- Name
- 3-Pentanone
- InChI
- InChI=1S/C5H10O/c1-3-5(6)4-2/h3-4H2,1-2H3
- InChI Key
- FDPIMTJIUBPUKL-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- CCC(=O)CC
- Mol. Weight (g/mol)
- 86.13
- CAS
- 96-22-0
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 804.5 |
| 303.15 | 0.0252 | 815.9 |
| 303.15 | 0.1627 | 878.1 |
| 303.15 | 0.2922 | 937.4 |
| 303.15 | 0.4201 | 996.2 |
| 303.15 | 0.5234 | 1044.1 |
| 303.15 | 0.6292 | 1093.5 |
| 303.15 | 0.7487 | 1149.4 |
| 303.15 | 0.8644 | 1202.8 |
| 303.15 | 0.9804 | 1253.5 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 799.6 |
| 308.15 | 0.0252 | 811.1 |
| 308.15 | 0.1627 | 873.1 |
| 308.15 | 0.2922 | 931.9 |
| 308.15 | 0.4201 | 991.1 |
| 308.15 | 0.5234 | 1039.1 |
| 308.15 | 0.6292 | 1088.4 |
| 308.15 | 0.7487 | 1144.2 |
| 308.15 | 0.8644 | 1198.1 |
| 308.15 | 0.9804 | 1250.0 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 794.3 |
| 313.15 | 0.0252 | 805.8 |
| 313.15 | 0.1627 | 867.6 |
| 313.15 | 0.2922 | 926.6 |
| 313.15 | 0.4201 | 985.6 |
| 313.15 | 0.5234 | 1033.7 |
| 313.15 | 0.6292 | 1083.1 |
| 313.15 | 0.7487 | 1139.3 |
| 313.15 | 0.8644 | 1193.2 |
| 313.15 | 0.9804 | 1244.6 |
| 313.15 | 1.0000 | 1251.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 804.5 |
| 303.15 | 0.0252 | 815.9 |
| 303.15 | 0.1627 | 878.1 |
| 303.15 | 0.2922 | 937.4 |
| 303.15 | 0.4201 | 996.2 |
| 303.15 | 0.5234 | 1044.1 |
| 303.15 | 0.6292 | 1093.5 |
| 303.15 | 0.7487 | 1149.4 |
| 303.15 | 0.8644 | 1202.8 |
| 303.15 | 0.9804 | 1253.5 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 799.6 |
| 308.15 | 0.0252 | 811.1 |
| 308.15 | 0.1627 | 873.1 |
| 308.15 | 0.2922 | 931.9 |
| 308.15 | 0.4201 | 991.1 |
| 308.15 | 0.5234 | 1039.1 |
| 308.15 | 0.6292 | 1088.4 |
| 308.15 | 0.7487 | 1144.2 |
| 308.15 | 0.8644 | 1198.1 |
| 308.15 | 0.9804 | 1250.0 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 794.3 |
| 313.15 | 0.0252 | 805.8 |
| 313.15 | 0.1627 | 867.6 |
| 313.15 | 0.2922 | 926.6 |
| 313.15 | 0.4201 | 985.6 |
| 313.15 | 0.5234 | 1033.7 |
| 313.15 | 0.6292 | 1083.1 |
| 313.15 | 0.7487 | 1139.3 |
| 313.15 | 0.8644 | 1193.2 |
| 313.15 | 0.9804 | 1244.6 |
| 313.15 | 1.0000 | 1251.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1197.0 |
| 303.15 | 0.0252 | 1208.0 |
| 303.15 | 0.1627 | 1257.0 |
| 303.15 | 0.2922 | 1300.0 |
| 303.15 | 0.4201 | 1345.0 |
| 303.15 | 0.5234 | 1388.0 |
| 303.15 | 0.6292 | 1435.0 |
| 303.15 | 0.7487 | 1490.0 |
| 303.15 | 0.8644 | 1536.0 |
| 303.15 | 0.9804 | 1579.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1179.0 |
| 308.15 | 0.0252 | 1191.0 |
| 308.15 | 0.1627 | 1240.0 |
| 308.15 | 0.2922 | 1283.0 |
| 308.15 | 0.4201 | 1331.0 |
| 308.15 | 0.5234 | 1376.0 |
| 308.15 | 0.6292 | 1421.0 |
| 308.15 | 0.7487 | 1473.0 |
| 308.15 | 0.8644 | 1520.0 |
| 308.15 | 0.9804 | 1566.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1160.0 |
| 313.15 | 0.0252 | 1170.0 |
| 313.15 | 0.1627 | 1218.0 |
| 313.15 | 0.2922 | 1263.0 |
| 313.15 | 0.4201 | 1315.0 |
| 313.15 | 0.5234 | 1361.0 |
| 313.15 | 0.6292 | 1406.0 |
| 313.15 | 0.7487 | 1460.0 |
| 313.15 | 0.8644 | 1506.0 |
| 313.15 | 0.9804 | 1550.0 |
| 313.15 | 1.0000 | 1558.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1197.0 |
| 303.15 | 0.0252 | 1208.0 |
| 303.15 | 0.1627 | 1257.0 |
| 303.15 | 0.2922 | 1300.0 |
| 303.15 | 0.4201 | 1345.0 |
| 303.15 | 0.5234 | 1388.0 |
| 303.15 | 0.6292 | 1435.0 |
| 303.15 | 0.7487 | 1490.0 |
| 303.15 | 0.8644 | 1536.0 |
| 303.15 | 0.9804 | 1579.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1179.0 |
| 308.15 | 0.0252 | 1191.0 |
| 308.15 | 0.1627 | 1240.0 |
| 308.15 | 0.2922 | 1283.0 |
| 308.15 | 0.4201 | 1331.0 |
| 308.15 | 0.5234 | 1376.0 |
| 308.15 | 0.6292 | 1421.0 |
| 308.15 | 0.7487 | 1473.0 |
| 308.15 | 0.8644 | 1520.0 |
| 308.15 | 0.9804 | 1566.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1160.0 |
| 313.15 | 0.0252 | 1170.0 |
| 313.15 | 0.1627 | 1218.0 |
| 313.15 | 0.2922 | 1263.0 |
| 313.15 | 0.4201 | 1315.0 |
| 313.15 | 0.5234 | 1361.0 |
| 313.15 | 0.6292 | 1406.0 |
| 313.15 | 0.7487 | 1460.0 |
| 313.15 | 0.8644 | 1506.0 |
| 313.15 | 0.9804 | 1550.0 |
| 313.15 | 1.0000 | 1558.0 |