- Name
- N,N-Diethylaniline
- InChI
- InChI=1S/C10H15N/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3
- InChI Key
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N
- Formula
- C10H15N
- SMILES
- CCN(CC)c1ccccc1
- Mol. Weight (g/mol)
- 149.23
- CAS
- 91-66-7
- Name
- Tetrahydrofuran
- InChI
- InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2
- InChI Key
- WYURNTSHIVDZCO-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- C1CCOC1
- Mol. Weight (g/mol)
- 72.11
- CAS
- 109-99-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 926.2 |
| 303.15 | 0.0933 | 923.9 |
| 303.15 | 0.1907 | 921.2 |
| 303.15 | 0.2899 | 918.2 |
| 303.15 | 0.3879 | 914.9 |
| 303.15 | 0.4892 | 910.8 |
| 303.15 | 0.5937 | 906.0 |
| 303.15 | 0.6904 | 900.9 |
| 303.15 | 0.7948 | 894.3 |
| 303.15 | 0.8935 | 886.9 |
| 303.15 | 1.0000 | 876.9 |
| 313.15 | 0.0000 | 917.6 |
| 313.15 | 0.0933 | 915.7 |
| 313.15 | 0.1907 | 913.3 |
| 313.15 | 0.2899 | 910.4 |
| 313.15 | 0.3879 | 907.1 |
| 313.15 | 0.4892 | 903.2 |
| 313.15 | 0.5937 | 898.4 |
| 313.15 | 0.6904 | 893.1 |
| 313.15 | 0.7948 | 886.2 |
| 313.15 | 0.8935 | 877.9 |
| 313.15 | 1.0000 | 865.7 |
| 323.15 | 0.0000 | 909.2 |
| 323.15 | 0.0933 | 907.8 |
| 323.15 | 0.1907 | 905.7 |
| 323.15 | 0.2899 | 903.0 |
| 323.15 | 0.3879 | 899.6 |
| 323.15 | 0.4892 | 895.3 |
| 323.15 | 0.5937 | 890.5 |
| 323.15 | 0.6904 | 885.1 |
| 323.15 | 0.7948 | 878.1 |
| 323.15 | 0.8935 | 869.2 |
| 323.15 | 1.0000 | 854.8 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 926.2 |
| 303.15 | 0.0933 | 923.9 |
| 303.15 | 0.1907 | 921.2 |
| 303.15 | 0.2899 | 918.2 |
| 303.15 | 0.3879 | 914.9 |
| 303.15 | 0.4892 | 910.8 |
| 303.15 | 0.5937 | 906.0 |
| 303.15 | 0.6904 | 900.9 |
| 303.15 | 0.7948 | 894.3 |
| 303.15 | 0.8935 | 886.9 |
| 303.15 | 1.0000 | 876.9 |
| 313.15 | 0.0000 | 917.6 |
| 313.15 | 0.0933 | 915.7 |
| 313.15 | 0.1907 | 913.3 |
| 313.15 | 0.2899 | 910.4 |
| 313.15 | 0.3879 | 907.1 |
| 313.15 | 0.4892 | 903.2 |
| 313.15 | 0.5937 | 898.4 |
| 313.15 | 0.6904 | 893.1 |
| 313.15 | 0.7948 | 886.2 |
| 313.15 | 0.8935 | 877.9 |
| 313.15 | 1.0000 | 865.7 |
| 323.15 | 0.0000 | 909.2 |
| 323.15 | 0.0933 | 907.8 |
| 323.15 | 0.1907 | 905.7 |
| 323.15 | 0.2899 | 903.0 |
| 323.15 | 0.3879 | 899.6 |
| 323.15 | 0.4892 | 895.3 |
| 323.15 | 0.5937 | 890.5 |
| 323.15 | 0.6904 | 885.1 |
| 323.15 | 0.7948 | 878.1 |
| 323.15 | 0.8935 | 869.2 |
| 323.15 | 1.0000 | 854.8 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1434.0 |
| 303.15 | 0.0933 | 1428.0 |
| 303.15 | 0.1907 | 1418.0 |
| 303.15 | 0.2899 | 1405.0 |
| 303.15 | 0.3879 | 1390.0 |
| 303.15 | 0.4892 | 1372.0 |
| 303.15 | 0.5937 | 1352.0 |
| 303.15 | 0.6904 | 1331.0 |
| 303.15 | 0.7948 | 1307.0 |
| 303.15 | 0.8935 | 1283.0 |
| 303.15 | 1.0000 | 1254.0 |
| 313.15 | 0.0000 | 1396.0 |
| 313.15 | 0.0933 | 1390.0 |
| 313.15 | 0.1907 | 1379.0 |
| 313.15 | 0.2899 | 1366.0 |
| 313.15 | 0.3879 | 1351.0 |
| 313.15 | 0.4892 | 1333.0 |
| 313.15 | 0.5937 | 1312.0 |
| 313.15 | 0.6904 | 1291.0 |
| 313.15 | 0.7948 | 1265.0 |
| 313.15 | 0.8935 | 1240.0 |
| 313.15 | 1.0000 | 1207.0 |
| 323.15 | 0.0000 | 1358.0 |
| 323.15 | 0.0933 | 1354.0 |
| 323.15 | 0.1907 | 1343.0 |
| 323.15 | 0.2899 | 1330.0 |
| 323.15 | 0.3879 | 1315.0 |
| 323.15 | 0.4892 | 1296.0 |
| 323.15 | 0.5937 | 1275.0 |
| 323.15 | 0.6904 | 1252.0 |
| 323.15 | 0.7948 | 1226.0 |
| 323.15 | 0.8935 | 1200.0 |
| 323.15 | 1.0000 | 1165.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1434.0 |
| 303.15 | 0.0933 | 1428.0 |
| 303.15 | 0.1907 | 1418.0 |
| 303.15 | 0.2899 | 1405.0 |
| 303.15 | 0.3879 | 1390.0 |
| 303.15 | 0.4892 | 1372.0 |
| 303.15 | 0.5937 | 1352.0 |
| 303.15 | 0.6904 | 1331.0 |
| 303.15 | 0.7948 | 1307.0 |
| 303.15 | 0.8935 | 1283.0 |
| 303.15 | 1.0000 | 1254.0 |
| 313.15 | 0.0000 | 1396.0 |
| 313.15 | 0.0933 | 1390.0 |
| 313.15 | 0.1907 | 1379.0 |
| 313.15 | 0.2899 | 1366.0 |
| 313.15 | 0.3879 | 1351.0 |
| 313.15 | 0.4892 | 1333.0 |
| 313.15 | 0.5937 | 1312.0 |
| 313.15 | 0.6904 | 1291.0 |
| 313.15 | 0.7948 | 1265.0 |
| 313.15 | 0.8935 | 1240.0 |
| 313.15 | 1.0000 | 1207.0 |
| 323.15 | 0.0000 | 1358.0 |
| 323.15 | 0.0933 | 1354.0 |
| 323.15 | 0.1907 | 1343.0 |
| 323.15 | 0.2899 | 1330.0 |
| 323.15 | 0.3879 | 1315.0 |
| 323.15 | 0.4892 | 1296.0 |
| 323.15 | 0.5937 | 1275.0 |
| 323.15 | 0.6904 | 1252.0 |
| 323.15 | 0.7948 | 1226.0 |
| 323.15 | 0.8935 | 1200.0 |
| 323.15 | 1.0000 | 1165.0 |