- Name
- 2-Methyl-1-butanol
- InChI
- InChI=1S/C5H12O/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3
- InChI Key
- QPRQEDXDYOZYLA-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- CCC(C)CO
- Mol. Weight (g/mol)
- 88.15
- CAS
- 137-32-6
- Name
- Heptane
- InChI
- InChI=1S/C7H16/c1-3-5-7-6-4-2/h3-7H2,1-2H3
- InChI Key
- IMNFDUFMRHMDMM-UHFFFAOYSA-N
- Formula
- C7H16
- SMILES
- CCCCCCC
- Mol. Weight (g/mol)
- 100.20
- CAS
- 142-82-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Binary diffusion coefficient, m2/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of 2-Methyl-1-butanol (1) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 288.15 | 0.0500 | 0.0000 |
| 288.15 | 0.1500 | 0.0000 |
| 288.15 | 0.2500 | 0.0000 |
| 288.15 | 0.3500 | 0.0000 |
| 288.15 | 0.4500 | 0.0000 |
| 288.15 | 0.5500 | 0.0000 |
| 288.15 | 0.6500 | 0.0000 |
| 288.15 | 0.7500 | 0.0000 |
| 288.15 | 0.8500 | 0.0000 |
| 288.15 | 0.9500 | 0.0000 |
| 298.15 | 0.0500 | 0.0000 |
| 298.15 | 0.1500 | 0.0000 |
| 298.15 | 0.2500 | 0.0000 |
| 298.15 | 0.3500 | 0.0000 |
| 298.15 | 0.4500 | 0.0000 |
| 298.15 | 0.5500 | 0.0000 |
| 298.15 | 0.6500 | 0.0000 |
| 298.15 | 0.7500 | 0.0000 |
| 298.15 | 0.8500 | 0.0000 |
| 298.15 | 0.9500 | 0.0000 |
| 308.15 | 0.0500 | 0.0000 |
| 308.15 | 0.1500 | 0.0000 |
| 308.15 | 0.2500 | 0.0000 |
| 308.15 | 0.3500 | 0.0000 |
| 308.15 | 0.4500 | 0.0000 |
| 308.15 | 0.5500 | 0.0000 |
| 308.15 | 0.6500 | 0.0000 |
| 308.15 | 0.7500 | 0.0000 |
| 308.15 | 0.8500 | 0.0000 |
| 308.15 | 0.9500 | 0.0000 |
| 318.15 | 0.0500 | 0.0000 |
| 318.15 | 0.1500 | 0.0000 |
| 318.15 | 0.2500 | 0.0000 |
| 318.15 | 0.3500 | 0.0000 |
| 318.15 | 0.4500 | 0.0000 |
| 318.15 | 0.5500 | 0.0000 |
| 318.15 | 0.6500 | 0.0000 |
| 318.15 | 0.7500 | 0.0000 |
| 318.15 | 0.8500 | 0.0000 |
| 318.15 | 0.9500 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of 2-Methyl-1-butanol (1) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 288.15 | 0.0500 | 0.0000 |
| 288.15 | 0.1500 | 0.0000 |
| 288.15 | 0.2500 | 0.0000 |
| 288.15 | 0.3500 | 0.0000 |
| 288.15 | 0.4500 | 0.0000 |
| 288.15 | 0.5500 | 0.0000 |
| 288.15 | 0.6500 | 0.0000 |
| 288.15 | 0.7500 | 0.0000 |
| 288.15 | 0.8500 | 0.0000 |
| 288.15 | 0.9500 | 0.0000 |
| 298.15 | 0.0500 | 0.0000 |
| 298.15 | 0.1500 | 0.0000 |
| 298.15 | 0.2500 | 0.0000 |
| 298.15 | 0.3500 | 0.0000 |
| 298.15 | 0.4500 | 0.0000 |
| 298.15 | 0.5500 | 0.0000 |
| 298.15 | 0.6500 | 0.0000 |
| 298.15 | 0.7500 | 0.0000 |
| 298.15 | 0.8500 | 0.0000 |
| 298.15 | 0.9500 | 0.0000 |
| 308.15 | 0.0500 | 0.0000 |
| 308.15 | 0.1500 | 0.0000 |
| 308.15 | 0.2500 | 0.0000 |
| 308.15 | 0.3500 | 0.0000 |
| 308.15 | 0.4500 | 0.0000 |
| 308.15 | 0.5500 | 0.0000 |
| 308.15 | 0.6500 | 0.0000 |
| 308.15 | 0.7500 | 0.0000 |
| 308.15 | 0.8500 | 0.0000 |
| 308.15 | 0.9500 | 0.0000 |
| 318.15 | 0.0500 | 0.0000 |
| 318.15 | 0.1500 | 0.0000 |
| 318.15 | 0.2500 | 0.0000 |
| 318.15 | 0.3500 | 0.0000 |
| 318.15 | 0.4500 | 0.0000 |
| 318.15 | 0.5500 | 0.0000 |
| 318.15 | 0.6500 | 0.0000 |
| 318.15 | 0.7500 | 0.0000 |
| 318.15 | 0.8500 | 0.0000 |
| 318.15 | 0.9500 | 0.0000 |