- Name
- Nitrogen
- InChI
- InChI=1S/N2/c1-2
- InChI Key
- IJGRMHOSHXDMSA-UHFFFAOYSA-N
- Formula
- N2
- SMILES
- N#N
- Mol. Weight (g/mol)
- 28.01
- CAS
- 7727-37-9
- Name
- Tetra-N-butylammonium bromide
- InChI
- InChI=1S/C16H36N.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- JRMUNVKIHCOMHV-UHFFFAOYSA-M
- Formula
- C16H36BrN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
- Mol. Weight (g/mol)
- 322.37
- CAS
- 1643-19-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Nitrogen (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass fraction of Tetra-N-butylammonium bromide (2) - Liquid | Mole fraction of Nitrogen (1) - Liquid |
| 292.15 | 3000.00 | 0.0000 | 0.0003 |
| 292.15 | 5000.00 | 0.0000 | 0.0006 |
| 292.15 | 7000.00 | 0.0000 | 0.0007 |
| 292.15 | 3000.00 | 0.0973 | 0.0004 |
| 292.15 | 5000.00 | 0.1035 | 0.0005 |
| 292.15 | 7000.00 | 0.1018 | 0.0008 |
| 292.15 | 3000.00 | 0.2048 | 0.0003 |
| 292.15 | 5000.00 | 0.1985 | 0.0006 |
| 292.15 | 7000.00 | 0.1967 | 0.0007 |
| 292.15 | 3000.00 | 0.2983 | 0.0005 |
| 292.15 | 5000.00 | 0.2983 | 0.0005 |
| 292.15 | 7000.00 | 0.2983 | 0.0008 |
| 292.15 | 3000.00 | 0.4007 | 0.0003 |
| 292.15 | 5000.00 | 0.4012 | 0.0004 |
| 292.15 | 7000.00 | 0.3998 | 0.0008 |
| 302.15 | 3000.00 | 0.0000 | 0.0004 |
| 302.15 | 5000.00 | 0.0000 | 0.0006 |
| 302.15 | 7000.00 | 0.0000 | 0.0008 |
| 302.15 | 3000.00 | 0.1005 | 0.0002 |
| 302.15 | 5000.00 | 0.0986 | 0.0006 |
| 302.15 | 7000.00 | 0.1004 | 0.0007 |
| 302.15 | 3000.00 | 0.2005 | 0.0002 |
| 302.15 | 5000.00 | 0.2030 | 0.0005 |
| 302.15 | 7000.00 | 0.1965 | 0.0008 |
| 302.15 | 3000.00 | 0.3006 | 0.0004 |
| 302.15 | 5000.00 | 0.3040 | 0.0006 |
| 302.15 | 7000.00 | 0.3031 | 0.0008 |
| 302.15 | 3000.00 | 0.3994 | 0.0004 |
| 302.15 | 5000.00 | 0.4045 | 0.0005 |
| 302.15 | 7000.00 | 0.4019 | 0.0010 |
| 307.15 | 3000.00 | 0.0000 | 0.0003 |
| 307.15 | 5000.00 | 0.0000 | 0.0004 |
| 307.15 | 7000.00 | 0.0000 | 0.0007 |
| 307.15 | 3000.00 | 0.1007 | 0.0003 |
| 307.15 | 5000.00 | 0.0999 | 0.0005 |
| 307.15 | 7000.00 | 0.1009 | 0.0007 |
| 307.15 | 3000.00 | 0.1971 | 0.0002 |
| 307.15 | 5000.00 | 0.1984 | 0.0004 |
| 307.15 | 7000.00 | 0.2006 | 0.0007 |
| 307.15 | 3000.00 | 0.3029 | 0.0004 |
| 307.15 | 5000.00 | 0.3012 | 0.0005 |
| 307.15 | 7000.00 | 0.2982 | 0.0008 |
| 307.15 | 3000.00 | 0.3986 | 0.0002 |
| 307.15 | 5000.00 | 0.4010 | 0.0005 |
| 307.15 | 7000.00 | 0.4018 | 0.0009 |
Mole fraction of Nitrogen (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Solvent: Molality, mol/kg of Tetra-N-butylammonium bromide (2) - Liquid | Mole fraction of Nitrogen (1) - Liquid |
| 94.20 | 283.15 | 0.2000 | 0.0000 |
| 94.28 | 283.15 | 0.4000 | 0.0000 |
| 94.34 | 283.15 | 0.6000 | 0.0000 |
| 94.26 | 283.15 | 0.8000 | 0.0000 |
| 94.36 | 283.15 | 1.0000 | 0.0000 |
| 94.22 | 288.15 | 0.2000 | 0.0000 |
| 94.30 | 288.15 | 0.4000 | 0.0000 |
| 94.41 | 288.15 | 0.6000 | 0.0000 |
| 94.47 | 288.15 | 0.8000 | 0.0000 |
| 94.48 | 288.15 | 1.0000 | 0.0000 |
| 94.42 | 293.15 | 0.2000 | 0.0000 |
| 94.28 | 293.15 | 0.4000 | 0.0000 |
| 94.36 | 293.15 | 0.6000 | 0.0000 |
| 94.34 | 293.15 | 0.8000 | 0.0000 |
| 94.37 | 293.15 | 1.0000 | 0.0000 |
| 94.46 | 298.15 | 0.2000 | 0.0000 |
| 94.37 | 298.15 | 0.4000 | 0.0000 |
| 94.32 | 298.15 | 0.6000 | 0.0000 |
| 94.35 | 298.15 | 0.8000 | 0.0000 |
| 94.41 | 298.15 | 1.001 | 0.0000 |
Mole fraction of Nitrogen (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass fraction of Tetra-N-butylammonium bromide (2) - Liquid | Mole fraction of Nitrogen (1) - Liquid |
| 292.15 | 3000.00 | 0.0000 | 0.0003 |
| 292.15 | 5000.00 | 0.0000 | 0.0006 |
| 292.15 | 7000.00 | 0.0000 | 0.0007 |
| 292.15 | 3000.00 | 0.0973 | 0.0004 |
| 292.15 | 5000.00 | 0.1035 | 0.0005 |
| 292.15 | 7000.00 | 0.1018 | 0.0008 |
| 292.15 | 3000.00 | 0.2048 | 0.0003 |
| 292.15 | 5000.00 | 0.1985 | 0.0006 |
| 292.15 | 7000.00 | 0.1967 | 0.0007 |
| 292.15 | 3000.00 | 0.2983 | 0.0005 |
| 292.15 | 5000.00 | 0.2983 | 0.0005 |
| 292.15 | 7000.00 | 0.2983 | 0.0008 |
| 292.15 | 3000.00 | 0.4007 | 0.0003 |
| 292.15 | 5000.00 | 0.4012 | 0.0004 |
| 292.15 | 7000.00 | 0.3998 | 0.0008 |
| 302.15 | 3000.00 | 0.0000 | 0.0004 |
| 302.15 | 5000.00 | 0.0000 | 0.0006 |
| 302.15 | 7000.00 | 0.0000 | 0.0008 |
| 302.15 | 3000.00 | 0.1005 | 0.0002 |
| 302.15 | 5000.00 | 0.0986 | 0.0006 |
| 302.15 | 7000.00 | 0.1004 | 0.0007 |
| 302.15 | 3000.00 | 0.2005 | 0.0002 |
| 302.15 | 5000.00 | 0.2030 | 0.0005 |
| 302.15 | 7000.00 | 0.1965 | 0.0008 |
| 302.15 | 3000.00 | 0.3006 | 0.0004 |
| 302.15 | 5000.00 | 0.3040 | 0.0006 |
| 302.15 | 7000.00 | 0.3031 | 0.0008 |
| 302.15 | 3000.00 | 0.3994 | 0.0004 |
| 302.15 | 5000.00 | 0.4045 | 0.0005 |
| 302.15 | 7000.00 | 0.4019 | 0.0010 |
| 307.15 | 3000.00 | 0.0000 | 0.0003 |
| 307.15 | 5000.00 | 0.0000 | 0.0004 |
| 307.15 | 7000.00 | 0.0000 | 0.0007 |
| 307.15 | 3000.00 | 0.1007 | 0.0003 |
| 307.15 | 5000.00 | 0.0999 | 0.0005 |
| 307.15 | 7000.00 | 0.1009 | 0.0007 |
| 307.15 | 3000.00 | 0.1971 | 0.0002 |
| 307.15 | 5000.00 | 0.1984 | 0.0004 |
| 307.15 | 7000.00 | 0.2006 | 0.0007 |
| 307.15 | 3000.00 | 0.3029 | 0.0004 |
| 307.15 | 5000.00 | 0.3012 | 0.0005 |
| 307.15 | 7000.00 | 0.2982 | 0.0008 |
| 307.15 | 3000.00 | 0.3986 | 0.0002 |
| 307.15 | 5000.00 | 0.4010 | 0.0005 |
| 307.15 | 7000.00 | 0.4018 | 0.0009 |
Mole fraction of Nitrogen (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Solvent: Molality, mol/kg of Tetra-N-butylammonium bromide (2) - Liquid | Mole fraction of Nitrogen (1) - Liquid |
| 94.20 | 283.15 | 0.2000 | 0.0000 |
| 94.28 | 283.15 | 0.4000 | 0.0000 |
| 94.34 | 283.15 | 0.6000 | 0.0000 |
| 94.26 | 283.15 | 0.8000 | 0.0000 |
| 94.36 | 283.15 | 1.0000 | 0.0000 |
| 94.22 | 288.15 | 0.2000 | 0.0000 |
| 94.30 | 288.15 | 0.4000 | 0.0000 |
| 94.41 | 288.15 | 0.6000 | 0.0000 |
| 94.47 | 288.15 | 0.8000 | 0.0000 |
| 94.48 | 288.15 | 1.0000 | 0.0000 |
| 94.42 | 293.15 | 0.2000 | 0.0000 |
| 94.28 | 293.15 | 0.4000 | 0.0000 |
| 94.36 | 293.15 | 0.6000 | 0.0000 |
| 94.34 | 293.15 | 0.8000 | 0.0000 |
| 94.37 | 293.15 | 1.0000 | 0.0000 |
| 94.46 | 298.15 | 0.2000 | 0.0000 |
| 94.37 | 298.15 | 0.4000 | 0.0000 |
| 94.32 | 298.15 | 0.6000 | 0.0000 |
| 94.35 | 298.15 | 0.8000 | 0.0000 |
| 94.41 | 298.15 | 1.001 | 0.0000 |