- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- Acetic acid, butyl ester
- InChI
- InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3
- InChI Key
- DKPFZGUDAPQIHT-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CCCCOC(C)=O
- Mol. Weight (g/mol)
- 116.16
- CAS
- 123-86-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Excess molar volume, m3/mol (2)
Mole fraction of Acetic acid, butyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Gas |
|---|---|
| 0.0273 | 0.0094 |
| 0.0564 | 0.0193 |
| 0.0903 | 0.0308 |
| 0.1209 | 0.0411 |
| 0.1541 | 0.0525 |
| 0.1921 | 0.0659 |
| 0.2215 | 0.0761 |
| 0.2691 | 0.0935 |
| 0.3061 | 0.1072 |
| 0.3421 | 0.1212 |
| 0.3811 | 0.1371 |
| 0.4146 | 0.1521 |
| 0.4602 | 0.1735 |
| 0.4921 | 0.1904 |
| 0.5402 | 0.2168 |
| 0.5728 | 0.2361 |
| 0.6011 | 0.2548 |
| 0.6168 | 0.2653 |
| 0.6375 | 0.2815 |
| 0.6661 | 0.3045 |
| 0.6922 | 0.3281 |
| 0.7008 | 0.3361 |
| 0.7311 | 0.3669 |
| 0.7633 | 0.4038 |
| 0.7898 | 0.4383 |
| 0.8004 | 0.4531 |
| 0.8211 | 0.4854 |
| 0.8382 | 0.5151 |
| 0.8487 | 0.5331 |
| 0.8737 | 0.5835 |
| 0.8906 | 0.6219 |
| 0.9125 | 0.6771 |
| 0.9395 | 0.7558 |
| 0.9565 | 0.8129 |
| 0.9782 | 0.8986 |
Mole fraction of Acetic acid, butyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Gas |
|---|---|
| 0.0273 | 0.0094 |
| 0.0564 | 0.0193 |
| 0.0903 | 0.0308 |
| 0.1209 | 0.0411 |
| 0.1541 | 0.0525 |
| 0.1921 | 0.0659 |
| 0.2215 | 0.0761 |
| 0.2691 | 0.0935 |
| 0.3061 | 0.1072 |
| 0.3421 | 0.1212 |
| 0.3811 | 0.1371 |
| 0.4146 | 0.1521 |
| 0.4602 | 0.1735 |
| 0.4921 | 0.1904 |
| 0.5402 | 0.2168 |
| 0.5728 | 0.2361 |
| 0.6011 | 0.2548 |
| 0.6168 | 0.2653 |
| 0.6375 | 0.2815 |
| 0.6661 | 0.3045 |
| 0.6922 | 0.3281 |
| 0.7008 | 0.3361 |
| 0.7311 | 0.3669 |
| 0.7633 | 0.4038 |
| 0.7898 | 0.4383 |
| 0.8004 | 0.4531 |
| 0.8211 | 0.4854 |
| 0.8382 | 0.5151 |
| 0.8487 | 0.5331 |
| 0.8737 | 0.5835 |
| 0.8906 | 0.6219 |
| 0.9125 | 0.6771 |
| 0.9395 | 0.7558 |
| 0.9565 | 0.8129 |
| 0.9782 | 0.8986 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0489 | 0.3145 |
| 299.15 | 0.0993 | 0.6118 |
| 299.15 | 0.1534 | 0.9009 |
| 299.15 | 0.2101 | 1.1587 |
| 299.15 | 0.2646 | 1.3646 |
| 299.15 | 0.3182 | 1.5249 |
| 299.15 | 0.3620 | 1.6424 |
| 299.15 | 0.4090 | 1.7336 |
| 299.15 | 0.4531 | 1.7962 |
| 299.15 | 0.5053 | 1.8338 |
| 299.15 | 0.5507 | 1.8227 |
| 299.15 | 0.6122 | 1.7512 |
| 299.15 | 0.6844 | 1.5984 |
| 299.15 | 0.7606 | 1.3567 |
| 299.15 | 0.8423 | 1.0055 |
| 299.15 | 0.9195 | 0.5833 |
| 318.15 | 0.0403 | 0.3064 |
| 318.15 | 0.0856 | 0.5485 |
| 318.15 | 0.1381 | 0.8283 |
| 318.15 | 0.1926 | 1.0817 |
| 318.15 | 0.2461 | 1.2886 |
| 318.15 | 0.2937 | 1.438 |
| 318.15 | 0.3414 | 1.5677 |
| 318.15 | 0.3865 | 1.6638 |
| 318.15 | 0.4190 | 1.7339 |
| 318.15 | 0.4550 | 1.7672 |
| 318.15 | 0.4920 | 1.8142 |
| 318.15 | 0.5485 | 1.8088 |
| 318.15 | 0.6058 | 1.7679 |
| 318.15 | 0.6796 | 1.6284 |
| 318.15 | 0.7538 | 1.3975 |
| 318.15 | 0.8369 | 1.0373 |
| 318.15 | 0.9197 | 0.5779 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0489 | 0.3145 |
| 299.15 | 0.0993 | 0.6118 |
| 299.15 | 0.1534 | 0.9009 |
| 299.15 | 0.2101 | 1.1587 |
| 299.15 | 0.2646 | 1.3646 |
| 299.15 | 0.3182 | 1.5249 |
| 299.15 | 0.3620 | 1.6424 |
| 299.15 | 0.4090 | 1.7336 |
| 299.15 | 0.4531 | 1.7962 |
| 299.15 | 0.5053 | 1.8338 |
| 299.15 | 0.5507 | 1.8227 |
| 299.15 | 0.6122 | 1.7512 |
| 299.15 | 0.6844 | 1.5984 |
| 299.15 | 0.7606 | 1.3567 |
| 299.15 | 0.8423 | 1.0055 |
| 299.15 | 0.9195 | 0.5833 |
| 318.15 | 0.0403 | 0.3064 |
| 318.15 | 0.0856 | 0.5485 |
| 318.15 | 0.1381 | 0.8283 |
| 318.15 | 0.1926 | 1.0817 |
| 318.15 | 0.2461 | 1.2886 |
| 318.15 | 0.2937 | 1.438 |
| 318.15 | 0.3414 | 1.5677 |
| 318.15 | 0.3865 | 1.6638 |
| 318.15 | 0.4190 | 1.7339 |
| 318.15 | 0.4550 | 1.7672 |
| 318.15 | 0.4920 | 1.8142 |
| 318.15 | 0.5485 | 1.8088 |
| 318.15 | 0.6058 | 1.7679 |
| 318.15 | 0.6796 | 1.6284 |
| 318.15 | 0.7538 | 1.3975 |
| 318.15 | 0.8369 | 1.0373 |
| 318.15 | 0.9197 | 0.5779 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 373.15 | 1.0000 | 42.55 |
| 373.15 | 0.9769 | 46.24 |
| 373.15 | 0.9521 | 50.95 |
| 373.15 | 0.9275 | 55.84 |
| 373.15 | 0.9033 | 60.97 |
| 373.15 | 0.8555 | 69.86 |
| 373.15 | 0.8062 | 78.05 |
| 373.15 | 0.7561 | 86.31 |
| 373.15 | 0.7061 | 94.64 |
| 373.15 | 0.6552 | 102.39 |
| 373.15 | 0.6052 | 110.10 |
| 373.15 | 0.5545 | 117.93 |
| 373.15 | 0.5035 | 125.28 |
| 373.15 | 0.4793 | 127.13 |
| 373.15 | 0.4524 | 133.15 |
| 373.15 | 0.4259 | 134.05 |
| 373.15 | 0.3726 | 141.36 |
| 373.15 | 0.3204 | 148.18 |
| 373.15 | 0.2612 | 156.25 |
| 373.15 | 0.2067 | 163.15 |
| 373.15 | 0.1582 | 168.62 |
| 373.15 | 0.1053 | 175.97 |
| 373.15 | 0.0781 | 179.22 |
| 373.15 | 0.0519 | 184.75 |
| 373.15 | 0.0257 | 188.70 |
| 373.15 | 0.0000 | 191.18 |
| 423.15 | 1.0000 | 188.81 |
| 423.15 | 0.9777 | 199.48 |
| 423.15 | 0.9538 | 213.90 |
| 423.15 | 0.9299 | 228.60 |
| 423.15 | 0.9063 | 242.64 |
| 423.15 | 0.8596 | 271.54 |
| 423.15 | 0.8111 | 302.28 |
| 423.15 | 0.7615 | 333.22 |
| 423.15 | 0.7118 | 365.64 |
| 423.15 | 0.6608 | 397.06 |
| 423.15 | 0.6105 | 430.18 |
| 423.15 | 0.5868 | 444.87 |
| 423.15 | 0.5593 | 462.12 |
| 423.15 | 0.5364 | 473.01 |
| 423.15 | 0.5076 | 494.86 |
| 423.15 | 0.4849 | 504.07 |
| 423.15 | 0.4557 | 526.64 |
| 423.15 | 0.4323 | 535.34 |
| 423.15 | 0.3796 | 568.61 |
| 423.15 | 0.3277 | 600.31 |
| 423.15 | 0.2686 | 638.99 |
| 423.15 | 0.2136 | 674.38 |
| 423.15 | 0.1643 | 707.68 |
| 423.15 | 0.1100 | 745.37 |
| 423.15 | 0.0819 | 764.67 |
| 423.15 | 0.0545 | 784.35 |
| 423.15 | 0.0271 | 804.00 |
| 423.15 | 0.0000 | 816.37 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 373.15 | 1.0000 | 42.55 |
| 373.15 | 0.9769 | 46.24 |
| 373.15 | 0.9521 | 50.95 |
| 373.15 | 0.9275 | 55.84 |
| 373.15 | 0.9033 | 60.97 |
| 373.15 | 0.8555 | 69.86 |
| 373.15 | 0.8062 | 78.05 |
| 373.15 | 0.7561 | 86.31 |
| 373.15 | 0.7061 | 94.64 |
| 373.15 | 0.6552 | 102.39 |
| 373.15 | 0.6052 | 110.10 |
| 373.15 | 0.5545 | 117.93 |
| 373.15 | 0.5035 | 125.28 |
| 373.15 | 0.4793 | 127.13 |
| 373.15 | 0.4524 | 133.15 |
| 373.15 | 0.4259 | 134.05 |
| 373.15 | 0.3726 | 141.36 |
| 373.15 | 0.3204 | 148.18 |
| 373.15 | 0.2612 | 156.25 |
| 373.15 | 0.2067 | 163.15 |
| 373.15 | 0.1582 | 168.62 |
| 373.15 | 0.1053 | 175.97 |
| 373.15 | 0.0781 | 179.22 |
| 373.15 | 0.0519 | 184.75 |
| 373.15 | 0.0257 | 188.70 |
| 373.15 | 0.0000 | 191.18 |
| 423.15 | 1.0000 | 188.81 |
| 423.15 | 0.9777 | 199.48 |
| 423.15 | 0.9538 | 213.90 |
| 423.15 | 0.9299 | 228.60 |
| 423.15 | 0.9063 | 242.64 |
| 423.15 | 0.8596 | 271.54 |
| 423.15 | 0.8111 | 302.28 |
| 423.15 | 0.7615 | 333.22 |
| 423.15 | 0.7118 | 365.64 |
| 423.15 | 0.6608 | 397.06 |
| 423.15 | 0.6105 | 430.18 |
| 423.15 | 0.5868 | 444.87 |
| 423.15 | 0.5593 | 462.12 |
| 423.15 | 0.5364 | 473.01 |
| 423.15 | 0.5076 | 494.86 |
| 423.15 | 0.4849 | 504.07 |
| 423.15 | 0.4557 | 526.64 |
| 423.15 | 0.4323 | 535.34 |
| 423.15 | 0.3796 | 568.61 |
| 423.15 | 0.3277 | 600.31 |
| 423.15 | 0.2686 | 638.99 |
| 423.15 | 0.2136 | 674.38 |
| 423.15 | 0.1643 | 707.68 |
| 423.15 | 0.1100 | 745.37 |
| 423.15 | 0.0819 | 764.67 |
| 423.15 | 0.0545 | 784.35 |
| 423.15 | 0.0271 | 804.00 |
| 423.15 | 0.0000 | 816.37 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0273 | 356.06 |
| 0.0564 | 356.60 |
| 0.0903 | 357.21 |
| 0.1209 | 357.78 |
| 0.1541 | 358.40 |
| 0.1921 | 359.17 |
| 0.2215 | 359.75 |
| 0.2691 | 360.77 |
| 0.3061 | 361.53 |
| 0.3421 | 362.37 |
| 0.3811 | 363.29 |
| 0.4146 | 364.18 |
| 0.4602 | 365.41 |
| 0.4921 | 366.36 |
| 0.5402 | 367.88 |
| 0.5728 | 368.98 |
| 0.6011 | 370.02 |
| 0.6168 | 370.60 |
| 0.6375 | 371.44 |
| 0.6661 | 372.66 |
| 0.6922 | 373.84 |
| 0.7008 | 374.26 |
| 0.7311 | 375.77 |
| 0.7633 | 377.53 |
| 0.7898 | 379.12 |
| 0.8004 | 379.80 |
| 0.8211 | 381.18 |
| 0.8382 | 382.42 |
| 0.8487 | 383.17 |
| 0.8737 | 385.19 |
| 0.8906 | 386.64 |
| 0.9125 | 388.71 |
| 0.9395 | 391.48 |
| 0.9565 | 393.40 |
| 0.9782 | 396.14 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0273 | 356.06 |
| 0.0564 | 356.60 |
| 0.0903 | 357.21 |
| 0.1209 | 357.78 |
| 0.1541 | 358.40 |
| 0.1921 | 359.17 |
| 0.2215 | 359.75 |
| 0.2691 | 360.77 |
| 0.3061 | 361.53 |
| 0.3421 | 362.37 |
| 0.3811 | 363.29 |
| 0.4146 | 364.18 |
| 0.4602 | 365.41 |
| 0.4921 | 366.36 |
| 0.5402 | 367.88 |
| 0.5728 | 368.98 |
| 0.6011 | 370.02 |
| 0.6168 | 370.60 |
| 0.6375 | 371.44 |
| 0.6661 | 372.66 |
| 0.6922 | 373.84 |
| 0.7008 | 374.26 |
| 0.7311 | 375.77 |
| 0.7633 | 377.53 |
| 0.7898 | 379.12 |
| 0.8004 | 379.80 |
| 0.8211 | 381.18 |
| 0.8382 | 382.42 |
| 0.8487 | 383.17 |
| 0.8737 | 385.19 |
| 0.8906 | 386.64 |
| 0.9125 | 388.71 |
| 0.9395 | 391.48 |
| 0.9565 | 393.40 |
| 0.9782 | 396.14 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0574 | 1.7600e-07 |
| 303.15 | 0.0965 | 2.7100e-07 |
| 303.15 | 0.1524 | 3.9600e-07 |
| 303.15 | 0.2027 | 4.7800e-07 |
| 303.15 | 0.2462 | 5.3900e-07 |
| 303.15 | 0.3081 | 6.0400e-07 |
| 303.15 | 0.3513 | 6.3200e-07 |
| 303.15 | 0.3544 | 6.3600e-07 |
| 303.15 | 0.3993 | 6.5900e-07 |
| 303.15 | 0.4482 | 6.6900e-07 |
| 303.15 | 0.4516 | 6.7000e-07 |
| 303.15 | 0.5027 | 6.6400e-07 |
| 303.15 | 0.5624 | 6.4100e-07 |
| 303.15 | 0.6068 | 6.1400e-07 |
| 303.15 | 0.6521 | 5.7900e-07 |
| 303.15 | 0.7069 | 5.2500e-07 |
| 303.15 | 0.7606 | 4.6200e-07 |
| 303.15 | 0.8085 | 3.9800e-07 |
| 303.15 | 0.8654 | 3.1000e-07 |
| 303.15 | 0.8979 | 2.4800e-07 |
| 303.15 | 0.9379 | 1.5700e-07 |
| 318.15 | 0.0632 | 1.9400e-07 |
| 318.15 | 0.1239 | 3.4000e-07 |
| 318.15 | 0.1517 | 3.8900e-07 |
| 318.15 | 0.2082 | 4.6300e-07 |
| 318.15 | 0.2556 | 5.3100e-07 |
| 318.15 | 0.2946 | 5.6500e-07 |
| 318.15 | 0.3438 | 6.3100e-07 |
| 318.15 | 0.4052 | 6.5900e-07 |
| 318.15 | 0.4526 | 6.7100e-07 |
| 318.15 | 0.5062 | 6.7800e-07 |
| 318.15 | 0.5564 | 6.7000e-07 |
| 318.15 | 0.6192 | 6.5500e-07 |
| 318.15 | 0.7359 | 5.7200e-07 |
| 318.15 | 0.7617 | 5.2200e-07 |
| 318.15 | 0.8574 | 3.7300e-07 |
| 318.15 | 0.9049 | 2.6200e-07 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0574 | 1.7600e-07 |
| 303.15 | 0.0965 | 2.7100e-07 |
| 303.15 | 0.1524 | 3.9600e-07 |
| 303.15 | 0.2027 | 4.7800e-07 |
| 303.15 | 0.2462 | 5.3900e-07 |
| 303.15 | 0.3081 | 6.0400e-07 |
| 303.15 | 0.3513 | 6.3200e-07 |
| 303.15 | 0.3544 | 6.3600e-07 |
| 303.15 | 0.3993 | 6.5900e-07 |
| 303.15 | 0.4482 | 6.6900e-07 |
| 303.15 | 0.4516 | 6.7000e-07 |
| 303.15 | 0.5027 | 6.6400e-07 |
| 303.15 | 0.5624 | 6.4100e-07 |
| 303.15 | 0.6068 | 6.1400e-07 |
| 303.15 | 0.6521 | 5.7900e-07 |
| 303.15 | 0.7069 | 5.2500e-07 |
| 303.15 | 0.7606 | 4.6200e-07 |
| 303.15 | 0.8085 | 3.9800e-07 |
| 303.15 | 0.8654 | 3.1000e-07 |
| 303.15 | 0.8979 | 2.4800e-07 |
| 303.15 | 0.9379 | 1.5700e-07 |
| 318.15 | 0.0632 | 1.9400e-07 |
| 318.15 | 0.1239 | 3.4000e-07 |
| 318.15 | 0.1517 | 3.8900e-07 |
| 318.15 | 0.2082 | 4.6300e-07 |
| 318.15 | 0.2556 | 5.3100e-07 |
| 318.15 | 0.2946 | 5.6500e-07 |
| 318.15 | 0.3438 | 6.3100e-07 |
| 318.15 | 0.4052 | 6.5900e-07 |
| 318.15 | 0.4526 | 6.7100e-07 |
| 318.15 | 0.5062 | 6.7800e-07 |
| 318.15 | 0.5564 | 6.7000e-07 |
| 318.15 | 0.6192 | 6.5500e-07 |
| 318.15 | 0.7359 | 5.7200e-07 |
| 318.15 | 0.7617 | 5.2200e-07 |
| 318.15 | 0.8574 | 3.7300e-07 |
| 318.15 | 0.9049 | 2.6200e-07 |