- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
- Name
- 1-Decanol
- InChI
- InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3
- InChI Key
- MWKFXSUHUHTGQN-UHFFFAOYSA-N
- Formula
- C10H22O
- SMILES
- CCCCCCCCCCO
- Mol. Weight (g/mol)
- 158.28
- CAS
- 112-30-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- Excess molar enthalpy (molar enthalpy (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0868 | 355.30 |
| 0.1641 | 338.00 |
| 0.2592 | 316.30 |
| 0.4231 | 282.40 |
| 0.5259 | 259.20 |
| 0.6431 | 235.20 |
| 0.7082 | 221.40 |
| 0.7997 | 201.00 |
| 0.8618 | 186.20 |
| 0.8908 | 179.20 |
| 0.9159 | 172.90 |
| 0.9596 | 162.10 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0868 | 355.30 |
| 0.1641 | 338.00 |
| 0.2592 | 316.30 |
| 0.4231 | 282.40 |
| 0.5259 | 259.20 |
| 0.6431 | 235.20 |
| 0.7082 | 221.40 |
| 0.7997 | 201.00 |
| 0.8618 | 186.20 |
| 0.8908 | 179.20 |
| 0.9159 | 172.90 |
| 0.9596 | 162.10 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1006 | 0.4660 |
| 0.1828 | 0.8760 |
| 0.2512 | 1.157 |
| 0.3091 | 1.326 |
| 0.4016 | 1.475 |
| 0.4722 | 1.524 |
| 0.5730 | 1.508 |
| 0.6414 | 1.475 |
| 0.7286 | 1.374 |
| 0.8011 | 1.259 |
| 0.8430 | 1.135 |
| 0.8895 | 0.9520 |
| 0.9148 | 0.8210 |
| 0.9416 | 0.6280 |
| 0.9555 | 0.4950 |
| 0.9699 | 0.3540 |
| 0.9847 | 0.1910 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1006 | 0.4660 |
| 0.1828 | 0.8760 |
| 0.2512 | 1.157 |
| 0.3091 | 1.326 |
| 0.4016 | 1.475 |
| 0.4722 | 1.524 |
| 0.5730 | 1.508 |
| 0.6414 | 1.475 |
| 0.7286 | 1.374 |
| 0.8011 | 1.259 |
| 0.8430 | 1.135 |
| 0.8895 | 0.9520 |
| 0.9148 | 0.8210 |
| 0.9416 | 0.6280 |
| 0.9555 | 0.4950 |
| 0.9699 | 0.3540 |
| 0.9847 | 0.1910 |