- Name
- Tridecane
- InChI
- InChI=1S/C13H28/c1-3-5-7-9-11-13-12-10-8-6-4-2/h3-13H2,1-2H3
- InChI Key
- IIYFAKIEWZDVMP-UHFFFAOYSA-N
- Formula
- C13H28
- SMILES
- CCCCCCCCCCCCC
- Mol. Weight (g/mol)
- 184.36
- CAS
- 629-50-5
- Name
- 4,7-Methano-1H-indene, octahydro-
- InChI
- InChI=1S/C10H16/c1-2-9-7-4-5-8(6-7)10(9)3-1/h7-10H,1-6H2
- InChI Key
- LPSXSORODABQKT-UHFFFAOYSA-N
- Formula
- C10H16
- SMILES
- C1CC2C3CCC(C3)C2C1
- Mol. Weight (g/mol)
- 136.23
- CAS
- 6004-38-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0031 |
| 293.15 | 0.0757 | 0.0029 |
| 293.15 | 0.1546 | 0.0027 |
| 293.15 | 0.2392 | 0.0026 |
| 293.15 | 0.3284 | 0.0024 |
| 293.15 | 0.4236 | 0.0023 |
| 293.15 | 0.5258 | 0.0022 |
| 293.15 | 0.6320 | 0.0021 |
| 293.15 | 0.7477 | 0.0020 |
| 293.15 | 0.8665 | 0.0020 |
| 293.15 | 1.0000 | 0.0019 |
| 298.15 | 0.0000 | 0.0028 |
| 298.15 | 0.0757 | 0.0026 |
| 298.15 | 0.1546 | 0.0024 |
| 298.15 | 0.2392 | 0.0023 |
| 298.15 | 0.3284 | 0.0022 |
| 298.15 | 0.4236 | 0.0021 |
| 298.15 | 0.5258 | 0.0020 |
| 298.15 | 0.6320 | 0.0019 |
| 298.15 | 0.7477 | 0.0018 |
| 298.15 | 0.8665 | 0.0018 |
| 298.15 | 1.0000 | 0.0017 |
| 303.15 | 0.0000 | 0.0025 |
| 303.15 | 0.0757 | 0.0024 |
| 303.15 | 0.1546 | 0.0022 |
| 303.15 | 0.2392 | 0.0021 |
| 303.15 | 0.3284 | 0.0020 |
| 303.15 | 0.4236 | 0.0019 |
| 303.15 | 0.5258 | 0.0018 |
| 303.15 | 0.6320 | 0.0017 |
| 303.15 | 0.7477 | 0.0017 |
| 303.15 | 0.8665 | 0.0016 |
| 303.15 | 1.0000 | 0.0016 |
| 313.15 | 0.0000 | 0.0021 |
| 313.15 | 0.0757 | 0.0020 |
| 313.15 | 0.1546 | 0.0019 |
| 313.15 | 0.2392 | 0.0018 |
| 313.15 | 0.3284 | 0.0017 |
| 313.15 | 0.4236 | 0.0016 |
| 313.15 | 0.5258 | 0.0015 |
| 313.15 | 0.6320 | 0.0015 |
| 313.15 | 0.7477 | 0.0014 |
| 313.15 | 0.8665 | 0.0014 |
| 313.15 | 1.0000 | 0.0013 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0031 |
| 293.15 | 0.0757 | 0.0029 |
| 293.15 | 0.1546 | 0.0027 |
| 293.15 | 0.2392 | 0.0026 |
| 293.15 | 0.3284 | 0.0024 |
| 293.15 | 0.4236 | 0.0023 |
| 293.15 | 0.5258 | 0.0022 |
| 293.15 | 0.6320 | 0.0021 |
| 293.15 | 0.7477 | 0.0020 |
| 293.15 | 0.8665 | 0.0020 |
| 293.15 | 1.0000 | 0.0019 |
| 298.15 | 0.0000 | 0.0028 |
| 298.15 | 0.0757 | 0.0026 |
| 298.15 | 0.1546 | 0.0024 |
| 298.15 | 0.2392 | 0.0023 |
| 298.15 | 0.3284 | 0.0022 |
| 298.15 | 0.4236 | 0.0021 |
| 298.15 | 0.5258 | 0.0020 |
| 298.15 | 0.6320 | 0.0019 |
| 298.15 | 0.7477 | 0.0018 |
| 298.15 | 0.8665 | 0.0018 |
| 298.15 | 1.0000 | 0.0017 |
| 303.15 | 0.0000 | 0.0025 |
| 303.15 | 0.0757 | 0.0024 |
| 303.15 | 0.1546 | 0.0022 |
| 303.15 | 0.2392 | 0.0021 |
| 303.15 | 0.3284 | 0.0020 |
| 303.15 | 0.4236 | 0.0019 |
| 303.15 | 0.5258 | 0.0018 |
| 303.15 | 0.6320 | 0.0017 |
| 303.15 | 0.7477 | 0.0017 |
| 303.15 | 0.8665 | 0.0016 |
| 303.15 | 1.0000 | 0.0016 |
| 313.15 | 0.0000 | 0.0021 |
| 313.15 | 0.0757 | 0.0020 |
| 313.15 | 0.1546 | 0.0019 |
| 313.15 | 0.2392 | 0.0018 |
| 313.15 | 0.3284 | 0.0017 |
| 313.15 | 0.4236 | 0.0016 |
| 313.15 | 0.5258 | 0.0015 |
| 313.15 | 0.6320 | 0.0015 |
| 313.15 | 0.7477 | 0.0014 |
| 313.15 | 0.8665 | 0.0014 |
| 313.15 | 1.0000 | 0.0013 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.4877 |
| 293.15 | 0.0757 | 1.4795 |
| 293.15 | 0.1546 | 1.4726 |
| 293.15 | 0.2392 | 1.4662 |
| 293.15 | 0.3284 | 1.4586 |
| 293.15 | 0.4236 | 1.4528 |
| 293.15 | 0.5258 | 1.4468 |
| 293.15 | 0.6320 | 1.4407 |
| 293.15 | 0.7477 | 1.4349 |
| 293.15 | 0.8665 | 1.4306 |
| 293.15 | 1.0000 | 1.4253 |
| 303.15 | 0.0000 | 1.4832 |
| 303.15 | 0.0757 | 1.4743 |
| 303.15 | 0.1546 | 1.4683 |
| 303.15 | 0.2392 | 1.4614 |
| 303.15 | 0.3284 | 1.4541 |
| 303.15 | 0.4236 | 1.4483 |
| 303.15 | 0.5258 | 1.442 |
| 303.15 | 0.6320 | 1.4357 |
| 303.15 | 0.7477 | 1.4305 |
| 303.15 | 0.8665 | 1.4258 |
| 303.15 | 1.0000 | 1.4213 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.4877 |
| 293.15 | 0.0757 | 1.4795 |
| 293.15 | 0.1546 | 1.4726 |
| 293.15 | 0.2392 | 1.4662 |
| 293.15 | 0.3284 | 1.4586 |
| 293.15 | 0.4236 | 1.4528 |
| 293.15 | 0.5258 | 1.4468 |
| 293.15 | 0.6320 | 1.4407 |
| 293.15 | 0.7477 | 1.4349 |
| 293.15 | 0.8665 | 1.4306 |
| 293.15 | 1.0000 | 1.4253 |
| 303.15 | 0.0000 | 1.4832 |
| 303.15 | 0.0757 | 1.4743 |
| 303.15 | 0.1546 | 1.4683 |
| 303.15 | 0.2392 | 1.4614 |
| 303.15 | 0.3284 | 1.4541 |
| 303.15 | 0.4236 | 1.4483 |
| 303.15 | 0.5258 | 1.442 |
| 303.15 | 0.6320 | 1.4357 |
| 303.15 | 0.7477 | 1.4305 |
| 303.15 | 0.8665 | 1.4258 |
| 303.15 | 1.0000 | 1.4213 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 935.3 |
| 293.15 | 0.0757 | 913.9 |
| 293.15 | 0.1546 | 893.5 |
| 293.15 | 0.2392 | 873.7 |
| 293.15 | 0.3284 | 854.6 |
| 293.15 | 0.4236 | 836.3 |
| 293.15 | 0.5258 | 818.7 |
| 293.15 | 0.6320 | 802.3 |
| 293.15 | 0.7477 | 786.3 |
| 293.15 | 0.8665 | 771.5 |
| 293.15 | 1.0000 | 756.5 |
| 298.15 | 0.0000 | 931.4 |
| 298.15 | 0.0757 | 910.0 |
| 298.15 | 0.1546 | 889.7 |
| 298.15 | 0.2392 | 869.9 |
| 298.15 | 0.3284 | 850.9 |
| 298.15 | 0.4236 | 832.6 |
| 298.15 | 0.5258 | 815.0 |
| 298.15 | 0.6320 | 798.7 |
| 298.15 | 0.7477 | 782.7 |
| 298.15 | 0.8665 | 767.9 |
| 298.15 | 1.0000 | 752.9 |
| 303.15 | 0.0000 | 927.5 |
| 303.15 | 0.0757 | 906.1 |
| 303.15 | 0.1546 | 885.9 |
| 303.15 | 0.2392 | 866.1 |
| 303.15 | 0.3284 | 847.1 |
| 303.15 | 0.4236 | 828.9 |
| 303.15 | 0.5258 | 811.3 |
| 303.15 | 0.6320 | 795.0 |
| 303.15 | 0.7477 | 779.0 |
| 303.15 | 0.8665 | 764.3 |
| 303.15 | 1.0000 | 749.3 |
| 313.15 | 0.0000 | 919.6 |
| 313.15 | 0.0757 | 898.4 |
| 313.15 | 0.1546 | 878.2 |
| 313.15 | 0.2392 | 858.4 |
| 313.15 | 0.3284 | 839.5 |
| 313.15 | 0.4236 | 821.4 |
| 313.15 | 0.5258 | 803.9 |
| 313.15 | 0.6320 | 787.7 |
| 313.15 | 0.7477 | 771.8 |
| 313.15 | 0.8665 | 757.0 |
| 313.15 | 1.0000 | 742.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 935.3 |
| 293.15 | 0.0757 | 913.9 |
| 293.15 | 0.1546 | 893.5 |
| 293.15 | 0.2392 | 873.7 |
| 293.15 | 0.3284 | 854.6 |
| 293.15 | 0.4236 | 836.3 |
| 293.15 | 0.5258 | 818.7 |
| 293.15 | 0.6320 | 802.3 |
| 293.15 | 0.7477 | 786.3 |
| 293.15 | 0.8665 | 771.5 |
| 293.15 | 1.0000 | 756.5 |
| 298.15 | 0.0000 | 931.4 |
| 298.15 | 0.0757 | 910.0 |
| 298.15 | 0.1546 | 889.7 |
| 298.15 | 0.2392 | 869.9 |
| 298.15 | 0.3284 | 850.9 |
| 298.15 | 0.4236 | 832.6 |
| 298.15 | 0.5258 | 815.0 |
| 298.15 | 0.6320 | 798.7 |
| 298.15 | 0.7477 | 782.7 |
| 298.15 | 0.8665 | 767.9 |
| 298.15 | 1.0000 | 752.9 |
| 303.15 | 0.0000 | 927.5 |
| 303.15 | 0.0757 | 906.1 |
| 303.15 | 0.1546 | 885.9 |
| 303.15 | 0.2392 | 866.1 |
| 303.15 | 0.3284 | 847.1 |
| 303.15 | 0.4236 | 828.9 |
| 303.15 | 0.5258 | 811.3 |
| 303.15 | 0.6320 | 795.0 |
| 303.15 | 0.7477 | 779.0 |
| 303.15 | 0.8665 | 764.3 |
| 303.15 | 1.0000 | 749.3 |
| 313.15 | 0.0000 | 919.6 |
| 313.15 | 0.0757 | 898.4 |
| 313.15 | 0.1546 | 878.2 |
| 313.15 | 0.2392 | 858.4 |
| 313.15 | 0.3284 | 839.5 |
| 313.15 | 0.4236 | 821.4 |
| 313.15 | 0.5258 | 803.9 |
| 313.15 | 0.6320 | 787.7 |
| 313.15 | 0.7477 | 771.8 |
| 313.15 | 0.8665 | 757.0 |
| 313.15 | 1.0000 | 742.2 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0319 |
| 293.15 | 0.0757 | 0.0304 |
| 293.15 | 0.1546 | 0.0296 |
| 293.15 | 0.2392 | 0.0285 |
| 293.15 | 0.3284 | 0.0280 |
| 293.15 | 0.4236 | 0.0272 |
| 293.15 | 0.5258 | 0.0267 |
| 293.15 | 0.6320 | 0.0260 |
| 293.15 | 0.7477 | 0.0255 |
| 293.15 | 0.8665 | 0.0252 |
| 293.15 | 1.0000 | 0.0248 |
| 303.15 | 0.0000 | 0.0311 |
| 303.15 | 0.0757 | 0.0299 |
| 303.15 | 0.1546 | 0.0290 |
| 303.15 | 0.2392 | 0.0284 |
| 303.15 | 0.3284 | 0.0272 |
| 303.15 | 0.4236 | 0.0267 |
| 303.15 | 0.5258 | 0.0257 |
| 303.15 | 0.6320 | 0.0254 |
| 303.15 | 0.7477 | 0.0248 |
| 303.15 | 0.8665 | 0.0245 |
| 303.15 | 1.0000 | 0.0241 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tridecane (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0319 |
| 293.15 | 0.0757 | 0.0304 |
| 293.15 | 0.1546 | 0.0296 |
| 293.15 | 0.2392 | 0.0285 |
| 293.15 | 0.3284 | 0.0280 |
| 293.15 | 0.4236 | 0.0272 |
| 293.15 | 0.5258 | 0.0267 |
| 293.15 | 0.6320 | 0.0260 |
| 293.15 | 0.7477 | 0.0255 |
| 293.15 | 0.8665 | 0.0252 |
| 293.15 | 1.0000 | 0.0248 |
| 303.15 | 0.0000 | 0.0311 |
| 303.15 | 0.0757 | 0.0299 |
| 303.15 | 0.1546 | 0.0290 |
| 303.15 | 0.2392 | 0.0284 |
| 303.15 | 0.3284 | 0.0272 |
| 303.15 | 0.4236 | 0.0267 |
| 303.15 | 0.5258 | 0.0257 |
| 303.15 | 0.6320 | 0.0254 |
| 303.15 | 0.7477 | 0.0248 |
| 303.15 | 0.8665 | 0.0245 |
| 303.15 | 1.0000 | 0.0241 |