- Name
- Cyclohexane, methyl-
- InChI
- InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3
- InChI Key
- UAEPNZWRGJTJPN-UHFFFAOYSA-N
- Formula
- C7H14
- SMILES
- CC1CCCCC1
- Mol. Weight (g/mol)
- 98.19
- CAS
- 108-87-2
- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0558 | 1.4976 |
| 298.15 | 0.0973 | 1.4937 |
| 298.15 | 0.1875 | 1.4859 |
| 298.15 | 0.2979 | 1.4761 |
| 298.15 | 0.4084 | 1.4666 |
| 298.15 | 0.4965 | 1.4593 |
| 298.15 | 0.5946 | 1.4513 |
| 298.15 | 0.6948 | 1.4433 |
| 298.15 | 0.7944 | 1.4357 |
| 298.15 | 0.8912 | 1.4285 |
| 298.15 | 0.9497 | 1.4243 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0490 | 1.4904 |
| 313.15 | 0.0983 | 1.4859 |
| 313.15 | 0.1972 | 1.477 |
| 313.15 | 0.2832 | 1.4696 |
| 313.15 | 0.4030 | 1.4595 |
| 313.15 | 0.5001 | 1.4514 |
| 313.15 | 0.5980 | 1.4435 |
| 313.15 | 0.6977 | 1.4356 |
| 313.15 | 0.7947 | 1.4281 |
| 313.15 | 0.9013 | 1.42 |
| 313.15 | 0.9474 | 1.4165 |
| 313.15 | 1.0000 | 1.4127 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0558 | 1.4976 |
| 298.15 | 0.0973 | 1.4937 |
| 298.15 | 0.1875 | 1.4859 |
| 298.15 | 0.2979 | 1.4761 |
| 298.15 | 0.4084 | 1.4666 |
| 298.15 | 0.4965 | 1.4593 |
| 298.15 | 0.5946 | 1.4513 |
| 298.15 | 0.6948 | 1.4433 |
| 298.15 | 0.7944 | 1.4357 |
| 298.15 | 0.8912 | 1.4285 |
| 298.15 | 0.9497 | 1.4243 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0490 | 1.4904 |
| 313.15 | 0.0983 | 1.4859 |
| 313.15 | 0.1972 | 1.477 |
| 313.15 | 0.2832 | 1.4696 |
| 313.15 | 0.4030 | 1.4595 |
| 313.15 | 0.5001 | 1.4514 |
| 313.15 | 0.5980 | 1.4435 |
| 313.15 | 0.6977 | 1.4356 |
| 313.15 | 0.7947 | 1.4281 |
| 313.15 | 0.9013 | 1.42 |
| 313.15 | 0.9474 | 1.4165 |
| 313.15 | 1.0000 | 1.4127 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0558 | 868.7 |
| 298.15 | 0.0973 | 863.5 |
| 298.15 | 0.1875 | 852.9 |
| 298.15 | 0.2979 | 839.7 |
| 298.15 | 0.4084 | 827.0 |
| 298.15 | 0.4965 | 817.1 |
| 298.15 | 0.5946 | 806.3 |
| 298.15 | 0.6948 | 795.5 |
| 298.15 | 0.7944 | 785.2 |
| 298.15 | 0.8912 | 775.6 |
| 298.15 | 0.9497 | 769.9 |
| 298.15 | 1.0000 | 765.0 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0490 | 856.8 |
| 313.15 | 0.0983 | 850.8 |
| 313.15 | 0.1972 | 838.9 |
| 313.15 | 0.2832 | 828.7 |
| 313.15 | 0.4030 | 814.8 |
| 313.15 | 0.5001 | 803.8 |
| 313.15 | 0.5980 | 793.0 |
| 313.15 | 0.6977 | 782.3 |
| 313.15 | 0.7947 | 772.2 |
| 313.15 | 0.9013 | 761.5 |
| 313.15 | 0.9474 | 756.9 |
| 313.15 | 1.0000 | 751.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0558 | 868.7 |
| 298.15 | 0.0973 | 863.5 |
| 298.15 | 0.1875 | 852.9 |
| 298.15 | 0.2979 | 839.7 |
| 298.15 | 0.4084 | 827.0 |
| 298.15 | 0.4965 | 817.1 |
| 298.15 | 0.5946 | 806.3 |
| 298.15 | 0.6948 | 795.5 |
| 298.15 | 0.7944 | 785.2 |
| 298.15 | 0.8912 | 775.6 |
| 298.15 | 0.9497 | 769.9 |
| 298.15 | 1.0000 | 765.0 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0490 | 856.8 |
| 313.15 | 0.0983 | 850.8 |
| 313.15 | 0.1972 | 838.9 |
| 313.15 | 0.2832 | 828.7 |
| 313.15 | 0.4030 | 814.8 |
| 313.15 | 0.5001 | 803.8 |
| 313.15 | 0.5980 | 793.0 |
| 313.15 | 0.6977 | 782.3 |
| 313.15 | 0.7947 | 772.2 |
| 313.15 | 0.9013 | 761.5 |
| 313.15 | 0.9474 | 756.9 |
| 313.15 | 1.0000 | 751.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0558 | 1340.0 |
| 298.15 | 0.0973 | 1333.0 |
| 298.15 | 0.1875 | 1318.0 |
| 298.15 | 0.2979 | 1300.0 |
| 298.15 | 0.4084 | 1283.0 |
| 298.15 | 0.4965 | 1271.0 |
| 298.15 | 0.5946 | 1259.0 |
| 298.15 | 0.6948 | 1246.0 |
| 298.15 | 0.7944 | 1235.0 |
| 298.15 | 0.8912 | 1225.0 |
| 298.15 | 0.9497 | 1219.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1289.0 |
| 313.15 | 0.0490 | 1281.0 |
| 313.15 | 0.0983 | 1272.0 |
| 313.15 | 0.1972 | 1255.0 |
| 313.15 | 0.2832 | 1241.0 |
| 313.15 | 0.4030 | 1222.0 |
| 313.15 | 0.5001 | 1208.0 |
| 313.15 | 0.5980 | 1195.0 |
| 313.15 | 0.6977 | 1182.0 |
| 313.15 | 0.7947 | 1171.0 |
| 313.15 | 0.9013 | 1160.0 |
| 313.15 | 0.9474 | 1154.0 |
| 313.15 | 1.0000 | 1150.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0558 | 1340.0 |
| 298.15 | 0.0973 | 1333.0 |
| 298.15 | 0.1875 | 1318.0 |
| 298.15 | 0.2979 | 1300.0 |
| 298.15 | 0.4084 | 1283.0 |
| 298.15 | 0.4965 | 1271.0 |
| 298.15 | 0.5946 | 1259.0 |
| 298.15 | 0.6948 | 1246.0 |
| 298.15 | 0.7944 | 1235.0 |
| 298.15 | 0.8912 | 1225.0 |
| 298.15 | 0.9497 | 1219.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1289.0 |
| 313.15 | 0.0490 | 1281.0 |
| 313.15 | 0.0983 | 1272.0 |
| 313.15 | 0.1972 | 1255.0 |
| 313.15 | 0.2832 | 1241.0 |
| 313.15 | 0.4030 | 1222.0 |
| 313.15 | 0.5001 | 1208.0 |
| 313.15 | 0.5980 | 1195.0 |
| 313.15 | 0.6977 | 1182.0 |
| 313.15 | 0.7947 | 1171.0 |
| 313.15 | 0.9013 | 1160.0 |
| 313.15 | 0.9474 | 1154.0 |
| 313.15 | 1.0000 | 1150.0 |