- Name
- Propanoic acid, ethyl ester
- InChI
- InChI=1S/C5H10O2/c1-3-5(6)7-4-2/h3-4H2,1-2H3
- InChI Key
- FKRCODPIKNYEAC-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCOC(=O)CC
- Mol. Weight (g/mol)
- 102.13
- CAS
- 105-37-3
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Pc - Critical pressure, kPa (4)
- Pvap - Vapor or sublimation pressure, kPa (2)
- ρc - Critical density, kg/m3 (2)
- ρg - Mass density, kg/m3 (2)
- ρl - Mass density, kg/m3 (2)
- Tc - Critical temperature, K (4)
Mole fraction of Carbon dioxide (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Carbon dioxide (2) - Liquid | Temperature, K - Liquid | Mole fraction of Carbon dioxide (2) - Gas |
| 0.3282 | 373.00 | 0.0444 |
| 0.3557 | 353.00 | 0.0484 |
| 0.3961 | 373.00 | 0.0686 |
| 0.4093 | 333.00 | 0.0524 |
| 0.4093 | 353.00 | 0.0679 |
| 0.4733 | 333.00 | 0.0629 |
| 0.4746 | 353.00 | 0.0923 |
| 0.4965 | 373.00 | 0.1045 |
| 0.5422 | 373.00 | 0.1340 |
| 0.5459 | 353.00 | 0.1162 |
| 0.5479 | 333.00 | 0.0940 |
| 0.5818 | 313.00 | 0.0660 |
| 0.6173 | 353.00 | 0.1485 |
| 0.6214 | 333.00 | 0.1235 |
| 0.6332 | 373.00 | 0.2177 |
| 0.6608 | 333.00 | 0.1461 |
| 0.6847 | 353.00 | 0.1954 |
| 0.6881 | 313.00 | 0.1018 |
| 0.7127 | 373.00 | 0.3590 |
| 0.7224 | 333.00 | 0.2018 |
| 0.7391 | 373.00 | 0.3922 |
| 0.7509 | 313.00 | 0.1106 |
| 0.7529 | 353.00 | 0.2698 |
| 0.7819 | 333.00 | 0.2616 |
| 0.7990 | 313.00 | 0.1368 |
| 0.8301 | 313.00 | 0.1887 |
| 0.8675 | 313.00 | 0.2484 |
| 0.8871 | 313.00 | 0.2799 |
Mole fraction of Carbon dioxide (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Carbon dioxide (2) - Liquid | Temperature, K - Liquid | Mole fraction of Carbon dioxide (2) - Gas |
| 0.3282 | 373.00 | 0.0444 |
| 0.3557 | 353.00 | 0.0484 |
| 0.3961 | 373.00 | 0.0686 |
| 0.4093 | 333.00 | 0.0524 |
| 0.4093 | 353.00 | 0.0679 |
| 0.4733 | 333.00 | 0.0629 |
| 0.4746 | 353.00 | 0.0923 |
| 0.4965 | 373.00 | 0.1045 |
| 0.5422 | 373.00 | 0.1340 |
| 0.5459 | 353.00 | 0.1162 |
| 0.5479 | 333.00 | 0.0940 |
| 0.5818 | 313.00 | 0.0660 |
| 0.6173 | 353.00 | 0.1485 |
| 0.6214 | 333.00 | 0.1235 |
| 0.6332 | 373.00 | 0.2177 |
| 0.6608 | 333.00 | 0.1461 |
| 0.6847 | 353.00 | 0.1954 |
| 0.6881 | 313.00 | 0.1018 |
| 0.7127 | 373.00 | 0.3590 |
| 0.7224 | 333.00 | 0.2018 |
| 0.7391 | 373.00 | 0.3922 |
| 0.7509 | 313.00 | 0.1106 |
| 0.7529 | 353.00 | 0.2698 |
| 0.7819 | 333.00 | 0.2616 |
| 0.7990 | 313.00 | 0.1368 |
| 0.8301 | 313.00 | 0.1887 |
| 0.8675 | 313.00 | 0.2484 |
| 0.8871 | 313.00 | 0.2799 |
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.8593 | 12490.00 |
| 0.9128 | 10890.00 |
| 0.9623 | 9330.00 |
| 0.9917 | 8230.00 |
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.0000 | 3385.60 |
| 0.1446 | 5079.60 |
| 0.3120 | 7345.00 |
| 0.4697 | 9413.30 |
| 0.5797 | 10738.30 |
| 0.6525 | 11585.40 |
| 0.7414 | 12501.50 |
| 0.8454 | 13202.00 |
| 0.8997 | 13325.60 |
| 0.9212 | 12184.10 |
| 0.9497 | 10510.20 |
| 1.0000 | 7379.80 |
Mole fraction of Carbon dioxide (2)
Critical pressure, kPa
4000
6000
8000
10000
12000
14000
0
0.5
1
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.8593 | 12490.00 |
| 0.9128 | 10890.00 |
| 0.9623 | 9330.00 |
| 0.9917 | 8230.00 |
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.0000 | 3385.60 |
| 0.1446 | 5079.60 |
| 0.3120 | 7345.00 |
| 0.4697 | 9413.30 |
| 0.5797 | 10738.30 |
| 0.6525 | 11585.40 |
| 0.7414 | 12501.50 |
| 0.8454 | 13202.00 |
| 0.8997 | 13325.60 |
| 0.9212 | 12184.10 |
| 0.9497 | 10510.20 |
| 1.0000 | 7379.80 |
Mole fraction of Carbon dioxide (2)
Critical pressure, kPa
4000
6000
8000
10000
12000
14000
0
0.5
1
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Carbon dioxide (2) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.3282 | 373.00 | 2960.00 |
| 0.3557 | 353.00 | 2960.00 |
| 0.3961 | 373.00 | 4460.00 |
| 0.4093 | 333.00 | 2960.00 |
| 0.4093 | 353.00 | 3860.00 |
| 0.4733 | 333.00 | 3460.00 |
| 0.4746 | 353.00 | 4960.00 |
| 0.4965 | 373.00 | 5960.00 |
| 0.5422 | 373.00 | 7470.00 |
| 0.5459 | 353.00 | 5960.00 |
| 0.5479 | 333.00 | 4460.00 |
| 0.5818 | 313.00 | 2960.00 |
| 0.6173 | 353.00 | 6960.00 |
| 0.6214 | 333.00 | 5460.00 |
| 0.6332 | 373.00 | 8970.00 |
| 0.6608 | 333.00 | 5960.00 |
| 0.6847 | 353.00 | 7970.00 |
| 0.6881 | 313.00 | 3960.00 |
| 0.7127 | 373.00 | 10570.00 |
| 0.7224 | 333.00 | 6660.00 |
| 0.7391 | 373.00 | 10970.00 |
| 0.7509 | 313.00 | 4460.00 |
| 0.7529 | 353.00 | 8870.00 |
| 0.7819 | 333.00 | 7260.00 |
| 0.7990 | 313.00 | 4960.00 |
| 0.8301 | 313.00 | 5460.00 |
| 0.8675 | 313.00 | 5970.00 |
| 0.8871 | 313.00 | 6270.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Carbon dioxide (2) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.3282 | 373.00 | 2960.00 |
| 0.3557 | 353.00 | 2960.00 |
| 0.3961 | 373.00 | 4460.00 |
| 0.4093 | 333.00 | 2960.00 |
| 0.4093 | 353.00 | 3860.00 |
| 0.4733 | 333.00 | 3460.00 |
| 0.4746 | 353.00 | 4960.00 |
| 0.4965 | 373.00 | 5960.00 |
| 0.5422 | 373.00 | 7470.00 |
| 0.5459 | 353.00 | 5960.00 |
| 0.5479 | 333.00 | 4460.00 |
| 0.5818 | 313.00 | 2960.00 |
| 0.6173 | 353.00 | 6960.00 |
| 0.6214 | 333.00 | 5460.00 |
| 0.6332 | 373.00 | 8970.00 |
| 0.6608 | 333.00 | 5960.00 |
| 0.6847 | 353.00 | 7970.00 |
| 0.6881 | 313.00 | 3960.00 |
| 0.7127 | 373.00 | 10570.00 |
| 0.7224 | 333.00 | 6660.00 |
| 0.7391 | 373.00 | 10970.00 |
| 0.7509 | 313.00 | 4460.00 |
| 0.7529 | 353.00 | 8870.00 |
| 0.7819 | 333.00 | 7260.00 |
| 0.7990 | 313.00 | 4960.00 |
| 0.8301 | 313.00 | 5460.00 |
| 0.8675 | 313.00 | 5970.00 |
| 0.8871 | 313.00 | 6270.00 |
Critical density, kg/m3 [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical density, kg/m3 - Liquid |
|---|---|
| 0.8593 | 627.1 |
| 0.9128 | 635.1 |
| 0.9623 | 648.4 |
| 0.9917 | 670.9 |
Critical density, kg/m3 [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical density, kg/m3 - Liquid |
|---|---|
| 0.8593 | 627.1 |
| 0.9128 | 635.1 |
| 0.9623 | 648.4 |
| 0.9917 | 670.9 |
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Gas | Pressure, kPa - Gas | Mole fraction of Carbon dioxide (2) - Gas | Mass density, kg/m3 - Gas |
| 313.00 | 2960.00 | 0.0660 | 993.3 |
| 313.00 | 3960.00 | 0.1018 | 996.8 |
| 313.00 | 4460.00 | 0.1106 | 997.8 |
| 313.00 | 4960.00 | 0.1368 | 998.0 |
| 313.00 | 5460.00 | 0.1887 | 997.0 |
| 313.00 | 5970.00 | 0.2484 | 996.1 |
| 313.00 | 6270.00 | 0.2799 | 995.6 |
| 333.00 | 2960.00 | 0.0524 | 996.3 |
| 333.00 | 3460.00 | 0.0629 | 996.1 |
| 333.00 | 4460.00 | 0.0940 | 994.5 |
| 333.00 | 5460.00 | 0.1235 | 992.9 |
| 333.00 | 5960.00 | 0.1461 | 991.0 |
| 333.00 | 6660.00 | 0.2018 | 990.5 |
| 333.00 | 7260.00 | 0.2616 | 990.0 |
| 353.00 | 2960.00 | 0.0484 | 993.0 |
| 353.00 | 3860.00 | 0.0679 | 990.0 |
| 353.00 | 4960.00 | 0.0923 | 989.1 |
| 353.00 | 5960.00 | 0.1162 | 986.0 |
| 353.00 | 6960.00 | 0.1485 | 982.0 |
| 353.00 | 7970.00 | 0.1954 | 974.2 |
| 353.00 | 8870.00 | 0.2698 | 972.2 |
| 373.00 | 2960.00 | 0.0444 | 981.3 |
| 373.00 | 4460.00 | 0.0686 | 975.5 |
| 373.00 | 5960.00 | 0.1045 | 972.9 |
| 373.00 | 7470.00 | 0.1340 | 972.5 |
| 373.00 | 8970.00 | 0.2177 | 962.6 |
| 373.00 | 10570.00 | 0.3590 | 954.5 |
| 373.00 | 10970.00 | 0.3922 | 946.4 |
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Gas | Pressure, kPa - Gas | Mole fraction of Carbon dioxide (2) - Gas | Mass density, kg/m3 - Gas |
| 313.00 | 2960.00 | 0.0660 | 993.3 |
| 313.00 | 3960.00 | 0.1018 | 996.8 |
| 313.00 | 4460.00 | 0.1106 | 997.8 |
| 313.00 | 4960.00 | 0.1368 | 998.0 |
| 313.00 | 5460.00 | 0.1887 | 997.0 |
| 313.00 | 5970.00 | 0.2484 | 996.1 |
| 313.00 | 6270.00 | 0.2799 | 995.6 |
| 333.00 | 2960.00 | 0.0524 | 996.3 |
| 333.00 | 3460.00 | 0.0629 | 996.1 |
| 333.00 | 4460.00 | 0.0940 | 994.5 |
| 333.00 | 5460.00 | 0.1235 | 992.9 |
| 333.00 | 5960.00 | 0.1461 | 991.0 |
| 333.00 | 6660.00 | 0.2018 | 990.5 |
| 333.00 | 7260.00 | 0.2616 | 990.0 |
| 353.00 | 2960.00 | 0.0484 | 993.0 |
| 353.00 | 3860.00 | 0.0679 | 990.0 |
| 353.00 | 4960.00 | 0.0923 | 989.1 |
| 353.00 | 5960.00 | 0.1162 | 986.0 |
| 353.00 | 6960.00 | 0.1485 | 982.0 |
| 353.00 | 7970.00 | 0.1954 | 974.2 |
| 353.00 | 8870.00 | 0.2698 | 972.2 |
| 373.00 | 2960.00 | 0.0444 | 981.3 |
| 373.00 | 4460.00 | 0.0686 | 975.5 |
| 373.00 | 5960.00 | 0.1045 | 972.9 |
| 373.00 | 7470.00 | 0.1340 | 972.5 |
| 373.00 | 8970.00 | 0.2177 | 962.6 |
| 373.00 | 10570.00 | 0.3590 | 954.5 |
| 373.00 | 10970.00 | 0.3922 | 946.4 |
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 313.00 | 2960.00 | 0.5818 | 971.0 |
| 313.00 | 3960.00 | 0.6881 | 973.6 |
| 313.00 | 4460.00 | 0.7509 | 965.9 |
| 313.00 | 4960.00 | 0.7990 | 960.9 |
| 313.00 | 5460.00 | 0.8301 | 950.9 |
| 313.00 | 5970.00 | 0.8675 | 923.3 |
| 313.00 | 6270.00 | 0.8871 | 902.4 |
| 333.00 | 2960.00 | 0.4093 | 900.2 |
| 333.00 | 3460.00 | 0.4733 | 905.3 |
| 333.00 | 4460.00 | 0.5479 | 902.9 |
| 333.00 | 5460.00 | 0.6214 | 895.5 |
| 333.00 | 5960.00 | 0.6608 | 886.6 |
| 333.00 | 6660.00 | 0.7224 | 868.7 |
| 333.00 | 7260.00 | 0.7819 | 842.2 |
| 353.00 | 2960.00 | 0.3557 | 864.4 |
| 353.00 | 3860.00 | 0.4093 | 864.9 |
| 353.00 | 4960.00 | 0.4746 | 869.1 |
| 353.00 | 5960.00 | 0.5459 | 855.1 |
| 353.00 | 6960.00 | 0.6173 | 854.0 |
| 353.00 | 7970.00 | 0.6847 | 850.5 |
| 353.00 | 8870.00 | 0.7529 | 824.3 |
| 373.00 | 2960.00 | 0.3282 | 817.0 |
| 373.00 | 4460.00 | 0.3961 | 812.4 |
| 373.00 | 5960.00 | 0.4965 | 802.1 |
| 373.00 | 7470.00 | 0.5422 | 788.2 |
| 373.00 | 8970.00 | 0.6332 | 766.7 |
| 373.00 | 10570.00 | 0.7127 | 735.7 |
| 373.00 | 10970.00 | 0.7391 | 720.9 |
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 313.00 | 2960.00 | 0.5818 | 971.0 |
| 313.00 | 3960.00 | 0.6881 | 973.6 |
| 313.00 | 4460.00 | 0.7509 | 965.9 |
| 313.00 | 4960.00 | 0.7990 | 960.9 |
| 313.00 | 5460.00 | 0.8301 | 950.9 |
| 313.00 | 5970.00 | 0.8675 | 923.3 |
| 313.00 | 6270.00 | 0.8871 | 902.4 |
| 333.00 | 2960.00 | 0.4093 | 900.2 |
| 333.00 | 3460.00 | 0.4733 | 905.3 |
| 333.00 | 4460.00 | 0.5479 | 902.9 |
| 333.00 | 5460.00 | 0.6214 | 895.5 |
| 333.00 | 5960.00 | 0.6608 | 886.6 |
| 333.00 | 6660.00 | 0.7224 | 868.7 |
| 333.00 | 7260.00 | 0.7819 | 842.2 |
| 353.00 | 2960.00 | 0.3557 | 864.4 |
| 353.00 | 3860.00 | 0.4093 | 864.9 |
| 353.00 | 4960.00 | 0.4746 | 869.1 |
| 353.00 | 5960.00 | 0.5459 | 855.1 |
| 353.00 | 6960.00 | 0.6173 | 854.0 |
| 353.00 | 7970.00 | 0.6847 | 850.5 |
| 353.00 | 8870.00 | 0.7529 | 824.3 |
| 373.00 | 2960.00 | 0.3282 | 817.0 |
| 373.00 | 4460.00 | 0.3961 | 812.4 |
| 373.00 | 5960.00 | 0.4965 | 802.1 |
| 373.00 | 7470.00 | 0.5422 | 788.2 |
| 373.00 | 8970.00 | 0.6332 | 766.7 |
| 373.00 | 10570.00 | 0.7127 | 735.7 |
| 373.00 | 10970.00 | 0.7391 | 720.9 |
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.8593 | 373.20 |
| 0.9128 | 353.20 |
| 0.9623 | 333.20 |
| 0.9917 | 313.20 |
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.0000 | 546.28 |
| 0.1446 | 532.94 |
| 0.3120 | 514.86 |
| 0.4697 | 494.30 |
| 0.5797 | 479.18 |
| 0.6525 | 466.83 |
| 0.7414 | 447.82 |
| 0.8454 | 420.94 |
| 0.8997 | 391.61 |
| 0.9212 | 362.40 |
| 0.9497 | 339.59 |
| 1.0000 | 304.30 |
Mole fraction of Carbon dioxide (2)
Critical temperature, K
300
350
400
450
500
550
0
0.5
1
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.8593 | 373.20 |
| 0.9128 | 353.20 |
| 0.9623 | 333.20 |
| 0.9917 | 313.20 |
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (2) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.0000 | 546.28 |
| 0.1446 | 532.94 |
| 0.3120 | 514.86 |
| 0.4697 | 494.30 |
| 0.5797 | 479.18 |
| 0.6525 | 466.83 |
| 0.7414 | 447.82 |
| 0.8454 | 420.94 |
| 0.8997 | 391.61 |
| 0.9212 | 362.40 |
| 0.9497 | 339.59 |
| 1.0000 | 304.30 |
Mole fraction of Carbon dioxide (2)
Critical temperature, K
300
350
400
450
500
550
0
0.5
1
Sources
- Experimental determination and calculation of the critical curves for the binary systems of CO2 containing ketone, alkane, ester and alcohol, respectively
- Vapor-Liquid Equilibria of the Carbon Dioxide + Ethyl Propanoate and Carbon Dioxide + Ethyl Acetate Systems at Pressure from 2.96 MPa to 11.79 MPa and Temperature from 313 K to 393 K
- Development of a Predictive Equation of State for CO2 + Ethyl Ester Mixtures Based on Critical Points Measurements