- Name
- Tributylamine
- InChI
- InChI=1S/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3
- InChI Key
- IMFACGCPASFAPR-UHFFFAOYSA-N
- Formula
- C12H27N
- SMILES
- CCCCN(CCCC)CCCC
- Mol. Weight (g/mol)
- 185.35
- CAS
- 102-82-9
- Name
- Tetradecane
- InChI
- InChI=1S/C14H30/c1-3-5-7-9-11-13-14-12-10-8-6-4-2/h3-14H2,1-2H3
- InChI Key
- BGHCVCJVXZWKCC-UHFFFAOYSA-N
- Formula
- C14H30
- SMILES
- CCCCCCCCCCCCCC
- Mol. Weight (g/mol)
- 198.39
- CAS
- 629-59-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.1081 | 0.0019 |
| 298.15 | 0.2058 | 0.0018 |
| 298.15 | 0.2802 | 0.0018 |
| 298.15 | 0.4095 | 0.0017 |
| 298.15 | 0.5112 | 0.0016 |
| 298.15 | 0.6101 | 0.0015 |
| 298.15 | 0.7051 | 0.0014 |
| 298.15 | 0.7999 | 0.0014 |
| 298.15 | 0.8953 | 0.0013 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.1081 | 0.0018 |
| 303.15 | 0.2058 | 0.0017 |
| 303.15 | 0.2802 | 0.0016 |
| 303.15 | 0.4095 | 0.0015 |
| 303.15 | 0.5112 | 0.0014 |
| 303.15 | 0.6101 | 0.0014 |
| 303.15 | 0.7051 | 0.0013 |
| 303.15 | 0.7999 | 0.0013 |
| 303.15 | 0.8953 | 0.0012 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0017 |
| 308.15 | 0.1081 | 0.0016 |
| 308.15 | 0.2058 | 0.0015 |
| 308.15 | 0.2802 | 0.0014 |
| 308.15 | 0.4095 | 0.0014 |
| 308.15 | 0.5112 | 0.0013 |
| 308.15 | 0.6101 | 0.0013 |
| 308.15 | 0.7051 | 0.0012 |
| 308.15 | 0.7999 | 0.0012 |
| 308.15 | 0.8953 | 0.0011 |
| 308.15 | 1.0000 | 0.0011 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.1081 | 0.0019 |
| 298.15 | 0.2058 | 0.0018 |
| 298.15 | 0.2802 | 0.0018 |
| 298.15 | 0.4095 | 0.0017 |
| 298.15 | 0.5112 | 0.0016 |
| 298.15 | 0.6101 | 0.0015 |
| 298.15 | 0.7051 | 0.0014 |
| 298.15 | 0.7999 | 0.0014 |
| 298.15 | 0.8953 | 0.0013 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.1081 | 0.0018 |
| 303.15 | 0.2058 | 0.0017 |
| 303.15 | 0.2802 | 0.0016 |
| 303.15 | 0.4095 | 0.0015 |
| 303.15 | 0.5112 | 0.0014 |
| 303.15 | 0.6101 | 0.0014 |
| 303.15 | 0.7051 | 0.0013 |
| 303.15 | 0.7999 | 0.0013 |
| 303.15 | 0.8953 | 0.0012 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0017 |
| 308.15 | 0.1081 | 0.0016 |
| 308.15 | 0.2058 | 0.0015 |
| 308.15 | 0.2802 | 0.0014 |
| 308.15 | 0.4095 | 0.0014 |
| 308.15 | 0.5112 | 0.0013 |
| 308.15 | 0.6101 | 0.0013 |
| 308.15 | 0.7051 | 0.0012 |
| 308.15 | 0.7999 | 0.0012 |
| 308.15 | 0.8953 | 0.0011 |
| 308.15 | 1.0000 | 0.0011 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4282 |
| 298.15 | 0.1081 | 1.4283 |
| 298.15 | 0.2058 | 1.4282 |
| 298.15 | 0.2802 | 1.428 |
| 298.15 | 0.4095 | 1.4278 |
| 298.15 | 0.5112 | 1.4278 |
| 298.15 | 0.6101 | 1.4278 |
| 298.15 | 0.7051 | 1.4279 |
| 298.15 | 0.7999 | 1.4281 |
| 298.15 | 0.8953 | 1.428 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.426 |
| 303.15 | 0.1081 | 1.4258 |
| 303.15 | 0.2058 | 1.4257 |
| 303.15 | 0.2802 | 1.4256 |
| 303.15 | 0.4095 | 1.4254 |
| 303.15 | 0.5112 | 1.4254 |
| 303.15 | 0.6101 | 1.4254 |
| 303.15 | 0.7051 | 1.4255 |
| 303.15 | 0.7999 | 1.4256 |
| 303.15 | 0.8953 | 1.4255 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.4236 |
| 308.15 | 0.1081 | 1.4234 |
| 308.15 | 0.2058 | 1.4234 |
| 308.15 | 0.2802 | 1.4232 |
| 308.15 | 0.4095 | 1.4231 |
| 308.15 | 0.5112 | 1.423 |
| 308.15 | 0.6101 | 1.423 |
| 308.15 | 0.7051 | 1.4231 |
| 308.15 | 0.7999 | 1.4231 |
| 308.15 | 0.8953 | 1.4231 |
| 308.15 | 1.0000 | 1.4228 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4282 |
| 298.15 | 0.1081 | 1.4283 |
| 298.15 | 0.2058 | 1.4282 |
| 298.15 | 0.2802 | 1.428 |
| 298.15 | 0.4095 | 1.4278 |
| 298.15 | 0.5112 | 1.4278 |
| 298.15 | 0.6101 | 1.4278 |
| 298.15 | 0.7051 | 1.4279 |
| 298.15 | 0.7999 | 1.4281 |
| 298.15 | 0.8953 | 1.428 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.426 |
| 303.15 | 0.1081 | 1.4258 |
| 303.15 | 0.2058 | 1.4257 |
| 303.15 | 0.2802 | 1.4256 |
| 303.15 | 0.4095 | 1.4254 |
| 303.15 | 0.5112 | 1.4254 |
| 303.15 | 0.6101 | 1.4254 |
| 303.15 | 0.7051 | 1.4255 |
| 303.15 | 0.7999 | 1.4256 |
| 303.15 | 0.8953 | 1.4255 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.4236 |
| 308.15 | 0.1081 | 1.4234 |
| 308.15 | 0.2058 | 1.4234 |
| 308.15 | 0.2802 | 1.4232 |
| 308.15 | 0.4095 | 1.4231 |
| 308.15 | 0.5112 | 1.423 |
| 308.15 | 0.6101 | 1.423 |
| 308.15 | 0.7051 | 1.4231 |
| 308.15 | 0.7999 | 1.4231 |
| 308.15 | 0.8953 | 1.4231 |
| 308.15 | 1.0000 | 1.4228 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 760.7 |
| 298.15 | 0.1081 | 761.9 |
| 298.15 | 0.2058 | 762.9 |
| 298.15 | 0.2802 | 763.8 |
| 298.15 | 0.4095 | 765.3 |
| 298.15 | 0.5112 | 766.6 |
| 298.15 | 0.6101 | 767.9 |
| 298.15 | 0.7051 | 769.3 |
| 298.15 | 0.7999 | 770.9 |
| 298.15 | 0.8953 | 772.4 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 757.0 |
| 303.15 | 0.1081 | 758.1 |
| 303.15 | 0.2058 | 759.2 |
| 303.15 | 0.2802 | 760.0 |
| 303.15 | 0.4095 | 761.5 |
| 303.15 | 0.5112 | 762.9 |
| 303.15 | 0.6101 | 764.2 |
| 303.15 | 0.7051 | 765.5 |
| 303.15 | 0.7999 | 767.0 |
| 303.15 | 0.8953 | 768.4 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 753.3 |
| 308.15 | 0.1081 | 754.4 |
| 308.15 | 0.2058 | 755.5 |
| 308.15 | 0.2802 | 756.3 |
| 308.15 | 0.4095 | 757.8 |
| 308.15 | 0.5112 | 759.1 |
| 308.15 | 0.6101 | 760.5 |
| 308.15 | 0.7051 | 761.9 |
| 308.15 | 0.7999 | 763.1 |
| 308.15 | 0.8953 | 764.4 |
| 308.15 | 1.0000 | 765.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 760.7 |
| 298.15 | 0.1081 | 761.9 |
| 298.15 | 0.2058 | 762.9 |
| 298.15 | 0.2802 | 763.8 |
| 298.15 | 0.4095 | 765.3 |
| 298.15 | 0.5112 | 766.6 |
| 298.15 | 0.6101 | 767.9 |
| 298.15 | 0.7051 | 769.3 |
| 298.15 | 0.7999 | 770.9 |
| 298.15 | 0.8953 | 772.4 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 757.0 |
| 303.15 | 0.1081 | 758.1 |
| 303.15 | 0.2058 | 759.2 |
| 303.15 | 0.2802 | 760.0 |
| 303.15 | 0.4095 | 761.5 |
| 303.15 | 0.5112 | 762.9 |
| 303.15 | 0.6101 | 764.2 |
| 303.15 | 0.7051 | 765.5 |
| 303.15 | 0.7999 | 767.0 |
| 303.15 | 0.8953 | 768.4 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 753.3 |
| 308.15 | 0.1081 | 754.4 |
| 308.15 | 0.2058 | 755.5 |
| 308.15 | 0.2802 | 756.3 |
| 308.15 | 0.4095 | 757.8 |
| 308.15 | 0.5112 | 759.1 |
| 308.15 | 0.6101 | 760.5 |
| 308.15 | 0.7051 | 761.9 |
| 308.15 | 0.7999 | 763.1 |
| 308.15 | 0.8953 | 764.4 |
| 308.15 | 1.0000 | 765.7 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1315.0 |
| 0.1081 | 1303.0 |
| 0.2058 | 1292.0 |
| 0.2802 | 1287.0 |
| 0.4095 | 1283.0 |
| 0.5112 | 1279.0 |
| 0.6101 | 1275.0 |
| 0.7051 | 1272.0 |
| 0.7999 | 1270.0 |
| 0.8953 | 1267.0 |
| 1.0000 | 1262.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1315.0 |
| 0.1081 | 1303.0 |
| 0.2058 | 1292.0 |
| 0.2802 | 1287.0 |
| 0.4095 | 1283.0 |
| 0.5112 | 1279.0 |
| 0.6101 | 1275.0 |
| 0.7051 | 1272.0 |
| 0.7999 | 1270.0 |
| 0.8953 | 1267.0 |
| 1.0000 | 1262.0 |