- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- 1,2-Benzenedicarboxylic acid
- InChI
- InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)
- InChI Key
- XNGIFLGASWRNHJ-UHFFFAOYSA-N
- Formula
- C8H6O4
- SMILES
- O=C(O)c1ccccc1C(=O)O
- Mol. Weight (g/mol)
- 166.13
- CAS
- 88-99-3
- Name
- 4-aminobenzoic acid
- InChI
- InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)
- InChI Key
- ALYNCZNDIQEVRV-UHFFFAOYSA-N
- Formula
- C7H7NO2
- SMILES
- Nc1ccc(C(=O)O)cc1
- Mol. Weight (g/mol)
- 137.14
- CAS
- 150-13-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 1,2-Benzenedicarboxylic acid (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1,2-Benzenedicarboxylic acid (2) - Fluid (supercritical or subcritical phases) |
| 308.15 | 8000.00 | 1.8600e-06 |
| 308.15 | 11000.00 | 3.7900e-06 |
| 308.15 | 13000.00 | 3.8900e-06 |
| 308.15 | 17000.00 | 4.0000e-06 |
| 308.15 | 21000.00 | 4.0600e-06 |
| 318.15 | 8000.00 | 1.7100e-06 |
| 318.15 | 11000.00 | 3.4800e-06 |
| 318.15 | 13000.00 | 3.9700e-06 |
| 318.15 | 17000.00 | 4.7600e-06 |
| 318.15 | 21000.00 | 5.1600e-06 |
| 328.15 | 8000.00 | 1.6300e-06 |
| 328.15 | 11000.00 | 2.7100e-06 |
| 328.15 | 13000.00 | 4.4200e-06 |
| 328.15 | 17000.00 | 4.9800e-06 |
| 328.15 | 21000.00 | 5.3900e-06 |
Mole fraction of 4-aminobenzoic acid (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 4-aminobenzoic acid (3) - Fluid (supercritical or subcritical phases) |
| 308.15 | 8000.00 | 2.1100e-06 |
| 308.15 | 11000.00 | 4.1700e-06 |
| 308.15 | 13000.00 | 4.2300e-06 |
| 308.15 | 17000.00 | 4.3100e-06 |
| 308.15 | 21000.00 | 4.3600e-06 |
| 318.15 | 8000.00 | 1.9600e-06 |
| 318.15 | 11000.00 | 3.8500e-06 |
| 318.15 | 13000.00 | 4.5500e-06 |
| 318.15 | 17000.00 | 5.1700e-06 |
| 318.15 | 21000.00 | 5.5600e-06 |
| 328.15 | 8000.00 | 1.9000e-06 |
| 328.15 | 11000.00 | 3.0700e-06 |
| 328.15 | 13000.00 | 4.8900e-06 |
| 328.15 | 17000.00 | 5.4600e-06 |
| 328.15 | 21000.00 | 5.8700e-06 |
Mole fraction of 1,2-Benzenedicarboxylic acid (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1,2-Benzenedicarboxylic acid (2) - Fluid (supercritical or subcritical phases) |
| 308.15 | 8000.00 | 1.8600e-06 |
| 308.15 | 11000.00 | 3.7900e-06 |
| 308.15 | 13000.00 | 3.8900e-06 |
| 308.15 | 17000.00 | 4.0000e-06 |
| 308.15 | 21000.00 | 4.0600e-06 |
| 318.15 | 8000.00 | 1.7100e-06 |
| 318.15 | 11000.00 | 3.4800e-06 |
| 318.15 | 13000.00 | 3.9700e-06 |
| 318.15 | 17000.00 | 4.7600e-06 |
| 318.15 | 21000.00 | 5.1600e-06 |
| 328.15 | 8000.00 | 1.6300e-06 |
| 328.15 | 11000.00 | 2.7100e-06 |
| 328.15 | 13000.00 | 4.4200e-06 |
| 328.15 | 17000.00 | 4.9800e-06 |
| 328.15 | 21000.00 | 5.3900e-06 |
Mole fraction of 4-aminobenzoic acid (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 4-aminobenzoic acid (3) - Fluid (supercritical or subcritical phases) |
| 308.15 | 8000.00 | 2.1100e-06 |
| 308.15 | 11000.00 | 4.1700e-06 |
| 308.15 | 13000.00 | 4.2300e-06 |
| 308.15 | 17000.00 | 4.3100e-06 |
| 308.15 | 21000.00 | 4.3600e-06 |
| 318.15 | 8000.00 | 1.9600e-06 |
| 318.15 | 11000.00 | 3.8500e-06 |
| 318.15 | 13000.00 | 4.5500e-06 |
| 318.15 | 17000.00 | 5.1700e-06 |
| 318.15 | 21000.00 | 5.5600e-06 |
| 328.15 | 8000.00 | 1.9000e-06 |
| 328.15 | 11000.00 | 3.0700e-06 |
| 328.15 | 13000.00 | 4.8900e-06 |
| 328.15 | 17000.00 | 5.4600e-06 |
| 328.15 | 21000.00 | 5.8700e-06 |