- Name
- Citric acid
- InChI
- InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
- InChI Key
- KRKNYBCHXYNGOX-UHFFFAOYSA-N
- Formula
- C6H8O7
- SMILES
- O=C(O)CC(O)(CC(=O)O)C(=O)O
- Mol. Weight (g/mol)
- 192.12
- CAS
- 77-92-9
- Name
- 1-Decanol
- InChI
- InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3
- InChI Key
- MWKFXSUHUHTGQN-UHFFFAOYSA-N
- Formula
- C10H22O
- SMILES
- CCCCCCCCCCO
- Mol. Weight (g/mol)
- 158.28
- CAS
- 112-30-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Citric acid (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Molality, mol/kg of Citric acid (1) - Liquid mixture 2 | Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Molality, mol/kg of Citric acid (1) - Liquid mixture 1 |
| 0.4470 | 298.15 | 100.00 | 0.0050 |
Mass fraction of Citric acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Citric acid (1) - Liquid mixture 1 |
| 298.20 | 0.9975 | 0.0000 |
| 298.20 | 0.8911 | 0.0990 |
| 298.20 | 0.7843 | 0.1961 |
| 298.20 | 0.6813 | 0.2920 |
| 298.20 | 0.5808 | 0.3872 |
| 298.20 | 0.4808 | 0.4808 |
| 298.20 | 0.3733 | 0.5818 |
| 298.20 | 0.2484 | 0.7019 |
| 308.20 | 0.9938 | 0.0000 |
| 308.20 | 0.8878 | 0.0986 |
| 308.20 | 0.7814 | 0.1954 |
| 308.20 | 0.6788 | 0.2909 |
| 308.20 | 0.5787 | 0.3858 |
| 308.20 | 0.4790 | 0.4790 |
| 308.20 | 0.3574 | 0.5932 |
| 308.20 | 0.2418 | 0.7062 |
| 318.20 | 0.9901 | 0.0000 |
| 318.20 | 0.8845 | 0.0983 |
| 318.20 | 0.7786 | 0.1946 |
| 318.20 | 0.6763 | 0.2899 |
| 318.20 | 0.5766 | 0.3844 |
| 318.20 | 0.4773 | 0.4773 |
| 318.20 | 0.3786 | 0.5703 |
| 318.20 | 0.2461 | 0.6973 |
| 328.20 | 0.9864 | 0.0000 |
| 328.20 | 0.8813 | 0.0979 |
| 328.20 | 0.7758 | 0.1939 |
| 328.20 | 0.6739 | 0.2888 |
| 328.20 | 0.5746 | 0.3831 |
| 328.20 | 0.4756 | 0.4756 |
| 328.20 | 0.3611 | 0.5830 |
| 328.20 | 0.2441 | 0.6961 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Citric acid (1) - Liquid mixture 1 | Mass fraction of 1-Decanol (2) - Liquid mixture 1 | Mass fraction of 1-Decanol (2) - Liquid mixture 2 | Mass fraction of Citric acid (1) - Liquid mixture 2 |
| 298.20 | 0.0310 | 0.9360 | 0.0237 | 0.1770 |
| 318.20 | 0.1296 | 0.8135 | 0.0679 | 0.6394 |
| 328.20 | 0.0234 | 0.9332 | 0.0359 | 0.2064 |
| 298.20 | 0.0553 | 0.9087 | 0.0280 | 0.2882 |
| 328.20 | 0.0443 | 0.9099 | 0.0401 | 0.3641 |
| 328.20 | 0.0550 | 0.8967 | 0.0468 | 0.4154 |
| 328.20 | 0.0811 | 0.8673 | 0.0537 | 0.5437 |
| 328.20 | 0.1054 | 0.8386 | 0.0633 | 0.6196 |
| 328.20 | 0.1223 | 0.8179 | 0.0763 | 0.6480 |
| 298.20 | 0.0727 | 0.8893 | 0.0333 | 0.3607 |
| 298.20 | 0.0991 | 0.8603 | 0.0393 | 0.4763 |
| 308.20 | 0.0931 | 0.8622 | 0.0460 | 0.4909 |
| 298.20 | 0.1264 | 0.8296 | 0.0469 | 0.5749 |
| 298.20 | 0.1405 | 0.8125 | 0.0539 | 0.6052 |
| 308.20 | 0.0296 | 0.9341 | 0.0283 | 0.1891 |
| 308.20 | 0.0522 | 0.9082 | 0.0330 | 0.3114 |
| 308.20 | 0.0695 | 0.8887 | 0.0392 | 0.3900 |
| 308.20 | 0.1217 | 0.8299 | 0.0549 | 0.5908 |
| 308.20 | 0.1374 | 0.8109 | 0.0632 | 0.6276 |
| 318.20 | 0.0269 | 0.9332 | 0.0319 | 0.1976 |
| 318.20 | 0.0497 | 0.9068 | 0.0364 | 0.3367 |
| 318.20 | 0.0638 | 0.8903 | 0.0428 | 0.4025 |
| 318.20 | 0.0869 | 0.8639 | 0.0497 | 0.5166 |
| 318.20 | 0.1159 | 0.8308 | 0.0590 | 0.6050 |
Molality, mol/kg of Citric acid (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Molality, mol/kg of Citric acid (1) - Liquid mixture 2 | Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Molality, mol/kg of Citric acid (1) - Liquid mixture 1 |
| 0.4470 | 298.15 | 100.00 | 0.0050 |
Mass fraction of Citric acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Citric acid (1) - Liquid mixture 1 |
| 298.20 | 0.9975 | 0.0000 |
| 298.20 | 0.8911 | 0.0990 |
| 298.20 | 0.7843 | 0.1961 |
| 298.20 | 0.6813 | 0.2920 |
| 298.20 | 0.5808 | 0.3872 |
| 298.20 | 0.4808 | 0.4808 |
| 298.20 | 0.3733 | 0.5818 |
| 298.20 | 0.2484 | 0.7019 |
| 308.20 | 0.9938 | 0.0000 |
| 308.20 | 0.8878 | 0.0986 |
| 308.20 | 0.7814 | 0.1954 |
| 308.20 | 0.6788 | 0.2909 |
| 308.20 | 0.5787 | 0.3858 |
| 308.20 | 0.4790 | 0.4790 |
| 308.20 | 0.3574 | 0.5932 |
| 308.20 | 0.2418 | 0.7062 |
| 318.20 | 0.9901 | 0.0000 |
| 318.20 | 0.8845 | 0.0983 |
| 318.20 | 0.7786 | 0.1946 |
| 318.20 | 0.6763 | 0.2899 |
| 318.20 | 0.5766 | 0.3844 |
| 318.20 | 0.4773 | 0.4773 |
| 318.20 | 0.3786 | 0.5703 |
| 318.20 | 0.2461 | 0.6973 |
| 328.20 | 0.9864 | 0.0000 |
| 328.20 | 0.8813 | 0.0979 |
| 328.20 | 0.7758 | 0.1939 |
| 328.20 | 0.6739 | 0.2888 |
| 328.20 | 0.5746 | 0.3831 |
| 328.20 | 0.4756 | 0.4756 |
| 328.20 | 0.3611 | 0.5830 |
| 328.20 | 0.2441 | 0.6961 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Citric acid (1) - Liquid mixture 1 | Mass fraction of 1-Decanol (2) - Liquid mixture 1 | Mass fraction of 1-Decanol (2) - Liquid mixture 2 | Mass fraction of Citric acid (1) - Liquid mixture 2 |
| 298.20 | 0.0310 | 0.9360 | 0.0237 | 0.1770 |
| 318.20 | 0.1296 | 0.8135 | 0.0679 | 0.6394 |
| 328.20 | 0.0234 | 0.9332 | 0.0359 | 0.2064 |
| 298.20 | 0.0553 | 0.9087 | 0.0280 | 0.2882 |
| 328.20 | 0.0443 | 0.9099 | 0.0401 | 0.3641 |
| 328.20 | 0.0550 | 0.8967 | 0.0468 | 0.4154 |
| 328.20 | 0.0811 | 0.8673 | 0.0537 | 0.5437 |
| 328.20 | 0.1054 | 0.8386 | 0.0633 | 0.6196 |
| 328.20 | 0.1223 | 0.8179 | 0.0763 | 0.6480 |
| 298.20 | 0.0727 | 0.8893 | 0.0333 | 0.3607 |
| 298.20 | 0.0991 | 0.8603 | 0.0393 | 0.4763 |
| 308.20 | 0.0931 | 0.8622 | 0.0460 | 0.4909 |
| 298.20 | 0.1264 | 0.8296 | 0.0469 | 0.5749 |
| 298.20 | 0.1405 | 0.8125 | 0.0539 | 0.6052 |
| 308.20 | 0.0296 | 0.9341 | 0.0283 | 0.1891 |
| 308.20 | 0.0522 | 0.9082 | 0.0330 | 0.3114 |
| 308.20 | 0.0695 | 0.8887 | 0.0392 | 0.3900 |
| 308.20 | 0.1217 | 0.8299 | 0.0549 | 0.5908 |
| 308.20 | 0.1374 | 0.8109 | 0.0632 | 0.6276 |
| 318.20 | 0.0269 | 0.9332 | 0.0319 | 0.1976 |
| 318.20 | 0.0497 | 0.9068 | 0.0364 | 0.3367 |
| 318.20 | 0.0638 | 0.8903 | 0.0428 | 0.4025 |
| 318.20 | 0.0869 | 0.8639 | 0.0497 | 0.5166 |
| 318.20 | 0.1159 | 0.8308 | 0.0590 | 0.6050 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Citric acid (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.20 | 0.9975 | 0.0000 | 1.3355 |
| 298.20 | 0.8911 | 0.0990 | 1.3455 |
| 298.20 | 0.7843 | 0.1961 | 1.3589 |
| 298.20 | 0.6813 | 0.2920 | 1.3735 |
| 298.20 | 0.5808 | 0.3872 | 1.387 |
| 298.20 | 0.4808 | 0.4808 | 1.399 |
| 298.20 | 0.3733 | 0.5818 | 1.4122 |
| 298.20 | 0.2484 | 0.7019 | 1.4281 |
| 308.20 | 0.9938 | 0.0000 | 1.3346 |
| 308.20 | 0.8878 | 0.0986 | 1.3446 |
| 308.20 | 0.7814 | 0.1954 | 1.3573 |
| 308.20 | 0.6788 | 0.2909 | 1.3715 |
| 308.20 | 0.5787 | 0.3858 | 1.3837 |
| 308.20 | 0.4790 | 0.4790 | 1.3971 |
| 308.20 | 0.3574 | 0.5932 | 1.411 |
| 308.20 | 0.2418 | 0.7062 | 1.4253 |
| 318.20 | 0.9901 | 0.0000 | 1.3332 |
| 318.20 | 0.8845 | 0.0983 | 1.3436 |
| 318.20 | 0.7786 | 0.1946 | 1.3549 |
| 318.20 | 0.6763 | 0.2899 | 1.3695 |
| 318.20 | 0.5766 | 0.3844 | 1.382 |
| 318.20 | 0.4773 | 0.4773 | 1.3968 |
| 318.20 | 0.3786 | 0.5703 | 1.4071 |
| 318.20 | 0.2461 | 0.6973 | 1.4237 |
| 328.20 | 0.9864 | 0.0000 | 1.3322 |
| 328.20 | 0.8813 | 0.0979 | 1.3421 |
| 328.20 | 0.7758 | 0.1939 | 1.3532 |
| 328.20 | 0.6739 | 0.2888 | 1.3673 |
| 328.20 | 0.5746 | 0.3831 | 1.3809 |
| 328.20 | 0.4756 | 0.4756 | 1.3948 |
| 328.20 | 0.3611 | 0.5830 | 1.4074 |
| 328.20 | 0.2441 | 0.6961 | 1.4214 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Citric acid (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.20 | 0.9975 | 0.0000 | 1.3355 |
| 298.20 | 0.8911 | 0.0990 | 1.3455 |
| 298.20 | 0.7843 | 0.1961 | 1.3589 |
| 298.20 | 0.6813 | 0.2920 | 1.3735 |
| 298.20 | 0.5808 | 0.3872 | 1.387 |
| 298.20 | 0.4808 | 0.4808 | 1.399 |
| 298.20 | 0.3733 | 0.5818 | 1.4122 |
| 298.20 | 0.2484 | 0.7019 | 1.4281 |
| 308.20 | 0.9938 | 0.0000 | 1.3346 |
| 308.20 | 0.8878 | 0.0986 | 1.3446 |
| 308.20 | 0.7814 | 0.1954 | 1.3573 |
| 308.20 | 0.6788 | 0.2909 | 1.3715 |
| 308.20 | 0.5787 | 0.3858 | 1.3837 |
| 308.20 | 0.4790 | 0.4790 | 1.3971 |
| 308.20 | 0.3574 | 0.5932 | 1.411 |
| 308.20 | 0.2418 | 0.7062 | 1.4253 |
| 318.20 | 0.9901 | 0.0000 | 1.3332 |
| 318.20 | 0.8845 | 0.0983 | 1.3436 |
| 318.20 | 0.7786 | 0.1946 | 1.3549 |
| 318.20 | 0.6763 | 0.2899 | 1.3695 |
| 318.20 | 0.5766 | 0.3844 | 1.382 |
| 318.20 | 0.4773 | 0.4773 | 1.3968 |
| 318.20 | 0.3786 | 0.5703 | 1.4071 |
| 318.20 | 0.2461 | 0.6973 | 1.4237 |
| 328.20 | 0.9864 | 0.0000 | 1.3322 |
| 328.20 | 0.8813 | 0.0979 | 1.3421 |
| 328.20 | 0.7758 | 0.1939 | 1.3532 |
| 328.20 | 0.6739 | 0.2888 | 1.3673 |
| 328.20 | 0.5746 | 0.3831 | 1.3809 |
| 328.20 | 0.4756 | 0.4756 | 1.3948 |
| 328.20 | 0.3611 | 0.5830 | 1.4074 |
| 328.20 | 0.2441 | 0.6961 | 1.4214 |