- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- Butanoic acid, propyl ester
- InChI
- InChI=1S/C7H14O2/c1-3-5-7(8)9-6-4-2/h3-6H2,1-2H3
- InChI Key
- HUAZGNHGCJGYNP-UHFFFAOYSA-N
- Formula
- C7H14O2
- SMILES
- CCCOC(=O)CCC
- Mol. Weight (g/mol)
- 130.18
- CAS
- 105-66-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Excess molar volume, m3/mol (2)
Mole fraction of Butanoic acid, propyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Mole fraction of Butanoic acid, propyl ester (2) - Gas |
|---|---|
| 0.0147 | 0.0030 |
| 0.0381 | 0.0078 |
| 0.0631 | 0.0130 |
| 0.0997 | 0.0205 |
| 0.1295 | 0.0269 |
| 0.1675 | 0.0344 |
| 0.2009 | 0.0410 |
| 0.2488 | 0.0521 |
| 0.3071 | 0.0662 |
| 0.3523 | 0.0782 |
| 0.4004 | 0.0928 |
| 0.4095 | 0.0958 |
| 0.4285 | 0.1018 |
| 0.4732 | 0.1178 |
| 0.4962 | 0.1247 |
| 0.5109 | 0.1308 |
| 0.5358 | 0.1406 |
| 0.6001 | 0.1714 |
| 0.6615 | 0.2078 |
| 0.6997 | 0.2353 |
| 0.7332 | 0.2632 |
| 0.7695 | 0.3005 |
| 0.7986 | 0.3357 |
| 0.8321 | 0.3839 |
| 0.8553 | 0.4249 |
| 0.8761 | 0.4676 |
| 0.8933 | 0.5085 |
| 0.9005 | 0.5325 |
| 0.9097 | 0.5561 |
| 0.9248 | 0.6076 |
| 0.9325 | 0.6348 |
| 0.9375 | 0.6548 |
| 0.9379 | 0.6508 |
| 0.9442 | 0.6781 |
| 0.9504 | 0.7055 |
| 0.9549 | 0.7233 |
| 0.9602 | 0.7488 |
| 0.9702 | 0.8052 |
| 0.9806 | 0.8613 |
| 0.9859 | 0.8948 |
Mole fraction of Butanoic acid, propyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Mole fraction of Butanoic acid, propyl ester (2) - Gas |
|---|---|
| 0.0147 | 0.0030 |
| 0.0381 | 0.0078 |
| 0.0631 | 0.0130 |
| 0.0997 | 0.0205 |
| 0.1295 | 0.0269 |
| 0.1675 | 0.0344 |
| 0.2009 | 0.0410 |
| 0.2488 | 0.0521 |
| 0.3071 | 0.0662 |
| 0.3523 | 0.0782 |
| 0.4004 | 0.0928 |
| 0.4095 | 0.0958 |
| 0.4285 | 0.1018 |
| 0.4732 | 0.1178 |
| 0.4962 | 0.1247 |
| 0.5109 | 0.1308 |
| 0.5358 | 0.1406 |
| 0.6001 | 0.1714 |
| 0.6615 | 0.2078 |
| 0.6997 | 0.2353 |
| 0.7332 | 0.2632 |
| 0.7695 | 0.3005 |
| 0.7986 | 0.3357 |
| 0.8321 | 0.3839 |
| 0.8553 | 0.4249 |
| 0.8761 | 0.4676 |
| 0.8933 | 0.5085 |
| 0.9005 | 0.5325 |
| 0.9097 | 0.5561 |
| 0.9248 | 0.6076 |
| 0.9325 | 0.6348 |
| 0.9375 | 0.6548 |
| 0.9379 | 0.6508 |
| 0.9442 | 0.6781 |
| 0.9504 | 0.7055 |
| 0.9549 | 0.7233 |
| 0.9602 | 0.7488 |
| 0.9702 | 0.8052 |
| 0.9806 | 0.8613 |
| 0.9859 | 0.8948 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0342 | 0.1938 |
| 299.15 | 0.0755 | 0.4208 |
| 299.15 | 0.1160 | 0.6364 |
| 299.15 | 0.1522 | 0.8249 |
| 299.15 | 0.2039 | 1.0328 |
| 299.15 | 0.2539 | 1.2213 |
| 299.15 | 0.2948 | 1.3599 |
| 299.15 | 0.3409 | 1.484 |
| 299.15 | 0.3865 | 1.5748 |
| 299.15 | 0.4067 | 1.614 |
| 299.15 | 0.4282 | 1.6437 |
| 299.15 | 0.4571 | 1.6724 |
| 299.15 | 0.5150 | 1.6936 |
| 299.15 | 0.5782 | 1.6805 |
| 299.15 | 0.6520 | 1.5835 |
| 299.15 | 0.7324 | 1.3933 |
| 299.15 | 0.8229 | 1.0557 |
| 299.15 | 0.9118 | 0.5926 |
| 318.15 | 0.0544 | 0.2902 |
| 318.15 | 0.1126 | 0.5789 |
| 318.15 | 0.1688 | 0.8363 |
| 318.15 | 0.2307 | 1.0999 |
| 318.15 | 0.2881 | 1.2987 |
| 318.15 | 0.3385 | 1.4343 |
| 318.15 | 0.3867 | 1.5533 |
| 318.15 | 0.4260 | 1.6253 |
| 318.15 | 0.4292 | 1.6305 |
| 318.15 | 0.4640 | 1.6606 |
| 318.15 | 0.5016 | 1.6919 |
| 318.15 | 0.5498 | 1.6879 |
| 318.15 | 0.5988 | 1.6672 |
| 318.15 | 0.6689 | 1.5608 |
| 318.15 | 0.7436 | 1.3709 |
| 318.15 | 0.8141 | 1.1075 |
| 318.15 | 0.8864 | 0.7619 |
| 318.15 | 0.9510 | 0.3676 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0342 | 0.1938 |
| 299.15 | 0.0755 | 0.4208 |
| 299.15 | 0.1160 | 0.6364 |
| 299.15 | 0.1522 | 0.8249 |
| 299.15 | 0.2039 | 1.0328 |
| 299.15 | 0.2539 | 1.2213 |
| 299.15 | 0.2948 | 1.3599 |
| 299.15 | 0.3409 | 1.484 |
| 299.15 | 0.3865 | 1.5748 |
| 299.15 | 0.4067 | 1.614 |
| 299.15 | 0.4282 | 1.6437 |
| 299.15 | 0.4571 | 1.6724 |
| 299.15 | 0.5150 | 1.6936 |
| 299.15 | 0.5782 | 1.6805 |
| 299.15 | 0.6520 | 1.5835 |
| 299.15 | 0.7324 | 1.3933 |
| 299.15 | 0.8229 | 1.0557 |
| 299.15 | 0.9118 | 0.5926 |
| 318.15 | 0.0544 | 0.2902 |
| 318.15 | 0.1126 | 0.5789 |
| 318.15 | 0.1688 | 0.8363 |
| 318.15 | 0.2307 | 1.0999 |
| 318.15 | 0.2881 | 1.2987 |
| 318.15 | 0.3385 | 1.4343 |
| 318.15 | 0.3867 | 1.5533 |
| 318.15 | 0.4260 | 1.6253 |
| 318.15 | 0.4292 | 1.6305 |
| 318.15 | 0.4640 | 1.6606 |
| 318.15 | 0.5016 | 1.6919 |
| 318.15 | 0.5498 | 1.6879 |
| 318.15 | 0.5988 | 1.6672 |
| 318.15 | 0.6689 | 1.5608 |
| 318.15 | 0.7436 | 1.3709 |
| 318.15 | 0.8141 | 1.1075 |
| 318.15 | 0.8864 | 0.7619 |
| 318.15 | 0.9510 | 0.3676 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0147 | 355.90 |
| 0.0381 | 356.40 |
| 0.0631 | 356.89 |
| 0.0997 | 357.77 |
| 0.1295 | 358.44 |
| 0.1675 | 359.32 |
| 0.2009 | 360.04 |
| 0.2488 | 361.26 |
| 0.3071 | 362.67 |
| 0.3523 | 363.98 |
| 0.4004 | 365.37 |
| 0.4095 | 365.72 |
| 0.4285 | 366.26 |
| 0.4732 | 367.94 |
| 0.4962 | 368.56 |
| 0.5109 | 369.17 |
| 0.5358 | 370.06 |
| 0.6001 | 372.96 |
| 0.6615 | 375.93 |
| 0.6997 | 378.23 |
| 0.7332 | 380.38 |
| 0.7695 | 383.00 |
| 0.7986 | 385.49 |
| 0.8321 | 388.51 |
| 0.8553 | 391.02 |
| 0.8761 | 393.36 |
| 0.8933 | 395.70 |
| 0.9005 | 396.81 |
| 0.9097 | 398.02 |
| 0.9248 | 400.58 |
| 0.9325 | 401.76 |
| 0.9375 | 402.71 |
| 0.9379 | 402.62 |
| 0.9442 | 403.78 |
| 0.9504 | 405.01 |
| 0.9549 | 405.83 |
| 0.9602 | 406.81 |
| 0.9702 | 409.25 |
| 0.9806 | 411.38 |
| 0.9859 | 412.76 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0147 | 355.90 |
| 0.0381 | 356.40 |
| 0.0631 | 356.89 |
| 0.0997 | 357.77 |
| 0.1295 | 358.44 |
| 0.1675 | 359.32 |
| 0.2009 | 360.04 |
| 0.2488 | 361.26 |
| 0.3071 | 362.67 |
| 0.3523 | 363.98 |
| 0.4004 | 365.37 |
| 0.4095 | 365.72 |
| 0.4285 | 366.26 |
| 0.4732 | 367.94 |
| 0.4962 | 368.56 |
| 0.5109 | 369.17 |
| 0.5358 | 370.06 |
| 0.6001 | 372.96 |
| 0.6615 | 375.93 |
| 0.6997 | 378.23 |
| 0.7332 | 380.38 |
| 0.7695 | 383.00 |
| 0.7986 | 385.49 |
| 0.8321 | 388.51 |
| 0.8553 | 391.02 |
| 0.8761 | 393.36 |
| 0.8933 | 395.70 |
| 0.9005 | 396.81 |
| 0.9097 | 398.02 |
| 0.9248 | 400.58 |
| 0.9325 | 401.76 |
| 0.9375 | 402.71 |
| 0.9379 | 402.62 |
| 0.9442 | 403.78 |
| 0.9504 | 405.01 |
| 0.9549 | 405.83 |
| 0.9602 | 406.81 |
| 0.9702 | 409.25 |
| 0.9806 | 411.38 |
| 0.9859 | 412.76 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0472 | 1.0100e-07 |
| 303.15 | 0.1057 | 2.1800e-07 |
| 303.15 | 0.1522 | 3.0200e-07 |
| 303.15 | 0.1960 | 3.6000e-07 |
| 303.15 | 0.2531 | 4.3700e-07 |
| 303.15 | 0.2929 | 4.7900e-07 |
| 303.15 | 0.3508 | 5.2800e-07 |
| 303.15 | 0.4039 | 5.5500e-07 |
| 303.15 | 0.4461 | 5.6300e-07 |
| 303.15 | 0.4593 | 5.7300e-07 |
| 303.15 | 0.4895 | 5.7100e-07 |
| 303.15 | 0.5459 | 5.6500e-07 |
| 303.15 | 0.5540 | 5.6800e-07 |
| 303.15 | 0.5931 | 5.5500e-07 |
| 303.15 | 0.6402 | 5.2900e-07 |
| 303.15 | 0.6915 | 4.9400e-07 |
| 303.15 | 0.7449 | 4.4000e-07 |
| 303.15 | 0.7992 | 3.7400e-07 |
| 303.15 | 0.8526 | 2.8400e-07 |
| 303.15 | 0.9028 | 1.9800e-07 |
| 303.15 | 0.9597 | 8.7000e-08 |
| 318.15 | 0.0350 | 8.6000e-08 |
| 318.15 | 0.0730 | 1.6600e-07 |
| 318.15 | 0.1085 | 2.4300e-07 |
| 318.15 | 0.1678 | 3.5200e-07 |
| 318.15 | 0.2108 | 3.8500e-07 |
| 318.15 | 0.2620 | 4.3400e-07 |
| 318.15 | 0.2956 | 4.6800e-07 |
| 318.15 | 0.3301 | 5.0100e-07 |
| 318.15 | 0.4003 | 5.4200e-07 |
| 318.15 | 0.4560 | 5.6100e-07 |
| 318.15 | 0.5182 | 5.6500e-07 |
| 318.15 | 0.5871 | 5.6100e-07 |
| 318.15 | 0.6439 | 5.3900e-07 |
| 318.15 | 0.7150 | 4.8200e-07 |
| 318.15 | 0.8068 | 3.8800e-07 |
| 318.15 | 0.8966 | 2.3900e-07 |
| 318.15 | 0.9299 | 1.6900e-07 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, propyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0472 | 1.0100e-07 |
| 303.15 | 0.1057 | 2.1800e-07 |
| 303.15 | 0.1522 | 3.0200e-07 |
| 303.15 | 0.1960 | 3.6000e-07 |
| 303.15 | 0.2531 | 4.3700e-07 |
| 303.15 | 0.2929 | 4.7900e-07 |
| 303.15 | 0.3508 | 5.2800e-07 |
| 303.15 | 0.4039 | 5.5500e-07 |
| 303.15 | 0.4461 | 5.6300e-07 |
| 303.15 | 0.4593 | 5.7300e-07 |
| 303.15 | 0.4895 | 5.7100e-07 |
| 303.15 | 0.5459 | 5.6500e-07 |
| 303.15 | 0.5540 | 5.6800e-07 |
| 303.15 | 0.5931 | 5.5500e-07 |
| 303.15 | 0.6402 | 5.2900e-07 |
| 303.15 | 0.6915 | 4.9400e-07 |
| 303.15 | 0.7449 | 4.4000e-07 |
| 303.15 | 0.7992 | 3.7400e-07 |
| 303.15 | 0.8526 | 2.8400e-07 |
| 303.15 | 0.9028 | 1.9800e-07 |
| 303.15 | 0.9597 | 8.7000e-08 |
| 318.15 | 0.0350 | 8.6000e-08 |
| 318.15 | 0.0730 | 1.6600e-07 |
| 318.15 | 0.1085 | 2.4300e-07 |
| 318.15 | 0.1678 | 3.5200e-07 |
| 318.15 | 0.2108 | 3.8500e-07 |
| 318.15 | 0.2620 | 4.3400e-07 |
| 318.15 | 0.2956 | 4.6800e-07 |
| 318.15 | 0.3301 | 5.0100e-07 |
| 318.15 | 0.4003 | 5.4200e-07 |
| 318.15 | 0.4560 | 5.6100e-07 |
| 318.15 | 0.5182 | 5.6500e-07 |
| 318.15 | 0.5871 | 5.6100e-07 |
| 318.15 | 0.6439 | 5.3900e-07 |
| 318.15 | 0.7150 | 4.8200e-07 |
| 318.15 | 0.8068 | 3.8800e-07 |
| 318.15 | 0.8966 | 2.3900e-07 |
| 318.15 | 0.9299 | 1.6900e-07 |