- Name
- Benzenemethanol, «alpha»-methyl-
- InChI
- InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3
- InChI Key
- WAPNOHKVXSQRPX-UHFFFAOYSA-N
- Formula
- C8H10O
- SMILES
- CC(O)c1ccccc1
- Mol. Weight (g/mol)
- 122.16
- CAS
- 98-85-1
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Pc - Critical pressure, kPa (2)
- Pvap - Vapor or sublimation pressure, kPa (4)
- Tc - Critical temperature, K (2)
Critical pressure, kPa [ref]
| Critical pressure, kPa - Liquid mixture 1 |
|---|
| 7780.00 |
Critical pressure, kPa [ref]
| Critical pressure, kPa - Liquid mixture 1 |
|---|
| 7780.00 |
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 283.49 | 4370.00 |
| 288.48 | 4930.00 |
| 293.14 | 5610.00 |
| 297.95 | 6270.00 |
| 304.05 | 7080.00 |
| 308.15 | 7740.00 |
| 308.33 | 7770.00 |
Temperature, K
Vapor or sublimation pressure, kPa
4500
5000
5500
6000
6500
7000
7500
8000
290
300
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Benzenemethanol, «alpha»-methyl- (1) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.5479 | 283.15 | 4500.00 |
| 0.5479 | 293.16 | 5550.00 |
| 0.5479 | 303.30 | 6750.00 |
| 0.5479 | 313.12 | 8100.00 |
| 0.5479 | 323.13 | 9450.00 |
| 0.5479 | 333.17 | 10800.00 |
| 0.5479 | 343.20 | 11950.00 |
| 0.5479 | 353.29 | 12970.00 |
| 0.5479 | 363.33 | 13920.00 |
| 0.6012 | 283.15 | 4250.00 |
| 0.6012 | 293.13 | 5150.00 |
| 0.6012 | 303.11 | 6200.00 |
| 0.6012 | 313.14 | 7300.00 |
| 0.6012 | 322.91 | 8300.00 |
| 0.6012 | 333.20 | 9370.00 |
| 0.6012 | 343.33 | 10370.00 |
| 0.6012 | 353.26 | 11200.00 |
| 0.6012 | 363.27 | 12100.00 |
| 0.7001 | 283.11 | 3500.00 |
| 0.7001 | 293.13 | 4150.00 |
| 0.7001 | 303.12 | 4850.00 |
| 0.7001 | 313.00 | 5550.00 |
| 0.7001 | 323.39 | 6300.00 |
| 0.7001 | 333.18 | 7000.00 |
| 0.7001 | 343.16 | 7450.00 |
| 0.7001 | 353.15 | 8300.00 |
| 0.7001 | 363.25 | 8900.00 |
| 0.8008 | 283.10 | 2650.00 |
| 0.8008 | 293.13 | 3100.00 |
| 0.8008 | 303.14 | 3450.00 |
| 0.8008 | 313.14 | 3950.00 |
| 0.8008 | 323.13 | 4400.00 |
| 0.8008 | 333.02 | 4750.00 |
| 0.8008 | 343.20 | 5150.00 |
| 0.8008 | 353.24 | 5500.00 |
| 0.8008 | 363.25 | 5850.00 |
| 0.9004 | 283.08 | 1420.00 |
| 0.9004 | 293.15 | 1620.00 |
| 0.9004 | 303.07 | 1800.00 |
| 0.9004 | 313.14 | 2010.00 |
| 0.9004 | 322.98 | 2170.00 |
| 0.9004 | 333.11 | 2410.00 |
| 0.9004 | 343.15 | 2570.00 |
| 0.9004 | 353.26 | 2760.00 |
| 0.9004 | 363.27 | 2910.00 |
| 0.9496 | 283.08 | 650.00 |
| 0.9496 | 293.09 | 750.00 |
| 0.9496 | 303.10 | 850.00 |
| 0.9496 | 312.99 | 950.00 |
| 0.9496 | 323.17 | 1050.00 |
| 0.9496 | 333.14 | 1140.00 |
| 0.9496 | 343.16 | 1220.00 |
| 0.9496 | 353.20 | 1310.00 |
| 0.9496 | 363.25 | 1400.00 |
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 283.49 | 4370.00 |
| 288.48 | 4930.00 |
| 293.14 | 5610.00 |
| 297.95 | 6270.00 |
| 304.05 | 7080.00 |
| 308.15 | 7740.00 |
| 308.33 | 7770.00 |
Temperature, K
Vapor or sublimation pressure, kPa
4500
5000
5500
6000
6500
7000
7500
8000
290
300
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Benzenemethanol, «alpha»-methyl- (1) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.5479 | 283.15 | 4500.00 |
| 0.5479 | 293.16 | 5550.00 |
| 0.5479 | 303.30 | 6750.00 |
| 0.5479 | 313.12 | 8100.00 |
| 0.5479 | 323.13 | 9450.00 |
| 0.5479 | 333.17 | 10800.00 |
| 0.5479 | 343.20 | 11950.00 |
| 0.5479 | 353.29 | 12970.00 |
| 0.5479 | 363.33 | 13920.00 |
| 0.6012 | 283.15 | 4250.00 |
| 0.6012 | 293.13 | 5150.00 |
| 0.6012 | 303.11 | 6200.00 |
| 0.6012 | 313.14 | 7300.00 |
| 0.6012 | 322.91 | 8300.00 |
| 0.6012 | 333.20 | 9370.00 |
| 0.6012 | 343.33 | 10370.00 |
| 0.6012 | 353.26 | 11200.00 |
| 0.6012 | 363.27 | 12100.00 |
| 0.7001 | 283.11 | 3500.00 |
| 0.7001 | 293.13 | 4150.00 |
| 0.7001 | 303.12 | 4850.00 |
| 0.7001 | 313.00 | 5550.00 |
| 0.7001 | 323.39 | 6300.00 |
| 0.7001 | 333.18 | 7000.00 |
| 0.7001 | 343.16 | 7450.00 |
| 0.7001 | 353.15 | 8300.00 |
| 0.7001 | 363.25 | 8900.00 |
| 0.8008 | 283.10 | 2650.00 |
| 0.8008 | 293.13 | 3100.00 |
| 0.8008 | 303.14 | 3450.00 |
| 0.8008 | 313.14 | 3950.00 |
| 0.8008 | 323.13 | 4400.00 |
| 0.8008 | 333.02 | 4750.00 |
| 0.8008 | 343.20 | 5150.00 |
| 0.8008 | 353.24 | 5500.00 |
| 0.8008 | 363.25 | 5850.00 |
| 0.9004 | 283.08 | 1420.00 |
| 0.9004 | 293.15 | 1620.00 |
| 0.9004 | 303.07 | 1800.00 |
| 0.9004 | 313.14 | 2010.00 |
| 0.9004 | 322.98 | 2170.00 |
| 0.9004 | 333.11 | 2410.00 |
| 0.9004 | 343.15 | 2570.00 |
| 0.9004 | 353.26 | 2760.00 |
| 0.9004 | 363.27 | 2910.00 |
| 0.9496 | 283.08 | 650.00 |
| 0.9496 | 293.09 | 750.00 |
| 0.9496 | 303.10 | 850.00 |
| 0.9496 | 312.99 | 950.00 |
| 0.9496 | 323.17 | 1050.00 |
| 0.9496 | 333.14 | 1140.00 |
| 0.9496 | 343.16 | 1220.00 |
| 0.9496 | 353.20 | 1310.00 |
| 0.9496 | 363.25 | 1400.00 |
Critical temperature, K [ref]
| Critical temperature, K - Liquid mixture 1 |
|---|
| 308.42 |
Critical temperature, K [ref]
| Critical temperature, K - Liquid mixture 1 |
|---|
| 308.42 |