- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- 2-Naphthalenol
- InChI
- InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H
- InChI Key
- JWAZRIHNYRIHIV-UHFFFAOYSA-N
- Formula
- C10H8O
- SMILES
- Oc1ccc2ccccc2c1
- Mol. Weight (g/mol)
- 144.17
- CAS
- 135-19-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 2-Naphthalenol (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 2-Naphthalenol (2) - Fluid (supercritical or subcritical phases) |
| 313.25 | 10000.00 | 0.0784 |
| 313.35 | 20030.00 | 0.0879 |
| 313.20 | 29850.00 | 0.0903 |
| 313.30 | 39940.00 | 0.0789 |
| 313.25 | 49470.00 | 0.0825 |
| 313.05 | 59640.00 | 0.0851 |
| 353.25 | 9970.00 | 0.0740 |
| 353.40 | 20020.00 | 0.0781 |
| 353.20 | 30050.00 | 0.0765 |
| 353.30 | 39890.00 | 0.0765 |
| 353.45 | 49950.00 | 0.0788 |
| 333.45 | 9950.00 | 0.0736 |
| 333.30 | 19840.00 | 0.0760 |
| 332.58 | 29880.00 | 0.0731 |
| 333.02 | 40720.00 | 0.0727 |
| 333.45 | 50060.00 | 0.0803 |
| 332.85 | 60000.00 | 0.0761 |
Mole fraction of 2-Naphthalenol (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 2-Naphthalenol (2) - Fluid (supercritical or subcritical phases) |
| 313.25 | 10000.00 | 0.0784 |
| 313.35 | 20030.00 | 0.0879 |
| 313.20 | 29850.00 | 0.0903 |
| 313.30 | 39940.00 | 0.0789 |
| 313.25 | 49470.00 | 0.0825 |
| 313.05 | 59640.00 | 0.0851 |
| 353.25 | 9970.00 | 0.0740 |
| 353.40 | 20020.00 | 0.0781 |
| 353.20 | 30050.00 | 0.0765 |
| 353.30 | 39890.00 | 0.0765 |
| 353.45 | 49950.00 | 0.0788 |
| 333.45 | 9950.00 | 0.0736 |
| 333.30 | 19840.00 | 0.0760 |
| 332.58 | 29880.00 | 0.0731 |
| 333.02 | 40720.00 | 0.0727 |
| 333.45 | 50060.00 | 0.0803 |
| 332.85 | 60000.00 | 0.0761 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mass density, kg/m3 - Fluid (supercritical or subcritical phases) |
| 313.00 | 690.00 | 16.18 |
| 313.00 | 3440.00 | 74.31 |
| 313.00 | 5540.00 | 137.24 |
| 313.00 | 7570.00 | 237.62 |
| 313.00 | 9220.00 | 477.38 |
| 313.00 | 12220.00 | 712.57 |
| 313.00 | 13950.00 | 754.37 |
| 313.00 | 16630.00 | 799.16 |
| 313.00 | 19290.00 | 830.24 |
| 313.00 | 22770.00 | 861.64 |
| 313.00 | 26570.00 | 889.5 |
| 313.00 | 29200.00 | 906.02 |
| 313.00 | 33730.00 | 929.35 |
| 313.00 | 39390.00 | 954.14 |
| 333.00 | 1300.00 | 21.31 |
| 333.00 | 3430.00 | 60.92 |
| 333.00 | 5660.00 | 112.53 |
| 333.00 | 9160.00 | 237.55 |
| 333.00 | 13910.00 | 540.68 |
| 333.00 | 17000.00 | 651.37 |
| 333.00 | 20120.00 | 715.08 |
| 333.00 | 25460.00 | 783.89 |
| 333.00 | 29390.00 | 818.98 |
| 333.00 | 34530.00 | 855.16 |
| 333.00 | 39850.00 | 874.76 |
| 353.00 | 1970.00 | 29.02 |
| 353.00 | 5040.00 | 85.27 |
| 353.00 | 13540.00 | 352.64 |
| 353.00 | 19820.00 | 576.64 |
| 353.00 | 25880.00 | 686.94 |
| 353.00 | 30150.00 | 743.88 |
| 353.00 | 35060.00 | 792.18 |
| 353.00 | 38910.00 | 820.4 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mass density, kg/m3 - Fluid (supercritical or subcritical phases) |
| 313.00 | 690.00 | 16.18 |
| 313.00 | 3440.00 | 74.31 |
| 313.00 | 5540.00 | 137.24 |
| 313.00 | 7570.00 | 237.62 |
| 313.00 | 9220.00 | 477.38 |
| 313.00 | 12220.00 | 712.57 |
| 313.00 | 13950.00 | 754.37 |
| 313.00 | 16630.00 | 799.16 |
| 313.00 | 19290.00 | 830.24 |
| 313.00 | 22770.00 | 861.64 |
| 313.00 | 26570.00 | 889.5 |
| 313.00 | 29200.00 | 906.02 |
| 313.00 | 33730.00 | 929.35 |
| 313.00 | 39390.00 | 954.14 |
| 333.00 | 1300.00 | 21.31 |
| 333.00 | 3430.00 | 60.92 |
| 333.00 | 5660.00 | 112.53 |
| 333.00 | 9160.00 | 237.55 |
| 333.00 | 13910.00 | 540.68 |
| 333.00 | 17000.00 | 651.37 |
| 333.00 | 20120.00 | 715.08 |
| 333.00 | 25460.00 | 783.89 |
| 333.00 | 29390.00 | 818.98 |
| 333.00 | 34530.00 | 855.16 |
| 333.00 | 39850.00 | 874.76 |
| 353.00 | 1970.00 | 29.02 |
| 353.00 | 5040.00 | 85.27 |
| 353.00 | 13540.00 | 352.64 |
| 353.00 | 19820.00 | 576.64 |
| 353.00 | 25880.00 | 686.94 |
| 353.00 | 30150.00 | 743.88 |
| 353.00 | 35060.00 | 792.18 |
| 353.00 | 38910.00 | 820.4 |
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Fluid (supercritical or subcritical phases) | Vapor or sublimation pressure, kPa - Fluid (supercritical or subcritical phases) |
|---|---|
| 396.98 | 100.00 |
| 397.40 | 2510.00 |
| 394.40 | 4980.00 |
| 390.10 | 10060.00 |
| 386.05 | 14790.00 |
| 383.45 | 20480.00 |
| 384.10 | 30480.00 |
| 385.05 | 39990.00 |
| 386.10 | 51120.00 |
| 387.35 | 60570.00 |
Temperature, K
Vapor or sublimation pressure, kPa
0
10000
20000
30000
40000
50000
60000
385
390
395
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Fluid (supercritical or subcritical phases) | Vapor or sublimation pressure, kPa - Fluid (supercritical or subcritical phases) |
|---|---|
| 396.98 | 100.00 |
| 397.40 | 2510.00 |
| 394.40 | 4980.00 |
| 390.10 | 10060.00 |
| 386.05 | 14790.00 |
| 383.45 | 20480.00 |
| 384.10 | 30480.00 |
| 385.05 | 39990.00 |
| 386.10 | 51120.00 |
| 387.35 | 60570.00 |
Temperature, K
Vapor or sublimation pressure, kPa
0
10000
20000
30000
40000
50000
60000
385
390
395