- Name
- Tributylamine
- InChI
- InChI=1S/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3
- InChI Key
- IMFACGCPASFAPR-UHFFFAOYSA-N
- Formula
- C12H27N
- SMILES
- CCCCN(CCCC)CCCC
- Mol. Weight (g/mol)
- 185.35
- CAS
- 102-82-9
- Name
- Tetrahydrofuran
- InChI
- InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2
- InChI Key
- WYURNTSHIVDZCO-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- C1CCOC1
- Mol. Weight (g/mol)
- 72.11
- CAS
- 109-99-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (4)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1637 | 0.0003 |
| 0.3071 | 0.0004 |
| 0.4107 | 0.0004 |
| 0.5836 | 0.0004 |
| 0.7131 | 0.0004 |
| 0.9025 | 0.0004 |
| 1.1253 | 0.0004 |
| 1.2042 | 0.0004 |
| 1.3105 | 0.0004 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0005 |
| 298.15 | 0.1033 | 0.0006 |
| 298.15 | 0.2033 | 0.0007 |
| 298.15 | 0.3041 | 0.0007 |
| 298.15 | 0.4012 | 0.0008 |
| 298.15 | 0.5024 | 0.0009 |
| 298.15 | 0.5974 | 0.0010 |
| 298.15 | 0.6814 | 0.0010 |
| 298.15 | 0.7898 | 0.0011 |
| 298.15 | 0.8941 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.1033 | 0.0005 |
| 303.15 | 0.2033 | 0.0006 |
| 303.15 | 0.3041 | 0.0007 |
| 303.15 | 0.4012 | 0.0008 |
| 303.15 | 0.5024 | 0.0008 |
| 303.15 | 0.5974 | 0.0009 |
| 303.15 | 0.6814 | 0.0009 |
| 303.15 | 0.7898 | 0.0010 |
| 303.15 | 0.8941 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0004 |
| 308.15 | 0.1033 | 0.0005 |
| 308.15 | 0.2033 | 0.0006 |
| 308.15 | 0.3041 | 0.0006 |
| 308.15 | 0.4012 | 0.0007 |
| 308.15 | 0.5024 | 0.0008 |
| 308.15 | 0.5974 | 0.0008 |
| 308.15 | 0.6814 | 0.0009 |
| 308.15 | 0.7898 | 0.0009 |
| 308.15 | 0.8941 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1637 | 0.0003 |
| 0.3071 | 0.0004 |
| 0.4107 | 0.0004 |
| 0.5836 | 0.0004 |
| 0.7131 | 0.0004 |
| 0.9025 | 0.0004 |
| 1.1253 | 0.0004 |
| 1.2042 | 0.0004 |
| 1.3105 | 0.0004 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0005 |
| 298.15 | 0.1033 | 0.0006 |
| 298.15 | 0.2033 | 0.0007 |
| 298.15 | 0.3041 | 0.0007 |
| 298.15 | 0.4012 | 0.0008 |
| 298.15 | 0.5024 | 0.0009 |
| 298.15 | 0.5974 | 0.0010 |
| 298.15 | 0.6814 | 0.0010 |
| 298.15 | 0.7898 | 0.0011 |
| 298.15 | 0.8941 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.1033 | 0.0005 |
| 303.15 | 0.2033 | 0.0006 |
| 303.15 | 0.3041 | 0.0007 |
| 303.15 | 0.4012 | 0.0008 |
| 303.15 | 0.5024 | 0.0008 |
| 303.15 | 0.5974 | 0.0009 |
| 303.15 | 0.6814 | 0.0009 |
| 303.15 | 0.7898 | 0.0010 |
| 303.15 | 0.8941 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0004 |
| 308.15 | 0.1033 | 0.0005 |
| 308.15 | 0.2033 | 0.0006 |
| 308.15 | 0.3041 | 0.0006 |
| 308.15 | 0.4012 | 0.0007 |
| 308.15 | 0.5024 | 0.0008 |
| 308.15 | 0.5974 | 0.0008 |
| 308.15 | 0.6814 | 0.0009 |
| 308.15 | 0.7898 | 0.0009 |
| 308.15 | 0.8941 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4049 |
| 298.15 | 0.1033 | 1.412 |
| 298.15 | 0.2033 | 1.415 |
| 298.15 | 0.3041 | 1.418 |
| 298.15 | 0.4012 | 1.42 |
| 298.15 | 0.5024 | 1.4229 |
| 298.15 | 0.5974 | 1.4235 |
| 298.15 | 0.6814 | 1.4249 |
| 298.15 | 0.7898 | 1.4265 |
| 298.15 | 0.8941 | 1.4269 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.4026 |
| 303.15 | 0.1033 | 1.4094 |
| 303.15 | 0.2033 | 1.4141 |
| 303.15 | 0.3041 | 1.4155 |
| 303.15 | 0.4012 | 1.4178 |
| 303.15 | 0.5024 | 1.4203 |
| 303.15 | 0.5974 | 1.4211 |
| 303.15 | 0.6814 | 1.4226 |
| 303.15 | 0.7898 | 1.4238 |
| 303.15 | 0.8941 | 1.4246 |
| 303.15 | 1.0000 | 1.4254 |
| 308.15 | 0.0000 | 1.3998 |
| 308.15 | 0.1033 | 1.4068 |
| 308.15 | 0.2033 | 1.4132 |
| 308.15 | 0.3041 | 1.413 |
| 308.15 | 0.4012 | 1.4156 |
| 308.15 | 0.5024 | 1.4178 |
| 308.15 | 0.5974 | 1.4188 |
| 308.15 | 0.6814 | 1.4203 |
| 308.15 | 0.7898 | 1.4212 |
| 308.15 | 0.8941 | 1.4224 |
| 308.15 | 1.0000 | 1.4228 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4049 |
| 298.15 | 0.1033 | 1.412 |
| 298.15 | 0.2033 | 1.415 |
| 298.15 | 0.3041 | 1.418 |
| 298.15 | 0.4012 | 1.42 |
| 298.15 | 0.5024 | 1.4229 |
| 298.15 | 0.5974 | 1.4235 |
| 298.15 | 0.6814 | 1.4249 |
| 298.15 | 0.7898 | 1.4265 |
| 298.15 | 0.8941 | 1.4269 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.4026 |
| 303.15 | 0.1033 | 1.4094 |
| 303.15 | 0.2033 | 1.4141 |
| 303.15 | 0.3041 | 1.4155 |
| 303.15 | 0.4012 | 1.4178 |
| 303.15 | 0.5024 | 1.4203 |
| 303.15 | 0.5974 | 1.4211 |
| 303.15 | 0.6814 | 1.4226 |
| 303.15 | 0.7898 | 1.4238 |
| 303.15 | 0.8941 | 1.4246 |
| 303.15 | 1.0000 | 1.4254 |
| 308.15 | 0.0000 | 1.3998 |
| 308.15 | 0.1033 | 1.4068 |
| 308.15 | 0.2033 | 1.4132 |
| 308.15 | 0.3041 | 1.413 |
| 308.15 | 0.4012 | 1.4156 |
| 308.15 | 0.5024 | 1.4178 |
| 308.15 | 0.5974 | 1.4188 |
| 308.15 | 0.6814 | 1.4203 |
| 308.15 | 0.7898 | 1.4212 |
| 308.15 | 0.8941 | 1.4224 |
| 308.15 | 1.0000 | 1.4228 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 882.9 |
| 298.15 | 0.1033 | 853.3 |
| 298.15 | 0.2033 | 833.4 |
| 298.15 | 0.3041 | 818.9 |
| 298.15 | 0.4012 | 808.1 |
| 298.15 | 0.5024 | 799.2 |
| 298.15 | 0.5974 | 792.5 |
| 298.15 | 0.6814 | 787.5 |
| 298.15 | 0.7898 | 782.1 |
| 298.15 | 0.8941 | 777.8 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 877.5 |
| 303.15 | 0.1033 | 847.9 |
| 303.15 | 0.2033 | 828.4 |
| 303.15 | 0.3041 | 814.2 |
| 303.15 | 0.4012 | 803.5 |
| 303.15 | 0.5024 | 794.7 |
| 303.15 | 0.5974 | 788.2 |
| 303.15 | 0.6814 | 783.1 |
| 303.15 | 0.7898 | 777.9 |
| 303.15 | 0.8941 | 773.6 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 871.2 |
| 308.15 | 0.1033 | 842.5 |
| 308.15 | 0.2033 | 823.5 |
| 308.15 | 0.3041 | 809.3 |
| 308.15 | 0.4012 | 798.9 |
| 308.15 | 0.5024 | 790.3 |
| 308.15 | 0.5974 | 783.8 |
| 308.15 | 0.6814 | 778.9 |
| 308.15 | 0.7898 | 773.6 |
| 308.15 | 0.8941 | 769.4 |
| 308.15 | 1.0000 | 765.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 882.9 |
| 298.15 | 0.1033 | 853.3 |
| 298.15 | 0.2033 | 833.4 |
| 298.15 | 0.3041 | 818.9 |
| 298.15 | 0.4012 | 808.1 |
| 298.15 | 0.5024 | 799.2 |
| 298.15 | 0.5974 | 792.5 |
| 298.15 | 0.6814 | 787.5 |
| 298.15 | 0.7898 | 782.1 |
| 298.15 | 0.8941 | 777.8 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 877.5 |
| 303.15 | 0.1033 | 847.9 |
| 303.15 | 0.2033 | 828.4 |
| 303.15 | 0.3041 | 814.2 |
| 303.15 | 0.4012 | 803.5 |
| 303.15 | 0.5024 | 794.7 |
| 303.15 | 0.5974 | 788.2 |
| 303.15 | 0.6814 | 783.1 |
| 303.15 | 0.7898 | 777.9 |
| 303.15 | 0.8941 | 773.6 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 871.2 |
| 308.15 | 0.1033 | 842.5 |
| 308.15 | 0.2033 | 823.5 |
| 308.15 | 0.3041 | 809.3 |
| 308.15 | 0.4012 | 798.9 |
| 308.15 | 0.5024 | 790.3 |
| 308.15 | 0.5974 | 783.8 |
| 308.15 | 0.6814 | 778.9 |
| 308.15 | 0.7898 | 773.6 |
| 308.15 | 0.8941 | 769.4 |
| 308.15 | 1.0000 | 765.7 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1288.0 |
| 0.1033 | 1283.0 |
| 0.2033 | 1278.0 |
| 0.3041 | 1274.0 |
| 0.4012 | 1271.0 |
| 0.5024 | 1269.0 |
| 0.5974 | 1267.0 |
| 0.6814 | 1266.0 |
| 0.7898 | 1264.0 |
| 0.8941 | 1263.0 |
| 1.0000 | 1262.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1288.0 |
| 0.1033 | 1283.0 |
| 0.2033 | 1278.0 |
| 0.3041 | 1274.0 |
| 0.4012 | 1271.0 |
| 0.5024 | 1269.0 |
| 0.5974 | 1267.0 |
| 0.6814 | 1266.0 |
| 0.7898 | 1264.0 |
| 0.8941 | 1263.0 |
| 1.0000 | 1262.0 |
Sources
- Studies of viscosities of dilute solutions of alkylamines in non-electrolyte solvents: IV. Alkylamines in 1,4-dioxane and oxolane at 303.15K
- Density, Viscosity, Refractive Index, and Speed of Sound in the Binary Mixtures of Tri-n-butylamine + Triethylamine, + Tetrahydrofuran, + Tetradecane, + Tetrachloroethylene, + Pyridine, or + Trichloroethylene at (298.15, 303.15, and 308.15) K