- Name
- Ammonia
- InChI
- InChI=1S/H3N/h1H3
- InChI Key
- QGZKDVFQNNGYKY-UHFFFAOYSA-N
- Formula
- H3N
- SMILES
- N
- Mol. Weight (g/mol)
- 17.03
- CAS
- 7664-41-7
- Name
- 1,2-Propanediol, 3-methoxy-
- InChI
- InChI=1S/C4H10O3/c1-7-3-4(6)2-5/h4-6H,2-3H2,1H3
- InChI Key
- PSJBSUHYCGQTHZ-UHFFFAOYSA-N
- Formula
- C4H10O3
- SMILES
- COCC(O)CO
- Mol. Weight (g/mol)
- 106.12
- CAS
- 623-39-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Ammonia (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Ammonia (1) - Liquid |
| 303.15 | 32.30 | 0.1849 |
| 303.15 | 65.80 | 0.2707 |
| 303.15 | 109.80 | 0.3454 |
| 303.15 | 216.90 | 0.4612 |
| 303.15 | 255.50 | 0.4914 |
| 303.15 | 291.20 | 0.5162 |
| 303.15 | 376.10 | 0.5696 |
| 303.15 | 404.40 | 0.5861 |
| 303.15 | 466.20 | 0.6197 |
| 303.15 | 494.90 | 0.6348 |
| 313.15 | 63.00 | 0.2170 |
| 313.15 | 113.60 | 0.3038 |
| 313.15 | 194.00 | 0.3986 |
| 313.15 | 276.70 | 0.4660 |
| 313.15 | 360.20 | 0.5184 |
| 313.15 | 415.80 | 0.5478 |
| 313.15 | 465.80 | 0.5726 |
| 313.15 | 530.40 | 0.6031 |
| 323.15 | 31.70 | 0.1036 |
| 323.15 | 78.50 | 0.2024 |
| 323.15 | 118.50 | 0.2618 |
| 323.15 | 185.50 | 0.3374 |
| 323.15 | 288.30 | 0.4163 |
| 323.15 | 332.40 | 0.4439 |
| 323.15 | 348.90 | 0.4557 |
| 323.15 | 395.10 | 0.4807 |
| 323.15 | 440.20 | 0.5026 |
| 323.15 | 486.70 | 0.5225 |
| 333.15 | 29.10 | 0.0720 |
| 333.15 | 73.60 | 0.1440 |
| 333.15 | 163.80 | 0.2478 |
| 333.15 | 193.20 | 0.2734 |
| 333.15 | 250.30 | 0.3153 |
| 333.15 | 321.80 | 0.3593 |
| 333.15 | 368.10 | 0.3840 |
| 333.15 | 408.60 | 0.4042 |
| 333.15 | 449.20 | 0.4233 |
| 333.15 | 516.70 | 0.4511 |
Mole fraction of Ammonia (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Ammonia (1) - Liquid |
| 303.15 | 32.30 | 0.1849 |
| 303.15 | 65.80 | 0.2707 |
| 303.15 | 109.80 | 0.3454 |
| 303.15 | 216.90 | 0.4612 |
| 303.15 | 255.50 | 0.4914 |
| 303.15 | 291.20 | 0.5162 |
| 303.15 | 376.10 | 0.5696 |
| 303.15 | 404.40 | 0.5861 |
| 303.15 | 466.20 | 0.6197 |
| 303.15 | 494.90 | 0.6348 |
| 313.15 | 63.00 | 0.2170 |
| 313.15 | 113.60 | 0.3038 |
| 313.15 | 194.00 | 0.3986 |
| 313.15 | 276.70 | 0.4660 |
| 313.15 | 360.20 | 0.5184 |
| 313.15 | 415.80 | 0.5478 |
| 313.15 | 465.80 | 0.5726 |
| 313.15 | 530.40 | 0.6031 |
| 323.15 | 31.70 | 0.1036 |
| 323.15 | 78.50 | 0.2024 |
| 323.15 | 118.50 | 0.2618 |
| 323.15 | 185.50 | 0.3374 |
| 323.15 | 288.30 | 0.4163 |
| 323.15 | 332.40 | 0.4439 |
| 323.15 | 348.90 | 0.4557 |
| 323.15 | 395.10 | 0.4807 |
| 323.15 | 440.20 | 0.5026 |
| 323.15 | 486.70 | 0.5225 |
| 333.15 | 29.10 | 0.0720 |
| 333.15 | 73.60 | 0.1440 |
| 333.15 | 163.80 | 0.2478 |
| 333.15 | 193.20 | 0.2734 |
| 333.15 | 250.30 | 0.3153 |
| 333.15 | 321.80 | 0.3593 |
| 333.15 | 368.10 | 0.3840 |
| 333.15 | 408.60 | 0.4042 |
| 333.15 | 449.20 | 0.4233 |
| 333.15 | 516.70 | 0.4511 |