- Name
- Cyclopentane
- InChI
- InChI=1S/C5H10/c1-2-4-5-3-1/h1-5H2
- InChI Key
- RGSFGYAAUTVSQA-UHFFFAOYSA-N
- Formula
- C5H10
- SMILES
- C1CCCC1
- Mol. Weight (g/mol)
- 70.13
- CAS
- 287-92-3
- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0450 | 1.4995 |
| 298.15 | 0.0924 | 1.4955 |
| 298.15 | 0.1949 | 1.487 |
| 298.15 | 0.2932 | 1.4791 |
| 298.15 | 0.3903 | 1.47 |
| 298.15 | 0.4954 | 1.4606 |
| 298.15 | 0.5940 | 1.4507 |
| 298.15 | 0.6958 | 1.4393 |
| 298.15 | 0.7939 | 1.4283 |
| 298.15 | 0.8926 | 1.4165 |
| 298.15 | 0.9503 | 1.4095 |
| 298.15 | 1.0000 | 1.4029 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0720 | 1.4892 |
| 313.15 | 0.0931 | 1.4874 |
| 313.15 | 0.1919 | 1.4794 |
| 313.15 | 0.2934 | 1.4705 |
| 313.15 | 0.3772 | 1.463 |
| 313.15 | 0.4855 | 1.4528 |
| 313.15 | 0.5894 | 1.4424 |
| 313.15 | 0.6850 | 1.4322 |
| 313.15 | 0.8099 | 1.4183 |
| 313.15 | 0.8912 | 1.4086 |
| 313.15 | 0.9479 | 1.402 |
| 313.15 | 1.0000 | 1.3946 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0450 | 1.4995 |
| 298.15 | 0.0924 | 1.4955 |
| 298.15 | 0.1949 | 1.487 |
| 298.15 | 0.2932 | 1.4791 |
| 298.15 | 0.3903 | 1.47 |
| 298.15 | 0.4954 | 1.4606 |
| 298.15 | 0.5940 | 1.4507 |
| 298.15 | 0.6958 | 1.4393 |
| 298.15 | 0.7939 | 1.4283 |
| 298.15 | 0.8926 | 1.4165 |
| 298.15 | 0.9503 | 1.4095 |
| 298.15 | 1.0000 | 1.4029 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0720 | 1.4892 |
| 313.15 | 0.0931 | 1.4874 |
| 313.15 | 0.1919 | 1.4794 |
| 313.15 | 0.2934 | 1.4705 |
| 313.15 | 0.3772 | 1.463 |
| 313.15 | 0.4855 | 1.4528 |
| 313.15 | 0.5894 | 1.4424 |
| 313.15 | 0.6850 | 1.4322 |
| 313.15 | 0.8099 | 1.4183 |
| 313.15 | 0.8912 | 1.4086 |
| 313.15 | 0.9479 | 1.402 |
| 313.15 | 1.0000 | 1.3946 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0450 | 870.7 |
| 298.15 | 0.0924 | 865.7 |
| 298.15 | 0.1949 | 854.1 |
| 298.15 | 0.2932 | 842.5 |
| 298.15 | 0.3903 | 830.4 |
| 298.15 | 0.4954 | 816.6 |
| 298.15 | 0.5940 | 802.9 |
| 298.15 | 0.6958 | 788.1 |
| 298.15 | 0.7939 | 773.0 |
| 298.15 | 0.8926 | 757.3 |
| 298.15 | 0.9503 | 747.9 |
| 298.15 | 1.0000 | 740.0 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0720 | 855.0 |
| 313.15 | 0.0931 | 852.7 |
| 313.15 | 0.1919 | 841.5 |
| 313.15 | 0.2934 | 829.3 |
| 313.15 | 0.3772 | 818.8 |
| 313.15 | 0.4855 | 804.6 |
| 313.15 | 0.5894 | 790.1 |
| 313.15 | 0.6850 | 776.2 |
| 313.15 | 0.8099 | 756.9 |
| 313.15 | 0.8912 | 743.6 |
| 313.15 | 0.9479 | 734.1 |
| 313.15 | 1.0000 | 725.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0450 | 870.7 |
| 298.15 | 0.0924 | 865.7 |
| 298.15 | 0.1949 | 854.1 |
| 298.15 | 0.2932 | 842.5 |
| 298.15 | 0.3903 | 830.4 |
| 298.15 | 0.4954 | 816.6 |
| 298.15 | 0.5940 | 802.9 |
| 298.15 | 0.6958 | 788.1 |
| 298.15 | 0.7939 | 773.0 |
| 298.15 | 0.8926 | 757.3 |
| 298.15 | 0.9503 | 747.9 |
| 298.15 | 1.0000 | 740.0 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0720 | 855.0 |
| 313.15 | 0.0931 | 852.7 |
| 313.15 | 0.1919 | 841.5 |
| 313.15 | 0.2934 | 829.3 |
| 313.15 | 0.3772 | 818.8 |
| 313.15 | 0.4855 | 804.6 |
| 313.15 | 0.5894 | 790.1 |
| 313.15 | 0.6850 | 776.2 |
| 313.15 | 0.8099 | 756.9 |
| 313.15 | 0.8912 | 743.6 |
| 313.15 | 0.9479 | 734.1 |
| 313.15 | 1.0000 | 725.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0450 | 1342.0 |
| 298.15 | 0.0924 | 1336.0 |
| 298.15 | 0.1949 | 1319.0 |
| 298.15 | 0.2932 | 1304.0 |
| 298.15 | 0.3903 | 1289.0 |
| 298.15 | 0.4954 | 1273.0 |
| 298.15 | 0.5940 | 1259.0 |
| 298.15 | 0.6958 | 1244.0 |
| 298.15 | 0.7939 | 1231.0 |
| 298.15 | 0.8926 | 1217.0 |
| 298.15 | 0.9503 | 1210.0 |
| 298.15 | 1.0000 | 1204.0 |
| 313.15 | 0.0000 | 1290.0 |
| 313.15 | 0.0720 | 1277.0 |
| 313.15 | 0.0931 | 1274.0 |
| 313.15 | 0.1919 | 1257.0 |
| 313.15 | 0.2934 | 1241.0 |
| 313.15 | 0.3772 | 1227.0 |
| 313.15 | 0.4855 | 1209.0 |
| 313.15 | 0.5894 | 1192.0 |
| 313.15 | 0.6850 | 1177.0 |
| 313.15 | 0.8099 | 1158.0 |
| 313.15 | 0.8912 | 1146.0 |
| 313.15 | 0.9479 | 1138.0 |
| 313.15 | 1.0000 | 1130.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0450 | 1342.0 |
| 298.15 | 0.0924 | 1336.0 |
| 298.15 | 0.1949 | 1319.0 |
| 298.15 | 0.2932 | 1304.0 |
| 298.15 | 0.3903 | 1289.0 |
| 298.15 | 0.4954 | 1273.0 |
| 298.15 | 0.5940 | 1259.0 |
| 298.15 | 0.6958 | 1244.0 |
| 298.15 | 0.7939 | 1231.0 |
| 298.15 | 0.8926 | 1217.0 |
| 298.15 | 0.9503 | 1210.0 |
| 298.15 | 1.0000 | 1204.0 |
| 313.15 | 0.0000 | 1290.0 |
| 313.15 | 0.0720 | 1277.0 |
| 313.15 | 0.0931 | 1274.0 |
| 313.15 | 0.1919 | 1257.0 |
| 313.15 | 0.2934 | 1241.0 |
| 313.15 | 0.3772 | 1227.0 |
| 313.15 | 0.4855 | 1209.0 |
| 313.15 | 0.5894 | 1192.0 |
| 313.15 | 0.6850 | 1177.0 |
| 313.15 | 0.8099 | 1158.0 |
| 313.15 | 0.8912 | 1146.0 |
| 313.15 | 0.9479 | 1138.0 |
| 313.15 | 1.0000 | 1130.0 |