- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- Butanoic acid, ethyl ester
- InChI
- InChI=1S/C6H12O2/c1-3-5-6(7)8-4-2/h3-5H2,1-2H3
- InChI Key
- OBNCKNCVKJNDBV-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CCCC(=O)OCC
- Mol. Weight (g/mol)
- 116.16
- CAS
- 105-54-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Excess molar volume, m3/mol (2)
Mole fraction of Butanoic acid, ethyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Mole fraction of Butanoic acid, ethyl ester (2) - Gas |
|---|---|
| 0.0218 | 0.0098 |
| 0.0454 | 0.0204 |
| 0.0555 | 0.0250 |
| 0.0690 | 0.0310 |
| 0.1040 | 0.0470 |
| 0.1201 | 0.0541 |
| 0.1628 | 0.0735 |
| 0.1983 | 0.0887 |
| 0.2309 | 0.1032 |
| 0.2797 | 0.1231 |
| 0.3246 | 0.1431 |
| 0.3871 | 0.1704 |
| 0.4312 | 0.1939 |
| 0.4661 | 0.2113 |
| 0.5106 | 0.2352 |
| 0.5503 | 0.2602 |
| 0.5856 | 0.2835 |
| 0.6169 | 0.3055 |
| 0.6322 | 0.3165 |
| 0.6619 | 0.3384 |
| 0.6908 | 0.3632 |
| 0.7301 | 0.3993 |
| 0.7514 | 0.4207 |
| 0.7901 | 0.4666 |
| 0.8195 | 0.5076 |
| 0.8425 | 0.5441 |
| 0.8600 | 0.5739 |
| 0.8784 | 0.6082 |
| 0.8901 | 0.6326 |
| 0.9013 | 0.6579 |
| 0.9105 | 0.6800 |
| 0.9204 | 0.7058 |
| 0.9320 | 0.7369 |
| 0.9424 | 0.7685 |
| 0.9510 | 0.7961 |
| 0.9606 | 0.8295 |
| 0.9720 | 0.8731 |
| 0.9780 | 0.8975 |
| 0.9855 | 0.9299 |
Mole fraction of Butanoic acid, ethyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Mole fraction of Butanoic acid, ethyl ester (2) - Gas |
|---|---|
| 0.0218 | 0.0098 |
| 0.0454 | 0.0204 |
| 0.0555 | 0.0250 |
| 0.0690 | 0.0310 |
| 0.1040 | 0.0470 |
| 0.1201 | 0.0541 |
| 0.1628 | 0.0735 |
| 0.1983 | 0.0887 |
| 0.2309 | 0.1032 |
| 0.2797 | 0.1231 |
| 0.3246 | 0.1431 |
| 0.3871 | 0.1704 |
| 0.4312 | 0.1939 |
| 0.4661 | 0.2113 |
| 0.5106 | 0.2352 |
| 0.5503 | 0.2602 |
| 0.5856 | 0.2835 |
| 0.6169 | 0.3055 |
| 0.6322 | 0.3165 |
| 0.6619 | 0.3384 |
| 0.6908 | 0.3632 |
| 0.7301 | 0.3993 |
| 0.7514 | 0.4207 |
| 0.7901 | 0.4666 |
| 0.8195 | 0.5076 |
| 0.8425 | 0.5441 |
| 0.8600 | 0.5739 |
| 0.8784 | 0.6082 |
| 0.8901 | 0.6326 |
| 0.9013 | 0.6579 |
| 0.9105 | 0.6800 |
| 0.9204 | 0.7058 |
| 0.9320 | 0.7369 |
| 0.9424 | 0.7685 |
| 0.9510 | 0.7961 |
| 0.9606 | 0.8295 |
| 0.9720 | 0.8731 |
| 0.9780 | 0.8975 |
| 0.9855 | 0.9299 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0438 | 0.2518 |
| 299.15 | 0.0937 | 0.5156 |
| 299.15 | 0.1461 | 0.7789 |
| 299.15 | 0.1991 | 1.0406 |
| 299.15 | 0.2541 | 1.2374 |
| 299.15 | 0.3061 | 1.4119 |
| 299.15 | 0.3568 | 1.5494 |
| 299.15 | 0.4053 | 1.6425 |
| 299.15 | 0.4331 | 1.6966 |
| 299.15 | 0.4818 | 1.7418 |
| 299.15 | 0.5387 | 1.7519 |
| 299.15 | 0.6024 | 1.7113 |
| 299.15 | 0.6746 | 1.5961 |
| 299.15 | 0.7522 | 1.3863 |
| 299.15 | 0.8330 | 1.0501 |
| 299.15 | 0.9172 | 0.5989 |
| 318.15 | 0.0394 | 0.2933 |
| 318.15 | 0.0951 | 0.5773 |
| 318.15 | 0.1580 | 0.8507 |
| 318.15 | 0.2201 | 1.0882 |
| 318.15 | 0.2807 | 1.3101 |
| 318.15 | 0.3377 | 1.46 |
| 318.15 | 0.3850 | 1.5748 |
| 318.15 | 0.4267 | 1.6382 |
| 318.15 | 0.4576 | 1.6905 |
| 318.15 | 0.4628 | 1.6943 |
| 318.15 | 0.4938 | 1.7232 |
| 318.15 | 0.5386 | 1.7382 |
| 318.15 | 0.5934 | 1.714 |
| 318.15 | 0.6595 | 1.6195 |
| 318.15 | 0.7407 | 1.4059 |
| 318.15 | 0.8336 | 1.0404 |
| 318.15 | 0.9223 | 0.5697 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0438 | 0.2518 |
| 299.15 | 0.0937 | 0.5156 |
| 299.15 | 0.1461 | 0.7789 |
| 299.15 | 0.1991 | 1.0406 |
| 299.15 | 0.2541 | 1.2374 |
| 299.15 | 0.3061 | 1.4119 |
| 299.15 | 0.3568 | 1.5494 |
| 299.15 | 0.4053 | 1.6425 |
| 299.15 | 0.4331 | 1.6966 |
| 299.15 | 0.4818 | 1.7418 |
| 299.15 | 0.5387 | 1.7519 |
| 299.15 | 0.6024 | 1.7113 |
| 299.15 | 0.6746 | 1.5961 |
| 299.15 | 0.7522 | 1.3863 |
| 299.15 | 0.8330 | 1.0501 |
| 299.15 | 0.9172 | 0.5989 |
| 318.15 | 0.0394 | 0.2933 |
| 318.15 | 0.0951 | 0.5773 |
| 318.15 | 0.1580 | 0.8507 |
| 318.15 | 0.2201 | 1.0882 |
| 318.15 | 0.2807 | 1.3101 |
| 318.15 | 0.3377 | 1.46 |
| 318.15 | 0.3850 | 1.5748 |
| 318.15 | 0.4267 | 1.6382 |
| 318.15 | 0.4576 | 1.6905 |
| 318.15 | 0.4628 | 1.6943 |
| 318.15 | 0.4938 | 1.7232 |
| 318.15 | 0.5386 | 1.7382 |
| 318.15 | 0.5934 | 1.714 |
| 318.15 | 0.6595 | 1.6195 |
| 318.15 | 0.7407 | 1.4059 |
| 318.15 | 0.8336 | 1.0404 |
| 318.15 | 0.9223 | 0.5697 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0218 | 355.90 |
| 0.0454 | 356.38 |
| 0.0555 | 356.54 |
| 0.0690 | 356.71 |
| 0.1040 | 357.31 |
| 0.1201 | 357.49 |
| 0.1628 | 358.32 |
| 0.1983 | 358.85 |
| 0.2309 | 359.44 |
| 0.2797 | 360.20 |
| 0.3246 | 361.13 |
| 0.3871 | 362.37 |
| 0.4312 | 363.43 |
| 0.4661 | 364.21 |
| 0.5106 | 365.28 |
| 0.5503 | 366.42 |
| 0.5856 | 367.45 |
| 0.6169 | 368.42 |
| 0.6322 | 368.91 |
| 0.6619 | 369.93 |
| 0.6908 | 371.03 |
| 0.7301 | 372.63 |
| 0.7514 | 373.55 |
| 0.7901 | 375.45 |
| 0.8195 | 377.06 |
| 0.8425 | 378.52 |
| 0.8600 | 379.66 |
| 0.8784 | 380.98 |
| 0.8901 | 381.96 |
| 0.9013 | 382.86 |
| 0.9105 | 383.63 |
| 0.9204 | 384.54 |
| 0.9320 | 385.74 |
| 0.9424 | 386.87 |
| 0.9510 | 387.84 |
| 0.9606 | 388.93 |
| 0.9720 | 390.22 |
| 0.9780 | 391.06 |
| 0.9855 | 392.07 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0218 | 355.90 |
| 0.0454 | 356.38 |
| 0.0555 | 356.54 |
| 0.0690 | 356.71 |
| 0.1040 | 357.31 |
| 0.1201 | 357.49 |
| 0.1628 | 358.32 |
| 0.1983 | 358.85 |
| 0.2309 | 359.44 |
| 0.2797 | 360.20 |
| 0.3246 | 361.13 |
| 0.3871 | 362.37 |
| 0.4312 | 363.43 |
| 0.4661 | 364.21 |
| 0.5106 | 365.28 |
| 0.5503 | 366.42 |
| 0.5856 | 367.45 |
| 0.6169 | 368.42 |
| 0.6322 | 368.91 |
| 0.6619 | 369.93 |
| 0.6908 | 371.03 |
| 0.7301 | 372.63 |
| 0.7514 | 373.55 |
| 0.7901 | 375.45 |
| 0.8195 | 377.06 |
| 0.8425 | 378.52 |
| 0.8600 | 379.66 |
| 0.8784 | 380.98 |
| 0.8901 | 381.96 |
| 0.9013 | 382.86 |
| 0.9105 | 383.63 |
| 0.9204 | 384.54 |
| 0.9320 | 385.74 |
| 0.9424 | 386.87 |
| 0.9510 | 387.84 |
| 0.9606 | 388.93 |
| 0.9720 | 390.22 |
| 0.9780 | 391.06 |
| 0.9855 | 392.07 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0445 | 9.2000e-07 |
| 303.15 | 0.0966 | 2.0800e-06 |
| 303.15 | 0.1518 | 3.1100e-06 |
| 303.15 | 0.1999 | 3.8300e-06 |
| 303.15 | 0.2466 | 4.4100e-06 |
| 303.15 | 0.3111 | 5.1300e-06 |
| 303.15 | 0.3504 | 5.6000e-06 |
| 303.15 | 0.4043 | 5.9100e-06 |
| 303.15 | 0.4468 | 6.0900e-06 |
| 303.15 | 0.4837 | 6.1100e-06 |
| 303.15 | 0.5015 | 6.1100e-06 |
| 303.15 | 0.5259 | 6.0700e-06 |
| 303.15 | 0.5538 | 5.9900e-06 |
| 303.15 | 0.6004 | 5.7400e-06 |
| 303.15 | 0.6399 | 5.5000e-06 |
| 303.15 | 0.6630 | 5.2300e-06 |
| 303.15 | 0.7129 | 4.8300e-06 |
| 303.15 | 0.7538 | 4.3300e-06 |
| 303.15 | 0.7934 | 3.7700e-06 |
| 303.15 | 0.8465 | 2.9900e-06 |
| 303.15 | 0.9017 | 2.0000e-06 |
| 303.15 | 0.9614 | 8.2000e-07 |
| 318.15 | 0.0604 | 1.8300e-06 |
| 318.15 | 0.1099 | 2.8500e-06 |
| 318.15 | 0.1559 | 3.6300e-06 |
| 318.15 | 0.2141 | 4.4500e-06 |
| 318.15 | 0.2650 | 5.1700e-06 |
| 318.15 | 0.2982 | 5.4100e-06 |
| 318.15 | 0.3386 | 5.7400e-06 |
| 318.15 | 0.3900 | 6.1400e-06 |
| 318.15 | 0.4477 | 6.4400e-06 |
| 318.15 | 0.4595 | 6.5000e-06 |
| 318.15 | 0.4778 | 6.5300e-06 |
| 318.15 | 0.4982 | 6.5500e-06 |
| 318.15 | 0.4996 | 6.5600e-06 |
| 318.15 | 0.5163 | 6.5600e-06 |
| 318.15 | 0.5222 | 6.5500e-06 |
| 318.15 | 0.5936 | 6.3800e-06 |
| 318.15 | 0.6597 | 6.0300e-06 |
| 318.15 | 0.7011 | 5.7300e-06 |
| 318.15 | 0.7450 | 5.1500e-06 |
| 318.15 | 0.7968 | 4.5000e-06 |
| 318.15 | 0.8396 | 3.8100e-06 |
| 318.15 | 0.8701 | 3.1500e-06 |
| 318.15 | 0.9283 | 2.0100e-06 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butanoic acid, ethyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0445 | 9.2000e-07 |
| 303.15 | 0.0966 | 2.0800e-06 |
| 303.15 | 0.1518 | 3.1100e-06 |
| 303.15 | 0.1999 | 3.8300e-06 |
| 303.15 | 0.2466 | 4.4100e-06 |
| 303.15 | 0.3111 | 5.1300e-06 |
| 303.15 | 0.3504 | 5.6000e-06 |
| 303.15 | 0.4043 | 5.9100e-06 |
| 303.15 | 0.4468 | 6.0900e-06 |
| 303.15 | 0.4837 | 6.1100e-06 |
| 303.15 | 0.5015 | 6.1100e-06 |
| 303.15 | 0.5259 | 6.0700e-06 |
| 303.15 | 0.5538 | 5.9900e-06 |
| 303.15 | 0.6004 | 5.7400e-06 |
| 303.15 | 0.6399 | 5.5000e-06 |
| 303.15 | 0.6630 | 5.2300e-06 |
| 303.15 | 0.7129 | 4.8300e-06 |
| 303.15 | 0.7538 | 4.3300e-06 |
| 303.15 | 0.7934 | 3.7700e-06 |
| 303.15 | 0.8465 | 2.9900e-06 |
| 303.15 | 0.9017 | 2.0000e-06 |
| 303.15 | 0.9614 | 8.2000e-07 |
| 318.15 | 0.0604 | 1.8300e-06 |
| 318.15 | 0.1099 | 2.8500e-06 |
| 318.15 | 0.1559 | 3.6300e-06 |
| 318.15 | 0.2141 | 4.4500e-06 |
| 318.15 | 0.2650 | 5.1700e-06 |
| 318.15 | 0.2982 | 5.4100e-06 |
| 318.15 | 0.3386 | 5.7400e-06 |
| 318.15 | 0.3900 | 6.1400e-06 |
| 318.15 | 0.4477 | 6.4400e-06 |
| 318.15 | 0.4595 | 6.5000e-06 |
| 318.15 | 0.4778 | 6.5300e-06 |
| 318.15 | 0.4982 | 6.5500e-06 |
| 318.15 | 0.4996 | 6.5600e-06 |
| 318.15 | 0.5163 | 6.5600e-06 |
| 318.15 | 0.5222 | 6.5500e-06 |
| 318.15 | 0.5936 | 6.3800e-06 |
| 318.15 | 0.6597 | 6.0300e-06 |
| 318.15 | 0.7011 | 5.7300e-06 |
| 318.15 | 0.7450 | 5.1500e-06 |
| 318.15 | 0.7968 | 4.5000e-06 |
| 318.15 | 0.8396 | 3.8100e-06 |
| 318.15 | 0.8701 | 3.1500e-06 |
| 318.15 | 0.9283 | 2.0100e-06 |