- Name
- potassium chloride
- InChI
- InChI=1S/ClH.K/h1H;/q;+1/p-1
- InChI Key
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M
- Formula
- ClK
- SMILES
- [Cl-].[K+]
- Mol. Weight (g/mol)
- 74.55
- CAS
- 7447-40-7
- Name
- D-Valine
- InChI
- InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
- InChI Key
- KZSNJWFQEVHDMF-BYPYZUCNSA-N
- Formula
- C5H11NO2
- SMILES
- CC(C)C(N)C(=O)O
- Mol. Weight (g/mol)
- 117.15
- CAS
- 640-68-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Osmotic coefficient (4)
- Molality, mol/kg (2)
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (4)
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of D-Valine (2) - Liquid | Molality, mol/kg of potassium chloride (1) - Liquid | Osmotic coefficient - Liquid |
| 0.1000 | 0.5000 | 0.9180 |
| 0.2000 | 0.5000 | 0.9170 |
| 0.3000 | 0.5000 | 0.9270 |
| 0.4000 | 0.5000 | 0.9340 |
| 0.1000 | 1.0000 | 0.9170 |
| 0.2000 | 1.0000 | 0.9040 |
| 0.3000 | 1.0000 | 0.9210 |
| 0.4000 | 1.0000 | 0.9340 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of D-Valine (2) - Liquid | Molality, mol/kg of potassium chloride (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.8970 |
| 0.0500 | 1.0000 | 0.8970 |
| 0.1000 | 1.0000 | 0.9080 |
| 0.1500 | 1.0000 | 0.9050 |
| 0.2000 | 1.0000 | 0.9150 |
| 0.2500 | 1.0000 | 0.9280 |
| 0.3000 | 1.0000 | 0.9310 |
| 0.3490 | 1.0000 | 0.9350 |
| 0.3980 | 1.0000 | 0.9470 |
| 0.4500 | 1.0000 | 0.9510 |
| 0.0000 | 3.0 | 0.9350 |
| 0.0500 | 3.0 | 0.9560 |
| 0.1000 | 3.0 | 0.9630 |
| 0.1500 | 3.0 | 0.9680 |
| 0.2000 | 3.0 | 0.9830 |
| 0.2530 | 3.0 | 0.9890 |
| 0.3000 | 3.0 | 0.9890 |
| 0.3490 | 3.0 | 0.9960 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of D-Valine (2) - Liquid | Molality, mol/kg of potassium chloride (1) - Liquid | Osmotic coefficient - Liquid |
| 0.1000 | 0.5000 | 0.9180 |
| 0.2000 | 0.5000 | 0.9170 |
| 0.3000 | 0.5000 | 0.9270 |
| 0.4000 | 0.5000 | 0.9340 |
| 0.1000 | 1.0000 | 0.9170 |
| 0.2000 | 1.0000 | 0.9040 |
| 0.3000 | 1.0000 | 0.9210 |
| 0.4000 | 1.0000 | 0.9340 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of D-Valine (2) - Liquid | Molality, mol/kg of potassium chloride (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.8970 |
| 0.0500 | 1.0000 | 0.8970 |
| 0.1000 | 1.0000 | 0.9080 |
| 0.1500 | 1.0000 | 0.9050 |
| 0.2000 | 1.0000 | 0.9150 |
| 0.2500 | 1.0000 | 0.9280 |
| 0.3000 | 1.0000 | 0.9310 |
| 0.3490 | 1.0000 | 0.9350 |
| 0.3980 | 1.0000 | 0.9470 |
| 0.4500 | 1.0000 | 0.9510 |
| 0.0000 | 3.0 | 0.9350 |
| 0.0500 | 3.0 | 0.9560 |
| 0.1000 | 3.0 | 0.9630 |
| 0.1500 | 3.0 | 0.9680 |
| 0.2000 | 3.0 | 0.9830 |
| 0.2530 | 3.0 | 0.9890 |
| 0.3000 | 3.0 | 0.9890 |
| 0.3490 | 3.0 | 0.9960 |
Molality, mol/kg of D-Valine (2) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of potassium chloride (1) - Liquid | Molality, mol/kg of D-Valine (2) - Liquid |
|---|---|
| 1.0000 | 0.4600 |
| 3.01 | 0.3500 |
Molality, mol/kg of D-Valine (2) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of potassium chloride (1) - Liquid | Molality, mol/kg of D-Valine (2) - Liquid |
|---|---|
| 1.0000 | 0.4600 |
| 3.01 | 0.3500 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0184 | 0.0009 |
| 298.15 | 0.0369 | 0.0009 |
| 298.15 | 0.0554 | 0.0009 |
| 298.15 | 0.0927 | 0.0010 |
| 298.15 | 0.1303 | 0.0010 |
| 298.15 | 0.1682 | 0.0010 |
| 298.15 | 0.1873 | 0.0010 |
| 303.15 | 0.0000 | 0.0009 |
| 303.15 | 0.0184 | 0.0009 |
| 303.15 | 0.0369 | 0.0009 |
| 303.15 | 0.0554 | 0.0009 |
| 303.15 | 0.0927 | 0.0009 |
| 303.15 | 0.1303 | 0.0009 |
| 303.15 | 0.1682 | 0.0009 |
| 303.15 | 0.1873 | 0.0010 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.0184 | 0.0008 |
| 308.15 | 0.0369 | 0.0008 |
| 308.15 | 0.0554 | 0.0008 |
| 308.15 | 0.0927 | 0.0008 |
| 308.15 | 0.1303 | 0.0008 |
| 308.15 | 0.1682 | 0.0008 |
| 308.15 | 0.1873 | 0.0009 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0184 | 0.0007 |
| 313.15 | 0.0369 | 0.0007 |
| 313.15 | 0.0554 | 0.0007 |
| 313.15 | 0.0927 | 0.0007 |
| 313.15 | 0.1303 | 0.0008 |
| 313.15 | 0.1682 | 0.0008 |
| 313.15 | 0.1873 | 0.0008 |
| 318.15 | 0.0000 | 0.0006 |
| 318.15 | 0.0184 | 0.0007 |
| 318.15 | 0.0369 | 0.0007 |
| 318.15 | 0.0554 | 0.0007 |
| 323.15 | 0.0000 | 0.0006 |
| 323.15 | 0.0184 | 0.0006 |
| 323.15 | 0.0369 | 0.0006 |
| 323.15 | 0.0554 | 0.0006 |
| 323.15 | 0.0927 | 0.0006 |
| 323.15 | 0.1303 | 0.0007 |
| 323.15 | 0.1682 | 0.0007 |
| 323.15 | 0.1873 | 0.0007 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0184 | 0.0009 |
| 298.15 | 0.0369 | 0.0009 |
| 298.15 | 0.0554 | 0.0009 |
| 298.15 | 0.0927 | 0.0010 |
| 298.15 | 0.1303 | 0.0010 |
| 298.15 | 0.1682 | 0.0010 |
| 298.15 | 0.1873 | 0.0010 |
| 303.15 | 0.0000 | 0.0009 |
| 303.15 | 0.0184 | 0.0009 |
| 303.15 | 0.0369 | 0.0009 |
| 303.15 | 0.0554 | 0.0009 |
| 303.15 | 0.0927 | 0.0009 |
| 303.15 | 0.1303 | 0.0009 |
| 303.15 | 0.1682 | 0.0009 |
| 303.15 | 0.1873 | 0.0010 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.0184 | 0.0008 |
| 308.15 | 0.0369 | 0.0008 |
| 308.15 | 0.0554 | 0.0008 |
| 308.15 | 0.0927 | 0.0008 |
| 308.15 | 0.1303 | 0.0008 |
| 308.15 | 0.1682 | 0.0008 |
| 308.15 | 0.1873 | 0.0009 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0184 | 0.0007 |
| 313.15 | 0.0369 | 0.0007 |
| 313.15 | 0.0554 | 0.0007 |
| 313.15 | 0.0927 | 0.0007 |
| 313.15 | 0.1303 | 0.0008 |
| 313.15 | 0.1682 | 0.0008 |
| 313.15 | 0.1873 | 0.0008 |
| 318.15 | 0.0000 | 0.0006 |
| 318.15 | 0.0184 | 0.0007 |
| 318.15 | 0.0369 | 0.0007 |
| 318.15 | 0.0554 | 0.0007 |
| 323.15 | 0.0000 | 0.0006 |
| 323.15 | 0.0184 | 0.0006 |
| 323.15 | 0.0369 | 0.0006 |
| 323.15 | 0.0554 | 0.0006 |
| 323.15 | 0.0927 | 0.0006 |
| 323.15 | 0.1303 | 0.0007 |
| 323.15 | 0.1682 | 0.0007 |
| 323.15 | 0.1873 | 0.0007 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1089.1 |
| 298.15 | 0.0184 | 1089.5 |
| 298.15 | 0.0369 | 1089.6 |
| 298.15 | 0.0554 | 1089.9 |
| 298.15 | 0.0927 | 1090.6 |
| 298.15 | 0.1303 | 1090.8 |
| 298.15 | 0.1682 | 1091.3 |
| 298.15 | 0.1873 | 1091.4 |
| 303.15 | 0.0000 | 1087.5 |
| 303.15 | 0.0184 | 1087.8 |
| 303.15 | 0.0369 | 1088.1 |
| 303.15 | 0.0554 | 1088.3 |
| 303.15 | 0.0927 | 1089.0 |
| 303.15 | 0.1303 | 1089.4 |
| 303.15 | 0.1682 | 1089.9 |
| 303.15 | 0.1873 | 1090.1 |
| 308.15 | 0.0000 | 1085.6 |
| 308.15 | 0.0184 | 1085.9 |
| 308.15 | 0.0369 | 1086.2 |
| 308.15 | 0.0554 | 1086.5 |
| 308.15 | 0.0927 | 1087.1 |
| 308.15 | 0.1303 | 1087.6 |
| 308.15 | 0.1682 | 1088.3 |
| 308.15 | 0.1873 | 1088.5 |
| 313.15 | 0.0000 | 1083.4 |
| 313.15 | 0.0184 | 1083.7 |
| 313.15 | 0.0369 | 1084.1 |
| 313.15 | 0.0554 | 1084.4 |
| 313.15 | 0.0927 | 1085.0 |
| 313.15 | 0.1303 | 1085.6 |
| 313.15 | 0.1682 | 1086.3 |
| 313.15 | 0.1873 | 1086.7 |
| 318.15 | 0.0000 | 1080.9 |
| 318.15 | 0.0184 | 1081.3 |
| 318.15 | 0.0369 | 1081.7 |
| 318.15 | 0.0554 | 1082.0 |
| 318.15 | 0.0927 | 1082.7 |
| 318.15 | 0.1303 | 1083.4 |
| 318.15 | 0.1682 | 1084.2 |
| 318.15 | 0.1873 | 1084.6 |
| 323.15 | 0.0000 | 1078.3 |
| 323.15 | 0.0184 | 1078.6 |
| 323.15 | 0.0369 | 1079.1 |
| 323.15 | 0.0554 | 1079.4 |
| 323.15 | 0.0927 | 1080.2 |
| 323.15 | 0.1303 | 1080.9 |
| 323.15 | 0.1682 | 1081.8 |
| 323.15 | 0.1873 | 1082.2 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1089.1 |
| 298.15 | 0.0184 | 1089.5 |
| 298.15 | 0.0369 | 1089.6 |
| 298.15 | 0.0554 | 1089.9 |
| 298.15 | 0.0927 | 1090.6 |
| 298.15 | 0.1303 | 1090.8 |
| 298.15 | 0.1682 | 1091.3 |
| 298.15 | 0.1873 | 1091.4 |
| 303.15 | 0.0000 | 1087.5 |
| 303.15 | 0.0184 | 1087.8 |
| 303.15 | 0.0369 | 1088.1 |
| 303.15 | 0.0554 | 1088.3 |
| 303.15 | 0.0927 | 1089.0 |
| 303.15 | 0.1303 | 1089.4 |
| 303.15 | 0.1682 | 1089.9 |
| 303.15 | 0.1873 | 1090.1 |
| 308.15 | 0.0000 | 1085.6 |
| 308.15 | 0.0184 | 1085.9 |
| 308.15 | 0.0369 | 1086.2 |
| 308.15 | 0.0554 | 1086.5 |
| 308.15 | 0.0927 | 1087.1 |
| 308.15 | 0.1303 | 1087.6 |
| 308.15 | 0.1682 | 1088.3 |
| 308.15 | 0.1873 | 1088.5 |
| 313.15 | 0.0000 | 1083.4 |
| 313.15 | 0.0184 | 1083.7 |
| 313.15 | 0.0369 | 1084.1 |
| 313.15 | 0.0554 | 1084.4 |
| 313.15 | 0.0927 | 1085.0 |
| 313.15 | 0.1303 | 1085.6 |
| 313.15 | 0.1682 | 1086.3 |
| 313.15 | 0.1873 | 1086.7 |
| 318.15 | 0.0000 | 1080.9 |
| 318.15 | 0.0184 | 1081.3 |
| 318.15 | 0.0369 | 1081.7 |
| 318.15 | 0.0554 | 1082.0 |
| 318.15 | 0.0927 | 1082.7 |
| 318.15 | 0.1303 | 1083.4 |
| 318.15 | 0.1682 | 1084.2 |
| 318.15 | 0.1873 | 1084.6 |
| 323.15 | 0.0000 | 1078.3 |
| 323.15 | 0.0184 | 1078.6 |
| 323.15 | 0.0369 | 1079.1 |
| 323.15 | 0.0554 | 1079.4 |
| 323.15 | 0.0927 | 1080.2 |
| 323.15 | 0.1303 | 1080.9 |
| 323.15 | 0.1682 | 1081.8 |
| 323.15 | 0.1873 | 1082.2 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1089.1 |
| 298.15 | 0.0184 | 1089.5 |
| 298.15 | 0.0369 | 1089.6 |
| 298.15 | 0.0554 | 1089.9 |
| 298.15 | 0.0927 | 1090.6 |
| 298.15 | 0.1303 | 1090.8 |
| 298.15 | 0.1682 | 1091.3 |
| 298.15 | 0.1873 | 1091.4 |
| 303.15 | 0.0000 | 1087.5 |
| 303.15 | 0.0184 | 1087.8 |
| 303.15 | 0.0369 | 1088.1 |
| 303.15 | 0.0554 | 1088.3 |
| 303.15 | 0.0927 | 1089.0 |
| 303.15 | 0.1303 | 1089.4 |
| 303.15 | 0.1682 | 1089.9 |
| 303.15 | 0.1873 | 1090.1 |
| 308.15 | 0.0000 | 1085.6 |
| 308.15 | 0.0184 | 1085.9 |
| 308.15 | 0.0369 | 1086.2 |
| 308.15 | 0.0554 | 1086.5 |
| 308.15 | 0.0927 | 1087.1 |
| 308.15 | 0.1303 | 1087.6 |
| 308.15 | 0.1682 | 1088.3 |
| 308.15 | 0.1873 | 1088.5 |
| 313.15 | 0.0000 | 1083.4 |
| 313.15 | 0.0184 | 1083.7 |
| 313.15 | 0.0369 | 1084.1 |
| 313.15 | 0.0554 | 1084.4 |
| 313.15 | 0.0927 | 1085.0 |
| 313.15 | 0.1303 | 1085.6 |
| 313.15 | 0.1682 | 1086.3 |
| 313.15 | 0.1873 | 1086.7 |
| 318.15 | 0.0000 | 1080.9 |
| 318.15 | 0.0184 | 1081.3 |
| 318.15 | 0.0369 | 1081.7 |
| 318.15 | 0.0554 | 1082.0 |
| 318.15 | 0.0927 | 1082.7 |
| 318.15 | 0.1303 | 1083.4 |
| 318.15 | 0.1682 | 1084.2 |
| 318.15 | 0.1873 | 1084.6 |
| 323.15 | 0.0000 | 1078.3 |
| 323.15 | 0.0184 | 1078.6 |
| 323.15 | 0.0369 | 1079.1 |
| 323.15 | 0.0554 | 1079.4 |
| 323.15 | 0.0927 | 1080.2 |
| 323.15 | 0.1303 | 1080.9 |
| 323.15 | 0.1682 | 1081.8 |
| 323.15 | 0.1873 | 1082.2 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1089.1 |
| 298.15 | 0.0184 | 1089.5 |
| 298.15 | 0.0369 | 1089.6 |
| 298.15 | 0.0554 | 1089.9 |
| 298.15 | 0.0927 | 1090.6 |
| 298.15 | 0.1303 | 1090.8 |
| 298.15 | 0.1682 | 1091.3 |
| 298.15 | 0.1873 | 1091.4 |
| 303.15 | 0.0000 | 1087.5 |
| 303.15 | 0.0184 | 1087.8 |
| 303.15 | 0.0369 | 1088.1 |
| 303.15 | 0.0554 | 1088.3 |
| 303.15 | 0.0927 | 1089.0 |
| 303.15 | 0.1303 | 1089.4 |
| 303.15 | 0.1682 | 1089.9 |
| 303.15 | 0.1873 | 1090.1 |
| 308.15 | 0.0000 | 1085.6 |
| 308.15 | 0.0184 | 1085.9 |
| 308.15 | 0.0369 | 1086.2 |
| 308.15 | 0.0554 | 1086.5 |
| 308.15 | 0.0927 | 1087.1 |
| 308.15 | 0.1303 | 1087.6 |
| 308.15 | 0.1682 | 1088.3 |
| 308.15 | 0.1873 | 1088.5 |
| 313.15 | 0.0000 | 1083.4 |
| 313.15 | 0.0184 | 1083.7 |
| 313.15 | 0.0369 | 1084.1 |
| 313.15 | 0.0554 | 1084.4 |
| 313.15 | 0.0927 | 1085.0 |
| 313.15 | 0.1303 | 1085.6 |
| 313.15 | 0.1682 | 1086.3 |
| 313.15 | 0.1873 | 1086.7 |
| 318.15 | 0.0000 | 1080.9 |
| 318.15 | 0.0184 | 1081.3 |
| 318.15 | 0.0369 | 1081.7 |
| 318.15 | 0.0554 | 1082.0 |
| 318.15 | 0.0927 | 1082.7 |
| 318.15 | 0.1303 | 1083.4 |
| 318.15 | 0.1682 | 1084.2 |
| 318.15 | 0.1873 | 1084.6 |
| 323.15 | 0.0000 | 1078.3 |
| 323.15 | 0.0184 | 1078.6 |
| 323.15 | 0.0369 | 1079.1 |
| 323.15 | 0.0554 | 1079.4 |
| 323.15 | 0.0927 | 1080.2 |
| 323.15 | 0.1303 | 1080.9 |
| 323.15 | 0.1682 | 1081.8 |
| 323.15 | 0.1873 | 1082.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1595.2 |
| 298.15 | 0.0184 | 1599.2 |
| 298.15 | 0.0369 | 1602.2 |
| 298.15 | 0.0554 | 1605.9 |
| 298.15 | 0.0927 | 1612.0 |
| 298.15 | 0.1303 | 1618.0 |
| 298.15 | 0.1682 | 1624.0 |
| 298.15 | 0.1873 | 1627.0 |
| 303.15 | 0.0000 | 1605.9 |
| 303.15 | 0.0184 | 1607.0 |
| 303.15 | 0.0369 | 1610.2 |
| 303.15 | 0.0554 | 1613.2 |
| 303.15 | 0.0927 | 1619.8 |
| 303.15 | 0.1303 | 1626.2 |
| 303.15 | 0.1682 | 1632.6 |
| 303.15 | 0.1873 | 1636.0 |
| 308.15 | 0.0000 | 1610.2 |
| 308.15 | 0.0184 | 1613.2 |
| 308.15 | 0.0369 | 1616.2 |
| 308.15 | 0.0554 | 1619.4 |
| 308.15 | 0.0927 | 1626.0 |
| 308.15 | 0.1303 | 1632.2 |
| 308.15 | 0.1682 | 1638.0 |
| 308.15 | 0.1873 | 1641.4 |
| 313.15 | 0.0000 | 1616.4 |
| 313.15 | 0.0184 | 1619.4 |
| 313.15 | 0.0369 | 1622.8 |
| 313.15 | 0.0554 | 1626.0 |
| 313.15 | 0.0927 | 1633.0 |
| 313.15 | 0.1303 | 1639.2 |
| 313.15 | 0.1682 | 1645.6 |
| 313.15 | 0.1873 | 1649.0 |
| 318.15 | 0.0000 | 1621.4 |
| 318.15 | 0.0184 | 1626.2 |
| 318.15 | 0.0369 | 1629.4 |
| 318.15 | 0.0554 | 1632.6 |
| 318.15 | 0.0927 | 1639.2 |
| 318.15 | 0.1303 | 1645.6 |
| 318.15 | 0.1682 | 1651.8 |
| 318.15 | 0.1873 | 1655.0 |
| 323.15 | 0.0000 | 1626.5 |
| 323.15 | 0.0184 | 1631.4 |
| 323.15 | 0.0369 | 1634.4 |
| 323.15 | 0.0554 | 1637.4 |
| 323.15 | 0.0927 | 1643.6 |
| 323.15 | 0.1303 | 1650.0 |
| 323.15 | 0.1682 | 1656.4 |
| 323.15 | 0.1873 | 1659.6 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1595.2 |
| 298.15 | 0.0184 | 1599.2 |
| 298.15 | 0.0369 | 1602.2 |
| 298.15 | 0.0554 | 1605.9 |
| 298.15 | 0.0927 | 1612.0 |
| 298.15 | 0.1303 | 1618.0 |
| 298.15 | 0.1682 | 1624.0 |
| 298.15 | 0.1873 | 1630.0 |
| 303.15 | 0.0000 | 1605.9 |
| 303.15 | 0.0184 | 1607.0 |
| 303.15 | 0.0369 | 1610.2 |
| 303.15 | 0.0554 | 1613.2 |
| 303.15 | 0.0927 | 1619.8 |
| 303.15 | 0.1303 | 1626.2 |
| 303.15 | 0.1682 | 1632.6 |
| 303.15 | 0.1873 | 1638.2 |
| 308.15 | 0.0000 | 1610.2 |
| 308.15 | 0.0184 | 1613.2 |
| 308.15 | 0.0369 | 1616.2 |
| 308.15 | 0.0554 | 1619.4 |
| 308.15 | 0.0927 | 1626.0 |
| 308.15 | 0.1303 | 1632.2 |
| 308.15 | 0.1682 | 1638.0 |
| 308.15 | 0.1873 | 1643.8 |
| 313.15 | 0.0000 | 1616.4 |
| 313.15 | 0.0184 | 1619.4 |
| 313.15 | 0.0369 | 1622.8 |
| 313.15 | 0.0554 | 1626.0 |
| 313.15 | 0.0927 | 1633.0 |
| 313.15 | 0.1303 | 1639.2 |
| 313.15 | 0.1682 | 1645.6 |
| 313.15 | 0.1873 | 1651.4 |
| 318.15 | 0.0000 | 1621.4 |
| 318.15 | 0.0184 | 1626.2 |
| 318.15 | 0.0369 | 1629.4 |
| 318.15 | 0.0554 | 1632.6 |
| 318.15 | 0.0927 | 1639.2 |
| 318.15 | 0.1303 | 1645.6 |
| 318.15 | 0.1682 | 1651.8 |
| 318.15 | 0.1873 | 1657.6 |
| 323.15 | 0.0000 | 1626.5 |
| 323.15 | 0.0184 | 1631.4 |
| 323.15 | 0.0369 | 1634.4 |
| 323.15 | 0.0554 | 1637.4 |
| 323.15 | 0.0927 | 1643.6 |
| 323.15 | 0.1303 | 1650.0 |
| 323.15 | 0.1682 | 1656.4 |
| 323.15 | 0.1873 | 1662.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1595.2 |
| 298.15 | 0.0184 | 1599.2 |
| 298.15 | 0.0369 | 1602.2 |
| 298.15 | 0.0554 | 1605.9 |
| 298.15 | 0.0927 | 1612.0 |
| 298.15 | 0.1303 | 1618.0 |
| 298.15 | 0.1682 | 1624.0 |
| 298.15 | 0.1873 | 1627.0 |
| 303.15 | 0.0000 | 1605.9 |
| 303.15 | 0.0184 | 1607.0 |
| 303.15 | 0.0369 | 1610.2 |
| 303.15 | 0.0554 | 1613.2 |
| 303.15 | 0.0927 | 1619.8 |
| 303.15 | 0.1303 | 1626.2 |
| 303.15 | 0.1682 | 1632.6 |
| 303.15 | 0.1873 | 1636.0 |
| 308.15 | 0.0000 | 1610.2 |
| 308.15 | 0.0184 | 1613.2 |
| 308.15 | 0.0369 | 1616.2 |
| 308.15 | 0.0554 | 1619.4 |
| 308.15 | 0.0927 | 1626.0 |
| 308.15 | 0.1303 | 1632.2 |
| 308.15 | 0.1682 | 1638.0 |
| 308.15 | 0.1873 | 1641.4 |
| 313.15 | 0.0000 | 1616.4 |
| 313.15 | 0.0184 | 1619.4 |
| 313.15 | 0.0369 | 1622.8 |
| 313.15 | 0.0554 | 1626.0 |
| 313.15 | 0.0927 | 1633.0 |
| 313.15 | 0.1303 | 1639.2 |
| 313.15 | 0.1682 | 1645.6 |
| 313.15 | 0.1873 | 1649.0 |
| 318.15 | 0.0000 | 1621.4 |
| 318.15 | 0.0184 | 1626.2 |
| 318.15 | 0.0369 | 1629.4 |
| 318.15 | 0.0554 | 1632.6 |
| 318.15 | 0.0927 | 1639.2 |
| 318.15 | 0.1303 | 1645.6 |
| 318.15 | 0.1682 | 1651.8 |
| 318.15 | 0.1873 | 1655.0 |
| 323.15 | 0.0000 | 1626.5 |
| 323.15 | 0.0184 | 1631.4 |
| 323.15 | 0.0369 | 1634.4 |
| 323.15 | 0.0554 | 1637.4 |
| 323.15 | 0.0927 | 1643.6 |
| 323.15 | 0.1303 | 1650.0 |
| 323.15 | 0.1682 | 1656.4 |
| 323.15 | 0.1873 | 1659.6 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1595.2 |
| 298.15 | 0.0184 | 1599.2 |
| 298.15 | 0.0369 | 1602.2 |
| 298.15 | 0.0554 | 1605.9 |
| 298.15 | 0.0927 | 1612.0 |
| 298.15 | 0.1303 | 1618.0 |
| 298.15 | 0.1682 | 1624.0 |
| 298.15 | 0.1873 | 1630.0 |
| 303.15 | 0.0000 | 1605.9 |
| 303.15 | 0.0184 | 1607.0 |
| 303.15 | 0.0369 | 1610.2 |
| 303.15 | 0.0554 | 1613.2 |
| 303.15 | 0.0927 | 1619.8 |
| 303.15 | 0.1303 | 1626.2 |
| 303.15 | 0.1682 | 1632.6 |
| 303.15 | 0.1873 | 1638.2 |
| 308.15 | 0.0000 | 1610.2 |
| 308.15 | 0.0184 | 1613.2 |
| 308.15 | 0.0369 | 1616.2 |
| 308.15 | 0.0554 | 1619.4 |
| 308.15 | 0.0927 | 1626.0 |
| 308.15 | 0.1303 | 1632.2 |
| 308.15 | 0.1682 | 1638.0 |
| 308.15 | 0.1873 | 1643.8 |
| 313.15 | 0.0000 | 1616.4 |
| 313.15 | 0.0184 | 1619.4 |
| 313.15 | 0.0369 | 1622.8 |
| 313.15 | 0.0554 | 1626.0 |
| 313.15 | 0.0927 | 1633.0 |
| 313.15 | 0.1303 | 1639.2 |
| 313.15 | 0.1682 | 1645.6 |
| 313.15 | 0.1873 | 1651.4 |
| 318.15 | 0.0000 | 1621.4 |
| 318.15 | 0.0184 | 1626.2 |
| 318.15 | 0.0369 | 1629.4 |
| 318.15 | 0.0554 | 1632.6 |
| 318.15 | 0.0927 | 1639.2 |
| 318.15 | 0.1303 | 1645.6 |
| 318.15 | 0.1682 | 1651.8 |
| 318.15 | 0.1873 | 1657.6 |
| 323.15 | 0.0000 | 1626.5 |
| 323.15 | 0.0184 | 1631.4 |
| 323.15 | 0.0369 | 1634.4 |
| 323.15 | 0.0554 | 1637.4 |
| 323.15 | 0.0927 | 1643.6 |
| 323.15 | 0.1303 | 1650.0 |
| 323.15 | 0.1682 | 1656.4 |
| 323.15 | 0.1873 | 1662.2 |
Sources
- Effect of KCl and KNO3 on Partial Molal Volumes and Partial Molal Compressibilities of Some Amino Acids at Different Temperatures
- Viscosity studies of (L-alanine-, L-proline, L-valine, L-leucine + aqueous KCl/KNO3) solutions at different temperatures
- Measuring and modeling aqueous electrolyte/amino-acid solutions with ePC-SAFT
- Interactions in l-alanine /l-proline /l-valine /l-leucine aqueous KCl/KNO3 systems at different temperatures: An isentropic compressibility study