- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- Butanoic acid, butyl ester
- InChI
- InChI=1S/C8H16O2/c1-3-5-7-10-8(9)6-4-2/h3-7H2,1-2H3
- InChI Key
- XUPYJHCZDLZNFP-UHFFFAOYSA-N
- Formula
- C8H16O2
- SMILES
- CCCCOC(=O)CCC
- Mol. Weight (g/mol)
- 144.21
- CAS
- 109-21-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Excess molar volume, m3/mol (2)
Mole fraction of Butanoic acid, butyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Mole fraction of Butanoic acid, butyl ester (2) - Gas |
|---|---|
| 0.0279 | 0.0028 |
| 0.0724 | 0.0072 |
| 0.1071 | 0.0106 |
| 0.1541 | 0.0152 |
| 0.2062 | 0.0208 |
| 0.2609 | 0.0261 |
| 0.3165 | 0.0342 |
| 0.3708 | 0.0421 |
| 0.4185 | 0.0498 |
| 0.4824 | 0.0619 |
| 0.5472 | 0.0771 |
| 0.6037 | 0.0935 |
| 0.6406 | 0.1069 |
| 0.6831 | 0.1253 |
| 0.6968 | 0.1319 |
| 0.7268 | 0.1495 |
| 0.7617 | 0.1751 |
| 0.7998 | 0.2096 |
| 0.8502 | 0.2757 |
| 0.8771 | 0.3257 |
| 0.8937 | 0.3653 |
| 0.9096 | 0.4104 |
| 0.9228 | 0.4559 |
| 0.9370 | 0.5138 |
| 0.9476 | 0.5658 |
| 0.9573 | 0.6213 |
| 0.9672 | 0.6873 |
| 0.9771 | 0.7644 |
| 0.9872 | 0.8576 |
| 0.9927 | 0.9149 |
Mole fraction of Butanoic acid, butyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Mole fraction of Butanoic acid, butyl ester (2) - Gas |
|---|---|
| 0.0279 | 0.0028 |
| 0.0724 | 0.0072 |
| 0.1071 | 0.0106 |
| 0.1541 | 0.0152 |
| 0.2062 | 0.0208 |
| 0.2609 | 0.0261 |
| 0.3165 | 0.0342 |
| 0.3708 | 0.0421 |
| 0.4185 | 0.0498 |
| 0.4824 | 0.0619 |
| 0.5472 | 0.0771 |
| 0.6037 | 0.0935 |
| 0.6406 | 0.1069 |
| 0.6831 | 0.1253 |
| 0.6968 | 0.1319 |
| 0.7268 | 0.1495 |
| 0.7617 | 0.1751 |
| 0.7998 | 0.2096 |
| 0.8502 | 0.2757 |
| 0.8771 | 0.3257 |
| 0.8937 | 0.3653 |
| 0.9096 | 0.4104 |
| 0.9228 | 0.4559 |
| 0.9370 | 0.5138 |
| 0.9476 | 0.5658 |
| 0.9573 | 0.6213 |
| 0.9672 | 0.6873 |
| 0.9771 | 0.7644 |
| 0.9872 | 0.8576 |
| 0.9927 | 0.9149 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0368 | 0.2087 |
| 299.15 | 0.0754 | 0.4113 |
| 299.15 | 0.1200 | 0.6629 |
| 299.15 | 0.1658 | 0.8652 |
| 299.15 | 0.2126 | 1.0532 |
| 299.15 | 0.2602 | 1.2237 |
| 299.15 | 0.3063 | 1.374 |
| 299.15 | 0.3463 | 1.4793 |
| 299.15 | 0.3862 | 1.5565 |
| 299.15 | 0.4169 | 1.6234 |
| 299.15 | 0.4735 | 1.6852 |
| 299.15 | 0.5383 | 1.698 |
| 299.15 | 0.6147 | 1.6412 |
| 299.15 | 0.6989 | 1.4822 |
| 299.15 | 0.7960 | 1.1599 |
| 299.15 | 0.8990 | 0.6644 |
| 318.15 | 0.0288 | 0.1850 |
| 318.15 | 0.0688 | 0.4222 |
| 318.15 | 0.1135 | 0.6290 |
| 318.15 | 0.1662 | 0.8901 |
| 318.15 | 0.2221 | 1.1146 |
| 318.15 | 0.2818 | 1.3069 |
| 318.15 | 0.3381 | 1.4569 |
| 318.15 | 0.3911 | 1.5775 |
| 318.15 | 0.4266 | 1.6269 |
| 318.15 | 0.4728 | 1.6679 |
| 318.15 | 0.5051 | 1.6854 |
| 318.15 | 0.5405 | 1.6826 |
| 318.15 | 0.5837 | 1.6663 |
| 318.15 | 0.6336 | 1.6129 |
| 318.15 | 0.6898 | 1.5055 |
| 318.15 | 0.7492 | 1.3325 |
| 318.15 | 0.8181 | 1.0625 |
| 318.15 | 0.9049 | 0.6227 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0368 | 0.2087 |
| 299.15 | 0.0754 | 0.4113 |
| 299.15 | 0.1200 | 0.6629 |
| 299.15 | 0.1658 | 0.8652 |
| 299.15 | 0.2126 | 1.0532 |
| 299.15 | 0.2602 | 1.2237 |
| 299.15 | 0.3063 | 1.374 |
| 299.15 | 0.3463 | 1.4793 |
| 299.15 | 0.3862 | 1.5565 |
| 299.15 | 0.4169 | 1.6234 |
| 299.15 | 0.4735 | 1.6852 |
| 299.15 | 0.5383 | 1.698 |
| 299.15 | 0.6147 | 1.6412 |
| 299.15 | 0.6989 | 1.4822 |
| 299.15 | 0.7960 | 1.1599 |
| 299.15 | 0.8990 | 0.6644 |
| 318.15 | 0.0288 | 0.1850 |
| 318.15 | 0.0688 | 0.4222 |
| 318.15 | 0.1135 | 0.6290 |
| 318.15 | 0.1662 | 0.8901 |
| 318.15 | 0.2221 | 1.1146 |
| 318.15 | 0.2818 | 1.3069 |
| 318.15 | 0.3381 | 1.4569 |
| 318.15 | 0.3911 | 1.5775 |
| 318.15 | 0.4266 | 1.6269 |
| 318.15 | 0.4728 | 1.6679 |
| 318.15 | 0.5051 | 1.6854 |
| 318.15 | 0.5405 | 1.6826 |
| 318.15 | 0.5837 | 1.6663 |
| 318.15 | 0.6336 | 1.6129 |
| 318.15 | 0.6898 | 1.5055 |
| 318.15 | 0.7492 | 1.3325 |
| 318.15 | 0.8181 | 1.0625 |
| 318.15 | 0.9049 | 0.6227 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0279 | 356.35 |
| 0.0724 | 357.45 |
| 0.1071 | 358.21 |
| 0.1541 | 359.31 |
| 0.2062 | 360.52 |
| 0.2609 | 361.65 |
| 0.3165 | 363.55 |
| 0.3708 | 365.23 |
| 0.4185 | 366.85 |
| 0.4824 | 369.29 |
| 0.5472 | 372.15 |
| 0.6037 | 375.01 |
| 0.6406 | 377.19 |
| 0.6831 | 379.98 |
| 0.6968 | 380.95 |
| 0.7268 | 383.40 |
| 0.7617 | 386.73 |
| 0.7998 | 390.76 |
| 0.8502 | 397.51 |
| 0.8771 | 401.98 |
| 0.8937 | 405.23 |
| 0.9096 | 408.59 |
| 0.9228 | 411.74 |
| 0.9370 | 415.44 |
| 0.9476 | 418.51 |
| 0.9573 | 421.55 |
| 0.9672 | 424.94 |
| 0.9771 | 428.57 |
| 0.9872 | 432.69 |
| 0.9927 | 434.99 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0279 | 356.35 |
| 0.0724 | 357.45 |
| 0.1071 | 358.21 |
| 0.1541 | 359.31 |
| 0.2062 | 360.52 |
| 0.2609 | 361.65 |
| 0.3165 | 363.55 |
| 0.3708 | 365.23 |
| 0.4185 | 366.85 |
| 0.4824 | 369.29 |
| 0.5472 | 372.15 |
| 0.6037 | 375.01 |
| 0.6406 | 377.19 |
| 0.6831 | 379.98 |
| 0.6968 | 380.95 |
| 0.7268 | 383.40 |
| 0.7617 | 386.73 |
| 0.7998 | 390.76 |
| 0.8502 | 397.51 |
| 0.8771 | 401.98 |
| 0.8937 | 405.23 |
| 0.9096 | 408.59 |
| 0.9228 | 411.74 |
| 0.9370 | 415.44 |
| 0.9476 | 418.51 |
| 0.9573 | 421.55 |
| 0.9672 | 424.94 |
| 0.9771 | 428.57 |
| 0.9872 | 432.69 |
| 0.9927 | 434.99 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0471 | 9.8000e-08 |
| 303.15 | 0.0954 | 1.9700e-07 |
| 303.15 | 0.1464 | 2.8200e-07 |
| 303.15 | 0.1994 | 3.6500e-07 |
| 303.15 | 0.2500 | 4.3600e-07 |
| 303.15 | 0.3007 | 4.8700e-07 |
| 303.15 | 0.3484 | 5.1800e-07 |
| 303.15 | 0.3939 | 5.5000e-07 |
| 303.15 | 0.4803 | 5.7100e-07 |
| 303.15 | 0.4891 | 5.7400e-07 |
| 303.15 | 0.5482 | 5.7000e-07 |
| 303.15 | 0.6008 | 5.5100e-07 |
| 303.15 | 0.6449 | 5.2900e-07 |
| 303.15 | 0.7029 | 4.8100e-07 |
| 303.15 | 0.7639 | 4.1800e-07 |
| 303.15 | 0.8020 | 3.6900e-07 |
| 303.15 | 0.8412 | 3.0700e-07 |
| 303.15 | 0.9007 | 2.0400e-07 |
| 303.15 | 0.9256 | 1.5700e-07 |
| 318.15 | 0.0484 | 1.5000e-07 |
| 318.15 | 0.0835 | 2.1500e-07 |
| 318.15 | 0.1234 | 2.8400e-07 |
| 318.15 | 0.1698 | 3.4400e-07 |
| 318.15 | 0.2146 | 3.9900e-07 |
| 318.15 | 0.2273 | 4.0900e-07 |
| 318.15 | 0.2848 | 4.6800e-07 |
| 318.15 | 0.3429 | 5.0600e-07 |
| 318.15 | 0.3839 | 5.3800e-07 |
| 318.15 | 0.4547 | 5.5700e-07 |
| 318.15 | 0.5137 | 5.7500e-07 |
| 318.15 | 0.5666 | 5.6800e-07 |
| 318.15 | 0.6522 | 5.3700e-07 |
| 318.15 | 0.6925 | 5.0700e-07 |
| 318.15 | 0.8126 | 3.7200e-07 |
| 318.15 | 0.8937 | 2.4500e-07 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, butyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0471 | 9.8000e-08 |
| 303.15 | 0.0954 | 1.9700e-07 |
| 303.15 | 0.1464 | 2.8200e-07 |
| 303.15 | 0.1994 | 3.6500e-07 |
| 303.15 | 0.2500 | 4.3600e-07 |
| 303.15 | 0.3007 | 4.8700e-07 |
| 303.15 | 0.3484 | 5.1800e-07 |
| 303.15 | 0.3939 | 5.5000e-07 |
| 303.15 | 0.4803 | 5.7100e-07 |
| 303.15 | 0.4891 | 5.7400e-07 |
| 303.15 | 0.5482 | 5.7000e-07 |
| 303.15 | 0.6008 | 5.5100e-07 |
| 303.15 | 0.6449 | 5.2900e-07 |
| 303.15 | 0.7029 | 4.8100e-07 |
| 303.15 | 0.7639 | 4.1800e-07 |
| 303.15 | 0.8020 | 3.6900e-07 |
| 303.15 | 0.8412 | 3.0700e-07 |
| 303.15 | 0.9007 | 2.0400e-07 |
| 303.15 | 0.9256 | 1.5700e-07 |
| 318.15 | 0.0484 | 1.5000e-07 |
| 318.15 | 0.0835 | 2.1500e-07 |
| 318.15 | 0.1234 | 2.8400e-07 |
| 318.15 | 0.1698 | 3.4400e-07 |
| 318.15 | 0.2146 | 3.9900e-07 |
| 318.15 | 0.2273 | 4.0900e-07 |
| 318.15 | 0.2848 | 4.6800e-07 |
| 318.15 | 0.3429 | 5.0600e-07 |
| 318.15 | 0.3839 | 5.3800e-07 |
| 318.15 | 0.4547 | 5.5700e-07 |
| 318.15 | 0.5137 | 5.7500e-07 |
| 318.15 | 0.5666 | 5.6800e-07 |
| 318.15 | 0.6522 | 5.3700e-07 |
| 318.15 | 0.6925 | 5.0700e-07 |
| 318.15 | 0.8126 | 3.7200e-07 |
| 318.15 | 0.8937 | 2.4500e-07 |