- Name
- Benzoic acid, methyl ester
- InChI
- InChI=1S/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- QPJVMBTYPHYUOC-UHFFFAOYSA-N
- Formula
- C8H8O2
- SMILES
- COC(=O)c1ccccc1
- Mol. Weight (g/mol)
- 136.15
- CAS
- 93-58-3
- Name
- Heptane
- InChI
- InChI=1S/C7H16/c1-3-5-7-6-4-2/h3-7H2,1-2H3
- InChI Key
- IMNFDUFMRHMDMM-UHFFFAOYSA-N
- Formula
- C7H16
- SMILES
- CCCCCCC
- Mol. Weight (g/mol)
- 100.20
- CAS
- 142-82-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (1) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.1154 | 0.0004 |
| 303.15 | 0.2273 | 0.0005 |
| 303.15 | 0.3350 | 0.0005 |
| 303.15 | 0.4390 | 0.0006 |
| 303.15 | 0.5404 | 0.0007 |
| 303.15 | 0.6365 | 0.0008 |
| 303.15 | 0.7324 | 0.0010 |
| 303.15 | 0.8252 | 0.0012 |
| 303.15 | 0.9133 | 0.0014 |
| 303.15 | 1.0000 | 0.0017 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1154 | 0.0004 |
| 308.15 | 0.2273 | 0.0004 |
| 308.15 | 0.3350 | 0.0005 |
| 308.15 | 0.4390 | 0.0006 |
| 308.15 | 0.5404 | 0.0007 |
| 308.15 | 0.6365 | 0.0008 |
| 308.15 | 0.7324 | 0.0009 |
| 308.15 | 0.8252 | 0.0011 |
| 308.15 | 0.9133 | 0.0013 |
| 308.15 | 1.0000 | 0.0015 |
| 313.15 | 0.0000 | 0.0003 |
| 313.15 | 0.1154 | 0.0003 |
| 313.15 | 0.2273 | 0.0004 |
| 313.15 | 0.3350 | 0.0005 |
| 313.15 | 0.4390 | 0.0005 |
| 313.15 | 0.5404 | 0.0006 |
| 313.15 | 0.6365 | 0.0007 |
| 313.15 | 0.7324 | 0.0008 |
| 313.15 | 0.8252 | 0.0010 |
| 313.15 | 0.9133 | 0.0011 |
| 313.15 | 1.0000 | 0.0014 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (1) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.1154 | 0.0004 |
| 303.15 | 0.2273 | 0.0005 |
| 303.15 | 0.3350 | 0.0005 |
| 303.15 | 0.4390 | 0.0006 |
| 303.15 | 0.5404 | 0.0007 |
| 303.15 | 0.6365 | 0.0008 |
| 303.15 | 0.7324 | 0.0010 |
| 303.15 | 0.8252 | 0.0012 |
| 303.15 | 0.9133 | 0.0014 |
| 303.15 | 1.0000 | 0.0017 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1154 | 0.0004 |
| 308.15 | 0.2273 | 0.0004 |
| 308.15 | 0.3350 | 0.0005 |
| 308.15 | 0.4390 | 0.0006 |
| 308.15 | 0.5404 | 0.0007 |
| 308.15 | 0.6365 | 0.0008 |
| 308.15 | 0.7324 | 0.0009 |
| 308.15 | 0.8252 | 0.0011 |
| 308.15 | 0.9133 | 0.0013 |
| 308.15 | 1.0000 | 0.0015 |
| 313.15 | 0.0000 | 0.0003 |
| 313.15 | 0.1154 | 0.0003 |
| 313.15 | 0.2273 | 0.0004 |
| 313.15 | 0.3350 | 0.0005 |
| 313.15 | 0.4390 | 0.0005 |
| 313.15 | 0.5404 | 0.0006 |
| 313.15 | 0.6365 | 0.0007 |
| 313.15 | 0.7324 | 0.0008 |
| 313.15 | 0.8252 | 0.0010 |
| 313.15 | 0.9133 | 0.0011 |
| 313.15 | 1.0000 | 0.0014 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Heptane (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 433.15 | 0.3173 | 255.00 |
| 433.15 | 0.5012 | 307.00 |
| 433.15 | 0.6790 | 369.00 |
| 433.15 | 0.8942 | 440.00 |
| 433.15 | 1.0000 | 477.00 |
| 443.15 | 0.3202 | 298.00 |
| 443.15 | 0.5004 | 367.00 |
| 443.15 | 0.6783 | 440.00 |
| 443.15 | 0.8932 | 527.00 |
| 443.15 | 1.0000 | 587.00 |
| 453.15 | 0.3300 | 357.00 |
| 453.15 | 0.4990 | 443.00 |
| 453.15 | 0.6774 | 532.00 |
| 453.15 | 0.8940 | 645.00 |
| 453.15 | 1.0000 | 703.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Heptane (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 433.15 | 0.3173 | 255.00 |
| 433.15 | 0.5012 | 307.00 |
| 433.15 | 0.6790 | 369.00 |
| 433.15 | 0.8942 | 440.00 |
| 433.15 | 1.0000 | 477.00 |
| 443.15 | 0.3202 | 298.00 |
| 443.15 | 0.5004 | 367.00 |
| 443.15 | 0.6783 | 440.00 |
| 443.15 | 0.8932 | 527.00 |
| 443.15 | 1.0000 | 587.00 |
| 453.15 | 0.3300 | 357.00 |
| 453.15 | 0.4990 | 443.00 |
| 453.15 | 0.6774 | 532.00 |
| 453.15 | 0.8940 | 645.00 |
| 453.15 | 1.0000 | 703.00 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 674.5 |
| 303.15 | 0.1154 | 715.5 |
| 303.15 | 0.2273 | 756.4 |
| 303.15 | 0.3350 | 797.1 |
| 303.15 | 0.4390 | 837.7 |
| 303.15 | 0.5404 | 878.6 |
| 303.15 | 0.6365 | 918.3 |
| 303.15 | 0.7324 | 959.0 |
| 303.15 | 0.8252 | 999.4 |
| 303.15 | 0.9133 | 1038.7 |
| 303.15 | 1.0000 | 1078.3 |
| 308.15 | 0.0000 | 670.3 |
| 308.15 | 0.1154 | 711.3 |
| 308.15 | 0.2273 | 752.4 |
| 308.15 | 0.3350 | 793.1 |
| 308.15 | 0.4390 | 833.9 |
| 308.15 | 0.5404 | 874.8 |
| 308.15 | 0.6365 | 914.7 |
| 308.15 | 0.7324 | 955.3 |
| 308.15 | 0.8252 | 995.7 |
| 308.15 | 0.9133 | 1034.8 |
| 308.15 | 1.0000 | 1074.4 |
| 313.15 | 0.0000 | 667.2 |
| 313.15 | 0.1154 | 708.1 |
| 313.15 | 0.2273 | 749.1 |
| 313.15 | 0.3350 | 789.8 |
| 313.15 | 0.4390 | 830.5 |
| 313.15 | 0.5404 | 871.3 |
| 313.15 | 0.6365 | 911.1 |
| 313.15 | 0.7324 | 951.7 |
| 313.15 | 0.8252 | 992.1 |
| 313.15 | 0.9133 | 1030.9 |
| 313.15 | 1.0000 | 1070.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 674.5 |
| 303.15 | 0.1154 | 715.5 |
| 303.15 | 0.2273 | 756.4 |
| 303.15 | 0.3350 | 797.1 |
| 303.15 | 0.4390 | 837.7 |
| 303.15 | 0.5404 | 878.6 |
| 303.15 | 0.6365 | 918.3 |
| 303.15 | 0.7324 | 959.0 |
| 303.15 | 0.8252 | 999.4 |
| 303.15 | 0.9133 | 1038.7 |
| 303.15 | 1.0000 | 1078.3 |
| 308.15 | 0.0000 | 670.3 |
| 308.15 | 0.1154 | 711.3 |
| 308.15 | 0.2273 | 752.4 |
| 308.15 | 0.3350 | 793.1 |
| 308.15 | 0.4390 | 833.9 |
| 308.15 | 0.5404 | 874.8 |
| 308.15 | 0.6365 | 914.7 |
| 308.15 | 0.7324 | 955.3 |
| 308.15 | 0.8252 | 995.7 |
| 308.15 | 0.9133 | 1034.8 |
| 308.15 | 1.0000 | 1074.4 |
| 313.15 | 0.0000 | 667.2 |
| 313.15 | 0.1154 | 708.1 |
| 313.15 | 0.2273 | 749.1 |
| 313.15 | 0.3350 | 789.8 |
| 313.15 | 0.4390 | 830.5 |
| 313.15 | 0.5404 | 871.3 |
| 313.15 | 0.6365 | 911.1 |
| 313.15 | 0.7324 | 951.7 |
| 313.15 | 0.8252 | 992.1 |
| 313.15 | 0.9133 | 1030.9 |
| 313.15 | 1.0000 | 1070.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1116.0 |
| 303.15 | 0.1154 | 1128.0 |
| 303.15 | 0.2273 | 1148.0 |
| 303.15 | 0.3350 | 1168.0 |
| 303.15 | 0.4390 | 1192.0 |
| 303.15 | 0.5404 | 1220.0 |
| 303.15 | 0.6365 | 1248.0 |
| 303.15 | 0.7324 | 1276.0 |
| 303.15 | 0.8252 | 1308.0 |
| 303.15 | 0.9133 | 1348.0 |
| 303.15 | 1.0000 | 1380.0 |
| 308.15 | 0.0000 | 1092.0 |
| 308.15 | 0.1154 | 1108.0 |
| 308.15 | 0.2273 | 1128.0 |
| 308.15 | 0.3350 | 1148.0 |
| 308.15 | 0.4390 | 1172.0 |
| 308.15 | 0.5404 | 1196.0 |
| 308.15 | 0.6365 | 1228.0 |
| 308.15 | 0.7324 | 1260.0 |
| 308.15 | 0.8252 | 1296.0 |
| 308.15 | 0.9133 | 1336.0 |
| 308.15 | 1.0000 | 1364.0 |
| 313.15 | 0.0000 | 1072.0 |
| 313.15 | 0.1154 | 1088.0 |
| 313.15 | 0.2273 | 1108.0 |
| 313.15 | 0.3350 | 1128.0 |
| 313.15 | 0.4390 | 1152.0 |
| 313.15 | 0.5404 | 1180.0 |
| 313.15 | 0.6365 | 1212.0 |
| 313.15 | 0.7324 | 1248.0 |
| 313.15 | 0.8252 | 1284.0 |
| 313.15 | 0.9133 | 1324.0 |
| 313.15 | 1.0000 | 1348.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1116.0 |
| 303.15 | 0.1154 | 1128.0 |
| 303.15 | 0.2273 | 1148.0 |
| 303.15 | 0.3350 | 1168.0 |
| 303.15 | 0.4390 | 1192.0 |
| 303.15 | 0.5404 | 1220.0 |
| 303.15 | 0.6365 | 1248.0 |
| 303.15 | 0.7324 | 1276.0 |
| 303.15 | 0.8252 | 1308.0 |
| 303.15 | 0.9133 | 1348.0 |
| 303.15 | 1.0000 | 1380.0 |
| 308.15 | 0.0000 | 1092.0 |
| 308.15 | 0.1154 | 1108.0 |
| 308.15 | 0.2273 | 1128.0 |
| 308.15 | 0.3350 | 1148.0 |
| 308.15 | 0.4390 | 1172.0 |
| 308.15 | 0.5404 | 1196.0 |
| 308.15 | 0.6365 | 1228.0 |
| 308.15 | 0.7324 | 1260.0 |
| 308.15 | 0.8252 | 1296.0 |
| 308.15 | 0.9133 | 1336.0 |
| 308.15 | 1.0000 | 1364.0 |
| 313.15 | 0.0000 | 1072.0 |
| 313.15 | 0.1154 | 1088.0 |
| 313.15 | 0.2273 | 1108.0 |
| 313.15 | 0.3350 | 1128.0 |
| 313.15 | 0.4390 | 1152.0 |
| 313.15 | 0.5404 | 1180.0 |
| 313.15 | 0.6365 | 1212.0 |
| 313.15 | 0.7324 | 1248.0 |
| 313.15 | 0.8252 | 1284.0 |
| 313.15 | 0.9133 | 1324.0 |
| 313.15 | 1.0000 | 1348.0 |
Sources
- In Situ Determination of Phase Equilibria of Methyl Benzoate + Alkane Mixtures Using an Infrared Absorption Method. Comparison with Polar GC-SAFT Predictions
- Density, Viscosity, and Speed of Sound of (Methyl Benzoate + Cyclohexane), (Methyl Benzoate + n-Hexane), (Methyl Benzoate + Heptane), and (Methyl Benzoate + Octane) at Temperatures of (303.15, 308.15, and 313.15) K