- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.1022 | 0.0272 |
| 0.2010 | 0.0255 |
| 0.3018 | 0.0242 |
| 0.4037 | 0.0230 |
| 0.4997 | 0.0220 |
| 0.5998 | 0.0210 |
| 0.7013 | 0.0200 |
| 0.7987 | 0.0192 |
| 0.8987 | 0.0181 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.1022 | 0.0272 |
| 0.2010 | 0.0255 |
| 0.3018 | 0.0242 |
| 0.4037 | 0.0230 |
| 0.4997 | 0.0220 |
| 0.5998 | 0.0210 |
| 0.7013 | 0.0200 |
| 0.7987 | 0.0192 |
| 0.8987 | 0.0181 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0506 | -1.7700e-07 |
| 0.0997 | -3.1500e-07 |
| 0.1501 | -4.4900e-07 |
| 0.2003 | -5.7400e-07 |
| 0.2503 | -6.9100e-07 |
| 0.3003 | -7.8200e-07 |
| 0.3500 | -8.3900e-07 |
| 0.4004 | -8.8300e-07 |
| 0.4497 | -9.2200e-07 |
| 0.5050 | -9.3600e-07 |
| 0.5505 | -9.4800e-07 |
| 0.6001 | -9.1000e-07 |
| 0.6509 | -8.8200e-07 |
| 0.7000 | -8.1100e-07 |
| 0.7502 | -7.4700e-07 |
| 0.7999 | -6.3100e-07 |
| 0.8502 | -5.1100e-07 |
| 0.8997 | -3.6900e-07 |
| 0.9493 | -2.1000e-07 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0506 | -1.7700e-07 |
| 0.0997 | -3.1500e-07 |
| 0.1501 | -4.4900e-07 |
| 0.2003 | -5.7400e-07 |
| 0.2503 | -6.9100e-07 |
| 0.3003 | -7.8200e-07 |
| 0.3500 | -8.3900e-07 |
| 0.4004 | -8.8300e-07 |
| 0.4497 | -9.2200e-07 |
| 0.5050 | -9.3600e-07 |
| 0.5505 | -9.4800e-07 |
| 0.6001 | -9.1000e-07 |
| 0.6509 | -8.8200e-07 |
| 0.7000 | -8.1100e-07 |
| 0.7502 | -7.4700e-07 |
| 0.7999 | -6.3100e-07 |
| 0.8502 | -5.1100e-07 |
| 0.8997 | -3.6900e-07 |
| 0.9493 | -2.1000e-07 |