- Name
- 1-Naphthalenol
- InChI
- InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H
- InChI Key
- KJCVRFUGPWSIIH-UHFFFAOYSA-N
- Formula
- C10H8O
- SMILES
- Oc1cccc2ccccc12
- Mol. Weight (g/mol)
- 144.17
- CAS
- 90-15-3
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 1-Naphthalenol (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1-Naphthalenol (1) - Fluid (supercritical or subcritical phases) |
| 313.05 | 10040.00 | 0.0833 |
| 313.05 | 20390.00 | 0.0940 |
| 313.35 | 29550.00 | 0.1096 |
| 313.10 | 40230.00 | 0.1112 |
| 313.33 | 49630.00 | 0.1194 |
| 313.25 | 57940.00 | 0.1057 |
| 313.40 | 59530.00 | 0.1036 |
| 332.95 | 10450.00 | 0.0593 |
| 333.15 | 20800.00 | 0.0840 |
| 333.25 | 30590.00 | 0.1078 |
| 333.30 | 41270.00 | 0.1113 |
| 333.15 | 49470.00 | 0.1084 |
| 333.35 | 51600.00 | 0.1030 |
| 333.15 | 58840.00 | 0.0992 |
| 353.35 | 10490.00 | 0.0772 |
| 352.80 | 19570.00 | 0.0834 |
| 353.05 | 30520.00 | 0.0834 |
| 353.30 | 40580.00 | 0.0792 |
| 353.30 | 50110.00 | 0.0784 |
| 353.10 | 59130.00 | 0.0697 |
Mole fraction of 1-Naphthalenol (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1-Naphthalenol (1) - Fluid (supercritical or subcritical phases) |
| 313.05 | 10040.00 | 0.0833 |
| 313.05 | 20390.00 | 0.0940 |
| 313.35 | 29550.00 | 0.1096 |
| 313.10 | 40230.00 | 0.1112 |
| 313.33 | 49630.00 | 0.1194 |
| 313.25 | 57940.00 | 0.1057 |
| 313.40 | 59530.00 | 0.1036 |
| 332.95 | 10450.00 | 0.0593 |
| 333.15 | 20800.00 | 0.0840 |
| 333.25 | 30590.00 | 0.1078 |
| 333.30 | 41270.00 | 0.1113 |
| 333.15 | 49470.00 | 0.1084 |
| 333.35 | 51600.00 | 0.1030 |
| 333.15 | 58840.00 | 0.0992 |
| 353.35 | 10490.00 | 0.0772 |
| 352.80 | 19570.00 | 0.0834 |
| 353.05 | 30520.00 | 0.0834 |
| 353.30 | 40580.00 | 0.0792 |
| 353.30 | 50110.00 | 0.0784 |
| 353.10 | 59130.00 | 0.0697 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mass density, kg/m3 - Fluid (supercritical or subcritical phases) |
| 313.00 | 1160.00 | 47.04 |
| 313.00 | 3140.00 | 83.35 |
| 313.00 | 5240.00 | 143.14 |
| 313.00 | 6330.00 | 192.59 |
| 313.00 | 7220.00 | 237.08 |
| 313.00 | 8170.00 | 320.9 |
| 313.00 | 9970.00 | 651.56 |
| 313.00 | 10640.00 | 704.02 |
| 313.00 | 12120.00 | 763.2 |
| 313.00 | 13980.00 | 809.51 |
| 313.00 | 15660.00 | 831.36 |
| 313.00 | 18130.00 | 833.74 |
| 313.00 | 21590.00 | 864.24 |
| 313.00 | 25710.00 | 892.42 |
| 313.00 | 29810.00 | 912.78 |
| 313.00 | 34290.00 | 934.49 |
| 333.00 | 1500.00 | 52.02 |
| 333.00 | 3100.00 | 76.21 |
| 333.00 | 5450.00 | 142.3 |
| 333.00 | 6270.00 | 168.46 |
| 333.00 | 7030.00 | 198.25 |
| 333.00 | 7950.00 | 229.84 |
| 333.00 | 9520.00 | 296.29 |
| 333.00 | 11320.00 | 408.6 |
| 333.00 | 13280.00 | 509.67 |
| 333.00 | 15130.00 | 605.61 |
| 333.00 | 16120.00 | 628.76 |
| 333.00 | 19820.00 | 749.4 |
| 333.00 | 25180.00 | 781.03 |
| 333.00 | 31150.00 | 835.42 |
| 333.00 | 34470.00 | 855.78 |
| 333.00 | 39480.00 | 884.589 |
| 353.00 | 1120.00 | 15.55 |
| 353.00 | 3090.00 | 48.47 |
| 353.00 | 6360.00 | 114.62 |
| 353.00 | 9220.00 | 189.61 |
| 353.00 | 11950.00 | 289.19 |
| 353.00 | 16100.00 | 458.82 |
| 353.00 | 19900.00 | 583.64 |
| 353.00 | 23300.00 | 649.01 |
| 353.00 | 28100.00 | 714.82 |
| 353.00 | 31140.00 | 747.07 |
| 353.00 | 37780.00 | 798.4 |
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mass density, kg/m3 - Fluid (supercritical or subcritical phases) |
| 313.00 | 1160.00 | 47.04 |
| 313.00 | 3140.00 | 83.35 |
| 313.00 | 5240.00 | 143.14 |
| 313.00 | 6330.00 | 192.59 |
| 313.00 | 7220.00 | 237.08 |
| 313.00 | 8170.00 | 320.9 |
| 313.00 | 9970.00 | 651.56 |
| 313.00 | 10640.00 | 704.02 |
| 313.00 | 12120.00 | 763.2 |
| 313.00 | 13980.00 | 809.51 |
| 313.00 | 15660.00 | 831.36 |
| 313.00 | 18130.00 | 833.74 |
| 313.00 | 21590.00 | 864.24 |
| 313.00 | 25710.00 | 892.42 |
| 313.00 | 29810.00 | 912.78 |
| 313.00 | 34290.00 | 934.49 |
| 333.00 | 1500.00 | 52.02 |
| 333.00 | 3100.00 | 76.21 |
| 333.00 | 5450.00 | 142.3 |
| 333.00 | 6270.00 | 168.46 |
| 333.00 | 7030.00 | 198.25 |
| 333.00 | 7950.00 | 229.84 |
| 333.00 | 9520.00 | 296.29 |
| 333.00 | 11320.00 | 408.6 |
| 333.00 | 13280.00 | 509.67 |
| 333.00 | 15130.00 | 605.61 |
| 333.00 | 16120.00 | 628.76 |
| 333.00 | 19820.00 | 749.4 |
| 333.00 | 25180.00 | 781.03 |
| 333.00 | 31150.00 | 835.42 |
| 333.00 | 34470.00 | 855.78 |
| 333.00 | 39480.00 | 884.589 |
| 353.00 | 1120.00 | 15.55 |
| 353.00 | 3090.00 | 48.47 |
| 353.00 | 6360.00 | 114.62 |
| 353.00 | 9220.00 | 189.61 |
| 353.00 | 11950.00 | 289.19 |
| 353.00 | 16100.00 | 458.82 |
| 353.00 | 19900.00 | 583.64 |
| 353.00 | 23300.00 | 649.01 |
| 353.00 | 28100.00 | 714.82 |
| 353.00 | 31140.00 | 747.07 |
| 353.00 | 37780.00 | 798.4 |
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Fluid (supercritical or subcritical phases) | Vapor or sublimation pressure, kPa - Fluid (supercritical or subcritical phases) |
|---|---|
| 370.54 | 100.00 |
| 368.95 | 2400.00 |
| 365.45 | 5040.00 |
| 362.65 | 10210.00 |
| 359.90 | 15070.00 |
| 358.90 | 20250.00 |
| 359.15 | 30040.00 |
| 360.15 | 40840.00 |
| 360.80 | 50800.00 |
| 362.95 | 60840.00 |
Temperature, K
Vapor or sublimation pressure, kPa
0
10000
20000
30000
40000
50000
60000
360
365
370
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Fluid (supercritical or subcritical phases) | Vapor or sublimation pressure, kPa - Fluid (supercritical or subcritical phases) |
|---|---|
| 370.54 | 100.00 |
| 368.95 | 2400.00 |
| 365.45 | 5040.00 |
| 362.65 | 10210.00 |
| 359.90 | 15070.00 |
| 358.90 | 20250.00 |
| 359.15 | 30040.00 |
| 360.15 | 40840.00 |
| 360.80 | 50800.00 |
| 362.95 | 60840.00 |
Temperature, K
Vapor or sublimation pressure, kPa
0
10000
20000
30000
40000
50000
60000
360
365
370