- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
- Name
- Acetamide, N-methyl-
- InChI
- InChI=1S/C3H7NO/c1-3(5)4-2/h1-2H3,(H,4,5)
- InChI Key
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CNC(C)=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 79-16-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 888.9 |
| 303.15 | 0.0538 | 893.87 |
| 303.15 | 0.1843 | 903.06 |
| 303.15 | 0.2972 | 910.76 |
| 303.15 | 0.3991 | 917.49 |
| 303.15 | 0.4982 | 923.67 |
| 303.15 | 0.5940 | 929.3 |
| 303.15 | 0.6955 | 935.03 |
| 303.15 | 0.7437 | 937.68 |
| 303.15 | 0.9463 | 948.19 |
| 303.15 | 1.0000 | 951.3 |
| 308.15 | 0.0000 | 882.6 |
| 308.15 | 0.0537 | 887.58 |
| 308.15 | 0.1841 | 896.86 |
| 308.15 | 0.2969 | 904.58 |
| 308.15 | 0.3988 | 911.43 |
| 308.15 | 0.4979 | 917.94 |
| 308.15 | 0.5937 | 923.93 |
| 308.15 | 0.6952 | 930.02 |
| 308.15 | 0.7434 | 932.86 |
| 308.15 | 0.9488 | 943.96 |
| 308.15 | 1.0000 | 945.9 |
| 313.15 | 0.0000 | 875.9 |
| 313.15 | 0.0534 | 880.97 |
| 313.15 | 0.1833 | 891.3 |
| 313.15 | 0.2958 | 899.84 |
| 313.15 | 0.3976 | 907.15 |
| 313.15 | 0.4966 | 913.79 |
| 313.15 | 0.5924 | 920.09 |
| 313.15 | 0.6941 | 926.71 |
| 313.15 | 0.7431 | 929.67 |
| 313.15 | 0.9460 | 941.22 |
| 313.15 | 1.0000 | 943.6 |
| 318.15 | 0.0000 | 869.6 |
| 318.15 | 0.0533 | 875.13 |
| 318.15 | 0.1828 | 886.1 |
| 318.15 | 0.2951 | 894.79 |
| 318.15 | 0.3968 | 902.46 |
| 318.15 | 0.4958 | 909.37 |
| 318.15 | 0.5916 | 915.67 |
| 318.15 | 0.6934 | 922.12 |
| 318.15 | 0.7418 | 925.21 |
| 318.15 | 0.9458 | 937.26 |
| 318.15 | 1.0000 | 939.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 888.9 |
| 303.15 | 0.0538 | 893.87 |
| 303.15 | 0.1843 | 903.06 |
| 303.15 | 0.2972 | 910.76 |
| 303.15 | 0.3991 | 917.49 |
| 303.15 | 0.4982 | 923.67 |
| 303.15 | 0.5940 | 929.3 |
| 303.15 | 0.6955 | 935.03 |
| 303.15 | 0.7437 | 937.68 |
| 303.15 | 0.9463 | 948.19 |
| 303.15 | 1.0000 | 951.3 |
| 308.15 | 0.0000 | 882.6 |
| 308.15 | 0.0537 | 887.58 |
| 308.15 | 0.1841 | 896.86 |
| 308.15 | 0.2969 | 904.58 |
| 308.15 | 0.3988 | 911.43 |
| 308.15 | 0.4979 | 917.94 |
| 308.15 | 0.5937 | 923.93 |
| 308.15 | 0.6952 | 930.02 |
| 308.15 | 0.7434 | 932.86 |
| 308.15 | 0.9488 | 943.96 |
| 308.15 | 1.0000 | 945.9 |
| 313.15 | 0.0000 | 875.9 |
| 313.15 | 0.0534 | 880.97 |
| 313.15 | 0.1833 | 891.3 |
| 313.15 | 0.2958 | 899.84 |
| 313.15 | 0.3976 | 907.15 |
| 313.15 | 0.4966 | 913.79 |
| 313.15 | 0.5924 | 920.09 |
| 313.15 | 0.6941 | 926.71 |
| 313.15 | 0.7431 | 929.67 |
| 313.15 | 0.9460 | 941.22 |
| 313.15 | 1.0000 | 943.6 |
| 318.15 | 0.0000 | 869.6 |
| 318.15 | 0.0533 | 875.13 |
| 318.15 | 0.1828 | 886.1 |
| 318.15 | 0.2951 | 894.79 |
| 318.15 | 0.3968 | 902.46 |
| 318.15 | 0.4958 | 909.37 |
| 318.15 | 0.5916 | 915.67 |
| 318.15 | 0.6934 | 922.12 |
| 318.15 | 0.7418 | 925.21 |
| 318.15 | 0.9458 | 937.26 |
| 318.15 | 1.0000 | 939.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1119.0 |
| 303.15 | 0.0538 | 1132.0 |
| 303.15 | 0.1843 | 1167.0 |
| 303.15 | 0.2972 | 1197.0 |
| 303.15 | 0.3991 | 1223.0 |
| 303.15 | 0.4982 | 1248.0 |
| 303.15 | 0.5940 | 1271.0 |
| 303.15 | 0.6955 | 1295.0 |
| 303.15 | 0.7437 | 1306.0 |
| 303.15 | 0.9463 | 1354.0 |
| 303.15 | 1.0000 | 1367.0 |
| 308.15 | 0.0000 | 1098.0 |
| 308.15 | 0.0537 | 1114.0 |
| 308.15 | 0.1841 | 1149.0 |
| 308.15 | 0.2969 | 1180.0 |
| 308.15 | 0.3988 | 1208.0 |
| 308.15 | 0.4979 | 1234.0 |
| 308.15 | 0.5937 | 1259.0 |
| 308.15 | 0.6952 | 1284.0 |
| 308.15 | 0.7434 | 1296.0 |
| 308.15 | 0.9488 | 1348.0 |
| 308.15 | 1.0000 | 1362.0 |
| 313.15 | 0.0000 | 1081.0 |
| 313.15 | 0.0534 | 1097.0 |
| 313.15 | 0.1833 | 1132.0 |
| 313.15 | 0.2958 | 1161.0 |
| 313.15 | 0.3976 | 1188.0 |
| 313.15 | 0.4966 | 1214.0 |
| 313.15 | 0.5924 | 1238.0 |
| 313.15 | 0.6941 | 1263.0 |
| 313.15 | 0.7431 | 1274.0 |
| 313.15 | 0.9460 | 1322.0 |
| 313.15 | 1.0000 | 1334.0 |
| 318.15 | 0.0000 | 1058.0 |
| 318.15 | 0.0533 | 1074.0 |
| 318.15 | 0.1828 | 1113.0 |
| 318.15 | 0.2951 | 1144.0 |
| 318.15 | 0.3968 | 1172.0 |
| 318.15 | 0.4958 | 1198.0 |
| 318.15 | 0.5916 | 1223.0 |
| 318.15 | 0.6934 | 1249.0 |
| 318.15 | 0.7418 | 1261.0 |
| 318.15 | 0.9458 | 1309.0 |
| 318.15 | 1.0000 | 1319.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1119.0 |
| 303.15 | 0.0538 | 1132.0 |
| 303.15 | 0.1843 | 1167.0 |
| 303.15 | 0.2972 | 1197.0 |
| 303.15 | 0.3991 | 1223.0 |
| 303.15 | 0.4982 | 1248.0 |
| 303.15 | 0.5940 | 1271.0 |
| 303.15 | 0.6955 | 1295.0 |
| 303.15 | 0.7437 | 1306.0 |
| 303.15 | 0.9463 | 1354.0 |
| 303.15 | 1.0000 | 1367.0 |
| 308.15 | 0.0000 | 1098.0 |
| 308.15 | 0.0537 | 1114.0 |
| 308.15 | 0.1841 | 1149.0 |
| 308.15 | 0.2969 | 1180.0 |
| 308.15 | 0.3988 | 1208.0 |
| 308.15 | 0.4979 | 1234.0 |
| 308.15 | 0.5937 | 1259.0 |
| 308.15 | 0.6952 | 1284.0 |
| 308.15 | 0.7434 | 1296.0 |
| 308.15 | 0.9488 | 1348.0 |
| 308.15 | 1.0000 | 1362.0 |
| 313.15 | 0.0000 | 1081.0 |
| 313.15 | 0.0534 | 1097.0 |
| 313.15 | 0.1833 | 1132.0 |
| 313.15 | 0.2958 | 1161.0 |
| 313.15 | 0.3976 | 1188.0 |
| 313.15 | 0.4966 | 1214.0 |
| 313.15 | 0.5924 | 1238.0 |
| 313.15 | 0.6941 | 1263.0 |
| 313.15 | 0.7431 | 1274.0 |
| 313.15 | 0.9460 | 1322.0 |
| 313.15 | 1.0000 | 1334.0 |
| 318.15 | 0.0000 | 1058.0 |
| 318.15 | 0.0533 | 1074.0 |
| 318.15 | 0.1828 | 1113.0 |
| 318.15 | 0.2951 | 1144.0 |
| 318.15 | 0.3968 | 1172.0 |
| 318.15 | 0.4958 | 1198.0 |
| 318.15 | 0.5916 | 1223.0 |
| 318.15 | 0.6934 | 1249.0 |
| 318.15 | 0.7418 | 1261.0 |
| 318.15 | 0.9458 | 1309.0 |
| 318.15 | 1.0000 | 1319.0 |