyrene
- InChI
- InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H
- InChI Key
- BBEAQIROQSPTKN-UHFFFAOYSA-N
- Formula
- C16H10
- SMILES
- c1cc2ccc3cccc4ccc(c1)c2c34
- Mol. Weight (g/mol)
- 202.25
- CAS
- 129-00-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of Octane (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0219 |
| 293.00 | 0.1000 | 0.0200 |
| 293.00 | 0.2000 | 0.0180 |
| 293.00 | 0.3000 | 0.0179 |
| 293.00 | 0.4000 | 0.0175 |
| 293.00 | 0.5000 | 0.0173 |
| 293.00 | 0.6000 | 0.0172 |
| 293.00 | 0.7000 | 0.0171 |
| 293.00 | 0.8000 | 0.0170 |
| 293.00 | 0.9000 | 0.0162 |
| 293.00 | 1.0000 | 0.0156 |
| 298.00 | 0.0000 | 0.0241 |
| 298.00 | 0.1000 | 0.0228 |
| 298.00 | 0.2000 | 0.0227 |
| 298.00 | 0.3000 | 0.0223 |
| 298.00 | 0.4000 | 0.0216 |
| 298.00 | 0.5000 | 0.0209 |
| 298.00 | 0.6000 | 0.0200 |
| 298.00 | 0.7000 | 0.0197 |
| 298.00 | 0.8000 | 0.0189 |
| 298.00 | 0.9000 | 0.0188 |
| 298.00 | 1.0000 | 0.0169 |
| 303.00 | 0.0000 | 0.0285 |
| 303.00 | 0.1000 | 0.0264 |
| 303.00 | 0.2000 | 0.0262 |
| 303.00 | 0.3000 | 0.0252 |
| 303.00 | 0.4000 | 0.0242 |
| 303.00 | 0.5000 | 0.0239 |
| 303.00 | 0.6000 | 0.0231 |
| 303.00 | 0.7000 | 0.0222 |
| 303.00 | 0.8000 | 0.0218 |
| 303.00 | 0.9000 | 0.0209 |
| 303.00 | 1.0000 | 0.0195 |
| 308.00 | 0.0000 | 0.0333 |
| 308.00 | 0.1000 | 0.0294 |
| 308.00 | 0.2000 | 0.0284 |
| 308.00 | 0.3000 | 0.0275 |
| 308.00 | 0.4000 | 0.0273 |
| 308.00 | 0.5000 | 0.0269 |
| 308.00 | 0.6000 | 0.0264 |
| 308.00 | 0.7000 | 0.0248 |
| 308.00 | 0.8000 | 0.0237 |
| 308.00 | 0.9000 | 0.0226 |
| 308.00 | 1.0000 | 0.0219 |
| 313.00 | 0.0000 | 0.0366 |
| 313.00 | 0.1000 | 0.0336 |
| 313.00 | 0.2000 | 0.0328 |
| 313.00 | 0.3000 | 0.0327 |
| 313.00 | 0.4000 | 0.0326 |
| 313.00 | 0.5000 | 0.0321 |
| 313.00 | 0.6000 | 0.0315 |
| 313.00 | 0.7000 | 0.0294 |
| 313.00 | 0.8000 | 0.0276 |
| 313.00 | 0.9000 | 0.0269 |
| 313.00 | 1.0000 | 0.0259 |
| 318.00 | 0.0000 | 0.0411 |
| 318.00 | 0.1000 | 0.0367 |
| 318.00 | 0.2000 | 0.0358 |
| 318.00 | 0.3000 | 0.0357 |
| 318.00 | 0.4000 | 0.0351 |
| 318.00 | 0.5000 | 0.0346 |
| 318.00 | 0.6000 | 0.0340 |
| 318.00 | 0.7000 | 0.0331 |
| 318.00 | 0.8000 | 0.0316 |
| 318.00 | 0.9000 | 0.0305 |
| 318.00 | 1.0000 | 0.0290 |
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of Octane (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0219 |
| 293.00 | 0.1000 | 0.0200 |
| 293.00 | 0.2000 | 0.0180 |
| 293.00 | 0.3000 | 0.0179 |
| 293.00 | 0.4000 | 0.0175 |
| 293.00 | 0.5000 | 0.0173 |
| 293.00 | 0.6000 | 0.0172 |
| 293.00 | 0.7000 | 0.0171 |
| 293.00 | 0.8000 | 0.0170 |
| 293.00 | 0.9000 | 0.0162 |
| 293.00 | 1.0000 | 0.0156 |
| 298.00 | 0.0000 | 0.0241 |
| 298.00 | 0.1000 | 0.0228 |
| 298.00 | 0.2000 | 0.0227 |
| 298.00 | 0.3000 | 0.0223 |
| 298.00 | 0.4000 | 0.0216 |
| 298.00 | 0.5000 | 0.0209 |
| 298.00 | 0.6000 | 0.0200 |
| 298.00 | 0.7000 | 0.0197 |
| 298.00 | 0.8000 | 0.0189 |
| 298.00 | 0.9000 | 0.0188 |
| 298.00 | 1.0000 | 0.0169 |
| 303.00 | 0.0000 | 0.0285 |
| 303.00 | 0.1000 | 0.0264 |
| 303.00 | 0.2000 | 0.0262 |
| 303.00 | 0.3000 | 0.0252 |
| 303.00 | 0.4000 | 0.0242 |
| 303.00 | 0.5000 | 0.0239 |
| 303.00 | 0.6000 | 0.0231 |
| 303.00 | 0.7000 | 0.0222 |
| 303.00 | 0.8000 | 0.0218 |
| 303.00 | 0.9000 | 0.0209 |
| 303.00 | 1.0000 | 0.0195 |
| 308.00 | 0.0000 | 0.0333 |
| 308.00 | 0.1000 | 0.0294 |
| 308.00 | 0.2000 | 0.0284 |
| 308.00 | 0.3000 | 0.0275 |
| 308.00 | 0.4000 | 0.0273 |
| 308.00 | 0.5000 | 0.0269 |
| 308.00 | 0.6000 | 0.0264 |
| 308.00 | 0.7000 | 0.0248 |
| 308.00 | 0.8000 | 0.0237 |
| 308.00 | 0.9000 | 0.0226 |
| 308.00 | 1.0000 | 0.0219 |
| 313.00 | 0.0000 | 0.0366 |
| 313.00 | 0.1000 | 0.0336 |
| 313.00 | 0.2000 | 0.0328 |
| 313.00 | 0.3000 | 0.0327 |
| 313.00 | 0.4000 | 0.0326 |
| 313.00 | 0.5000 | 0.0321 |
| 313.00 | 0.6000 | 0.0315 |
| 313.00 | 0.7000 | 0.0294 |
| 313.00 | 0.8000 | 0.0276 |
| 313.00 | 0.9000 | 0.0269 |
| 313.00 | 1.0000 | 0.0259 |
| 318.00 | 0.0000 | 0.0411 |
| 318.00 | 0.1000 | 0.0367 |
| 318.00 | 0.2000 | 0.0358 |
| 318.00 | 0.3000 | 0.0357 |
| 318.00 | 0.4000 | 0.0351 |
| 318.00 | 0.5000 | 0.0346 |
| 318.00 | 0.6000 | 0.0340 |
| 318.00 | 0.7000 | 0.0331 |
| 318.00 | 0.8000 | 0.0316 |
| 318.00 | 0.9000 | 0.0305 |
| 318.00 | 1.0000 | 0.0290 |