- Name
- Benzene, 1,2-dichloro-
- InChI
- InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H
- InChI Key
- RFFLAFLAYFXFSW-UHFFFAOYSA-N
- Formula
- C6H4Cl2
- SMILES
- Clc1ccccc1Cl
- Mol. Weight (g/mol)
- 147.00
- CAS
- 95-50-1
- Name
- Buckminsterfullerene
- InChI
- InChI=1S/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59
- InChI Key
- XMWRBQBLMFGWIX-UHFFFAOYSA-N
- Formula
- C60
- SMILES
-
c12c3c4c5c1c1c6c7c2c2c8c3c3c9c
4c4c%10c5c5c1c1c6c6c%11c7c2c2c 7c8c3c3c8c9c4c4c9c%10c5c5c1c1c 6c6c%11c2c2c7c3c3c8c4c4c9c5c1c 1c6c2c3c41 - Mol. Weight (g/mol)
- 720.64
- CAS
- 99685-96-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Buckminsterfullerene (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.0000 | 1.5523 |
| 298.20 | 0.0000 | 1.5489 |
| 308.20 | 0.0000 | 1.5438 |
| 318.20 | 0.0000 | 1.5386 |
| 328.20 | 0.0000 | 1.5332 |
| 288.20 | 0.0038 | 1.5549 |
| 298.20 | 0.0038 | 1.5502 |
| 308.20 | 0.0038 | 1.5457 |
| 318.20 | 0.0038 | 1.5408 |
| 328.20 | 0.0038 | 1.5354 |
| 288.20 | 0.0077 | 1.5577 |
| 298.20 | 0.0077 | 1.5522 |
| 308.20 | 0.0077 | 1.5478 |
| 318.20 | 0.0077 | 1.5425 |
| 328.20 | 0.0077 | 1.5395 |
| 288.20 | 0.0115 | 1.5598 |
| 298.20 | 0.0115 | 1.5538 |
| 308.20 | 0.0115 | 1.5497 |
| 318.20 | 0.0115 | 1.5456 |
| 288.20 | 0.0154 | 1.5624 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Buckminsterfullerene (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.0000 | 1.5523 |
| 298.20 | 0.0000 | 1.5489 |
| 308.20 | 0.0000 | 1.5438 |
| 318.20 | 0.0000 | 1.5386 |
| 328.20 | 0.0000 | 1.5332 |
| 288.20 | 0.0038 | 1.5549 |
| 298.20 | 0.0038 | 1.5502 |
| 308.20 | 0.0038 | 1.5457 |
| 318.20 | 0.0038 | 1.5408 |
| 328.20 | 0.0038 | 1.5354 |
| 288.20 | 0.0077 | 1.5577 |
| 298.20 | 0.0077 | 1.5522 |
| 308.20 | 0.0077 | 1.5478 |
| 318.20 | 0.0077 | 1.5425 |
| 328.20 | 0.0077 | 1.5395 |
| 288.20 | 0.0115 | 1.5598 |
| 298.20 | 0.0115 | 1.5538 |
| 308.20 | 0.0115 | 1.5497 |
| 318.20 | 0.0115 | 1.5456 |
| 288.20 | 0.0154 | 1.5624 |
Binary diffusion coefficient, m2/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Buckminsterfullerene (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 288.20 | 0.0077 | 0.0000 |
| 293.20 | 0.0077 | 0.0000 |
| 298.20 | 0.0077 | 0.0000 |
| 303.20 | 0.0077 | 0.0000 |
| 308.20 | 0.0077 | 0.0000 |
| 313.20 | 0.0077 | 0.0000 |
| 318.20 | 0.0077 | 0.0000 |
| 323.20 | 0.0077 | 0.0000 |
| 328.20 | 0.0077 | 0.0000 |
| 333.20 | 0.0077 | 0.0000 |
| 298.20 | 0.0038 | 0.0000 |
| 298.20 | 0.0077 | 0.0000 |
| 298.20 | 0.0115 | 0.0000 |
| 298.20 | 0.0154 | 0.0000 |
| 298.20 | 0.0192 | 0.0000 |
| 298.20 | 0.0231 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Buckminsterfullerene (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 288.20 | 0.0077 | 0.0000 |
| 293.20 | 0.0077 | 0.0000 |
| 298.20 | 0.0077 | 0.0000 |
| 303.20 | 0.0077 | 0.0000 |
| 308.20 | 0.0077 | 0.0000 |
| 313.20 | 0.0077 | 0.0000 |
| 318.20 | 0.0077 | 0.0000 |
| 323.20 | 0.0077 | 0.0000 |
| 328.20 | 0.0077 | 0.0000 |
| 333.20 | 0.0077 | 0.0000 |
| 298.20 | 0.0038 | 0.0000 |
| 298.20 | 0.0077 | 0.0000 |
| 298.20 | 0.0115 | 0.0000 |
| 298.20 | 0.0154 | 0.0000 |
| 298.20 | 0.0192 | 0.0000 |
| 298.20 | 0.0231 | 0.0000 |