- Name
- Triethylamine
- InChI
- InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3
- InChI Key
- ZMANZCXQSJIPKH-UHFFFAOYSA-N
- Formula
- C6H15N
- SMILES
- CCN(CC)CC
- Mol. Weight (g/mol)
- 101.19
- CAS
- 121-44-8
- Name
- Tributylamine
- InChI
- InChI=1S/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3
- InChI Key
- IMFACGCPASFAPR-UHFFFAOYSA-N
- Formula
- C12H27N
- SMILES
- CCCCN(CCCC)CCCC
- Mol. Weight (g/mol)
- 185.35
- CAS
- 102-82-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.1072 | 0.0004 |
| 298.15 | 0.2039 | 0.0005 |
| 298.15 | 0.3083 | 0.0006 |
| 298.15 | 0.4066 | 0.0006 |
| 298.15 | 0.5029 | 0.0007 |
| 298.15 | 0.5905 | 0.0008 |
| 298.15 | 0.6928 | 0.0009 |
| 298.15 | 0.7914 | 0.0010 |
| 298.15 | 0.8942 | 0.0011 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.1072 | 0.0004 |
| 303.15 | 0.2039 | 0.0005 |
| 303.15 | 0.3083 | 0.0005 |
| 303.15 | 0.4066 | 0.0006 |
| 303.15 | 0.5029 | 0.0007 |
| 303.15 | 0.5905 | 0.0007 |
| 303.15 | 0.6928 | 0.0008 |
| 303.15 | 0.7914 | 0.0009 |
| 303.15 | 0.8942 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1072 | 0.0004 |
| 308.15 | 0.2039 | 0.0004 |
| 308.15 | 0.3083 | 0.0005 |
| 308.15 | 0.4066 | 0.0006 |
| 308.15 | 0.5029 | 0.0006 |
| 308.15 | 0.5905 | 0.0007 |
| 308.15 | 0.6928 | 0.0008 |
| 308.15 | 0.7914 | 0.0008 |
| 308.15 | 0.8942 | 0.0009 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.1072 | 0.0004 |
| 298.15 | 0.2039 | 0.0005 |
| 298.15 | 0.3083 | 0.0006 |
| 298.15 | 0.4066 | 0.0006 |
| 298.15 | 0.5029 | 0.0007 |
| 298.15 | 0.5905 | 0.0008 |
| 298.15 | 0.6928 | 0.0009 |
| 298.15 | 0.7914 | 0.0010 |
| 298.15 | 0.8942 | 0.0011 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.1072 | 0.0004 |
| 303.15 | 0.2039 | 0.0005 |
| 303.15 | 0.3083 | 0.0005 |
| 303.15 | 0.4066 | 0.0006 |
| 303.15 | 0.5029 | 0.0007 |
| 303.15 | 0.5905 | 0.0007 |
| 303.15 | 0.6928 | 0.0008 |
| 303.15 | 0.7914 | 0.0009 |
| 303.15 | 0.8942 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1072 | 0.0004 |
| 308.15 | 0.2039 | 0.0004 |
| 308.15 | 0.3083 | 0.0005 |
| 308.15 | 0.4066 | 0.0006 |
| 308.15 | 0.5029 | 0.0006 |
| 308.15 | 0.5905 | 0.0007 |
| 308.15 | 0.6928 | 0.0008 |
| 308.15 | 0.7914 | 0.0008 |
| 308.15 | 0.8942 | 0.0009 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3992 |
| 298.15 | 0.1072 | 1.4052 |
| 298.15 | 0.2039 | 1.4104 |
| 298.15 | 0.3083 | 1.4131 |
| 298.15 | 0.4066 | 1.4164 |
| 298.15 | 0.5029 | 1.4208 |
| 298.15 | 0.5905 | 1.4218 |
| 298.15 | 0.6928 | 1.4238 |
| 298.15 | 0.7914 | 1.4256 |
| 298.15 | 0.8942 | 1.4265 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.3958 |
| 303.15 | 0.1072 | 1.4031 |
| 303.15 | 0.2039 | 1.4079 |
| 303.15 | 0.3083 | 1.4116 |
| 303.15 | 0.4066 | 1.4144 |
| 303.15 | 0.5029 | 1.4178 |
| 303.15 | 0.5905 | 1.4194 |
| 303.15 | 0.6928 | 1.4213 |
| 303.15 | 0.7914 | 1.423 |
| 303.15 | 0.8942 | 1.4241 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.3929 |
| 308.15 | 0.1072 | 1.4012 |
| 308.15 | 0.2039 | 1.4054 |
| 308.15 | 0.3083 | 1.4102 |
| 308.15 | 0.4066 | 1.4122 |
| 308.15 | 0.5029 | 1.4148 |
| 308.15 | 0.5905 | 1.4169 |
| 308.15 | 0.6928 | 1.4189 |
| 308.15 | 0.7914 | 1.4204 |
| 308.15 | 0.8942 | 1.4217 |
| 308.15 | 1.0000 | 1.4228 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3992 |
| 298.15 | 0.1072 | 1.4052 |
| 298.15 | 0.2039 | 1.4104 |
| 298.15 | 0.3083 | 1.4131 |
| 298.15 | 0.4066 | 1.4164 |
| 298.15 | 0.5029 | 1.4208 |
| 298.15 | 0.5905 | 1.4218 |
| 298.15 | 0.6928 | 1.4238 |
| 298.15 | 0.7914 | 1.4256 |
| 298.15 | 0.8942 | 1.4265 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.3958 |
| 303.15 | 0.1072 | 1.4031 |
| 303.15 | 0.2039 | 1.4079 |
| 303.15 | 0.3083 | 1.4116 |
| 303.15 | 0.4066 | 1.4144 |
| 303.15 | 0.5029 | 1.4178 |
| 303.15 | 0.5905 | 1.4194 |
| 303.15 | 0.6928 | 1.4213 |
| 303.15 | 0.7914 | 1.423 |
| 303.15 | 0.8942 | 1.4241 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.3929 |
| 308.15 | 0.1072 | 1.4012 |
| 308.15 | 0.2039 | 1.4054 |
| 308.15 | 0.3083 | 1.4102 |
| 308.15 | 0.4066 | 1.4122 |
| 308.15 | 0.5029 | 1.4148 |
| 308.15 | 0.5905 | 1.4169 |
| 308.15 | 0.6928 | 1.4189 |
| 308.15 | 0.7914 | 1.4204 |
| 308.15 | 0.8942 | 1.4217 |
| 308.15 | 1.0000 | 1.4228 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 723.3 |
| 298.15 | 0.1072 | 732.0 |
| 298.15 | 0.2039 | 739.2 |
| 298.15 | 0.3083 | 745.9 |
| 298.15 | 0.4066 | 751.5 |
| 298.15 | 0.5029 | 756.4 |
| 298.15 | 0.5905 | 760.2 |
| 298.15 | 0.6928 | 763.7 |
| 298.15 | 0.7914 | 767.1 |
| 298.15 | 0.8942 | 770.6 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 718.6 |
| 303.15 | 0.1072 | 727.3 |
| 303.15 | 0.2039 | 734.6 |
| 303.15 | 0.3083 | 741.4 |
| 303.15 | 0.4066 | 747.2 |
| 303.15 | 0.5029 | 752.2 |
| 303.15 | 0.5905 | 756.0 |
| 303.15 | 0.6928 | 759.5 |
| 303.15 | 0.7914 | 763.0 |
| 303.15 | 0.8942 | 766.5 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 713.7 |
| 308.15 | 0.1072 | 722.8 |
| 308.15 | 0.2039 | 730.2 |
| 308.15 | 0.3083 | 737.1 |
| 308.15 | 0.4066 | 742.9 |
| 308.15 | 0.5029 | 747.9 |
| 308.15 | 0.5905 | 751.8 |
| 308.15 | 0.6928 | 755.4 |
| 308.15 | 0.7914 | 758.9 |
| 308.15 | 0.8942 | 762.4 |
| 308.15 | 1.0000 | 765.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 723.3 |
| 298.15 | 0.1072 | 732.0 |
| 298.15 | 0.2039 | 739.2 |
| 298.15 | 0.3083 | 745.9 |
| 298.15 | 0.4066 | 751.5 |
| 298.15 | 0.5029 | 756.4 |
| 298.15 | 0.5905 | 760.2 |
| 298.15 | 0.6928 | 763.7 |
| 298.15 | 0.7914 | 767.1 |
| 298.15 | 0.8942 | 770.6 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 718.6 |
| 303.15 | 0.1072 | 727.3 |
| 303.15 | 0.2039 | 734.6 |
| 303.15 | 0.3083 | 741.4 |
| 303.15 | 0.4066 | 747.2 |
| 303.15 | 0.5029 | 752.2 |
| 303.15 | 0.5905 | 756.0 |
| 303.15 | 0.6928 | 759.5 |
| 303.15 | 0.7914 | 763.0 |
| 303.15 | 0.8942 | 766.5 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 713.7 |
| 308.15 | 0.1072 | 722.8 |
| 308.15 | 0.2039 | 730.2 |
| 308.15 | 0.3083 | 737.1 |
| 308.15 | 0.4066 | 742.9 |
| 308.15 | 0.5029 | 747.9 |
| 308.15 | 0.5905 | 751.8 |
| 308.15 | 0.6928 | 755.4 |
| 308.15 | 0.7914 | 758.9 |
| 308.15 | 0.8942 | 762.4 |
| 308.15 | 1.0000 | 765.7 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1123.0 |
| 0.1072 | 1143.0 |
| 0.2039 | 1160.0 |
| 0.3083 | 1179.0 |
| 0.4066 | 1196.0 |
| 0.5029 | 1210.0 |
| 0.5905 | 1221.0 |
| 0.6928 | 1232.0 |
| 0.7914 | 1236.0 |
| 0.8942 | 1246.0 |
| 1.0000 | 1262.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1123.0 |
| 0.1072 | 1143.0 |
| 0.2039 | 1160.0 |
| 0.3083 | 1179.0 |
| 0.4066 | 1196.0 |
| 0.5029 | 1210.0 |
| 0.5905 | 1221.0 |
| 0.6928 | 1232.0 |
| 0.7914 | 1236.0 |
| 0.8942 | 1246.0 |
| 1.0000 | 1262.0 |