- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
- Name
- Cyclohexane
- InChI
- InChI=1S/C6H12/c1-2-4-6-5-3-1/h1-6H2
- InChI Key
- XDTMQSROBMDMFD-UHFFFAOYSA-N
- Formula
- C6H12
- SMILES
- C1CCCCC1
- Mol. Weight (g/mol)
- 84.16
- CAS
- 110-82-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of o-Xylene (1) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0998 | 0.0008 |
| 303.15 | 0.2001 | 0.0007 |
| 303.15 | 0.3000 | 0.0007 |
| 303.15 | 0.4000 | 0.0007 |
| 303.15 | 0.5000 | 0.0007 |
| 303.15 | 0.6000 | 0.0007 |
| 303.15 | 0.7001 | 0.0007 |
| 303.15 | 0.7999 | 0.0007 |
| 303.15 | 0.9000 | 0.0007 |
| 308.15 | 0.0998 | 0.0007 |
| 308.15 | 0.2001 | 0.0007 |
| 308.15 | 0.3000 | 0.0007 |
| 308.15 | 0.4000 | 0.0006 |
| 308.15 | 0.5000 | 0.0006 |
| 308.15 | 0.6000 | 0.0006 |
| 308.15 | 0.7001 | 0.0006 |
| 308.15 | 0.7999 | 0.0006 |
| 308.15 | 0.9000 | 0.0006 |
| 313.15 | 0.0998 | 0.0007 |
| 313.15 | 0.2001 | 0.0006 |
| 313.15 | 0.3000 | 0.0006 |
| 313.15 | 0.4000 | 0.0006 |
| 313.15 | 0.5000 | 0.0006 |
| 313.15 | 0.6000 | 0.0006 |
| 313.15 | 0.7001 | 0.0006 |
| 313.15 | 0.7999 | 0.0006 |
| 313.15 | 0.9000 | 0.0006 |
| 318.15 | 0.0998 | 0.0006 |
| 318.15 | 0.2001 | 0.0006 |
| 318.15 | 0.3000 | 0.0006 |
| 318.15 | 0.4000 | 0.0006 |
| 318.15 | 0.5000 | 0.0006 |
| 318.15 | 0.6000 | 0.0006 |
| 318.15 | 0.7001 | 0.0006 |
| 318.15 | 0.7999 | 0.0006 |
| 318.15 | 0.9000 | 0.0006 |
| 323.15 | 0.0998 | 0.0006 |
| 323.15 | 0.2001 | 0.0006 |
| 323.15 | 0.3000 | 0.0005 |
| 323.15 | 0.4000 | 0.0005 |
| 323.15 | 0.5000 | 0.0005 |
| 323.15 | 0.6000 | 0.0005 |
| 323.15 | 0.7001 | 0.0005 |
| 323.15 | 0.7999 | 0.0005 |
| 323.15 | 0.9000 | 0.0005 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of o-Xylene (1) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0998 | 0.0008 |
| 303.15 | 0.2001 | 0.0007 |
| 303.15 | 0.3000 | 0.0007 |
| 303.15 | 0.4000 | 0.0007 |
| 303.15 | 0.5000 | 0.0007 |
| 303.15 | 0.6000 | 0.0007 |
| 303.15 | 0.7001 | 0.0007 |
| 303.15 | 0.7999 | 0.0007 |
| 303.15 | 0.9000 | 0.0007 |
| 308.15 | 0.0998 | 0.0007 |
| 308.15 | 0.2001 | 0.0007 |
| 308.15 | 0.3000 | 0.0007 |
| 308.15 | 0.4000 | 0.0006 |
| 308.15 | 0.5000 | 0.0006 |
| 308.15 | 0.6000 | 0.0006 |
| 308.15 | 0.7001 | 0.0006 |
| 308.15 | 0.7999 | 0.0006 |
| 308.15 | 0.9000 | 0.0006 |
| 313.15 | 0.0998 | 0.0007 |
| 313.15 | 0.2001 | 0.0006 |
| 313.15 | 0.3000 | 0.0006 |
| 313.15 | 0.4000 | 0.0006 |
| 313.15 | 0.5000 | 0.0006 |
| 313.15 | 0.6000 | 0.0006 |
| 313.15 | 0.7001 | 0.0006 |
| 313.15 | 0.7999 | 0.0006 |
| 313.15 | 0.9000 | 0.0006 |
| 318.15 | 0.0998 | 0.0006 |
| 318.15 | 0.2001 | 0.0006 |
| 318.15 | 0.3000 | 0.0006 |
| 318.15 | 0.4000 | 0.0006 |
| 318.15 | 0.5000 | 0.0006 |
| 318.15 | 0.6000 | 0.0006 |
| 318.15 | 0.7001 | 0.0006 |
| 318.15 | 0.7999 | 0.0006 |
| 318.15 | 0.9000 | 0.0006 |
| 323.15 | 0.0998 | 0.0006 |
| 323.15 | 0.2001 | 0.0006 |
| 323.15 | 0.3000 | 0.0005 |
| 323.15 | 0.4000 | 0.0005 |
| 323.15 | 0.5000 | 0.0005 |
| 323.15 | 0.6000 | 0.0005 |
| 323.15 | 0.7001 | 0.0005 |
| 323.15 | 0.7999 | 0.0005 |
| 323.15 | 0.9000 | 0.0005 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0471 | 1.499 |
| 298.15 | 0.0981 | 1.4949 |
| 298.15 | 0.1961 | 1.487 |
| 298.15 | 0.2986 | 1.4789 |
| 298.15 | 0.3979 | 1.4709 |
| 298.15 | 0.4964 | 1.4629 |
| 298.15 | 0.5975 | 1.4549 |
| 298.15 | 0.6978 | 1.4469 |
| 298.15 | 0.7960 | 1.4392 |
| 298.15 | 0.8995 | 1.4313 |
| 298.15 | 0.9512 | 1.4274 |
| 298.15 | 1.0000 | 1.4236 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0528 | 1.4905 |
| 313.15 | 0.0977 | 1.4872 |
| 313.15 | 0.1958 | 1.4793 |
| 313.15 | 0.2169 | 1.4775 |
| 313.15 | 0.4011 | 1.4628 |
| 313.15 | 0.4999 | 1.4547 |
| 313.15 | 0.5976 | 1.4469 |
| 313.15 | 0.6971 | 1.4392 |
| 313.15 | 0.7994 | 1.4309 |
| 313.15 | 0.8995 | 1.4231 |
| 313.15 | 0.9484 | 1.4193 |
| 313.15 | 1.0000 | 1.4152 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0471 | 1.499 |
| 298.15 | 0.0981 | 1.4949 |
| 298.15 | 0.1961 | 1.487 |
| 298.15 | 0.2986 | 1.4789 |
| 298.15 | 0.3979 | 1.4709 |
| 298.15 | 0.4964 | 1.4629 |
| 298.15 | 0.5975 | 1.4549 |
| 298.15 | 0.6978 | 1.4469 |
| 298.15 | 0.7960 | 1.4392 |
| 298.15 | 0.8995 | 1.4313 |
| 298.15 | 0.9512 | 1.4274 |
| 298.15 | 1.0000 | 1.4236 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0528 | 1.4905 |
| 313.15 | 0.0977 | 1.4872 |
| 313.15 | 0.1958 | 1.4793 |
| 313.15 | 0.2169 | 1.4775 |
| 313.15 | 0.4011 | 1.4628 |
| 313.15 | 0.4999 | 1.4547 |
| 313.15 | 0.5976 | 1.4469 |
| 313.15 | 0.6971 | 1.4392 |
| 313.15 | 0.7994 | 1.4309 |
| 313.15 | 0.8995 | 1.4231 |
| 313.15 | 0.9484 | 1.4193 |
| 313.15 | 1.0000 | 1.4152 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of o-Xylene (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0998 | 778.1 |
| 303.15 | 0.2001 | 788.0 |
| 303.15 | 0.3000 | 798.1 |
| 303.15 | 0.4000 | 808.4 |
| 303.15 | 0.5000 | 818.8 |
| 303.15 | 0.6000 | 829.2 |
| 303.15 | 0.7001 | 839.6 |
| 303.15 | 0.7999 | 850.2 |
| 303.15 | 0.9000 | 861.0 |
| 308.15 | 0.0998 | 773.4 |
| 308.15 | 0.2001 | 783.4 |
| 308.15 | 0.3000 | 793.6 |
| 308.15 | 0.4000 | 803.9 |
| 308.15 | 0.5000 | 814.4 |
| 308.15 | 0.6000 | 824.8 |
| 308.15 | 0.7001 | 835.3 |
| 308.15 | 0.7999 | 845.9 |
| 308.15 | 0.9000 | 856.7 |
| 313.15 | 0.0998 | 768.8 |
| 313.15 | 0.2001 | 778.8 |
| 313.15 | 0.3000 | 789.1 |
| 313.15 | 0.4000 | 799.5 |
| 313.15 | 0.5000 | 810.0 |
| 313.15 | 0.6000 | 820.4 |
| 313.15 | 0.7001 | 830.9 |
| 313.15 | 0.7999 | 841.5 |
| 313.15 | 0.9000 | 852.3 |
| 318.15 | 0.0998 | 764.0 |
| 318.15 | 0.2001 | 774.2 |
| 318.15 | 0.3000 | 784.6 |
| 318.15 | 0.4000 | 795.1 |
| 318.15 | 0.5000 | 805.7 |
| 318.15 | 0.6000 | 816.1 |
| 318.15 | 0.7001 | 826.7 |
| 318.15 | 0.7999 | 837.4 |
| 318.15 | 0.9000 | 848.3 |
| 323.15 | 0.0998 | 759.2 |
| 323.15 | 0.2001 | 769.5 |
| 323.15 | 0.3000 | 780.0 |
| 323.15 | 0.4000 | 790.5 |
| 323.15 | 0.5000 | 801.1 |
| 323.15 | 0.6000 | 811.6 |
| 323.15 | 0.7001 | 822.2 |
| 323.15 | 0.7999 | 832.9 |
| 323.15 | 0.9000 | 843.8 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0471 | 870.8 |
| 298.15 | 0.0981 | 865.5 |
| 298.15 | 0.1961 | 855.2 |
| 298.15 | 0.2986 | 844.5 |
| 298.15 | 0.3979 | 834.0 |
| 298.15 | 0.4964 | 823.8 |
| 298.15 | 0.5975 | 813.5 |
| 298.15 | 0.6978 | 803.2 |
| 298.15 | 0.7960 | 793.4 |
| 298.15 | 0.8995 | 783.4 |
| 298.15 | 0.9512 | 778.6 |
| 298.15 | 1.0000 | 773.9 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0528 | 857.4 |
| 313.15 | 0.0977 | 852.7 |
| 313.15 | 0.1958 | 842.3 |
| 313.15 | 0.2169 | 840.0 |
| 313.15 | 0.4011 | 820.4 |
| 313.15 | 0.4999 | 809.9 |
| 313.15 | 0.5976 | 799.6 |
| 313.15 | 0.6971 | 789.4 |
| 313.15 | 0.7994 | 779.0 |
| 313.15 | 0.8995 | 769.1 |
| 313.15 | 0.9484 | 764.5 |
| 313.15 | 1.0000 | 759.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of o-Xylene (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0998 | 778.1 |
| 303.15 | 0.2001 | 788.0 |
| 303.15 | 0.3000 | 798.1 |
| 303.15 | 0.4000 | 808.4 |
| 303.15 | 0.5000 | 818.8 |
| 303.15 | 0.6000 | 829.2 |
| 303.15 | 0.7001 | 839.6 |
| 303.15 | 0.7999 | 850.2 |
| 303.15 | 0.9000 | 861.0 |
| 308.15 | 0.0998 | 773.4 |
| 308.15 | 0.2001 | 783.4 |
| 308.15 | 0.3000 | 793.6 |
| 308.15 | 0.4000 | 803.9 |
| 308.15 | 0.5000 | 814.4 |
| 308.15 | 0.6000 | 824.8 |
| 308.15 | 0.7001 | 835.3 |
| 308.15 | 0.7999 | 845.9 |
| 308.15 | 0.9000 | 856.7 |
| 313.15 | 0.0998 | 768.8 |
| 313.15 | 0.2001 | 778.8 |
| 313.15 | 0.3000 | 789.1 |
| 313.15 | 0.4000 | 799.5 |
| 313.15 | 0.5000 | 810.0 |
| 313.15 | 0.6000 | 820.4 |
| 313.15 | 0.7001 | 830.9 |
| 313.15 | 0.7999 | 841.5 |
| 313.15 | 0.9000 | 852.3 |
| 318.15 | 0.0998 | 764.0 |
| 318.15 | 0.2001 | 774.2 |
| 318.15 | 0.3000 | 784.6 |
| 318.15 | 0.4000 | 795.1 |
| 318.15 | 0.5000 | 805.7 |
| 318.15 | 0.6000 | 816.1 |
| 318.15 | 0.7001 | 826.7 |
| 318.15 | 0.7999 | 837.4 |
| 318.15 | 0.9000 | 848.3 |
| 323.15 | 0.0998 | 759.2 |
| 323.15 | 0.2001 | 769.5 |
| 323.15 | 0.3000 | 780.0 |
| 323.15 | 0.4000 | 790.5 |
| 323.15 | 0.5000 | 801.1 |
| 323.15 | 0.6000 | 811.6 |
| 323.15 | 0.7001 | 822.2 |
| 323.15 | 0.7999 | 832.9 |
| 323.15 | 0.9000 | 843.8 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0471 | 870.8 |
| 298.15 | 0.0981 | 865.5 |
| 298.15 | 0.1961 | 855.2 |
| 298.15 | 0.2986 | 844.5 |
| 298.15 | 0.3979 | 834.0 |
| 298.15 | 0.4964 | 823.8 |
| 298.15 | 0.5975 | 813.5 |
| 298.15 | 0.6978 | 803.2 |
| 298.15 | 0.7960 | 793.4 |
| 298.15 | 0.8995 | 783.4 |
| 298.15 | 0.9512 | 778.6 |
| 298.15 | 1.0000 | 773.9 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0528 | 857.4 |
| 313.15 | 0.0977 | 852.7 |
| 313.15 | 0.1958 | 842.3 |
| 313.15 | 0.2169 | 840.0 |
| 313.15 | 0.4011 | 820.4 |
| 313.15 | 0.4999 | 809.9 |
| 313.15 | 0.5976 | 799.6 |
| 313.15 | 0.6971 | 789.4 |
| 313.15 | 0.7994 | 779.0 |
| 313.15 | 0.8995 | 769.1 |
| 313.15 | 0.9484 | 764.5 |
| 313.15 | 1.0000 | 759.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0471 | 1343.0 |
| 298.15 | 0.0981 | 1336.0 |
| 298.15 | 0.1961 | 1323.0 |
| 298.15 | 0.2986 | 1310.0 |
| 298.15 | 0.3979 | 1298.0 |
| 298.15 | 0.4964 | 1288.0 |
| 298.15 | 0.5975 | 1278.0 |
| 298.15 | 0.6978 | 1269.0 |
| 298.15 | 0.7960 | 1263.0 |
| 298.15 | 0.8995 | 1257.0 |
| 298.15 | 0.9512 | 1255.0 |
| 298.15 | 1.0000 | 1255.0 |
| 313.15 | 0.0000 | 1289.0 |
| 313.15 | 0.0528 | 1282.0 |
| 313.15 | 0.0977 | 1275.0 |
| 313.15 | 0.1958 | 1261.0 |
| 313.15 | 0.2169 | 1258.0 |
| 313.15 | 0.4011 | 1234.0 |
| 313.15 | 0.4999 | 1222.0 |
| 313.15 | 0.5976 | 1211.0 |
| 313.15 | 0.6971 | 1201.0 |
| 313.15 | 0.7994 | 1193.0 |
| 313.15 | 0.8995 | 1186.0 |
| 313.15 | 0.9484 | 1183.0 |
| 313.15 | 1.0000 | 1182.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0471 | 1343.0 |
| 298.15 | 0.0981 | 1336.0 |
| 298.15 | 0.1961 | 1323.0 |
| 298.15 | 0.2986 | 1310.0 |
| 298.15 | 0.3979 | 1298.0 |
| 298.15 | 0.4964 | 1288.0 |
| 298.15 | 0.5975 | 1278.0 |
| 298.15 | 0.6978 | 1269.0 |
| 298.15 | 0.7960 | 1263.0 |
| 298.15 | 0.8995 | 1257.0 |
| 298.15 | 0.9512 | 1255.0 |
| 298.15 | 1.0000 | 1255.0 |
| 313.15 | 0.0000 | 1289.0 |
| 313.15 | 0.0528 | 1282.0 |
| 313.15 | 0.0977 | 1275.0 |
| 313.15 | 0.1958 | 1261.0 |
| 313.15 | 0.2169 | 1258.0 |
| 313.15 | 0.4011 | 1234.0 |
| 313.15 | 0.4999 | 1222.0 |
| 313.15 | 0.5976 | 1211.0 |
| 313.15 | 0.6971 | 1201.0 |
| 313.15 | 0.7994 | 1193.0 |
| 313.15 | 0.8995 | 1186.0 |
| 313.15 | 0.9484 | 1183.0 |
| 313.15 | 1.0000 | 1182.0 |
Sources
- Densities and Dynamic Viscosities of Alicyclic Cyclohexane with Toluene, o-Xylene, and Mesitylene at T = (303.15 to 323.15) K and Atmospheric Pressure
- Density, Speed of Sound, and Refractive Index for Binary Mixtures Containing Cycloalkanes with o-Xylene, m-Xylene, p-Xylene, and Mesitylene at T = (298.15 and 313.15) K